CharlesLi/graph_classification_smiles · Datasets at Hugging Face

prompt stringlengths 189 761	answer stringclasses 2 values
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN1CCOC(C(NC(=O)c2ccccc2)c2ccccc2)C1=O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(CCNC(=S)NC=C2C(=O)CC(C)(C)CC2=O)cc1OC	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=S1c2ccccc2SCSc2ccccc21	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1(C)CC(c2c[nH]c3ccccc23)=CC2=Nc3ccccc3C21O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=P1(N(CCCl)CCCl)NCCCO1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(C2NC(=O)N3C(c4ccc(OC)cc4)NC(=O)N23)cc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=S(=O)([N-]c1nc2ccccc2nc1-[n+]1ccccc1)c1ccccc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1C2ON(c3ccccc3)C(c3cccc([N+](=O)[O-])c3)C2C(=O)N1c1ccc(Cc2ccc(N3C(=O)C4ON(c5ccccc5)C(c5cccc([N+](=O)[O-])c5)C4C3=O)cc2)cc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1C(=Cc2cccc(Br)c2)CCc2ccccc21	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1OC(=O)C2=C1C(c1cccs1)C=C(c1cccnc1)N2c1ccncc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1c(-c2coc(-c3ccc([N+](=O)[O-])cc3)n2)c(=O)n(-c2ccccc2)n1C	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C1CSCC2(COC2)CSCCSCC2(COC2)CS1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)N(CCn1c2c3ccccc3ccc2c2oc(=O)c3ccccc3c21)C(C)C.Cl	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N[Co-4](N)(N)(N)(N)[NH+]1N=NC(C(=O)[O-])=N1.[Cl-]	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(NC1=NCC(CN2CCN(c3ccccc3)CC2)O1)Nc1ccccc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)c1nc(-c2ccc(Cl)c(Cl)c2)nc2ccc(Cl)cc12.[NaH]	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(NC(=O)C(Cc1ccc(OC(=O)c2ccccc2)cc1)NC(=O)OC(C)(C)C)C(=O)NCC(=O)NC(Cc1ccccc1)NC(=O)OCc1ccccc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(OC)c2c(OC)cc(C)cc12	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1[nH]c2nc(S)nc(NC(N)=S)c2c1Cc1ccccc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Nc1ccc2c(c1)N[Cu-3]1(Nc3cc(N)ccc3O1)O2	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1=NC(=Cc2cccc(C#N)c2)C(=O)O1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCC(=O)CC(=O)CCC(=O)Nc1cc(C)ccc1C	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=c1c2cccnc2[nH]c2ccc3scnc3c12	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN1C(=O)C2CCC(=O)N2c2cccnc21	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1ccc(-c2c(C#N)c(-c3ccc([N+](=O)[O-])cc3)c(C#N)c(=O)n2NS(=O)(=O)c2ccccc2)cc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=NC(=C(c1ccccc1)N1CCOCC1)c1ccccc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cc(O)ccc1N=O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc(C2c3cc(O)c(OC)cc3CC3C(=O)OCC32)ccc1O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)=C1C2C(C13C(=O)OC(C)(C)OC3=O)C2(C)C	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(OC)C(C)=NNC1=Nc2ccc(Cl)cc2C(c2ccccc2Cl)=NC1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)C(=O)NCCCN1CCOCC1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cc2c(c(C(=O)NCC(=O)NC(C)C(=O)OCc3ccccc3)c1)Oc1c(cc(C)cc1C(=O)NCC(=O)NC(C)C(=O)OCc1ccccc1)S2	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(=O)C1C(=O)C(C(=O)OC)C23C(C)CCC12C(C(=O)OC)C(=O)C3C(=O)OC	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cccc(C2c3cc4c(cc3OC(Nc3ccccc3)C2C)OCO4)c1OC	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=O)CC1CCC(=O)C=CC(=O)OC(CC(C)=O)CCC(=O)C=CC(=O)O1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N#CCCN(CCN(CCN(C(=O)Nc1ccccc1)c1ccccc1)C(=O)Nc1ccccc1)C(=O)Nc1ccccc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N=C(N)NS(=O)(=O)c1ccc(Nc2c3ccccc3nc3c(C(=O)NC(CO)(CO)CO)cccc23)cc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C=CCN=C1N=C(CC(=O)OCC)CS1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cn1cc2ccccc2c1-c1nc(F)nc(Oc2ccc3c(c2)CCC2C3CCC3(C)C(O)CCC23)n1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: OCc1c2c(cc3c1CC1(C3)Cc3cc4c(c(CO)c3C1)CCC4)CCC2	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1C(O)C(O)C(O)C(O)C1O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: [O-]c1c2cc(-[n+]3c(-c4ccccc4)cc(-c4ccccc4)cc3-c3ccccc3)cc1COC(c1ccccc1)C(c1ccccc1)OCCOCCOC(c1ccccc1)C(c1ccccc1)OC2	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(-c2csc(=[N+]3CCCCC3)s2)cc1.O=S(=O)(O)O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Oc1ccccc1-c1n[nH]c(=S)[nH]1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(Nc1ccc(C=Cc2ccc(NC(=O)c3cc(S(=O)(=O)O)c4cccnc4c3O)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1)c1cc(S(=O)(=O)O)c2cccnc2c1O.[NaH]	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(C=Cc1ccc2c(c1)OCO2)N1CCCCC1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(CCC(=O)Nc1ccc(Cl)c(Cl)c1)CC(=O)c1ccc(F)cc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc2cnc3c4cc(O)ccc4ccc3c2cc1OC	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)CCCCCCCCCCCI	No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1NC2OC(CO)C(O)C(O)C2O1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: NC(=O)c1nnn(Cc2ccccc2)c1N	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=[N+]([O-])O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)C=Cc1cccc(OC)c1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccccc1C1SC(c2ccccc2)(c2ccccc2)OC1=O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN(C)CCNC(=O)Cn1ccc(=O)c2cc([N+](=O)[O-])ccc21.Cl	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1c2ccccc2C(=O)N1N1C(=O)C2C3CCC(O3)C2C1=O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1c2c(nc3ccccc13)C(=O)c1cccnc1C2=O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C1=NN2C(=NC3=C(Cc4ccccc43)C2c2ccccc2)N1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC1=C(OC)C(=O)C(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)=C(C)C1=O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CNC(=O)c1nn[nH]c1O.[NaH]	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C(=O)C12CC3CC(CC(C3)C1)C2)C(O)c1ccccc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1nc(C)c(N2CCNCC2)c(O)n1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(-c2onc(-c3c(C)cc(C)cc3C)c2C2=NCCN2)cc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C#CCN1C(=O)CN2C(Cl)(Cl)C2(c2ccccc2)c2cc(Cl)ccc21	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cccc(NC(=O)CC(=O)n2nc(C)c(N=Nc3ccccc3F)c2C)c1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N#Cc1nc(Cc2cccs2)oc1N	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(O)c2c1C(=O)CCCC2=O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)C1C(C(=O)O)C2C3CC4C(C31)C42	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cc(NS(=O)(=O)c2ccc(NC(=O)c3ccc4nc5ccccc5c(Nc5ccc(S(=O)(=O)Nc6cc(C)on6)cc5)c4c3)cc2)no1	No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(CC1Sc2ccccc2NC1=O)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-]	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1(C)C(=O)N2CCSC21	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=O)C(=Cc1ccccc1F)C(=O)c1ccccc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(NC(=O)CCc2cc(-c3ccc(O)c(OC)c3)nc(NC#N)n2)cc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=c1c(-c2ccccc2)c2c3cccc4cccc(c-2c1-c1ccccc1)c43	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCc1ccccc1NC(=O)C(CC(=O)c1c(C)[n+]([O-])c2ccccc2[n+]1[O-])=NNS(=O)(=O)c1ccc(C)cc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=c1cc(CO)oc(C(O)c2ccccc2)c1O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cn1nc2ccc3nccc(NCCNCCCl)c3c2n1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc2c(cc1C)C1=C(C)C(=O)OC1C(O)C2C	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=[N+]([O-])c1ccc(S(=O)(=O)NCCSSCCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1c2ccccc2c(CSC(=N)N)c2ccccc12	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Nc1nc(Cl)cc(OCC2(CO)CC(OCc3ccccc3)C2)n1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN(CCCNC(=O)c1cn(C)c2c1ccc1ccccc12)CCCNC(=O)c1cn(C)c2c1ccc1ccccc12	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1OC(OCC2OC(Oc3c(-c4ccc(O)cc4)oc4cc(OC5OC(C)C(O)C(O)C5O)cc(O)c4c3=O)C(O)C(O)C2O)C(O)C(O)C1O	No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1c(C)c2nc3ccccc3nc2c2c(O)ccnc12	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: c1ccc2sc(SCN3CCCCC3)nc2c1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COCn1c2ccc(OC(C)=O)cc2c2c(=O)oc(C)nc21	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOP(=O)(OCC)C(C#N)=Cc1ccc2ccccc2c1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N#CC1(C#N)C(c2ccccc2)NC23CCCCC2C1(C#N)C(=O)N3	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOc1cc2ccc3c4cc(OC)c(OC)cc4cnc3c2cc1OCC	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Nc1nc(Cl)c(CO)c(NCC2(CO)CC(CCc3ccccc3)C2)n1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)C=C1CC(NC(=O)OCc2ccccc2)C(=O)N1CC(=O)OCC	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)C(=Cc1ccc(F)cc1)c1ccccc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN(N=C(C(=O)O)c1ccccc1)C1=NCCN1.I	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Sc1nc(Nc2ccccc2)c2c3c(sc2n1)CCCC3	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1ccccc1Cn1nc2ccccc2cc1=O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=O)NNC(=S)NC=C(C(=O)c1ccccc1)C(=O)c1ccccc1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cc(C)nc(NS(=O)(=O)c2ccc(Nc3c4ccccc4nc4c(C(=O)NCCN(C)C)ccc(Cl)c34)cc2)n1	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc2cc(C(=O)N3CC(CCl)c4c3cc(N(C)C)c3ccccc43)[nH]c2c(OC)c1OC	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN1NC(C2NN(C)C(=O)N(C)N2)NN(C)C1=O	Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN1CCCC1c1cccnc1.O=C(O)C(O)C(O)C(=O)O	Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN1CCOC(C(NC(=O)c2ccccc2)c2ccccc2)C1=O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(CCNC(=S)NC=C2C(=O)CC(C)(C)CC2=O)cc1OC

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=S1c2ccccc2SCSc2ccccc21

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1(C)CC(c2c[nH]c3ccccc23)=CC2=Nc3ccccc3C21O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=P1(N(CCCl)CCCl)NCCCO1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(C2NC(=O)N3C(c4ccc(OC)cc4)NC(=O)N23)cc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=S(=O)([N-]c1nc2ccccc2nc1-[n+]1ccccc1)c1ccccc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1C2ON(c3ccccc3)C(c3cccc([N+](=O)[O-])c3)C2C(=O)N1c1ccc(Cc2ccc(N3C(=O)C4ON(c5ccccc5)C(c5cccc([N+](=O)[O-])c5)C4C3=O)cc2)cc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1C(=Cc2cccc(Br)c2)CCc2ccccc21

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1OC(=O)C2=C1C(c1cccs1)C=C(c1cccnc1)N2c1ccncc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1c(-c2coc(-c3ccc([N+](=O)[O-])cc3)n2)c(=O)n(-c2ccccc2)n1C

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C1CSCC2(COC2)CSCCSCC2(COC2)CS1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)N(CCn1c2c3ccccc3ccc2c2oc(=O)c3ccccc3c21)C(C)C.Cl

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N[Co-4](N)(N)(N)(N)[NH+]1N=NC(C(=O)[O-])=N1.[Cl-]

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(NC1=NCC(CN2CCN(c3ccccc3)CC2)O1)Nc1ccccc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)c1nc(-c2ccc(Cl)c(Cl)c2)nc2ccc(Cl)cc12.[NaH]

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(NC(=O)C(Cc1ccc(OC(=O)c2ccccc2)cc1)NC(=O)OC(C)(C)C)C(=O)NCC(=O)NC(Cc1ccccc1)NC(=O)OCc1ccccc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(OC)c2c(OC)cc(C)cc12

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1[nH]c2nc(S)nc(NC(N)=S)c2c1Cc1ccccc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Nc1ccc2c(c1)N[Cu-3]1(Nc3cc(N)ccc3O1)O2

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1=NC(=Cc2cccc(C#N)c2)C(=O)O1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCC(=O)CC(=O)CCC(=O)Nc1cc(C)ccc1C

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=c1c2cccnc2[nH]c2ccc3scnc3c12

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN1C(=O)C2CCC(=O)N2c2cccnc21

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1ccc(-c2c(C#N)c(-c3ccc([N+](=O)[O-])cc3)c(C#N)c(=O)n2NS(=O)(=O)c2ccccc2)cc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=NC(=C(c1ccccc1)N1CCOCC1)c1ccccc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cc(O)ccc1N=O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc(C2c3cc(O)c(OC)cc3CC3C(=O)OCC32)ccc1O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)=C1C2C(C13C(=O)OC(C)(C)OC3=O)C2(C)C

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(OC)C(C)=NNC1=Nc2ccc(Cl)cc2C(c2ccccc2Cl)=NC1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)C(=O)NCCCN1CCOCC1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cc2c(c(C(=O)NCC(=O)NC(C)C(=O)OCc3ccccc3)c1)Oc1c(cc(C)cc1C(=O)NCC(=O)NC(C)C(=O)OCc1ccccc1)S2

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(=O)C1C(=O)C(C(=O)OC)C23C(C)CCC12C(C(=O)OC)C(=O)C3C(=O)OC

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cccc(C2c3cc4c(cc3OC(Nc3ccccc3)C2C)OCO4)c1OC

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=O)CC1CCC(=O)C=CC(=O)OC(CC(C)=O)CCC(=O)C=CC(=O)O1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N#CCCN(CCN(CCN(C(=O)Nc1ccccc1)c1ccccc1)C(=O)Nc1ccccc1)C(=O)Nc1ccccc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N=C(N)NS(=O)(=O)c1ccc(Nc2c3ccccc3nc3c(C(=O)NC(CO)(CO)CO)cccc23)cc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C=CCN=C1N=C(CC(=O)OCC)CS1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cn1cc2ccccc2c1-c1nc(F)nc(Oc2ccc3c(c2)CCC2C3CCC3(C)C(O)CCC23)n1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: OCc1c2c(cc3c1CC1(C3)Cc3cc4c(c(CO)c3C1)CCC4)CCC2

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1C(O)C(O)C(O)C(O)C1O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: [O-]c1c2cc(-[n+]3c(-c4ccccc4)cc(-c4ccccc4)cc3-c3ccccc3)cc1COC(c1ccccc1)C(c1ccccc1)OCCOCCOC(c1ccccc1)C(c1ccccc1)OC2

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(-c2csc(=[N+]3CCCCC3)s2)cc1.O=S(=O)(O)O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Oc1ccccc1-c1n[nH]c(=S)[nH]1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(Nc1ccc(C=Cc2ccc(NC(=O)c3cc(S(=O)(=O)O)c4cccnc4c3O)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1)c1cc(S(=O)(=O)O)c2cccnc2c1O.[NaH]

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(C=Cc1ccc2c(c1)OCO2)N1CCCCC1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(CCC(=O)Nc1ccc(Cl)c(Cl)c1)CC(=O)c1ccc(F)cc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc2cnc3c4cc(O)ccc4ccc3c2cc1OC

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)CCCCCCCCCCCI

No

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1NC2OC(CO)C(O)C(O)C2O1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: NC(=O)c1nnn(Cc2ccccc2)c1N

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=[N+]([O-])O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)C=Cc1cccc(OC)c1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccccc1C1SC(c2ccccc2)(c2ccccc2)OC1=O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN(C)CCNC(=O)Cn1ccc(=O)c2cc([N+](=O)[O-])ccc21.Cl

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1c2ccccc2C(=O)N1N1C(=O)C2C3CCC(O3)C2C1=O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1c2c(nc3ccccc13)C(=O)c1cccnc1C2=O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C1=NN2C(=NC3=C(Cc4ccccc43)C2c2ccccc2)N1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC1=C(OC)C(=O)C(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)=C(C)C1=O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CNC(=O)c1nn[nH]c1O.[NaH]

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C(=O)C12CC3CC(CC(C3)C1)C2)C(O)c1ccccc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1nc(C)c(N2CCNCC2)c(O)n1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(-c2onc(-c3c(C)cc(C)cc3C)c2C2=NCCN2)cc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C#CCN1C(=O)CN2C(Cl)(Cl)C2(c2ccccc2)c2cc(Cl)ccc21

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cccc(NC(=O)CC(=O)n2nc(C)c(N=Nc3ccccc3F)c2C)c1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N#Cc1nc(Cc2cccs2)oc1N

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(O)c2c1C(=O)CCCC2=O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)C1C(C(=O)O)C2C3CC4C(C31)C42

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cc(NS(=O)(=O)c2ccc(NC(=O)c3ccc4nc5ccccc5c(Nc5ccc(S(=O)(=O)Nc6cc(C)on6)cc5)c4c3)cc2)no1

No

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(CC1Sc2ccccc2NC1=O)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-]

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1(C)C(=O)N2CCSC21

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=O)C(=Cc1ccccc1F)C(=O)c1ccccc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(NC(=O)CCc2cc(-c3ccc(O)c(OC)c3)nc(NC#N)n2)cc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=c1c(-c2ccccc2)c2c3cccc4cccc(c-2c1-c1ccccc1)c43

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCc1ccccc1NC(=O)C(CC(=O)c1c(C)[n+]([O-])c2ccccc2[n+]1[O-])=NNS(=O)(=O)c1ccc(C)cc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=c1cc(CO)oc(C(O)c2ccccc2)c1O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cn1nc2ccc3nccc(NCCNCCCl)c3c2n1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc2c(cc1C)C1=C(C)C(=O)OC1C(O)C2C

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=[N+]([O-])c1ccc(S(=O)(=O)NCCSSCCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1c2ccccc2c(CSC(=N)N)c2ccccc12

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Nc1nc(Cl)cc(OCC2(CO)CC(OCc3ccccc3)C2)n1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN(CCCNC(=O)c1cn(C)c2c1ccc1ccccc12)CCCNC(=O)c1cn(C)c2c1ccc1ccccc12

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1OC(OCC2OC(Oc3c(-c4ccc(O)cc4)oc4cc(OC5OC(C)C(O)C(O)C5O)cc(O)c4c3=O)C(O)C(O)C2O)C(O)C(O)C1O

No

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1c(C)c2nc3ccccc3nc2c2c(O)ccnc12

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: c1ccc2sc(SCN3CCCCC3)nc2c1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COCn1c2ccc(OC(C)=O)cc2c2c(=O)oc(C)nc21

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOP(=O)(OCC)C(C#N)=Cc1ccc2ccccc2c1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N#CC1(C#N)C(c2ccccc2)NC23CCCCC2C1(C#N)C(=O)N3

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOc1cc2ccc3c4cc(OC)c(OC)cc4cnc3c2cc1OCC

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Nc1nc(Cl)c(CO)c(NCC2(CO)CC(CCc3ccccc3)C2)n1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)C=C1CC(NC(=O)OCc2ccccc2)C(=O)N1CC(=O)OCC

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)C(=Cc1ccc(F)cc1)c1ccccc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN(N=C(C(=O)O)c1ccccc1)C1=NCCN1.I

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Sc1nc(Nc2ccccc2)c2c3c(sc2n1)CCCC3

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1ccccc1Cn1nc2ccccc2cc1=O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=O)NNC(=S)NC=C(C(=O)c1ccccc1)C(=O)c1ccccc1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cc(C)nc(NS(=O)(=O)c2ccc(Nc3c4ccccc4nc4c(C(=O)NCCN(C)C)ccc(Cl)c34)cc2)n1

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc2cc(C(=O)N3CC(CCl)c4c3cc(N(C)C)c3ccccc43)[nH]c2c(OC)c1OC

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN1NC(C2NN(C)C(=O)N(C)N2)NN(C)C1=O

Yes

Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN1CCCC1c1cccnc1.O=C(O)C(O)C(O)C(=O)O

Yes