messages
listlengths 2
2
| images
images listlengths 1
1
|
|---|---|
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][O].[Cl][C][Cl].[Na+1].[OH1-1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC1=NC(=NC(=N1)NCCO)C(Cl)(Cl)Cl"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "0.2267"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][=C][C][=N][C][Branch1][Ring1][C][O][=C][Ring1][Branch2][Br]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a triterpenoid. It has a role as a metabolite."
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][S][C][S][C][Branch2][Ring1][Branch2][C][=N][C][Branch1][=N][N][C][=C][C][=C][C][Branch1][C][N][=C][Ring1][#Branch1][=N][C][=C][Ring1][=C][C][=C][Branch1][=Branch2][C][C][C][C][C][C][Ring1][=Branch1][C][=Ring2][Ring1][#Branch2][C][#N]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][S][C][=C][Branch1][C][F][C][=C][Branch1][Ring1][C][O][C][=C][Ring1][=Branch2][F]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][=C][C][=N][C][=C][Ring1][=Branch1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: C1C(COC2=CN(C(=O)C=C2C3=C1C=CC(=C3)Cl)C(CCOCC(F)F)C(=O)NC4=CC=C(C=C4)C(=O)N)C(F)(F)F"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][=Branch1][C][=O][Cl].[C][O][C][=C][C][=C][Branch1][S][C][O][C][=C][NH1][C][Branch1][Ring1][C][O][=C][C][Ring1][Branch2][=O][C][=C][Ring1][P]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "0.0372"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][C][O][C][Ring1][Branch1].[C][C][N][Branch1][Ring1][C][C][C][C]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[F][C][Branch1][C][F][Branch1][C][F][O][C][=C][C][=C][Branch2][Ring1][=Branch2][C][=C][C][=C][C][Branch1][#C][C][=C][N][Ring1][Branch1][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][S][C][=C][Ring2][Ring1][=Branch1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CS(=O)(=O)C1=C(C=CC(=C1)F)N(CC2=CC3=C(C=C2)C4=C(COC4)C(=N3)N)C(=O)C5=CN=C(C=C5)C6(CC6)C#N"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a triterpenoid saponin."
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a diterpenoid."
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.28"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][O][C][=Branch1][C][=O][C][=C][Branch1][C][F][C][Branch1][Ring1][O][C][=C][C][Branch1][Ring1][O][C][=C][Ring1][O][F]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.2298"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][O][C][=Branch1][C][=O][C][S][C][Branch2][Ring1][Ring1][N][C][C][N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][O][=O][=N][C][=Ring1][P][C]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is an oligopeptide."
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][O][C][C][N][Ring1][=Branch1].[C][O][C][=C][C][=C][Branch2][Ring2][Branch1][O][C][=C][C][=C][C][Branch2][Ring1][Branch2][N][C][=Branch1][C][=O][N][C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][O][N][=Ring1][=Branch2][=C][Ring2][Ring1][Ring1][N][=C][N][=C][Ring2][Ring1][#Branch2][C][=C][Ring2][Ring1][=C][O][C][C][Cl]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][C][=Branch1][C][=O][O][C][=C][C][=C][Branch2][Ring2][#Branch1][N][C][Branch1][=Branch2][C][=N][O][N][=C][Ring1][Branch1][N][=N][C][=C][N][=C][Branch1][=N][O][C][=C][C][=C][C][Branch1][C][N][=C][Ring1][#Branch1][C][=C][Ring1][=C][Ring2][Ring1][#Branch1][C][=C][Ring2][Ring1][=N]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[N][C][C][=C][C][=C][Branch2][Ring2][#C][C][=C][C][=C][N][=C][N][=C][Branch2][Ring1][N][N][C][=C][C][=C][Branch1][=C][O][C][C][=C][C][=C][C][Branch1][C][F][=C][Ring1][#Branch1][C][Branch1][C][Cl][=C][Ring1][S][C][Ring2][Ring1][#Branch1][=C][Ring2][Ring1][O][O][Ring2][Ring1][S]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][O][P][=Branch1][C][=O][Branch1][Ring2][C][C][N][O][C][C].[C][N][C][C][=C][Branch1][C][Cl][C][=C][Branch1][C][Cl][C][=C][Ring1][Branch2][C][Branch2][Ring1][Ring1][C][=C][C][=C][C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][=C][Ring1][#Branch2][C][Ring2][Ring1][=Branch1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][N][Branch1][C][C][C][=O].[H-1].[Na+1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[O][=S][=Branch1][C][=O][Branch1][S][N][C][=C][C][=C][C][=C][C][=C][N][=C][Ring1][#Branch2][Ring1][=Branch1][C][=C][Branch1][C][Cl][C][=C][C][=C][Ring1][#Branch1][Cl]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[Na+1].[OH1-1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][O][C][=C][C][Branch1][C][F][=C][Branch2][Ring1][#Branch1][N][C][C][C][Branch1][=N][C][=Branch1][C][=O][N][C][C][C][C][C][Ring1][=Branch1][C][C][Ring1][=C][C][=C][Ring2][Ring1][Branch1][F]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C@H1][C@@H1][Ring1][=Branch1][C][C][N][Ring1][Branch1][C][C][C][C][C][C][C][C][Ring1][=Branch1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[O][=C][Branch1][C][O][C][O][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][N][N][=N][C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][=C][Ring1][N][C][=C][N][Branch1][S][C][=C][C][=C][Branch1][=Branch1][C][Branch1][C][N][=O][C][=C][Ring1][=Branch2][C][=N][Ring1][=C]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: C1CNC(C2=CC=CC=C21)CC(=O)CCCCCCCCC(=O)CC3C4=CC=CC=C4CCN3"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][Branch1][Ring1][C][#N][C][=C][C][=C][Branch1][O][N][C][=C][Branch1][C][Cl][C][=N][Ring1][=Branch1][C][Branch1][C][Cl][=C][Ring1][=N]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: COC1=CC(=C(C(=C1)Cl)[N+](=O)[O-])OC"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][O].[Cl].[Na+1].[OH1-1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][N][C][C][N][Branch2][=Branch1][C][C][C][=Branch1][C][=O][N][C][=N][C][=C][C][=C][Branch2][Ring2][#Branch2][O][C][=C][C][Branch2][Ring1][=Branch2][N][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][#Branch2][C][Branch1][C][C][Branch1][C][C][C][#N][=C][Ring1][O][=C][Branch1][C][F][C][=C][Ring2][Ring1][Branch1][Cl][N][=C][Ring2][Ring1][=N][S][Ring2][Ring1][S][C][C][Ring2][Ring2][#Branch2]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC(=O)NC1C(C(C(OC1OC2C(C(OC(C2O)CO)OCC(COP(=O)(O)O)OC3C(C(C(C(O3)CO)O)O)NC(=O)C)NC(=O)C)CO)O)O"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CCOC(=O)CSC1=CC(OC(=C1)C)C"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.2456"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: C1CC=C(C1)C(=O)O"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][N][C][C@@H1][Branch1][=Branch2][C][C][=C][C][=C][S][Ring1][Branch1][N][Branch1][C][C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C].[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][C][=C][C][Branch1][Ring1][C][#N][=C][C][Branch1][C][C][=C][Ring1][=Branch2][C][C][C][=Branch1][C][=O][O].[N][O]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a purine 2'-deoxyribonucleoside having O(6)-methylguanine as the nucleobase. It is functionally related to a guanine."
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[Cl][C][Cl].[O].[O][=C][Branch1][C][O-1][O-1].[K+1].[K+1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC(C)(C)[Si](C)(C)OC1CCCCC1NC2=CC(=CC(=C2)C(F)(F)F)Cl"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][C][=Branch1][C][=O][N][Branch2][Ring1][=Branch1][C][=C][C][=C][Branch1][C][N][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][O][C][=Branch1][C][=O][N][Ring2][Ring1][Ring1][C][C][C][C][C][C][C][C][C][S][C][C][C][C][Branch1][C][F][Branch1][C][F][C][Branch1][C][F][Branch1][C][F][F]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][S][Branch1][C][C][=O]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][=Branch1][C][=O][N][C][C][C][Branch2][Ring2][#Branch1][N][C][=C][C][Branch2][Ring1][#Branch2][C][=Branch1][C][=O][N][C][C@H1][Branch1][C][O][C][N][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][#Branch2][=N][C][=N][Ring2][Ring1][#Branch1][C][C][Ring2][Ring1][=C]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "0.0755"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: C=CC#CCCO"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.2481"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][C][=C][C][=C][Branch2][Ring1][=N][N][C][=Branch1][C][=O][C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N][C][=C][Ring2][Ring1][=Branch1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][=Branch1][C][=O][O][C][=C][C][Branch1][Ring1][C][Br][=C][C][=C][Ring1][Branch2][C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][O][C][Branch1][C][C][=O]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][=C][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][=Branch2][C].[N][C][C][N][C][C][C][Ring1][=Branch1][C][C][Ring1][=Branch1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][N][Branch1][Ring1][C][C][C][C].[Cl][C][Cl]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "0.0259"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: C1CSCCN1SNC(C2=CC=C(C=C2)Cl)C(F)(F)F"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a natural product found in Schisandra henryi with data available."
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][C][O][C][Ring1][Branch1].[C][C][O][C][=Branch1][C][=O][Cl].[C][N][C][C][O][C][C][Ring1][=Branch1].[C][O].[BH4-1].[Na+1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][Branch1][S][C][N][C][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=C][Ring1][P].[O][=C][Branch1][C][O][C][=C][C][=C][Branch1][C][Cl][C][C][=C][NH1][C][Ring1][#Branch2][=Ring1][Branch1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring2][C][N][C][=C][C][Branch1][=Branch2][N][C][C][C][C][C][Ring1][=Branch1][=C][C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][=N][Ring2][Ring1][Ring1][C][=C][Ring2][Ring1][#Branch2]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][C][O][C][Ring1][Branch1].[C][O].[C][O].[O].[Li+1].[OH1-1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC1C(CC(=O)C2=CC=CC(=C12)C)C(=O)O"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch1][Ring2][C][C][#N][C][C][Ring1][=Branch2]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][=Branch1][C][=O][N][C@H1][C][C][N][Branch2][Ring2][=Branch2][C][C][C@@H1][C][S][C][Branch2][Ring1][N][C][=C][C][=C][C][Branch1][C][Cl][=C][C][Branch1][#Branch2][N][C][C][C][O][C][C][Ring1][=Branch1][=C][Ring1][=C][NH1][Ring1][P][=N][Ring2][Ring1][=Branch1][C][Ring2][Ring1][=N]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][N][Branch1][Ring1][C][C][C][C].[C][C][N][=C][=N][C][C][C][N][Branch1][C][C][C].[Cl].[Cl].[O][N][N][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][=Branch2]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][N][Branch1][C][C][C][=O].[Cl][C][=N][C][Branch1][C][Cl][=N][C][Branch1][C][Cl][=N][Ring1][Branch2].[O][=C][Branch1][C][O-1][O].[Na+1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][=C][C][Branch1][N][N][C][C][C][Branch1][C][O][C][C][Ring1][#Branch1][=C][C][=C][Ring1][=N][N][C][C][C][Branch1][Branch2][C][C][O][C][C][Ring1][=Branch1][C][Ring1][#Branch2][=O]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CCC1=C(C(=O)C2=NC(=CN=C2N1CC(=O)NC3=C(C=C(C=C3)C(F)(F)F)Cl)C)N4CCN(CC4)C(=O)C5=NC=NC(=C5O)C"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "0.0806"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[O][=C][C][=C][N][=C][C][Branch2][Ring2][Branch1][C][N][=C][Branch1][O][N][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][N][Ring1][O][N][=Ring2][Ring1][#Branch1][=C][Ring2][Ring1][=N]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.2315"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: C(CN)C(CNCCN(CCN)CCN)NCCN(CCN)CCN"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][#N].[C][O].[Cl][C][Cl].[O][=C][Branch1][C][O-1][O-1].[K+1].[K+1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: C1CCN(CC1)CCC2=C(CC3=CC=CC=C32)CC4=CC=CC=C4.Cl"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[Br][C][C][O][C][=C][C][=C][Branch1][C][Br][N][=C][Ring1][#Branch1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][O][C][=C][C][=C][Branch1][=C][C][C][=C][Branch1][Branch1][C][C][C][=O][O][N][=Ring1][=Branch2][C][=C][Ring1][#C][O][C].[C][=C][C][=C][Branch2][Ring1][Ring2][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][C][N][C][C][Ring1][=Branch1][C][=C][Ring2][Ring1][Ring1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][C][C][C][C].[C][C][O].[C][C][O][C][Branch1][C][C][=O].[O][=S][=Branch1][C][=O][Branch1][C][O][O].[Na+1].[OH1-1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a natural product found in Arctotis stoechadifolia with data available."
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][N][Branch1][=Branch1][C][Branch1][C][C][C][C][Branch1][C][C][C].[Cl][C][Cl]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][O][C][=Branch1][C][=O][C][C][C][=Branch1][C][=O][N][C][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][N][Branch1][C][C][C][=O].[C][O][C][=C][C][=C][Branch1][=Branch1][C][=C][Ring1][=Branch1][Br][C][C][C][=N][NH1][C][=Ring1][Branch1][Ring1][O]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[Br][C][Branch1][C][Br][Branch1][C][Br][Br].[C][O][C][=C][C][=C][Branch2][Ring1][=C][C][O][C][=C][C][=C][Branch1][=C][C][=C][C][Branch1][Ring1][O][C][=C][C][=C][Ring1][Branch2][F][C][Branch1][Ring1][C][O][=C][Ring1][P][C][=C][Ring2][Ring1][=Branch2]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC1C(C(C(C(O1)OC2C(C(COC2OC(=O)[C@@]34CC[C@@]5(C(=CC[C@H]6[C@]5(CC[C@@H]7[C@@]6(CC[C@@H](C7(C)C)OC8C(C(C(C(O8)C(=O)OC)O)O)O)C)C)[C@@H]3CC(CC4)(C)C)C)O)O)O)O)OC9C(C(C(CO9)O)O)O"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][O][C][C][O][Ring1][=Branch1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[O][=C][Branch1][C][O][C][C][C][N][Branch1][#C][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][S]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.2054"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a ketone."
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][N][=C][=O].[C][O][C][=Branch1][C][=O][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][Branch1][C][Br][=C][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][N][Ring2][Ring1][C][C][C][C][C][N][C][C][Ring1][=Branch1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[O][=C][Branch1][C][O][C@][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][O][Ring1][#Branch1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][O][C@H1][Branch1][Ring1][C][O][C][Ring1][Branch2].[C][C][=C][C][=C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][C][=C][Ring1][#Branch2]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][O][C][C][O][Ring1][=Branch1].[Cl]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][O].[BH4-1].[Na+1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC1=CC(=C(C=C1)OC)NC(=O)C2=C(C=C(C=C2)Cl)Cl"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][O].[Cl].[Na+1].[OH1-1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][N][Branch1][C][C][C][=O].[H-1].[Na+1]"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.0183"
}
]
| |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][O][C][=Branch1][C][=O][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][N][C][C][Ring1][N].[Cl][C][=N][C][=C][C][=N][Ring1][=Branch1]"
}
]
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.