Spaces:
Running
Running
Commit
·
71e2885
1
Parent(s):
2b18b2c
adjust several LD aa and GLY bond
Browse files
app.py
CHANGED
|
@@ -72,12 +72,10 @@ class PeptideAnalyzer:
|
|
| 72 |
|
| 73 |
is_cyclic = len(peptide_cycles) > 0 and not smiles.endswith('C(=O)O')
|
| 74 |
return is_cyclic, peptide_cycles, aromatic_cycles
|
| 75 |
-
|
| 76 |
def split_on_bonds(self, smiles):
|
| 77 |
-
"""Split SMILES into segments with simplified Pro handling"""
|
| 78 |
positions = []
|
| 79 |
used = set()
|
| 80 |
-
|
| 81 |
# Find Gly pattern first
|
| 82 |
gly_pattern = r'NCC\(=O\)'
|
| 83 |
for match in re.finditer(gly_pattern, smiles):
|
|
@@ -106,7 +104,6 @@ class PeptideAnalyzer:
|
|
| 106 |
|
| 107 |
# Create segments
|
| 108 |
segments = []
|
| 109 |
-
|
| 110 |
if positions:
|
| 111 |
# First segment
|
| 112 |
if positions[0]['start'] > 0:
|
|
@@ -114,18 +111,21 @@ class PeptideAnalyzer:
|
|
| 114 |
'content': smiles[0:positions[0]['start']],
|
| 115 |
'bond_after': positions[0]['pattern']
|
| 116 |
})
|
| 117 |
-
|
| 118 |
# Process segments
|
| 119 |
for i in range(len(positions)-1):
|
| 120 |
current = positions[i]
|
| 121 |
next_pos = positions[i+1]
|
| 122 |
-
|
| 123 |
if current['type'] == 'gly':
|
| 124 |
segments.append({
|
| 125 |
'content': 'NCC(=O)',
|
| 126 |
'bond_before': positions[i-1]['pattern'] if i > 0 else None,
|
| 127 |
'bond_after': next_pos['pattern']
|
| 128 |
})
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 129 |
else:
|
| 130 |
content = smiles[current['end']:next_pos['start']]
|
| 131 |
if content:
|
|
@@ -141,7 +141,6 @@ class PeptideAnalyzer:
|
|
| 141 |
'content': smiles[positions[-1]['end']:],
|
| 142 |
'bond_before': positions[-1]['pattern']
|
| 143 |
})
|
| 144 |
-
|
| 145 |
return segments
|
| 146 |
|
| 147 |
def clean_terminal_carboxyl(self, segment):
|
|
@@ -168,11 +167,162 @@ class PeptideAnalyzer:
|
|
| 168 |
content = self.clean_terminal_carboxyl(segment)
|
| 169 |
mods = self.get_modifications(segment)
|
| 170 |
|
| 171 |
-
#
|
| 172 |
-
|
| 173 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 174 |
if '[C@@H](c1ccccc1)' in content or '[C@H](c1ccccc1)' in content:
|
| 175 |
return '4', mods # Base phenylglycine
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 176 |
|
| 177 |
# 4-substituted phenylalanines
|
| 178 |
if 'Cc1ccc' in content:
|
|
@@ -282,22 +432,6 @@ class PeptideAnalyzer:
|
|
| 282 |
if 'c1ccc(c(c1)O)O' in content:
|
| 283 |
return 'DAH', mods # 3,4-Dihydroxy-phenylalanine
|
| 284 |
|
| 285 |
-
# Cyclic amino acids
|
| 286 |
-
if 'C1CCCC1' in content:
|
| 287 |
-
return 'CPA3', mods # 3-Cyclopentyl-alanine
|
| 288 |
-
if 'C1CCCCC1' in content:
|
| 289 |
-
if 'CC1CCCCC1' in content:
|
| 290 |
-
return 'ALC', mods # 3-cyclohexyl-alanine
|
| 291 |
-
else:
|
| 292 |
-
return 'CHG', mods # Cyclohexylglycine
|
| 293 |
-
|
| 294 |
-
# Chain-length variants
|
| 295 |
-
if 'CCC[C@@H]' in content or 'CCC[C@H]' in content:
|
| 296 |
-
return 'NLE', mods # Norleucine
|
| 297 |
-
if 'CC[C@@H]' in content or 'CC[C@H]' in content:
|
| 298 |
-
if not any(x in content for x in ['CC(C)', 'COC', 'CN(']):
|
| 299 |
-
return 'ABA', mods # 2-Aminobutyric acid
|
| 300 |
-
|
| 301 |
# Modified histidines
|
| 302 |
if 'c1cnc' in content:
|
| 303 |
if '[C@@H]1CN[C@@H](N1)F' in content:
|
|
@@ -307,7 +441,6 @@ class PeptideAnalyzer:
|
|
| 307 |
if 'c1c[nH]c(n1)F' in content:
|
| 308 |
return '2HF2', mods # 2-fluoro-l-histidine variant
|
| 309 |
|
| 310 |
-
# Sulfur and selenium containing
|
| 311 |
if '[SeH]' in content:
|
| 312 |
return 'CSE', mods # Selenocysteine
|
| 313 |
if 'S' in content:
|
|
@@ -318,7 +451,6 @@ class PeptideAnalyzer:
|
|
| 318 |
if 'CCS' in content:
|
| 319 |
return 'HCS', mods # homocysteine
|
| 320 |
|
| 321 |
-
# Additional modifications
|
| 322 |
if 'CN=[N]=N' in content:
|
| 323 |
return 'AZDA', mods # azido-alanine
|
| 324 |
if '[NH]=[C](=[NH2])=[NH2]' in content:
|
|
@@ -326,7 +458,21 @@ class PeptideAnalyzer:
|
|
| 326 |
return 'AGM', mods # 5-methyl-arginine
|
| 327 |
if 'CC[NH]=' in content:
|
| 328 |
return 'GDPR', mods # 2-Amino-3-guanidinopropionic acid
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 329 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 330 |
if 'CCON' in content:
|
| 331 |
return 'CAN', mods # canaline
|
| 332 |
if '[C@@H]1C=C[C@@H](C=C1)' in content:
|
|
@@ -350,7 +496,6 @@ class PeptideAnalyzer:
|
|
| 350 |
if 'c1cccc(c1)[C](=[NH2])=[NH2]' in content:
|
| 351 |
return 'APM', mods # m-amidinophenyl-3-alanine
|
| 352 |
|
| 353 |
-
# Multiple hydroxy patterns
|
| 354 |
if 'O' in content:
|
| 355 |
if '[C@H]([C@H](C)O)O' in content:
|
| 356 |
return 'ILX', mods # 4,5-dihydroxy-isoleucine
|
|
@@ -365,7 +510,6 @@ class PeptideAnalyzer:
|
|
| 365 |
if '[C@H](c1ccc(c(Cl)c1)O)O' in content:
|
| 366 |
return 'OMY', mods # (betar)-3-chloro-beta-hydroxy-l-tyrosine
|
| 367 |
|
| 368 |
-
# Heterocyclic patterns
|
| 369 |
if 'n1' in content:
|
| 370 |
if 'n1cccn1' in content:
|
| 371 |
return 'PYZ1', mods # 3-(1-Pyrazolyl)-alanine
|
|
@@ -384,7 +528,6 @@ class PeptideAnalyzer:
|
|
| 384 |
if 'c1cnc2c(n1)cccc2' in content:
|
| 385 |
return 'QX32', mods # 3-(2-quinoxalyl)-alanine
|
| 386 |
|
| 387 |
-
# Multiple nitrogen patterns
|
| 388 |
if 'N' in content:
|
| 389 |
if '[NH3]CC[C@@H]' in content:
|
| 390 |
return 'DAB', mods # Diaminobutyric acid
|
|
@@ -397,7 +540,6 @@ class PeptideAnalyzer:
|
|
| 397 |
if '[NH]=[C](=S)=[NH2]' in content:
|
| 398 |
return 'THIC', mods # Thio-citrulline
|
| 399 |
|
| 400 |
-
# Chain modified amino acids
|
| 401 |
if 'CC' in content:
|
| 402 |
if 'CCCC[C@@H]' in content:
|
| 403 |
return 'AHP', mods # 2-Aminoheptanoic acid
|
|
@@ -410,7 +552,6 @@ class PeptideAnalyzer:
|
|
| 410 |
if '[C@@H]([C@@H](C)O)C' in content:
|
| 411 |
return 'HLU', mods # beta-hydroxyleucine
|
| 412 |
|
| 413 |
-
# Modified glutamate/aspartate patterns
|
| 414 |
if '[C@@H]' in content:
|
| 415 |
if '[C@@H](C[C@@H](F))' in content:
|
| 416 |
return 'FGA4', mods # 4-Fluoro-glutamic acid
|
|
@@ -421,7 +562,6 @@ class PeptideAnalyzer:
|
|
| 421 |
if '[C@@H](CC[C@H](C))' in content:
|
| 422 |
return 'MEG', mods # (3s)-3-methyl-l-glutamic acid
|
| 423 |
|
| 424 |
-
# Sulfur and selenium modifications
|
| 425 |
if 'S' in content:
|
| 426 |
if 'SCC[C@@H]' in content:
|
| 427 |
return 'HSER', mods # homoserine
|
|
@@ -434,7 +574,6 @@ class PeptideAnalyzer:
|
|
| 434 |
if 'S(=O)(=O)' in content:
|
| 435 |
return 'OMT', mods # Methionine sulfone
|
| 436 |
|
| 437 |
-
# Double bond containing
|
| 438 |
if 'C=' in content:
|
| 439 |
if 'C=C[C@@H]' in content:
|
| 440 |
return '2AG', mods # 2-Allyl-glycine
|
|
@@ -443,175 +582,16 @@ class PeptideAnalyzer:
|
|
| 443 |
if 'C=Cc1ccccc1' in content:
|
| 444 |
return 'STYA', mods # Styrylalanine
|
| 445 |
|
| 446 |
-
# Special cases
|
| 447 |
if '[C@@H]1Cc2c(C1)cccc2' in content:
|
| 448 |
return 'IGL', mods # alpha-amino-2-indanacetic acid
|
| 449 |
if '[C](=[C](=O)=O)=O' in content:
|
| 450 |
return '26P', mods # 2-amino-6-oxopimelic acid
|
| 451 |
if '[C](=[C](=O)=O)=C' in content:
|
| 452 |
return '2NP', mods # l-2-amino-6-methylene-pimelic acid
|
| 453 |
-
if 'c2cnc[nH]2' in content:
|
| 454 |
-
return 'HIS', mods # histidine core
|
| 455 |
if 'c1cccc2c1cc(O)cc2' in content:
|
| 456 |
return 'NAO1', mods # 5-hydroxy-1-naphthalene
|
| 457 |
if 'c1ccc2c(c1)cc(O)cc2' in content:
|
| 458 |
-
return 'NAO2', mods # 6-hydroxy-2-naphthalene
|
| 459 |
-
|
| 460 |
-
# Proline (P) - flexible ring numbers
|
| 461 |
-
if any([
|
| 462 |
-
# Check for any ring number in bond patterns
|
| 463 |
-
(segment.get('bond_after', '').startswith(f'N{n}C(=O)') and 'CCC' in content and
|
| 464 |
-
any(f'[C@@H]{n}' in content or f'[C@H]{n}' in content for n in '123456789'))
|
| 465 |
-
for n in '123456789'
|
| 466 |
-
]) or any([
|
| 467 |
-
# Check ending patterns with any ring number
|
| 468 |
-
(f'CCCN{n}' in content and content.endswith('=O') and
|
| 469 |
-
any(f'[C@@H]{n}' in content or f'[C@H]{n}' in content for n in '123456789'))
|
| 470 |
-
for n in '123456789'
|
| 471 |
-
]) or any([
|
| 472 |
-
# Handle CCC[C@H]n patterns
|
| 473 |
-
(content == f'CCC[C@H]{n}' and segment.get('bond_before', '').startswith(f'C(=O)N{n}')) or
|
| 474 |
-
(content == f'CCC[C@@H]{n}' and segment.get('bond_before', '').startswith(f'C(=O)N{n}')) or
|
| 475 |
-
# N-terminal Pro with any ring number
|
| 476 |
-
(f'N{n}CCC[C@H]{n}' in content) or
|
| 477 |
-
(f'N{n}CCC[C@@H]{n}' in content)
|
| 478 |
-
for n in '123456789'
|
| 479 |
-
]):
|
| 480 |
-
return 'Pro', mods
|
| 481 |
-
|
| 482 |
-
# Tryptophan (W) - more specific indole pattern
|
| 483 |
-
if re.search(r'c[0-9]c\[nH\]c[0-9]ccccc[0-9][0-9]', content) and \
|
| 484 |
-
'c[nH]c' in content.replace(' ', ''):
|
| 485 |
-
return 'Trp', mods
|
| 486 |
-
|
| 487 |
-
# Lysine (K) - both patterns
|
| 488 |
-
if '[C@@H](CCCCN)' in content or '[C@H](CCCCN)' in content:
|
| 489 |
-
return 'Lys', mods
|
| 490 |
-
|
| 491 |
-
# Arginine (R) - both patterns
|
| 492 |
-
if '[C@@H](CCCNC(=N)N)' in content or '[C@H](CCCNC(=N)N)' in content:
|
| 493 |
-
return 'Arg', mods
|
| 494 |
-
|
| 495 |
-
if ('C[C@H](CCCC)' in content or 'C[C@@H](CCCC)' in content) and 'CC(C)' not in content:
|
| 496 |
-
return 'Nle', mods
|
| 497 |
-
|
| 498 |
-
# Ornithine (Orn) - 3-carbon chain with NH2
|
| 499 |
-
if ('C[C@H](CCCN)' in content or 'C[C@@H](CCCN)' in content) and 'CC(C)' not in content:
|
| 500 |
-
return 'Orn', mods
|
| 501 |
-
|
| 502 |
-
# 2-Naphthylalanine (2Nal) - distinct from Phe pattern
|
| 503 |
-
if ('Cc3cc2ccccc2c3' in content) and ('C[C@H]' in content or 'C[C@@H]' in content):
|
| 504 |
-
return '2Nal', mods
|
| 505 |
-
|
| 506 |
-
# Cyclohexylalanine (Cha) - already in your code but moved here for clarity
|
| 507 |
-
if 'N2CCCCC2' in content or 'CCCCC2' in content:
|
| 508 |
-
return 'Cha', mods
|
| 509 |
-
|
| 510 |
-
# Aminobutyric acid (Abu) - 2-carbon chain
|
| 511 |
-
if ('C[C@H](CC)' in content or 'C[C@@H](CC)' in content) and not any(p in content for p in ['CC(C)', 'CCCC', 'CCC(C)']):
|
| 512 |
-
return 'Abu', mods
|
| 513 |
-
|
| 514 |
-
# Pipecolic acid (Pip) - 6-membered ring like Pro
|
| 515 |
-
if ('N3CCCCC3' in content or 'CCCCC3' in content) and ('C[C@H]' in content or 'C[C@@H]' in content):
|
| 516 |
-
return 'Pip', mods
|
| 517 |
-
|
| 518 |
-
# Cyclohexylglycine (Chg) - direct cyclohexyl without CH2
|
| 519 |
-
if ('C[C@H](C1CCCCC1)' in content or 'C[C@@H](C1CCCCC1)' in content):
|
| 520 |
-
return 'Chg', mods
|
| 521 |
-
|
| 522 |
-
# 4-Fluorophenylalanine (4F-Phe)
|
| 523 |
-
if ('Cc2ccc(F)cc2' in content) and ('C[C@H]' in content or 'C[C@@H]' in content):
|
| 524 |
-
return '4F-Phe', mods
|
| 525 |
-
|
| 526 |
-
# Regular residue identification
|
| 527 |
-
if ('NCC(=O)' in content) or (content == 'C'):
|
| 528 |
-
# Middle case - between bonds
|
| 529 |
-
if segment.get('bond_before') and segment.get('bond_after'):
|
| 530 |
-
if ('C(=O)N' in segment['bond_before'] or 'C(=O)N(C)' in segment['bond_before']):
|
| 531 |
-
return 'Gly', mods
|
| 532 |
-
# Terminal case - at the end
|
| 533 |
-
elif segment.get('bond_before') and segment.get('bond_before').startswith('C(=O)N'):
|
| 534 |
-
return 'Gly', mods
|
| 535 |
-
|
| 536 |
-
if 'CC(C)C[C@H]' in content or 'CC(C)C[C@@H]' in content:
|
| 537 |
-
return 'Leu', mods
|
| 538 |
-
if '[C@@H](CC(C)C)' in content or '[C@H](CC(C)C)' in content:
|
| 539 |
-
return 'Leu', mods
|
| 540 |
-
|
| 541 |
-
if '[C@@H]([C@@H](C)O)' in content or '[C@H]([C@H](C)O)' in content:
|
| 542 |
-
return 'Thr', mods
|
| 543 |
-
|
| 544 |
-
if '[C@H](Cc2ccccc2)' in content or '[C@@H](Cc2ccccc2)' in content:
|
| 545 |
-
return 'Phe', mods
|
| 546 |
-
|
| 547 |
-
if ('[C@H](C(C)C)' in content or # With outer parentheses
|
| 548 |
-
'[C@@H](C(C)C)' in content or # With outer parentheses
|
| 549 |
-
'[C@H]C(C)C' in content or # Without outer parentheses
|
| 550 |
-
'[C@@H]C(C)C' in content): # Without outer parentheses
|
| 551 |
-
if not any(p in content for p in ['CC(C)C[C@H]', 'CC(C)C[C@@H]']): # Still check not Leu
|
| 552 |
-
return 'Val', mods
|
| 553 |
-
|
| 554 |
-
if '[C@H](COC(C)(C)C)' in content or '[C@@H](COC(C)(C)C)' in content:
|
| 555 |
-
return 'O-tBu', mods
|
| 556 |
-
|
| 557 |
-
if any([
|
| 558 |
-
'CC[C@H](C)' in content,
|
| 559 |
-
'CC[C@@H](C)' in content,
|
| 560 |
-
'C(C)C[C@H]' in content and 'CC(C)C' not in content,
|
| 561 |
-
'C(C)C[C@@H]' in content and 'CC(C)C' not in content
|
| 562 |
-
]):
|
| 563 |
-
return 'Ile', mods
|
| 564 |
-
|
| 565 |
-
if ('[C@H](C)' in content or '[C@@H](C)' in content):
|
| 566 |
-
if not any(p in content for p in ['C(C)C', 'COC', 'CN(', 'C(C)O', 'CC[C@H]', 'CC[C@@H]']):
|
| 567 |
-
return 'Ala', mods
|
| 568 |
-
|
| 569 |
-
# Tyrosine (Tyr) - 4-hydroxybenzyl side chain
|
| 570 |
-
if re.search(r'Cc[0-9]ccc\(O\)cc[0-9]', content):
|
| 571 |
-
return 'Tyr', mods
|
| 572 |
-
|
| 573 |
-
|
| 574 |
-
# Serine (Ser) - Hydroxymethyl side chain
|
| 575 |
-
if '[C@H](CO)' in content or '[C@@H](CO)' in content:
|
| 576 |
-
if not ('C(C)O' in content or 'COC' in content):
|
| 577 |
-
return 'Ser', mods
|
| 578 |
-
|
| 579 |
-
# Threonine (Thr) - 1-hydroxyethyl side chain
|
| 580 |
-
if '[C@@H]([C@@H](C)O)' in content or '[C@H]([C@H](C)O)' in content or '[C@@H](C)O' in content or '[C@H](C)O' in content:
|
| 581 |
-
return 'Thr', mods
|
| 582 |
-
|
| 583 |
-
# Cysteine (Cys) - Thiol side chain
|
| 584 |
-
if '[C@H](CS)' in content or '[C@@H](CS)' in content:
|
| 585 |
-
return 'Cys', mods
|
| 586 |
-
|
| 587 |
-
# Methionine (Met) - Methylthioethyl side chain
|
| 588 |
-
if ('C[C@H](CCSC)' in content or 'C[C@@H](CCSC)' in content):
|
| 589 |
-
return 'Met', mods
|
| 590 |
-
|
| 591 |
-
# Asparagine (Asn) - Carbamoylmethyl side chain
|
| 592 |
-
if ('CC(=O)N' in content) and ('C[C@H]' in content or 'C[C@@H]' in content):
|
| 593 |
-
return 'Asn', mods
|
| 594 |
-
|
| 595 |
-
# Glutamine (Gln) - Carbamoylethyl side chain
|
| 596 |
-
if ('CCC(=O)N' in content) and ('C[C@H]' in content or 'C[C@@H]' in content):
|
| 597 |
-
return 'Gln', mods
|
| 598 |
-
|
| 599 |
-
# Aspartic acid (Asp) - Carboxymethyl side chain
|
| 600 |
-
if ('CC(=O)O' in content) and ('C[C@H]' in content or 'C[C@@H]' in content):
|
| 601 |
-
return 'Asp', mods
|
| 602 |
-
|
| 603 |
-
# Glutamic acid (Glu) - Carboxyethyl side chain
|
| 604 |
-
if ('CCC(=O)O' in content) and ('C[C@H]' in content or 'C[C@@H]' in content):
|
| 605 |
-
return 'Glu', mods
|
| 606 |
-
|
| 607 |
-
# Arginine (Arg) - 3-guanidinopropyl side chain
|
| 608 |
-
if ('CCCNC(=N)N' in content) and ('C[C@H]' in content or 'C[C@@H]' in content):
|
| 609 |
-
return 'Arg', mods
|
| 610 |
-
|
| 611 |
-
# Histidine (His) - Imidazole side chain
|
| 612 |
-
if ('Cc2cnc[nH]2' in content) and ('C[C@H]' in content or 'C[C@@H]' in content):
|
| 613 |
-
return 'His', mods
|
| 614 |
-
|
| 615 |
return None, mods
|
| 616 |
|
| 617 |
def get_modifications(self, segment):
|
|
@@ -670,109 +650,11 @@ class PeptideAnalyzer:
|
|
| 670 |
'one_letter': one_letter,
|
| 671 |
'is_cyclic': is_cyclic
|
| 672 |
}
|
| 673 |
-
|
| 674 |
-
"""
|
| 675 |
-
def annotate_cyclic_structure(mol, sequence):
|
| 676 |
-
'''Create annotated 2D structure with clear, non-overlapping residue labels'''
|
| 677 |
-
# Generate 2D coordinates
|
| 678 |
-
# Generate 2D coordinates
|
| 679 |
-
AllChem.Compute2DCoords(mol)
|
| 680 |
-
|
| 681 |
-
# Create drawer with larger size for annotations
|
| 682 |
-
drawer = Draw.rdMolDraw2D.MolDraw2DCairo(2000, 2000) # Even larger size
|
| 683 |
-
|
| 684 |
-
# Get residue list and reverse it to match structural representation
|
| 685 |
-
if sequence.startswith('cyclo('):
|
| 686 |
-
residues = sequence[6:-1].split('-')
|
| 687 |
-
else:
|
| 688 |
-
residues = sequence.split('-')
|
| 689 |
-
residues = list(reversed(residues)) # Reverse the sequence
|
| 690 |
-
|
| 691 |
-
# Draw molecule first to get its bounds
|
| 692 |
-
drawer.drawOptions().addAtomIndices = False
|
| 693 |
-
drawer.DrawMolecule(mol)
|
| 694 |
-
drawer.FinishDrawing()
|
| 695 |
-
|
| 696 |
-
# Convert to PIL Image
|
| 697 |
-
img = Image.open(BytesIO(drawer.GetDrawingText()))
|
| 698 |
-
draw = ImageDraw.Draw(img)
|
| 699 |
-
|
| 700 |
-
try:
|
| 701 |
-
# Try to use DejaVuSans as it's commonly available on Linux systems
|
| 702 |
-
font = ImageFont.truetype("/usr/share/fonts/truetype/dejavu/DejaVuSans.ttf", 60)
|
| 703 |
-
small_font = ImageFont.truetype("/usr/share/fonts/truetype/dejavu/DejaVuSans.ttf", 60)
|
| 704 |
-
except OSError:
|
| 705 |
-
try:
|
| 706 |
-
# Fallback to Arial if available (common on Windows)
|
| 707 |
-
font = ImageFont.truetype("arial.ttf", 60)
|
| 708 |
-
small_font = ImageFont.truetype("arial.ttf", 60)
|
| 709 |
-
except OSError:
|
| 710 |
-
# If no TrueType fonts are available, fall back to default
|
| 711 |
-
print("Warning: TrueType fonts not available, using default font")
|
| 712 |
-
font = ImageFont.load_default()
|
| 713 |
-
small_font = ImageFont.load_default()
|
| 714 |
-
# Get molecule bounds
|
| 715 |
-
conf = mol.GetConformer()
|
| 716 |
-
positions = []
|
| 717 |
-
for i in range(mol.GetNumAtoms()):
|
| 718 |
-
pos = conf.GetAtomPosition(i)
|
| 719 |
-
positions.append((pos.x, pos.y))
|
| 720 |
-
|
| 721 |
-
x_coords = [p[0] for p in positions]
|
| 722 |
-
y_coords = [p[1] for p in positions]
|
| 723 |
-
min_x, max_x = min(x_coords), max(x_coords)
|
| 724 |
-
min_y, max_y = min(y_coords), max(y_coords)
|
| 725 |
-
|
| 726 |
-
# Calculate scaling factors
|
| 727 |
-
scale = 150 # Increased scale factor
|
| 728 |
-
center_x = 1000 # Image center
|
| 729 |
-
center_y = 1000
|
| 730 |
-
|
| 731 |
-
# Add residue labels in a circular arrangement around the structure
|
| 732 |
-
n_residues = len(residues)
|
| 733 |
-
radius = 700 # Distance of labels from center
|
| 734 |
-
|
| 735 |
-
# Start from the rightmost point (3 o'clock position) and go counterclockwise
|
| 736 |
-
# Offset by -3 positions to align with structure
|
| 737 |
-
offset = 0 # Adjust this value to match the structure alignment
|
| 738 |
-
for i, residue in enumerate(residues):
|
| 739 |
-
# Calculate position in a circle around the structure
|
| 740 |
-
# Start from 0 (3 o'clock) and go counterclockwise
|
| 741 |
-
angle = -(2 * np.pi * ((i + offset) % n_residues) / n_residues)
|
| 742 |
|
| 743 |
-
# Calculate label position
|
| 744 |
-
label_x = center_x + radius * np.cos(angle)
|
| 745 |
-
label_y = center_y + radius * np.sin(angle)
|
| 746 |
-
|
| 747 |
-
# Draw residue label
|
| 748 |
-
text = f"{i+1}. {residue}"
|
| 749 |
-
bbox = draw.textbbox((label_x, label_y), text, font=font)
|
| 750 |
-
padding = 10
|
| 751 |
-
draw.rectangle([bbox[0]-padding, bbox[1]-padding,
|
| 752 |
-
bbox[2]+padding, bbox[3]+padding],
|
| 753 |
-
fill='white', outline='white')
|
| 754 |
-
draw.text((label_x, label_y), text,
|
| 755 |
-
font=font, fill='black', anchor="mm")
|
| 756 |
-
|
| 757 |
-
# Add sequence at the top with white background
|
| 758 |
-
seq_text = f"Sequence: {sequence}"
|
| 759 |
-
bbox = draw.textbbox((center_x, 100), seq_text, font=small_font)
|
| 760 |
-
padding = 10
|
| 761 |
-
draw.rectangle([bbox[0]-padding, bbox[1]-padding,
|
| 762 |
-
bbox[2]+padding, bbox[3]+padding],
|
| 763 |
-
fill='white', outline='white')
|
| 764 |
-
draw.text((center_x, 100), seq_text,
|
| 765 |
-
font=small_font, fill='black', anchor="mm")
|
| 766 |
-
|
| 767 |
-
return img
|
| 768 |
-
|
| 769 |
-
"""
|
| 770 |
def annotate_cyclic_structure(mol, sequence):
|
| 771 |
-
"""Create structure visualization
|
| 772 |
-
# Generate 2D coordinates
|
| 773 |
AllChem.Compute2DCoords(mol)
|
| 774 |
|
| 775 |
-
# Create drawer with larger size for annotations
|
| 776 |
drawer = Draw.rdMolDraw2D.MolDraw2DCairo(2000, 2000)
|
| 777 |
|
| 778 |
# Draw molecule first
|
|
@@ -792,7 +674,7 @@ def annotate_cyclic_structure(mol, sequence):
|
|
| 792 |
print("Warning: TrueType fonts not available, using default font")
|
| 793 |
small_font = ImageFont.load_default()
|
| 794 |
|
| 795 |
-
#
|
| 796 |
seq_text = f"Sequence: {sequence}"
|
| 797 |
bbox = draw.textbbox((1000, 100), seq_text, font=small_font)
|
| 798 |
padding = 10
|
|
@@ -805,61 +687,50 @@ def annotate_cyclic_structure(mol, sequence):
|
|
| 805 |
return img
|
| 806 |
|
| 807 |
def create_enhanced_linear_viz(sequence, smiles):
|
| 808 |
-
"""
|
| 809 |
-
analyzer = PeptideAnalyzer()
|
| 810 |
|
| 811 |
-
# Create figure with two subplots
|
| 812 |
fig = plt.figure(figsize=(15, 10))
|
| 813 |
gs = fig.add_gridspec(2, 1, height_ratios=[1, 2])
|
| 814 |
ax_struct = fig.add_subplot(gs[0])
|
| 815 |
ax_detail = fig.add_subplot(gs[1])
|
| 816 |
|
| 817 |
-
# Parse sequence and get residues
|
| 818 |
if sequence.startswith('cyclo('):
|
| 819 |
residues = sequence[6:-1].split('-')
|
| 820 |
else:
|
| 821 |
residues = sequence.split('-')
|
| 822 |
|
| 823 |
-
# Get segments using analyzer
|
| 824 |
segments = analyzer.split_on_bonds(smiles)
|
| 825 |
|
| 826 |
-
# Debug print
|
| 827 |
print(f"Number of residues: {len(residues)}")
|
| 828 |
print(f"Number of segments: {len(segments)}")
|
| 829 |
|
| 830 |
-
# Top subplot - Basic structure
|
| 831 |
ax_struct.set_xlim(0, 10)
|
| 832 |
ax_struct.set_ylim(0, 2)
|
| 833 |
|
| 834 |
num_residues = len(residues)
|
| 835 |
spacing = 9.0 / (num_residues - 1) if num_residues > 1 else 9.0
|
| 836 |
|
| 837 |
-
# Draw basic structure
|
| 838 |
y_pos = 1.5
|
| 839 |
for i in range(num_residues):
|
| 840 |
x_pos = 0.5 + i * spacing
|
| 841 |
|
| 842 |
-
# Draw amino acid box
|
| 843 |
rect = patches.Rectangle((x_pos-0.3, y_pos-0.2), 0.6, 0.4,
|
| 844 |
facecolor='lightblue', edgecolor='black')
|
| 845 |
ax_struct.add_patch(rect)
|
| 846 |
|
| 847 |
-
# Draw connecting bonds if not the last residue
|
| 848 |
if i < num_residues - 1:
|
| 849 |
segment = segments[i] if i < len(segments) else None
|
| 850 |
if segment:
|
| 851 |
-
# Determine bond type from segment info
|
| 852 |
bond_type = 'ester' if 'O-linked' in segment.get('bond_after', '') else 'peptide'
|
| 853 |
is_n_methylated = 'N-Me' in segment.get('bond_after', '')
|
| 854 |
|
| 855 |
bond_color = 'red' if bond_type == 'ester' else 'black'
|
| 856 |
linestyle = '--' if bond_type == 'ester' else '-'
|
| 857 |
|
| 858 |
-
# Draw bond line
|
| 859 |
ax_struct.plot([x_pos+0.3, x_pos+spacing-0.3], [y_pos, y_pos],
|
| 860 |
color=bond_color, linestyle=linestyle, linewidth=2)
|
| 861 |
|
| 862 |
-
# Add bond type label
|
| 863 |
mid_x = x_pos + spacing/2
|
| 864 |
bond_label = f"{bond_type}"
|
| 865 |
if is_n_methylated:
|
|
@@ -868,16 +739,13 @@ def create_enhanced_linear_viz(sequence, smiles):
|
|
| 868 |
ha='center', va='bottom', fontsize=10,
|
| 869 |
color=bond_color)
|
| 870 |
|
| 871 |
-
# Add residue label
|
| 872 |
ax_struct.text(x_pos, y_pos-0.5, residues[i],
|
| 873 |
ha='center', va='top', fontsize=14)
|
| 874 |
|
| 875 |
-
# Bottom subplot - Detailed breakdown
|
| 876 |
ax_detail.set_ylim(0, len(segments)+1)
|
| 877 |
ax_detail.set_xlim(0, 1)
|
| 878 |
|
| 879 |
-
|
| 880 |
-
segment_y = len(segments) # Start from top
|
| 881 |
for i, segment in enumerate(segments):
|
| 882 |
y = segment_y - i
|
| 883 |
|
|
@@ -899,7 +767,6 @@ def create_enhanced_linear_viz(sequence, smiles):
|
|
| 899 |
text += "peptide"
|
| 900 |
color = 'red'
|
| 901 |
|
| 902 |
-
# Add segment analysis
|
| 903 |
ax_detail.text(0.05, y, text, fontsize=12, color=color)
|
| 904 |
ax_detail.text(0.5, y, f"SMILES: {segment.get('content', '')}", fontsize=10, color='gray')
|
| 905 |
|
|
@@ -910,11 +777,9 @@ def create_enhanced_linear_viz(sequence, smiles):
|
|
| 910 |
ax_struct.text(5, y_pos+0.3, 'Cyclic Connection',
|
| 911 |
ha='center', color='red', fontsize=14)
|
| 912 |
|
| 913 |
-
# Add titles and adjust layout
|
| 914 |
ax_struct.set_title("Peptide Structure Overview", pad=20)
|
| 915 |
ax_detail.set_title("Segment Analysis Breakdown", pad=20)
|
| 916 |
|
| 917 |
-
# Remove axes
|
| 918 |
for ax in [ax_struct, ax_detail]:
|
| 919 |
ax.set_xticks([])
|
| 920 |
ax.set_yticks([])
|
|
@@ -924,7 +789,7 @@ def create_enhanced_linear_viz(sequence, smiles):
|
|
| 924 |
return fig
|
| 925 |
|
| 926 |
class PeptideStructureGenerator:
|
| 927 |
-
"""
|
| 928 |
|
| 929 |
@staticmethod
|
| 930 |
def prepare_molecule(smiles):
|
|
@@ -933,7 +798,6 @@ class PeptideStructureGenerator:
|
|
| 933 |
if mol is None:
|
| 934 |
raise ValueError("Failed to create molecule from SMILES")
|
| 935 |
|
| 936 |
-
# Calculate valence for each atom
|
| 937 |
for atom in mol.GetAtoms():
|
| 938 |
atom.UpdatePropertyCache(strict=False)
|
| 939 |
|
|
@@ -951,7 +815,7 @@ class PeptideStructureGenerator:
|
|
| 951 |
|
| 952 |
@staticmethod
|
| 953 |
def get_etkdg_params(attempt=0):
|
| 954 |
-
"""Get ETKDG parameters
|
| 955 |
params = AllChem.ETKDGv3()
|
| 956 |
params.randomSeed = -1
|
| 957 |
params.maxIterations = 200
|
|
@@ -1025,13 +889,11 @@ class PeptideStructureGenerator:
|
|
| 1025 |
@staticmethod
|
| 1026 |
def mol_to_sdf_bytes(mol):
|
| 1027 |
"""Convert RDKit molecule to SDF file bytes"""
|
| 1028 |
-
# First write to StringIO in text mode
|
| 1029 |
sio = StringIO()
|
| 1030 |
writer = Chem.SDWriter(sio)
|
| 1031 |
writer.write(mol)
|
| 1032 |
writer.close()
|
| 1033 |
|
| 1034 |
-
# Convert the string to bytes
|
| 1035 |
return sio.getvalue().encode('utf-8')
|
| 1036 |
|
| 1037 |
def process_input(smiles_input=None, file_obj=None, show_linear=False,
|
|
@@ -1045,17 +907,14 @@ def process_input(smiles_input=None, file_obj=None, show_linear=False,
|
|
| 1045 |
if smiles_input:
|
| 1046 |
smiles = smiles_input.strip()
|
| 1047 |
|
| 1048 |
-
# First check if it's a peptide using analyzer's method
|
| 1049 |
if not analyzer.is_peptide(smiles):
|
| 1050 |
return "Error: Input SMILES does not appear to be a peptide structure.", None, None
|
| 1051 |
|
| 1052 |
try:
|
| 1053 |
-
# Create molecule
|
| 1054 |
mol = Chem.MolFromSmiles(smiles)
|
| 1055 |
if mol is None:
|
| 1056 |
return "Error: Invalid SMILES notation.", None, None
|
| 1057 |
|
| 1058 |
-
# Generate 3D structures if requested
|
| 1059 |
if generate_3d:
|
| 1060 |
generator = PeptideStructureGenerator()
|
| 1061 |
|
|
@@ -1080,10 +939,8 @@ def process_input(smiles_input=None, file_obj=None, show_linear=False,
|
|
| 1080 |
except Exception as e:
|
| 1081 |
return f"Error generating 3D structures: {str(e)}", None, None, None
|
| 1082 |
|
| 1083 |
-
# Use analyzer to get sequence
|
| 1084 |
segments = analyzer.split_on_bonds(smiles)
|
| 1085 |
|
| 1086 |
-
# Process segments and build sequence
|
| 1087 |
sequence_parts = []
|
| 1088 |
output_text = ""
|
| 1089 |
|
|
@@ -1108,7 +965,6 @@ def process_input(smiles_input=None, file_obj=None, show_linear=False,
|
|
| 1108 |
output_text += f"Warning: Could not identify residue in segment: {segment['content']}\n"
|
| 1109 |
output_text += "\n"
|
| 1110 |
else:
|
| 1111 |
-
# Just build sequence without detailed analysis in output
|
| 1112 |
for segment in segments:
|
| 1113 |
residue, mods = analyzer.identify_residue(segment)
|
| 1114 |
if residue:
|
|
@@ -1117,7 +973,6 @@ def process_input(smiles_input=None, file_obj=None, show_linear=False,
|
|
| 1117 |
else:
|
| 1118 |
sequence_parts.append(residue)
|
| 1119 |
|
| 1120 |
-
# Check if cyclic using analyzer's method
|
| 1121 |
is_cyclic, peptide_cycles, aromatic_cycles = analyzer.is_cyclic(smiles)
|
| 1122 |
three_letter = '-'.join(sequence_parts)
|
| 1123 |
one_letter = ''.join(analyzer.three_to_one.get(aa.split('(')[0], 'X') for aa in sequence_parts)
|
|
@@ -1126,7 +981,6 @@ def process_input(smiles_input=None, file_obj=None, show_linear=False,
|
|
| 1126 |
three_letter = f"cyclo({three_letter})"
|
| 1127 |
one_letter = f"cyclo({one_letter})"
|
| 1128 |
|
| 1129 |
-
# Create cyclic structure visualization
|
| 1130 |
img_cyclic = annotate_cyclic_structure(mol, three_letter)
|
| 1131 |
|
| 1132 |
# Create linear representation if requested
|
|
@@ -1139,7 +993,6 @@ def process_input(smiles_input=None, file_obj=None, show_linear=False,
|
|
| 1139 |
img_linear = Image.open(buf)
|
| 1140 |
plt.close(fig_linear)
|
| 1141 |
|
| 1142 |
-
# Add summary to output
|
| 1143 |
summary = "Summary:\n"
|
| 1144 |
summary += f"Sequence: {three_letter}\n"
|
| 1145 |
summary += f"One-letter code: {one_letter}\n"
|
|
@@ -1161,7 +1014,6 @@ def process_input(smiles_input=None, file_obj=None, show_linear=False,
|
|
| 1161 |
# Handle file input
|
| 1162 |
if file_obj is not None:
|
| 1163 |
try:
|
| 1164 |
-
# Handle file content
|
| 1165 |
if hasattr(file_obj, 'name'):
|
| 1166 |
with open(file_obj.name, 'r') as f:
|
| 1167 |
content = f.read()
|
|
@@ -1172,16 +1024,13 @@ def process_input(smiles_input=None, file_obj=None, show_linear=False,
|
|
| 1172 |
for line in content.splitlines():
|
| 1173 |
smiles = line.strip()
|
| 1174 |
if smiles:
|
| 1175 |
-
# Check if it's a peptide
|
| 1176 |
if not analyzer.is_peptide(smiles):
|
| 1177 |
output_text += f"Skipping non-peptide SMILES: {smiles}\n"
|
| 1178 |
continue
|
| 1179 |
|
| 1180 |
-
# Process this SMILES
|
| 1181 |
segments = analyzer.split_on_bonds(smiles)
|
| 1182 |
sequence_parts = []
|
| 1183 |
|
| 1184 |
-
# Add segment details if requested
|
| 1185 |
if show_segment_details:
|
| 1186 |
output_text += f"\nSegment Analysis for SMILES: {smiles}\n"
|
| 1187 |
for i, segment in enumerate(segments):
|
|
@@ -1206,7 +1055,6 @@ def process_input(smiles_input=None, file_obj=None, show_linear=False,
|
|
| 1206 |
else:
|
| 1207 |
sequence_parts.append(residue)
|
| 1208 |
|
| 1209 |
-
# Get cyclicity and create sequence
|
| 1210 |
is_cyclic, peptide_cycles, aromatic_cycles = analyzer.is_cyclic(smiles)
|
| 1211 |
sequence = f"cyclo({'-'.join(sequence_parts)})" if is_cyclic else '-'.join(sequence_parts)
|
| 1212 |
|
|
@@ -1215,7 +1063,6 @@ def process_input(smiles_input=None, file_obj=None, show_linear=False,
|
|
| 1215 |
output_text += f"Is Cyclic: {'Yes' if is_cyclic else 'No'}\n"
|
| 1216 |
if is_cyclic:
|
| 1217 |
output_text += f"Peptide Cycles: {', '.join(peptide_cycles)}\n"
|
| 1218 |
-
#output_text += f"Aromatic Cycles: {', '.join(aromatic_cycles)}\n"
|
| 1219 |
output_text += "-" * 50 + "\n"
|
| 1220 |
|
| 1221 |
return output_text, None, None
|
|
@@ -1298,6 +1145,5 @@ iface = gr.Interface(
|
|
| 1298 |
flagging_mode="never"
|
| 1299 |
)
|
| 1300 |
|
| 1301 |
-
# Launch the app
|
| 1302 |
if __name__ == "__main__":
|
| 1303 |
iface.launch(share=True)
|
|
|
|
| 72 |
|
| 73 |
is_cyclic = len(peptide_cycles) > 0 and not smiles.endswith('C(=O)O')
|
| 74 |
return is_cyclic, peptide_cycles, aromatic_cycles
|
| 75 |
+
|
| 76 |
def split_on_bonds(self, smiles):
|
|
|
|
| 77 |
positions = []
|
| 78 |
used = set()
|
|
|
|
| 79 |
# Find Gly pattern first
|
| 80 |
gly_pattern = r'NCC\(=O\)'
|
| 81 |
for match in re.finditer(gly_pattern, smiles):
|
|
|
|
| 104 |
|
| 105 |
# Create segments
|
| 106 |
segments = []
|
|
|
|
| 107 |
if positions:
|
| 108 |
# First segment
|
| 109 |
if positions[0]['start'] > 0:
|
|
|
|
| 111 |
'content': smiles[0:positions[0]['start']],
|
| 112 |
'bond_after': positions[0]['pattern']
|
| 113 |
})
|
|
|
|
| 114 |
# Process segments
|
| 115 |
for i in range(len(positions)-1):
|
| 116 |
current = positions[i]
|
| 117 |
next_pos = positions[i+1]
|
|
|
|
| 118 |
if current['type'] == 'gly':
|
| 119 |
segments.append({
|
| 120 |
'content': 'NCC(=O)',
|
| 121 |
'bond_before': positions[i-1]['pattern'] if i > 0 else None,
|
| 122 |
'bond_after': next_pos['pattern']
|
| 123 |
})
|
| 124 |
+
segments.append({
|
| 125 |
+
'content': smiles[current['start']+7:next_pos['start']],
|
| 126 |
+
'bond_before': 'gly_bond',
|
| 127 |
+
'bond_after': next_pos['pattern']
|
| 128 |
+
})
|
| 129 |
else:
|
| 130 |
content = smiles[current['end']:next_pos['start']]
|
| 131 |
if content:
|
|
|
|
| 141 |
'content': smiles[positions[-1]['end']:],
|
| 142 |
'bond_before': positions[-1]['pattern']
|
| 143 |
})
|
|
|
|
| 144 |
return segments
|
| 145 |
|
| 146 |
def clean_terminal_carboxyl(self, segment):
|
|
|
|
| 167 |
content = self.clean_terminal_carboxyl(segment)
|
| 168 |
mods = self.get_modifications(segment)
|
| 169 |
|
| 170 |
+
# Proline (P) - flexible ring numbers
|
| 171 |
+
if any([
|
| 172 |
+
# Check for any ring number in bond patterns
|
| 173 |
+
(segment.get('bond_after', '').startswith(f'N{n}C(=O)') and 'CCC' in content and
|
| 174 |
+
any(f'[C@@H]{n}' in content or f'[C@H]{n}' in content for n in '123456789'))
|
| 175 |
+
for n in '123456789'
|
| 176 |
+
]) or any([(segment.get('bond_before', '').startswith(f'C(=O)N{n}') and 'CCC' in content and
|
| 177 |
+
any(f'CCC{n}' for n in '123456789'))
|
| 178 |
+
for n in '123456789'
|
| 179 |
+
]) or any([
|
| 180 |
+
# Check ending patterns with any ring number
|
| 181 |
+
(f'CCCN{n}' in content and content.endswith('=O') and
|
| 182 |
+
any(f'[C@@H]{n}' in content or f'[C@H]{n}' in content for n in '123456789'))
|
| 183 |
+
for n in '123456789'
|
| 184 |
+
]) or any([
|
| 185 |
+
# Handle CCC[C@H]n patterns
|
| 186 |
+
(content == f'CCC[C@H]{n}' and segment.get('bond_before', '').startswith(f'C(=O)N{n}')) or
|
| 187 |
+
(content == f'CCC[C@@H]{n}' and segment.get('bond_before', '').startswith(f'C(=O)N{n}')) or
|
| 188 |
+
# N-terminal Pro with any ring number
|
| 189 |
+
(f'N{n}CCC[C@H]{n}' in content) or
|
| 190 |
+
(f'N{n}CCC[C@@H]{n}' in content)
|
| 191 |
+
for n in '123456789'
|
| 192 |
+
]):
|
| 193 |
+
return 'Pro', mods
|
| 194 |
+
|
| 195 |
+
# Tryptophan (W) - more specific indole pattern
|
| 196 |
+
if re.search(r'c[0-9]c\[nH\]c[0-9]ccccc[0-9][0-9]', content) and \
|
| 197 |
+
'c[nH]c' in content.replace(' ', ''):
|
| 198 |
+
return 'Trp', mods
|
| 199 |
+
|
| 200 |
+
# Lysine (K)
|
| 201 |
+
if '[C@@H](CCCCN)' in content or '[C@H](CCCCN)' in content:
|
| 202 |
+
return 'Lys', mods
|
| 203 |
+
|
| 204 |
+
# Arginine (R)
|
| 205 |
+
if '[C@@H](CCCNC(=N)N)' in content or '[C@H](CCCNC(=N)N)' in content:
|
| 206 |
+
return 'Arg', mods
|
| 207 |
+
|
| 208 |
+
if ('NCC(=O)' in content) or (content == 'C'):
|
| 209 |
+
if segment.get('bond_before') and segment.get('bond_after'):
|
| 210 |
+
if ('C(=O)N' in segment['bond_before'] or 'C(=O)N(C)' in segment['bond_before']):
|
| 211 |
+
return 'Gly', mods
|
| 212 |
+
elif segment.get('bond_before') and segment.get('bond_before').startswith('C(=O)N'):
|
| 213 |
+
return 'Gly', mods
|
| 214 |
+
|
| 215 |
+
if 'CC(C)C[C@H]' in content or 'CC(C)C[C@@H]' in content or '[C@@H](CC(C)C)' in content or '[C@H](CC(C)C)' in content or (('N[C@H](CCC(C)C)' in content or 'N[C@@H](CCC(C)C)' in content) and segment.get('bond_before') is None):
|
| 216 |
+
return 'Leu', mods
|
| 217 |
+
|
| 218 |
+
if '[C@@H]([C@@H](C)O)' in content or '[C@H]([C@H](C)O)' in content:
|
| 219 |
+
return 'Thr', mods
|
| 220 |
+
if re.search(r'\[C@H\]\(Cc\d+ccccc\d+\)', content) or re.search(r'\[C@@H\]\(Cc\d+ccccc\d+\)', content):
|
| 221 |
+
return 'Phe', mods
|
| 222 |
+
|
| 223 |
+
if ('[C@H](C(C)C)' in content or
|
| 224 |
+
'[C@@H](C(C)C)' in content or
|
| 225 |
+
'[C@H]C(C)C' in content or
|
| 226 |
+
'[C@@H]C(C)C' in content
|
| 227 |
+
):
|
| 228 |
+
if not any(p in content for p in ['CC(C)C[C@H]', 'CC(C)C[C@@H]']): # Still check not Leu
|
| 229 |
+
return 'Val', mods
|
| 230 |
+
|
| 231 |
+
if any([
|
| 232 |
+
'CC[C@H](C)' in content,
|
| 233 |
+
'CC[C@@H](C)' in content,
|
| 234 |
+
'[C@@H](CC)C' in content,
|
| 235 |
+
'[C@H](CC)C' in content,
|
| 236 |
+
'C(C)C[C@H]' in content and 'CC(C)C' not in content,
|
| 237 |
+
'C(C)C[C@@H]' in content and 'CC(C)C' not in content
|
| 238 |
+
]):
|
| 239 |
+
return 'Ile', mods
|
| 240 |
+
|
| 241 |
+
if ('[C@H](C)' in content or '[C@@H](C)' in content):
|
| 242 |
+
if not any(p in content for p in ['C(C)C', 'COC', 'CN(', 'C(C)O', 'CC[C@H]', 'CC[C@@H]']):
|
| 243 |
+
return 'Ala', mods
|
| 244 |
+
|
| 245 |
+
# Tyrosine (Tyr) - 4-hydroxybenzyl side chain
|
| 246 |
+
if re.search(r'Cc[0-9]ccc\(O\)cc[0-9]', content):
|
| 247 |
+
return 'Tyr', mods
|
| 248 |
+
|
| 249 |
+
# Serine (Ser) - Hydroxymethyl side chain
|
| 250 |
+
if '[C@H](CO)' in content or '[C@@H](CO)' in content:
|
| 251 |
+
if not ('C(C)O' in content or 'COC' in content):
|
| 252 |
+
return 'Ser', mods
|
| 253 |
+
|
| 254 |
+
# Threonine (Thr) - 1-hydroxyethyl side chain
|
| 255 |
+
if '[C@@H]([C@@H](C)O)' in content or '[C@H]([C@H](C)O)' in content or '[C@@H](C)O' in content or '[C@H](C)O' in content:
|
| 256 |
+
return 'Thr', mods
|
| 257 |
+
|
| 258 |
+
# Cysteine (Cys) - Thiol side chain
|
| 259 |
+
if '[C@H](CS)' in content or '[C@@H](CS)' in content:
|
| 260 |
+
return 'Cys', mods
|
| 261 |
+
|
| 262 |
+
# Methionine (Met) - Methylthioethyl side chain
|
| 263 |
+
if ('CCSC' in content):
|
| 264 |
+
return 'Met', mods
|
| 265 |
+
|
| 266 |
+
# Glutamine (Gln) - Carbamoylethyl side chain
|
| 267 |
+
if (content == '[C@@H](CC' or content == '[C@H](CC' and segment.get('bond_before')=='C(=O)N' and segment.get('bond_after')=='C(=O)N') or ('CCC(=O)N' in content) or ('CCC(N)=O' in content):
|
| 268 |
+
return 'Gln', mods
|
| 269 |
+
# Asparagine (Asn) - Carbamoylmethyl side chain
|
| 270 |
+
if (content == '[C@@H](C' or content == '[C@H](C' and segment.get('bond_before')=='C(=O)N' and segment.get('bond_after')=='C(=O)N') or ('CC(=O)N' in content) or ('CCN(=O)' in content) or ('CC(N)=O' in content):
|
| 271 |
+
return 'Asn', mods
|
| 272 |
+
|
| 273 |
+
# Glutamic acid (Glu) - Carboxyethyl side chain
|
| 274 |
+
if ('CCC(=O)O' in content):
|
| 275 |
+
return 'Glu', mods
|
| 276 |
+
# Aspartic acid (Asp) - Carboxymethyl side chain
|
| 277 |
+
if ('CC(=O)O' in content):
|
| 278 |
+
return 'Asp', mods
|
| 279 |
+
|
| 280 |
+
# Arginine (Arg) - 3-guanidinopropyl side chain
|
| 281 |
+
if ('CCCNC(=N)N' in content):
|
| 282 |
+
return 'Arg', mods
|
| 283 |
+
|
| 284 |
+
# Histidine (His) - Imidazole side chain
|
| 285 |
+
if re.search(r'Cc\d+c\[nH\]cn\d+', content) or re.search(r'Cc\d+cnc\[nH\]\d+', content):
|
| 286 |
+
return 'His', mods
|
| 287 |
+
|
| 288 |
+
############UAA
|
| 289 |
+
|
| 290 |
+
if '[C@H](COC(C)(C)C)' in content or '[C@@H](COC(C)(C)C)' in content:
|
| 291 |
+
return 'O-tBu', mods
|
| 292 |
+
|
| 293 |
+
if re.search(r'c\d+ccccc\d+', content):
|
| 294 |
if '[C@@H](c1ccccc1)' in content or '[C@H](c1ccccc1)' in content:
|
| 295 |
return '4', mods # Base phenylglycine
|
| 296 |
+
if ('C[C@H](CCCC)' in content or 'C[C@@H](CCCC)' in content) and 'CC(C)' not in content:
|
| 297 |
+
return 'Nle', mods
|
| 298 |
+
|
| 299 |
+
# Ornithine (Orn) - 3-carbon chain with NH2
|
| 300 |
+
if ('C[C@H](CCCN)' in content or 'C[C@@H](CCCN)' in content) and 'CC(C)' not in content:
|
| 301 |
+
return 'Orn', mods
|
| 302 |
+
|
| 303 |
+
# 2-Naphthylalanine (2Nal)
|
| 304 |
+
if ('Cc3cc2ccccc2c3' in content):
|
| 305 |
+
return '2Nal', mods
|
| 306 |
+
|
| 307 |
+
# Cyclohexylalanine (Cha)
|
| 308 |
+
if 'N2CCCCC2' in content or 'CCCCC2' in content:
|
| 309 |
+
return 'Cha', mods
|
| 310 |
+
|
| 311 |
+
# Aminobutyric acid (Abu) - 2-carbon chain
|
| 312 |
+
if ('C[C@H](CC)' in content or 'C[C@@H](CC)' in content) and not any(p in content for p in ['CC(C)', 'CCCC', 'CCC(C)']):
|
| 313 |
+
return 'Abu', mods
|
| 314 |
+
|
| 315 |
+
# Pipecolic acid (Pip)
|
| 316 |
+
if ('N3CCCCC3' in content or 'CCCCC3' in content):
|
| 317 |
+
return 'Pip', mods
|
| 318 |
+
|
| 319 |
+
# Cyclohexylglycine (Chg) - direct cyclohexyl without CH2
|
| 320 |
+
if ('C[C@H](C1CCCCC1)' in content or 'C[C@@H](C1CCCCC1)' in content):
|
| 321 |
+
return 'Chg', mods
|
| 322 |
+
|
| 323 |
+
# 4-Fluorophenylalanine (4F-Phe)
|
| 324 |
+
if ('Cc2ccc(F)cc2' in content):
|
| 325 |
+
return '4F-Phe', mods
|
| 326 |
|
| 327 |
# 4-substituted phenylalanines
|
| 328 |
if 'Cc1ccc' in content:
|
|
|
|
| 432 |
if 'c1ccc(c(c1)O)O' in content:
|
| 433 |
return 'DAH', mods # 3,4-Dihydroxy-phenylalanine
|
| 434 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 435 |
# Modified histidines
|
| 436 |
if 'c1cnc' in content:
|
| 437 |
if '[C@@H]1CN[C@@H](N1)F' in content:
|
|
|
|
| 441 |
if 'c1c[nH]c(n1)F' in content:
|
| 442 |
return '2HF2', mods # 2-fluoro-l-histidine variant
|
| 443 |
|
|
|
|
| 444 |
if '[SeH]' in content:
|
| 445 |
return 'CSE', mods # Selenocysteine
|
| 446 |
if 'S' in content:
|
|
|
|
| 451 |
if 'CCS' in content:
|
| 452 |
return 'HCS', mods # homocysteine
|
| 453 |
|
|
|
|
| 454 |
if 'CN=[N]=N' in content:
|
| 455 |
return 'AZDA', mods # azido-alanine
|
| 456 |
if '[NH]=[C](=[NH2])=[NH2]' in content:
|
|
|
|
| 458 |
return 'AGM', mods # 5-methyl-arginine
|
| 459 |
if 'CC[NH]=' in content:
|
| 460 |
return 'GDPR', mods # 2-Amino-3-guanidinopropionic acid
|
| 461 |
+
|
| 462 |
+
# Others
|
| 463 |
+
if 'C1CCCC1' in content:
|
| 464 |
+
return 'CPA3', mods # 3-Cyclopentyl-alanine
|
| 465 |
+
if 'C1CCCCC1' in content:
|
| 466 |
+
if 'CC1CCCCC1' in content:
|
| 467 |
+
return 'ALC', mods # 3-cyclohexyl-alanine
|
| 468 |
+
else:
|
| 469 |
+
return 'CHG', mods # Cyclohexylglycine
|
| 470 |
|
| 471 |
+
if 'CCC[C@@H]' in content or 'CCC[C@H]' in content:
|
| 472 |
+
return 'NLE', mods # Norleucine
|
| 473 |
+
if 'CC[C@@H]' in content or 'CC[C@H]' in content:
|
| 474 |
+
if not any(x in content for x in ['CC(C)', 'COC', 'CN(']):
|
| 475 |
+
return 'ABA', mods # 2-Aminobutyric acid
|
| 476 |
if 'CCON' in content:
|
| 477 |
return 'CAN', mods # canaline
|
| 478 |
if '[C@@H]1C=C[C@@H](C=C1)' in content:
|
|
|
|
| 496 |
if 'c1cccc(c1)[C](=[NH2])=[NH2]' in content:
|
| 497 |
return 'APM', mods # m-amidinophenyl-3-alanine
|
| 498 |
|
|
|
|
| 499 |
if 'O' in content:
|
| 500 |
if '[C@H]([C@H](C)O)O' in content:
|
| 501 |
return 'ILX', mods # 4,5-dihydroxy-isoleucine
|
|
|
|
| 510 |
if '[C@H](c1ccc(c(Cl)c1)O)O' in content:
|
| 511 |
return 'OMY', mods # (betar)-3-chloro-beta-hydroxy-l-tyrosine
|
| 512 |
|
|
|
|
| 513 |
if 'n1' in content:
|
| 514 |
if 'n1cccn1' in content:
|
| 515 |
return 'PYZ1', mods # 3-(1-Pyrazolyl)-alanine
|
|
|
|
| 528 |
if 'c1cnc2c(n1)cccc2' in content:
|
| 529 |
return 'QX32', mods # 3-(2-quinoxalyl)-alanine
|
| 530 |
|
|
|
|
| 531 |
if 'N' in content:
|
| 532 |
if '[NH3]CC[C@@H]' in content:
|
| 533 |
return 'DAB', mods # Diaminobutyric acid
|
|
|
|
| 540 |
if '[NH]=[C](=S)=[NH2]' in content:
|
| 541 |
return 'THIC', mods # Thio-citrulline
|
| 542 |
|
|
|
|
| 543 |
if 'CC' in content:
|
| 544 |
if 'CCCC[C@@H]' in content:
|
| 545 |
return 'AHP', mods # 2-Aminoheptanoic acid
|
|
|
|
| 552 |
if '[C@@H]([C@@H](C)O)C' in content:
|
| 553 |
return 'HLU', mods # beta-hydroxyleucine
|
| 554 |
|
|
|
|
| 555 |
if '[C@@H]' in content:
|
| 556 |
if '[C@@H](C[C@@H](F))' in content:
|
| 557 |
return 'FGA4', mods # 4-Fluoro-glutamic acid
|
|
|
|
| 562 |
if '[C@@H](CC[C@H](C))' in content:
|
| 563 |
return 'MEG', mods # (3s)-3-methyl-l-glutamic acid
|
| 564 |
|
|
|
|
| 565 |
if 'S' in content:
|
| 566 |
if 'SCC[C@@H]' in content:
|
| 567 |
return 'HSER', mods # homoserine
|
|
|
|
| 574 |
if 'S(=O)(=O)' in content:
|
| 575 |
return 'OMT', mods # Methionine sulfone
|
| 576 |
|
|
|
|
| 577 |
if 'C=' in content:
|
| 578 |
if 'C=C[C@@H]' in content:
|
| 579 |
return '2AG', mods # 2-Allyl-glycine
|
|
|
|
| 582 |
if 'C=Cc1ccccc1' in content:
|
| 583 |
return 'STYA', mods # Styrylalanine
|
| 584 |
|
|
|
|
| 585 |
if '[C@@H]1Cc2c(C1)cccc2' in content:
|
| 586 |
return 'IGL', mods # alpha-amino-2-indanacetic acid
|
| 587 |
if '[C](=[C](=O)=O)=O' in content:
|
| 588 |
return '26P', mods # 2-amino-6-oxopimelic acid
|
| 589 |
if '[C](=[C](=O)=O)=C' in content:
|
| 590 |
return '2NP', mods # l-2-amino-6-methylene-pimelic acid
|
|
|
|
|
|
|
| 591 |
if 'c1cccc2c1cc(O)cc2' in content:
|
| 592 |
return 'NAO1', mods # 5-hydroxy-1-naphthalene
|
| 593 |
if 'c1ccc2c(c1)cc(O)cc2' in content:
|
| 594 |
+
return 'NAO2', mods # 6-hydroxy-2-naphthalene
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 595 |
return None, mods
|
| 596 |
|
| 597 |
def get_modifications(self, segment):
|
|
|
|
| 650 |
'one_letter': one_letter,
|
| 651 |
'is_cyclic': is_cyclic
|
| 652 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 653 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 654 |
def annotate_cyclic_structure(mol, sequence):
|
| 655 |
+
"""Create structure visualization"""
|
|
|
|
| 656 |
AllChem.Compute2DCoords(mol)
|
| 657 |
|
|
|
|
| 658 |
drawer = Draw.rdMolDraw2D.MolDraw2DCairo(2000, 2000)
|
| 659 |
|
| 660 |
# Draw molecule first
|
|
|
|
| 674 |
print("Warning: TrueType fonts not available, using default font")
|
| 675 |
small_font = ImageFont.load_default()
|
| 676 |
|
| 677 |
+
# Header
|
| 678 |
seq_text = f"Sequence: {sequence}"
|
| 679 |
bbox = draw.textbbox((1000, 100), seq_text, font=small_font)
|
| 680 |
padding = 10
|
|
|
|
| 687 |
return img
|
| 688 |
|
| 689 |
def create_enhanced_linear_viz(sequence, smiles):
|
| 690 |
+
""""Linear visualization"""
|
| 691 |
+
analyzer = PeptideAnalyzer()
|
| 692 |
|
|
|
|
| 693 |
fig = plt.figure(figsize=(15, 10))
|
| 694 |
gs = fig.add_gridspec(2, 1, height_ratios=[1, 2])
|
| 695 |
ax_struct = fig.add_subplot(gs[0])
|
| 696 |
ax_detail = fig.add_subplot(gs[1])
|
| 697 |
|
|
|
|
| 698 |
if sequence.startswith('cyclo('):
|
| 699 |
residues = sequence[6:-1].split('-')
|
| 700 |
else:
|
| 701 |
residues = sequence.split('-')
|
| 702 |
|
|
|
|
| 703 |
segments = analyzer.split_on_bonds(smiles)
|
| 704 |
|
|
|
|
| 705 |
print(f"Number of residues: {len(residues)}")
|
| 706 |
print(f"Number of segments: {len(segments)}")
|
| 707 |
|
|
|
|
| 708 |
ax_struct.set_xlim(0, 10)
|
| 709 |
ax_struct.set_ylim(0, 2)
|
| 710 |
|
| 711 |
num_residues = len(residues)
|
| 712 |
spacing = 9.0 / (num_residues - 1) if num_residues > 1 else 9.0
|
| 713 |
|
|
|
|
| 714 |
y_pos = 1.5
|
| 715 |
for i in range(num_residues):
|
| 716 |
x_pos = 0.5 + i * spacing
|
| 717 |
|
|
|
|
| 718 |
rect = patches.Rectangle((x_pos-0.3, y_pos-0.2), 0.6, 0.4,
|
| 719 |
facecolor='lightblue', edgecolor='black')
|
| 720 |
ax_struct.add_patch(rect)
|
| 721 |
|
|
|
|
| 722 |
if i < num_residues - 1:
|
| 723 |
segment = segments[i] if i < len(segments) else None
|
| 724 |
if segment:
|
|
|
|
| 725 |
bond_type = 'ester' if 'O-linked' in segment.get('bond_after', '') else 'peptide'
|
| 726 |
is_n_methylated = 'N-Me' in segment.get('bond_after', '')
|
| 727 |
|
| 728 |
bond_color = 'red' if bond_type == 'ester' else 'black'
|
| 729 |
linestyle = '--' if bond_type == 'ester' else '-'
|
| 730 |
|
|
|
|
| 731 |
ax_struct.plot([x_pos+0.3, x_pos+spacing-0.3], [y_pos, y_pos],
|
| 732 |
color=bond_color, linestyle=linestyle, linewidth=2)
|
| 733 |
|
|
|
|
| 734 |
mid_x = x_pos + spacing/2
|
| 735 |
bond_label = f"{bond_type}"
|
| 736 |
if is_n_methylated:
|
|
|
|
| 739 |
ha='center', va='bottom', fontsize=10,
|
| 740 |
color=bond_color)
|
| 741 |
|
|
|
|
| 742 |
ax_struct.text(x_pos, y_pos-0.5, residues[i],
|
| 743 |
ha='center', va='top', fontsize=14)
|
| 744 |
|
|
|
|
| 745 |
ax_detail.set_ylim(0, len(segments)+1)
|
| 746 |
ax_detail.set_xlim(0, 1)
|
| 747 |
|
| 748 |
+
segment_y = len(segments)
|
|
|
|
| 749 |
for i, segment in enumerate(segments):
|
| 750 |
y = segment_y - i
|
| 751 |
|
|
|
|
| 767 |
text += "peptide"
|
| 768 |
color = 'red'
|
| 769 |
|
|
|
|
| 770 |
ax_detail.text(0.05, y, text, fontsize=12, color=color)
|
| 771 |
ax_detail.text(0.5, y, f"SMILES: {segment.get('content', '')}", fontsize=10, color='gray')
|
| 772 |
|
|
|
|
| 777 |
ax_struct.text(5, y_pos+0.3, 'Cyclic Connection',
|
| 778 |
ha='center', color='red', fontsize=14)
|
| 779 |
|
|
|
|
| 780 |
ax_struct.set_title("Peptide Structure Overview", pad=20)
|
| 781 |
ax_detail.set_title("Segment Analysis Breakdown", pad=20)
|
| 782 |
|
|
|
|
| 783 |
for ax in [ax_struct, ax_detail]:
|
| 784 |
ax.set_xticks([])
|
| 785 |
ax.set_yticks([])
|
|
|
|
| 789 |
return fig
|
| 790 |
|
| 791 |
class PeptideStructureGenerator:
|
| 792 |
+
"""Generate 3D structures of peptides using different embedding methods"""
|
| 793 |
|
| 794 |
@staticmethod
|
| 795 |
def prepare_molecule(smiles):
|
|
|
|
| 798 |
if mol is None:
|
| 799 |
raise ValueError("Failed to create molecule from SMILES")
|
| 800 |
|
|
|
|
| 801 |
for atom in mol.GetAtoms():
|
| 802 |
atom.UpdatePropertyCache(strict=False)
|
| 803 |
|
|
|
|
| 815 |
|
| 816 |
@staticmethod
|
| 817 |
def get_etkdg_params(attempt=0):
|
| 818 |
+
"""Get ETKDG parameters"""
|
| 819 |
params = AllChem.ETKDGv3()
|
| 820 |
params.randomSeed = -1
|
| 821 |
params.maxIterations = 200
|
|
|
|
| 889 |
@staticmethod
|
| 890 |
def mol_to_sdf_bytes(mol):
|
| 891 |
"""Convert RDKit molecule to SDF file bytes"""
|
|
|
|
| 892 |
sio = StringIO()
|
| 893 |
writer = Chem.SDWriter(sio)
|
| 894 |
writer.write(mol)
|
| 895 |
writer.close()
|
| 896 |
|
|
|
|
| 897 |
return sio.getvalue().encode('utf-8')
|
| 898 |
|
| 899 |
def process_input(smiles_input=None, file_obj=None, show_linear=False,
|
|
|
|
| 907 |
if smiles_input:
|
| 908 |
smiles = smiles_input.strip()
|
| 909 |
|
|
|
|
| 910 |
if not analyzer.is_peptide(smiles):
|
| 911 |
return "Error: Input SMILES does not appear to be a peptide structure.", None, None
|
| 912 |
|
| 913 |
try:
|
|
|
|
| 914 |
mol = Chem.MolFromSmiles(smiles)
|
| 915 |
if mol is None:
|
| 916 |
return "Error: Invalid SMILES notation.", None, None
|
| 917 |
|
|
|
|
| 918 |
if generate_3d:
|
| 919 |
generator = PeptideStructureGenerator()
|
| 920 |
|
|
|
|
| 939 |
except Exception as e:
|
| 940 |
return f"Error generating 3D structures: {str(e)}", None, None, None
|
| 941 |
|
|
|
|
| 942 |
segments = analyzer.split_on_bonds(smiles)
|
| 943 |
|
|
|
|
| 944 |
sequence_parts = []
|
| 945 |
output_text = ""
|
| 946 |
|
|
|
|
| 965 |
output_text += f"Warning: Could not identify residue in segment: {segment['content']}\n"
|
| 966 |
output_text += "\n"
|
| 967 |
else:
|
|
|
|
| 968 |
for segment in segments:
|
| 969 |
residue, mods = analyzer.identify_residue(segment)
|
| 970 |
if residue:
|
|
|
|
| 973 |
else:
|
| 974 |
sequence_parts.append(residue)
|
| 975 |
|
|
|
|
| 976 |
is_cyclic, peptide_cycles, aromatic_cycles = analyzer.is_cyclic(smiles)
|
| 977 |
three_letter = '-'.join(sequence_parts)
|
| 978 |
one_letter = ''.join(analyzer.three_to_one.get(aa.split('(')[0], 'X') for aa in sequence_parts)
|
|
|
|
| 981 |
three_letter = f"cyclo({three_letter})"
|
| 982 |
one_letter = f"cyclo({one_letter})"
|
| 983 |
|
|
|
|
| 984 |
img_cyclic = annotate_cyclic_structure(mol, three_letter)
|
| 985 |
|
| 986 |
# Create linear representation if requested
|
|
|
|
| 993 |
img_linear = Image.open(buf)
|
| 994 |
plt.close(fig_linear)
|
| 995 |
|
|
|
|
| 996 |
summary = "Summary:\n"
|
| 997 |
summary += f"Sequence: {three_letter}\n"
|
| 998 |
summary += f"One-letter code: {one_letter}\n"
|
|
|
|
| 1014 |
# Handle file input
|
| 1015 |
if file_obj is not None:
|
| 1016 |
try:
|
|
|
|
| 1017 |
if hasattr(file_obj, 'name'):
|
| 1018 |
with open(file_obj.name, 'r') as f:
|
| 1019 |
content = f.read()
|
|
|
|
| 1024 |
for line in content.splitlines():
|
| 1025 |
smiles = line.strip()
|
| 1026 |
if smiles:
|
|
|
|
| 1027 |
if not analyzer.is_peptide(smiles):
|
| 1028 |
output_text += f"Skipping non-peptide SMILES: {smiles}\n"
|
| 1029 |
continue
|
| 1030 |
|
|
|
|
| 1031 |
segments = analyzer.split_on_bonds(smiles)
|
| 1032 |
sequence_parts = []
|
| 1033 |
|
|
|
|
| 1034 |
if show_segment_details:
|
| 1035 |
output_text += f"\nSegment Analysis for SMILES: {smiles}\n"
|
| 1036 |
for i, segment in enumerate(segments):
|
|
|
|
| 1055 |
else:
|
| 1056 |
sequence_parts.append(residue)
|
| 1057 |
|
|
|
|
| 1058 |
is_cyclic, peptide_cycles, aromatic_cycles = analyzer.is_cyclic(smiles)
|
| 1059 |
sequence = f"cyclo({'-'.join(sequence_parts)})" if is_cyclic else '-'.join(sequence_parts)
|
| 1060 |
|
|
|
|
| 1063 |
output_text += f"Is Cyclic: {'Yes' if is_cyclic else 'No'}\n"
|
| 1064 |
if is_cyclic:
|
| 1065 |
output_text += f"Peptide Cycles: {', '.join(peptide_cycles)}\n"
|
|
|
|
| 1066 |
output_text += "-" * 50 + "\n"
|
| 1067 |
|
| 1068 |
return output_text, None, None
|
|
|
|
| 1145 |
flagging_mode="never"
|
| 1146 |
)
|
| 1147 |
|
|
|
|
| 1148 |
if __name__ == "__main__":
|
| 1149 |
iface.launch(share=True)
|