id
int64 0
71k
| molecules
dict | messages
listlengths 3
3
| ground_truth
stringclasses 1
value |
---|---|---|---|
70,800 | {
"selfies": [
"[C][I]",
"[O][=C][Branch1][C][O][C][Branch1][C][O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][N][C][=N][C][=C][N][=C][Ring1][=Branch1][S][Ring1][O]",
"[C][O][C][=Branch1][C][=O][C][Branch1][C][O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][N][C][=N][C][=C][N][=C][Ring1][=Branch1][S][Ring1][O]"
],
"smiles": [
"CI",
"O=C(O)C(O)c1ccc2c(c1)Nc1nccnc1S2",
"COC(=O)C(O)c1ccc2c(c1)Nc1nccnc1S2"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
70,801 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][C][C][Ring1][=Branch1]",
"[O][=C][Branch1][C][O][C][C][C][N][Branch1][#C][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][S]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch2][Ring1][=N][C][=Branch1][C][=O][C][C][C][N][Branch1][#C][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][S][C][C][Ring2][Ring1][Branch2]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCNCC1",
"O=C(O)C1CCN(C(=O)OCc2ccccc2)CC1",
"CC(C)(C)OC(=O)N1CCN(C(=O)C2CCN(C(=O)OCc3ccccc3)CC2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1CCOC1.ClCCl .",
"role": "assistant"
}
] | |
70,802 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch1][#C][C][=C][C][=C][Branch1][Branch1][C][#C][C][O][C][=C][Ring1][#Branch2][C][C][Ring1][S]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch1][#C][C][=C][C][=C][Branch1][Branch1][C][C][C][O][C][=C][Ring1][#Branch2][C][C][Ring1][S]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCN(c2ccc(C#CCO)cc2)CC1",
"CC(C)(C)OC(=O)N1CCN(c2ccc(CCCO)cc2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,803 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][C][F][C][Branch1][C][Br][=N][Ring1][Branch2]",
"[O][=C][Branch1][Ring1][O][O][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1]",
"[C][C][=C][C][=C][Branch1][C][F][C][Branch1][C][Br][=N+1][Ring1][Branch2][O-1]"
],
"smiles": [
"Cc1ccc(F)c(Br)n1",
"O=C(OO)c1cccc(Cl)c1",
"Cc1ccc(F)c(Br)[n+]1[O-]"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be ClC(Cl)Cl.O .",
"role": "assistant"
}
] | |
70,804 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C]",
"[O][=C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][Br]",
"[C][O][C][=Branch1][C][=O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Br]"
],
"smiles": [
"COC(=O)C(=O)c1ccccc1C",
"O=C1CCC(=O)N1Br",
"COC(=O)C(=O)c1ccccc1CBr"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "ClC(Cl)(Cl)Cl .",
"role": "assistant"
}
] | |
70,805 | {
"selfies": [
"[C][C][C][C][=C][Branch2][Ring1][=Branch1][C][C][=C][C][=C][Branch1][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][#N][C][=C][Ring1][=C][C][=Branch1][C][=O][N][Branch1][Branch2][C][C][=C][S][C][=Ring1][Branch1][C][=N][C][=N][N][Ring2][Ring1][=C][Ring1][Branch1]",
"[O][=C][Branch1][C][O-1][O]",
"[NH3+1][O]",
"[C][C][C][C][=C][Branch2][Ring1][S][C][C][=C][C][=C][Branch2][Ring1][Ring1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=N][O][C][=Branch1][C][=O][NH1][Ring1][=Branch1][C][=C][Ring2][Ring1][C][C][=Branch1][C][=O][N][Branch1][Branch2][C][C][=C][S][C][=Ring1][Branch1][C][=N][C][=N][N][Ring2][Ring2][C][Ring1][Branch1]"
],
"smiles": [
"CCCc1c(Cc2ccc(-c3ccccc3C#N)cc2)c(=O)n(-c2ccsc2)c2ncnn12",
"O=C([O-])O",
"[NH3+]O",
"CCCc1c(Cc2ccc(-c3ccccc3-c3noc(=O)[nH]3)cc2)c(=O)n(-c2ccsc2)c2ncnn12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CCOC(C)=O .",
"role": "assistant"
}
] | |
70,806 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][N][=C][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Branch1][=C][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][Cl][C][Ring2][Ring1][Branch1][=C][Ring2][Ring1][=Branch2]",
"[O][=C][Branch1][C][O][C][=C][C][=C][N][=C][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Branch1][=C][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][Cl][C][Ring2][Ring1][Branch1][=C][Ring2][Ring1][=Branch2]"
],
"smiles": [
"CCOC(=O)c1ccc2nc(Cc3ccccc3)n(Cc3ccc(Cl)cc3Cl)c2c1",
"O=C(O)c1ccc2nc(Cc3ccccc3)n(Cc3ccc(Cl)cc3Cl)c2c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,807 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][C][O][C][Ring1][=Branch1]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][#Branch2][O][S][Branch1][C][C][=Branch1][C][=O][=O][C][Ring1][#Branch2]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCC(O)C1",
"CS(=O)(=O)Cl",
"CC(C)(C)OC(=O)N1CCC(OS(C)(=O)=O)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CCOC(C)=O.ClCCl .",
"role": "assistant"
}
] | |
70,808 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][O][C][=C][C][=C][Branch1][#Branch1][C][=Branch1][C][=O][C][Br][C][=C][Ring1][#Branch2][Br]",
"[C][C][O][C][=Branch1][C][=O][C][O][C][=C][C][=C][Branch1][Ring2][C][C][Br][C][=C][Ring1][=Branch2][Br]"
],
"smiles": [
"CCOC(=O)COc1ccc(C(=O)CBr)cc1Br",
"CCOC(=O)COc1ccc(CCBr)cc1Br"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "O=C(O)C(F)(F)F .",
"role": "assistant"
}
] | |
70,809 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][C][C][Ring1][=Branch1]",
"[C][C][C][C][C][=N][C][=N][C][Branch1][C][Cl][=C][Ring1][#Branch1][Ring1][#Branch2]",
"[C][C][C][C][C][=N][C][=N][C][Branch2][Ring1][Branch2][N][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N][=C][Ring2][Ring1][Ring1][Ring2][Ring1][=Branch1]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCNCC1",
"CC1CCc2ncnc(Cl)c21",
"CC1CCc2ncnc(N3CCN(C(=O)OC(C)(C)C)CC3)c21"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CCOC(C)=O.CN1CCCC1=O .",
"role": "assistant"
}
] | |
70,810 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][C][C][Branch1][C][C][Cl]",
"[C][C][O][P][=Branch1][C][=O][Branch1][#Branch2][C][O][C][C][Branch1][C][O][C][O][O][C][C]",
"[C][C][O][P][=Branch1][C][=O][Branch2][Ring1][=Branch2][C][O][C][C][Branch1][C][O][C][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C][O][C][C]"
],
"smiles": [
"CC(C)(C)[Si](C)(C)Cl",
"CCOP(=O)(COCC(O)CO)OCC",
"CCOP(=O)(COCC(O)CO[Si](C)(C)C(C)(C)C)OCC"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be ClCCl .",
"role": "assistant"
}
] | |
70,811 | {
"selfies": [
"[C][S][C][C][C][N][C][=C][Branch2][Ring1][C][C][=Branch1][C][=O][N][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][C][=C][C][Branch1][#Branch2][C][N][C][C][O][C][C][Ring1][=Branch1][=C][C][=C][Ring1][=N][Ring2][Ring1][=N]",
"[O][=C][Branch1][Ring1][O][O][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1]",
"[C][S][=Branch1][C][=O][C][C][C][N][C][=C][Branch2][Ring1][C][C][=Branch1][C][=O][N][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][C][=C][C][Branch1][#Branch2][C][N][C][C][O][C][C][Ring1][=Branch1][=C][C][=C][Ring1][=N][Ring2][Ring1][=N]"
],
"smiles": [
"CSCCCn1cc(C(=O)NCc2ccc(Cl)cc2)c(=O)c2cc(CN3CCOCC3)ccc21",
"O=C(OO)c1cccc(Cl)c1",
"CS(=O)CCCn1cc(C(=O)NCc2ccc(Cl)cc2)c(=O)c2cc(CN3CCOCC3)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,812 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][C][Branch2][Ring1][=Branch2][N][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#Branch2][=C][Ring2][Ring1][Ring2]",
"[C][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][Branch2][Ring1][=Branch1][N][C][=Branch1][C][=O][N][C][=C][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][=Branch2][C][=C][Ring2][Ring1][Ring1]"
],
"smiles": [
"COC(=O)c1cccc(NC(=O)Nc2ccc(C(C)(C)C)cc2)c1",
"CC(C)(C)c1ccc(NC(=O)Nc2cccc(C(=O)O)c2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be c1ccncc1 .",
"role": "assistant"
}
] | |
70,813 | {
"selfies": [
"[N][C][C][C][Ring1][Ring1]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][C][=C][Ring1][=Branch1][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][C][=C][Ring1][=Branch1][S][=Branch1][C][=O][=Branch1][C][=O][N][C][C][C][Ring1][Ring1]"
],
"smiles": [
"NC1CC1",
"O=[N+]([O-])c1ccccc1S(=O)(=O)Cl",
"O=[N+]([O-])c1ccccc1S(=O)(=O)NC1CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,814 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][C][Branch1][C][Cl][=C][Branch2][Ring1][#C][O][C][=C][C][=C][Branch2][Ring1][Ring1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=C][Ring1][S][C][Branch1][C][Cl][=C][Ring2][Ring1][=Branch2]",
"[N][C][=C][C][Branch1][C][Cl][=C][Branch2][Ring1][#C][O][C][=C][C][=C][Branch2][Ring1][Ring1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=C][Ring1][S][C][Branch1][C][Cl][=C][Ring2][Ring1][=Branch2]"
],
"smiles": [
"O=[N+]([O-])c1cc(Cl)c(Oc2ccc(S(=O)(=O)c3ccc(Cl)cc3)cc2)c(Cl)c1",
"Nc1cc(Cl)c(Oc2ccc(S(=O)(=O)c3ccc(Cl)cc3)cc2)c(Cl)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "C1COCCO1 .",
"role": "assistant"
}
] | |
70,815 | {
"selfies": [
"[O][=C][Branch2][Ring1][=Branch2][N][C][C][C][=C][Branch1][C][F][C][=C][Branch1][C][Cl][C][Branch1][C][O][=C][Ring1][=Branch2][C][C][Ring1][=C][C][Branch1][C][F][Branch1][C][F][F]",
"[O][=S][=Branch1][C][=O][Branch1][P][O][S][=Branch1][C][=O][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][C][Branch1][C][F][Branch1][C][F][F]",
"[O][=C][Branch2][Ring2][=Branch2][N][C][C][C][=C][Branch1][C][F][C][=C][Branch1][C][Cl][C][Branch1][P][O][S][=Branch1][C][=O][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][S][C][C][Ring2][Ring1][Branch1][C][Branch1][C][F][Branch1][C][F][F]"
],
"smiles": [
"O=C(N1CCc2c(F)cc(Cl)c(O)c2CC1)C(F)(F)F",
"O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F",
"O=C(N1CCc2c(F)cc(Cl)c(OS(=O)(=O)C(F)(F)F)c2CC1)C(F)(F)F"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,816 | {
"selfies": [
"[C][O][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][C][=C][Ring1][=Branch2][N][C][=N][C][Branch1][=Branch1][C][Branch1][C][F][F][=C][Ring1][Branch2]",
"[C][O][C][=C][C][Branch1][C][N][=C][C][=C][Ring1][#Branch1][N][C][=N][C][Branch1][=Branch1][C][Branch1][C][F][F][=C][Ring1][Branch2]"
],
"smiles": [
"COc1cc([N+](=O)[O-])ccc1-n1cnc(C(F)F)c1",
"COc1cc(N)ccc1-n1cnc(C(F)F)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CO .",
"role": "assistant"
}
] | |
70,817 | {
"selfies": [
"[C][I]",
"[O][=C][C][=C][Branch1][C][I][C][=C][NH1][Ring1][#Branch1]",
"[C][N][C][=C][C][Branch1][C][I][=C][C][Ring1][#Branch1][=O]"
],
"smiles": [
"CI",
"O=c1cc(I)cc[nH]1",
"Cn1ccc(I)cc1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CCOC(C)=O.CN(C)C=O .",
"role": "assistant"
}
] | |
70,818 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][=C][S][C][=C][C][Branch1][C][O][=C][C][=C][Ring1][#Branch2][Ring1][#Branch1]",
"[O][=S][=Branch1][C][=O][Branch1][P][O][S][=Branch1][C][=O][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][C][Branch1][C][F][Branch1][C][F][F]",
"[C][C][O][C][=Branch1][C][=O][C][C][=C][S][C][=C][C][Branch1][P][O][S][=Branch1][C][=O][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][=C][C][=C][Ring1][P][Ring1][=C]"
],
"smiles": [
"CCOC(=O)Cc1csc2cc(O)ccc12",
"O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F",
"CCOC(=O)Cc1csc2cc(OS(=O)(=O)C(F)(F)F)ccc12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CC#N .",
"role": "assistant"
}
] | |
70,819 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][O][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]",
"[N][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1]"
],
"smiles": [
"CC(C)(C)OC(=O)OC(=O)OC(C)(C)C",
"Nc1ccc(O)cc1",
"CC(C)(C)OC(=O)Nc1ccc(O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "C1COCCO1.O .",
"role": "assistant"
}
] | |
70,820 | {
"selfies": [
"[C][O][C][=C][C][Branch1][=Branch1][C][Branch1][C][C][=O][=C][C][=C][Ring1][=Branch2][O][C][C][C][Cl]",
"[F][C][=C][C][=C][C][Branch1][=Branch2][C][C][C][N][C][C][Ring1][=Branch1][=N][NH1][C][Ring1][O][=C][Ring1][#C]",
"[C][O][C][=C][C][Branch1][=Branch1][C][Branch1][C][C][=O][=C][C][=C][Ring1][=Branch2][O][C][C][C][N][C][C][C][Branch1][P][C][=N][NH1][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch2][Ring1][#Branch1][C][C][Ring1][S]"
],
"smiles": [
"COc1cc(C(C)=O)ccc1OCCCCl",
"Fc1ccc2c(C3CCNCC3)n[nH]c2c1",
"COc1cc(C(C)=O)ccc1OCCCN1CCC(c2n[nH]c3cc(F)ccc23)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "O .",
"role": "assistant"
}
] | |
70,821 | {
"selfies": [
"[F][C][=C][C][=C][Branch1][Branch2][O][C][C][N][C][Ring1][Ring2][C][=C][Ring1][O]",
"[F][C][=C][C][=C][C][Branch1][C][Br][=N][Ring1][#Branch1]",
"[F][C][=C][C][=C][Branch2][Ring1][Branch1][O][C][C][N][Branch1][N][C][=C][C][=C][C][Branch1][C][Br][=N][Ring1][#Branch1][C][Ring1][O][C][=C][Ring2][Ring1][C]"
],
"smiles": [
"Fc1ccc(OC2CNC2)cc1",
"Fc1cccc(Br)n1",
"Fc1ccc(OC2CN(c3cccc(Br)n3)C2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CC(C)O .",
"role": "assistant"
}
] | |
70,822 | {
"selfies": [
"[C][C][C][C][Branch1][#Branch1][C][=Branch1][C][=O][O][C][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][N][=C][S][C][=C][Branch2][Ring1][C][C][Ring1][Branch1][=C][Ring1][#C][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][C][C][Ring1][=C]",
"[C][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][N][=C][S][C][=C][Branch2][Ring1][C][C][Ring1][Branch1][=C][Ring1][#C][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][C][C][Ring1][=C]"
],
"smiles": [
"CCCC(C(=O)OC)c1c(-c2ccccc2)nc2sc3c(c2c1-c1ccc(C)cc1)CCC3",
"CCCC(C(=O)O)c1c(-c2ccccc2)nc2sc3c(c2c1-c1ccc(C)cc1)CCC3"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
70,823 | {
"selfies": [
"[C][C][=Branch1][C][=O][C][C][C][O]",
"[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][C][C][Branch1][C][C][Cl]",
"[C][C][=Branch1][C][=O][C][C][C][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CC(=O)CCCO",
"CC(C)(C)[Si](C)(C)Cl",
"CC(=O)CCCO[Si](C)(C)C(C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CN(C)C=O .",
"role": "assistant"
}
] | |
70,824 | {
"selfies": [
"[O][=C][Branch1][C][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][O]",
"[O][C][C][C][N][C][Ring1][Branch1]",
"[O][=C][Branch1][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][N][C][C][C][Branch1][C][O][C][Ring1][=Branch1]"
],
"smiles": [
"O=C(O)Cc1ccccc1O",
"OC1CCNC1",
"O=C(Cc1ccccc1O)N1CCC(O)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CN(C)C=O .",
"role": "assistant"
}
] | |
70,825 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][Branch1][O][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][=C][C][=C][Branch1][Branch2][C][=C][C][=C][O][Ring1][Branch1][C][=C][Ring1][O]",
"[O][=C][Branch1][C][O][C][Branch1][O][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][=C][C][=C][Branch1][Branch2][C][=C][C][=C][O][Ring1][Branch1][C][=C][Ring1][O]"
],
"smiles": [
"CCOC(=O)C(CCc1ccccc1)Oc1ccc(-c2ccco2)cc1",
"O=C(O)C(CCc1ccccc1)Oc1ccc(-c2ccco2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,826 | {
"selfies": [
"[N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][Br]",
"[O][B][Branch1][C][O][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][F][=C][Ring1][Branch2]",
"[N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][F][=C][Ring1][Branch2]"
],
"smiles": [
"Nc1ccc(F)cc1Br",
"OB(O)c1ccc(Cl)c(F)c1",
"Nc1ccc(F)cc1-c1ccc(Cl)c(F)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "CCO.Cc1ccccc1 .",
"role": "assistant"
}
] | |
70,827 | {
"selfies": [
"[Br][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][C][=C][C][=C][N][=C][Ring1][=Branch1][C][N][C][=C][N][=C][Ring1][Branch1]",
"[C][=C][C][=C][Branch2][Ring1][Ring1][C][O][C][=C][C][=C][N][=C][Ring1][=Branch1][C][N][C][=C][N][=C][Ring1][Branch1][C][=C][Ring2][Ring1][Ring2]"
],
"smiles": [
"BrCc1ccccc1",
"Oc1cccnc1Cn1ccnc1",
"c1ccc(COc2cccnc2Cn2ccnc2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
70,828 | {
"selfies": [
"[C][O][C][C][O][C][C][O][C][=C][C][=C][C][Branch2][Ring1][Ring1][C][=N][C][Branch1][C][C][Branch1][#Branch1][C][=Branch1][C][=O][O][C][C][N][Ring1][#Branch2][=C][Ring1][S][O]",
"[C][O][C][C][O][C][C][O][C][=C][C][=C][C][Branch2][Ring1][C][C][=N][C][Branch1][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][N][Ring1][=Branch2][=C][Ring1][#C][O]"
],
"smiles": [
"COCCOCCOc1cccc(C2=NC(C)(C(=O)OC)CN2)c1O",
"COCCOCCOc1cccc(C2=NC(C)(C(=O)O)CN2)c1O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: CO .",
"role": "assistant"
}
] | |
70,829 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][=C][C][Branch1][C][Cl][=C][Branch2][Ring1][#C][O][C][=C][C][=C][Branch1][O][N][C][=Branch1][C][=O][C][Branch1][C][C][C][C][Branch1][Branch2][C][=C][C][=Branch1][C][=O][O][=C][Ring1][P][C][Branch1][C][Cl][=C][Ring2][Ring1][#Branch2]",
"[C][C][Branch1][C][C][C][=Branch1][C][=O][N][C][=C][C][=C][Branch2][Ring1][=Branch1][O][C][=C][Branch1][C][Cl][C][=C][Branch1][#Branch1][C][C][=Branch1][C][=O][O][C][=C][Ring1][O][Cl][C][=C][Ring2][Ring1][Ring1][C][=C][C][=Branch1][C][=O][O]"
],
"smiles": [
"COC(=O)Cc1cc(Cl)c(Oc2ccc(NC(=O)C(C)C)c(C=CC(=O)O)c2)c(Cl)c1",
"CC(C)C(=O)Nc1ccc(Oc2c(Cl)cc(CC(=O)O)cc2Cl)cc1C=CC(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be C1CCOC1 .",
"role": "assistant"
}
] | |
70,830 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][N][Branch1][P][C][C][=C][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][=Branch2][C][=Branch1][C][=O][C][Branch1][=C][N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][C][C]",
"[C][C][O][C][=Branch1][C][=O][C][N][Branch1][=N][C][C][=C][C][=C][C][Branch1][C][N][=C][Ring1][#Branch1][C][=Branch1][C][=O][C][Branch1][=C][N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][C][C]"
],
"smiles": [
"CCOC(=O)CN(Cc1cccc([N+](=O)[O-])c1)C(=O)C(NC(=O)c1ccccc1)C(C)C",
"CCOC(=O)CN(Cc1cccc(N)c1)C(=O)C(NC(=O)c1ccccc1)C(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
70,831 | {
"selfies": [
"[C][C][=C][Branch1][C][O][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][#Branch2][C]",
"[C][C][=C][Branch1][C][N][C][=C][C][Branch1][C][O][=C][Ring1][Branch2][C]"
],
"smiles": [
"Cc1c(O)ccc([N+](=O)[O-])c1C",
"Cc1c(N)ccc(O)c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,832 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch1][N][C][=Branch1][C][=O][C][C][=C][NH1][C][=Ring1][Branch1][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][P][O]",
"[C][I]",
"[C][N][C][=C][C][Branch2][Ring2][Ring2][C][=Branch1][C][=O][C][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Branch1][C][O][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][#C][=C][Ring2][Ring1][=Branch1]"
],
"smiles": [
"CC(C)(C)c1cc(C(=O)c2cc[nH]c2)cc(C(C)(C)C)c1O",
"CI",
"Cn1ccc(C(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
70,833 | {
"selfies": [
"[C][I]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][Branch1][C][Cl][=C][C][Branch1][C][Cl][=C][Ring1][Branch2][O]",
"[C][O][C][=C][Branch1][C][Cl][C][=C][Branch1][C][Cl][C][=C][Ring1][Branch2][N+1][=Branch1][C][=O][O-1]"
],
"smiles": [
"CI",
"O=[N+]([O-])c1cc(Cl)cc(Cl)c1O",
"COc1c(Cl)cc(Cl)cc1[N+](=O)[O-]"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: CN(C)C=O .",
"role": "assistant"
}
] | |
70,834 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][Branch1][C][O][C][C][Ring1][=Branch1][C][=Branch1][C][=O][O]",
"[C][O][C][=C][N][=C][Branch1][C][Cl][C][=C][C][=C][C][=C][Ring1][O][Ring1][=Branch1]",
"[C][O][C][=C][N][=C][Branch2][Ring1][#C][O][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][Ring1][#C][C][=C][C][=C][C][=C][Ring2][Ring1][#Branch2][Ring1][=Branch1]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CC(O)CC1C(=O)O",
"COc1cnc(Cl)c2ccccc12",
"COc1cnc(OC2CC(C(=O)O)N(C(=O)OC(C)(C)C)C2)c2ccccc12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CS(C)=O .",
"role": "assistant"
}
] | |
70,835 | {
"selfies": [
"[C][C][O][C][C][N][Ring1][=Branch1]",
"[C][C][C][Branch1][Ring1][C][#N][Branch1][=Branch1][C][=Branch1][C][=O][Cl][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][C][C][Branch1][Ring1][C][#N][Branch1][=N][C][=Branch1][C][=O][N][C][C][O][C][C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"C1COCCN1",
"CCC(C#N)(C(=O)Cl)c1ccccc1",
"CCC(C#N)(C(=O)N1CCOCC1)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,836 | {
"selfies": [
"[C][C][C][Branch1][C][C][C][Branch2][Ring1][=N][C][N][C][=C][C][=C][Branch1][P][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][=C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]",
"[O][=C][Branch1][C][O][C][C][C][Ring1][Ring1][C][=C][C][=C][C][=N][Ring1][=Branch1]",
"[C][C][C][Branch1][C][C][C][Branch2][Ring2][P][C][N][Branch2][Ring1][C][C][=Branch1][C][=O][C][C][C][Ring1][Ring1][C][=C][C][=C][C][=N][Ring1][=Branch1][C][=C][C][=C][Branch1][P][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][=C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CCC(C)C(CNc1ccc(O[Si](C)(C)C(C)(C)C)cc1)NC(=O)OC(C)(C)C",
"O=C(O)C1CC1c1ccccn1",
"CCC(C)C(CN(C(=O)C1CC1c1ccccn1)c1ccc(O[Si](C)(C)C(C)(C)C)cc1)NC(=O)OC(C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: CCOCC.ClCCl .",
"role": "assistant"
}
] | |
70,837 | {
"selfies": [
"[N][C][=C][C][=C][C][=C][Ring1][=Branch1][S][Branch1][C][N][=Branch1][C][=O][=O]",
"[O][=C][Branch1][C][O][C][=C][C][=C][Branch1][O][C][#C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=C]",
"[N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][=Branch1][C][=O][C][=C][C][=C][Branch1][O][C][#C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=C]"
],
"smiles": [
"Nc1ccccc1S(N)(=O)=O",
"O=C(O)c1ccc(C#Cc2ccccc2)cc1",
"NS(=O)(=O)c1ccccc1NC(=O)c1ccc(C#Cc2ccccc2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "c1ccccc1 .",
"role": "assistant"
}
] | |
70,838 | {
"selfies": [
"[O][=C][N][Branch2][Ring1][=Branch1][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][N][=C][Ring1][#Branch2][C][O][N][=C][C][Branch1][=Branch2][C][=C][C][=N][C][=C][Ring1][=Branch1][=C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=C][N][Ring2][Ring2][Ring1][Ring2][Ring1][Ring1]",
"[O][=C][C][=N][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][=C][Ring1][#Branch2][C][N][N][=C][C][Branch1][=Branch2][C][=C][C][=N][C][=C][Ring1][=Branch1][=C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=C][N][Ring2][Ring1][Ring1][C][Ring2][Ring1][=Branch1][=O]"
],
"smiles": [
"O=c1n(Cc2ccc(C(F)(F)F)nc2CO)nc2c(-c3ccncc3)c(-c3ccc(Cl)cc3)ccn12",
"O=Cc1nc(C(F)(F)F)ccc1Cn1nc2c(-c3ccncc3)c(-c3ccc(Cl)cc3)ccn2c1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,839 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][Branch1][C][O][C][Ring1][Branch1]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][N][=C][Ring1][=Branch1][F]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][Branch1][#C][O][C][=N][C][=C][C][=C][Ring1][=Branch1][N+1][=Branch1][C][=O][O-1][C][Ring1][=C]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CC(O)C1",
"O=[N+]([O-])c1cccnc1F",
"CC(C)(C)OC(=O)N1CC(Oc2ncccc2[N+](=O)[O-])C1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be C1CCOC1 .",
"role": "assistant"
}
] | |
70,840 | {
"selfies": [
"[O][=C][Branch1][C][Cl][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][Branch1][#Branch2][N][C][C][C][N][C][C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][Cl]",
"[O][=C][Branch2][Ring1][Branch2][N][C][C][C][N][Branch1][=N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][Cl]"
],
"smiles": [
"O=C(Cl)c1ccccc1",
"O=C(NC1CCNCC1)c1ccccc1Oc1ccc(Cl)cc1Cl",
"O=C(NC1CCN(C(=O)c2ccccc2)CC1)c1ccccc1Oc1ccc(Cl)cc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be ClCCl .",
"role": "assistant"
}
] | |
70,841 | {
"selfies": [
"[C][C][Branch1][C][C][Si][Branch1][=C][O][C][=C][C][=C][Branch1][Ring1][C][Br][C][=C][Ring1][Branch2][Branch1][=Branch1][C][Branch1][C][C][C][C][Branch1][C][C][C]",
"[C][C][=C][C][Branch2][Ring1][=C][C][=N][C][Branch2][Ring1][Ring2][C][=C][C][=C][Branch1][#Branch2][O][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][O][=N][O][Ring1][S][=N][NH1][Ring2][Ring1][Branch1]",
"[C][C][=C][C][Branch2][Ring1][=C][C][=N][C][Branch2][Ring1][Ring2][C][=C][C][=C][Branch1][#Branch2][O][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][O][=N][O][Ring1][S][=N][N][Ring2][Ring1][Branch1][C][C][=C][C][=C][Branch2][Ring1][=Branch1][O][Si][Branch1][=Branch1][C][Branch1][C][C][C][Branch1][=Branch1][C][Branch1][C][C][C][C][Branch1][C][C][C][C][=C][Ring1][P]"
],
"smiles": [
"CC(C)[Si](Oc1ccc(CBr)cc1)(C(C)C)C(C)C",
"Cc1cc(-c2nc(-c3ccc(OC(F)(F)F)cc3)no2)n[nH]1",
"Cc1cc(-c2nc(-c3ccc(OC(F)(F)F)cc3)no2)nn1Cc1ccc(O[Si](C(C)C)(C(C)C)C(C)C)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be C1CCOC1 .",
"role": "assistant"
}
] | |
70,842 | {
"selfies": [
"[C][O]",
"[O][=C][Branch1][C][Cl][C][=C][C][=C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][C][=C][Ring1][#Branch2]",
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][C][=C][Ring1][#Branch2]"
],
"smiles": [
"CO",
"O=C(Cl)c1ccc(S(=O)(=O)Cl)cc1",
"COC(=O)c1ccc(S(=O)(=O)Cl)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "O .",
"role": "assistant"
}
] | |
70,843 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=Branch1][C][=O][C][O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][C][=Ring1][N][NH1][Ring1][P]",
"[O][=C][Branch1][C][O][C][=C][C][=Branch1][C][=O][C][O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][C][=Ring1][N][NH1][Ring1][P]"
],
"smiles": [
"COC(=O)c1cc(=O)c2oc3ccc(Cl)cc3c(=O)c2[nH]1",
"O=C(O)c1cc(=O)c2oc3ccc(Cl)cc3c(=O)c2[nH]1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "[Na+].[OH-] .",
"role": "assistant"
}
] | |
70,844 | {
"selfies": [
"[C][N][C][C][N][C][C][Ring1][=Branch1]",
"[O][=C][Branch1][C][O][C][=C][N][Branch1][=Branch1][C][C][C][Ring1][Ring1][C][=C][C][Branch1][C][Cl][=C][Branch1][C][F][C][=C][Ring1][Branch2][C][Ring1][#C][=O]",
"[C][N][C][C][N][Branch2][Ring1][P][C][=C][C][=C][Branch1][=Branch1][C][=C][Ring1][=Branch1][F][C][=Branch1][C][=O][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][N][Ring1][=N][C][C][C][Ring1][Ring1][C][C][Ring2][Ring1][Branch2]"
],
"smiles": [
"CN1CCNCC1",
"O=C(O)c1cn(C2CC2)c2cc(Cl)c(F)cc2c1=O",
"CN1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CS(C)=O .",
"role": "assistant"
}
] | |
70,845 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch2][Branch1][Ring2][C][N][C][C][C][=C][Branch2][Ring1][=Branch1][S][C][Branch1][C][N][=C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][Ring1][P][C][N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][#Branch2][=O][C][=C][Ring2][Ring2][Ring2]",
"[C][O][C][=C][C][=C][Branch2][Ring2][Ring2][C][N][C][C][C][=C][Branch2][Ring1][=Branch1][S][C][Branch1][C][N][=C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][Ring1][P][C][N][C][=C][Ring2][Ring1][#Branch2]"
],
"smiles": [
"COc1ccc(CN2CCc3c(sc(N)c3C(=O)OC(C)(C)C)C2CN2C(=O)c3ccccc3C2=O)cc1",
"COc1ccc(CN2CCc3c(sc(N)c3C(=O)OC(C)(C)C)C2CN)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: CCO .",
"role": "assistant"
}
] | |
70,846 | {
"selfies": [
"[C][O][C][C][O]",
"[C][O][C][=C][C][Branch1][C][F][=C][Branch1][Ring1][C][#N][C][Branch1][C][F][=C][Ring1][#Branch2]",
"[C][O][C][C][O][C][=C][C][Branch1][Ring1][O][C][=C][C][Branch1][C][F][=C][Ring1][=Branch2][C][#N]"
],
"smiles": [
"COCCO",
"COc1cc(F)c(C#N)c(F)c1",
"COCCOc1cc(OC)cc(F)c1C#N"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
70,847 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][Ring1][C][O][C][Br]",
"[C][C][O][C][=C][C][=C][Branch1][#C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][Ring1][Branch1][=O][C][Branch1][C][O][=C][Ring1][P][O][C]",
"[C][C][O][C][=C][C][=C][Branch1][#C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][Ring1][Branch1][=O][C][Branch1][N][O][C][C][Branch1][C][C][Branch1][C][C][C][O][=C][Ring2][Ring1][#Branch1][O][C]"
],
"smiles": [
"CC(C)(CO)CBr",
"CCOc1ccc(-c2cccc3c2CCC3=O)c(O)c1OC",
"CCOc1ccc(-c2cccc3c2CCC3=O)c(OCC(C)(C)CO)c1OC"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CC#N .",
"role": "assistant"
}
] | |
70,848 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][C][Branch2][Ring2][=N][C][C][C][N][C][Branch1][=C][C][O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][=N][C][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][Ring1][=C][Ring2][Ring1][#Branch2][C][Ring2][Ring2][Ring1]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][C][Branch2][Ring2][Ring2][C][C][C][N][C][Branch1][=C][C][O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][=N][C][=C][Branch1][C][O][C][=C][C][=C][Ring1][#Branch1][Ring2][Ring1][Ring1][C][Ring2][Ring1][N]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCCC(CCCn2c(COc3ccc(Cl)cc3)nc3c(OCc4ccccc4)cccc32)C1",
"CC(C)(C)OC(=O)N1CCCC(CCCn2c(COc3ccc(Cl)cc3)nc3c(O)cccc32)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CCOC(C)=O .",
"role": "assistant"
}
] | |
70,849 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][O][C][#C][Si][Branch1][C][C][Branch1][C][C][C][C][=N][Ring1][N]",
"[C][#C][C][=C][C][=C][Branch1][C][C][N][=C][Ring1][#Branch1]"
],
"smiles": [
"Cc1ccc(C#C[Si](C)(C)C)cn1",
"C#Cc1ccc(C)nc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
70,850 | {
"selfies": [
"[Cl][C][=C][C][=C][C][Branch1][Ring1][C][Br][=C][Ring1][Branch2]",
"[N][C][=N][C][=C][C][=C][Ring1][=Branch1][O]",
"[N][C][=N][C][=C][C][=C][Ring1][=Branch1][O][C][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1]"
],
"smiles": [
"Clc1cccc(CBr)c1",
"Nc1ncccc1O",
"Nc1ncccc1OCc1cccc(Cl)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: CCOC(C)=O.O .",
"role": "assistant"
}
] | |
70,851 | {
"selfies": [
"[C][=C][C][O][C][=C][C][Branch1][C][O][=C][C][=Branch1][Ring2][=C][Ring1][#Branch1][O][C][Branch1][C][C][Branch1][C][C][C][C][Ring1][=Branch2][=O]",
"[C][I]",
"[C][=C][C][O][C][=C][C][Branch1][Ring1][O][C][=C][C][=Branch1][Ring2][=C][Ring1][Branch2][O][C][Branch1][C][C][Branch1][C][C][C][C][Ring1][=Branch2][=O]"
],
"smiles": [
"C=CCOc1cc(O)c2c(c1)OC(C)(C)CC2=O",
"CI",
"C=CCOc1cc(OC)c2c(c1)OC(C)(C)CC2=O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: CCOC(C)=O.CN(C)C=O .",
"role": "assistant"
}
] | |
70,852 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][C][Br]",
"[O][=C][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1]",
"[C][C][O][C][=Branch1][C][=O][C][C][C][O][C][=C][C][=C][Branch1][Ring1][C][=O][C][=C][Ring1][Branch2]"
],
"smiles": [
"CCOC(=O)CCCBr",
"O=Cc1ccc(O)cc1",
"CCOC(=O)CCCOc1ccc(C=O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CC#N .",
"role": "assistant"
}
] | |
70,853 | {
"selfies": [
"[Br][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][#C][N][C][=C][Branch1][=C][C][=C][C][Branch1][C][C][=C][C][=C][Ring1][#Branch1][Ring1][#Branch2][C][N][Branch1][C][C][C][C][Ring1][=C]",
"[C][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][=C][Branch1][=C][N][Ring1][=Branch1][C][#C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][N][Branch1][C][C][C][Ring1][S]"
],
"smiles": [
"Brc1ccccc1",
"C#Cn1c2c(c3cc(C)ccc31)CN(C)CC2",
"Cc1ccc2c(c1)c1c(n2C#Cc2ccccc2)CCN(C)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "O .",
"role": "assistant"
}
] | |
70,854 | {
"selfies": [
"[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[C][N][C][Branch1][Ring1][C][O][=C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][C][=C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Ring1][N][C][Ring2][Ring1][=Branch2][=O]",
"[C][N][C][Branch1][O][C][O][S][Branch1][C][C][=Branch1][C][=O][=O][=C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][C][=C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Ring1][N][C][Ring2][Ring1][=N][=O]"
],
"smiles": [
"CS(=O)(=O)Cl",
"Cn1c(CO)c(-c2ccc(Cl)cc2)c2ccn(Cc3ccccc3)c2c1=O",
"Cn1c(COS(C)(=O)=O)c(-c2ccc(Cl)cc2)c2ccn(Cc3ccccc3)c2c1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,855 | {
"selfies": [
"[C][C][C][C][C][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][Ring1][#Branch1]",
"[O][=S][Branch1][C][Cl][Cl]",
"[C][C][C][C][C][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][Cl][C][Ring1][#Branch1]"
],
"smiles": [
"CCCCCC1CC(C(=O)O)C1",
"O=S(Cl)Cl",
"CCCCCC1CC(C(=O)Cl)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "c1ccccc1 .",
"role": "assistant"
}
] | |
70,856 | {
"selfies": [
"[N][C][=C][C][=C][C][=C][Ring1][=Branch1][F]",
"[O][=C][Branch1][C][Cl][C][C][Cl]",
"[O][=C][Branch1][Ring2][C][C][Cl][N][C][=C][C][=C][C][=C][Ring1][=Branch1][F]"
],
"smiles": [
"Nc1ccccc1F",
"O=C(Cl)CCCl",
"O=C(CCCl)Nc1ccccc1F"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl.O .",
"role": "assistant"
}
] | |
70,857 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Branch1][=Branch1][C][Branch1][C][N][=O][NH1][C][Ring1][Branch2][=C][Ring1][N]",
"[N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][=Branch2][NH1][Ring1][N]"
],
"smiles": [
"CCOC(=O)c1ccc2cc(C(N)=O)[nH]c2c1",
"NC(=O)c1cc2ccc(C(=O)O)cc2[nH]1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
70,858 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][N][C][O]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][N][=C][Ring1][#Branch2][Cl]",
"[C][C][Branch1][C][C][Branch1][Ring1][C][O][N][C][=N][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][N+1][=Branch1][C][=O][O-1]"
],
"smiles": [
"CC(C)(N)CO",
"O=[N+]([O-])c1cc(C(F)(F)F)cnc1Cl",
"CC(C)(CO)Nc1ncc(C(F)(F)F)cc1[N+](=O)[O-]"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be CCOC(C)=O.CN(C)C=O .",
"role": "assistant"
}
] | |
70,859 | {
"selfies": [
"[N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Branch1][C][Cl][C][=C][Ring1][#Branch2][F]",
"[N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][Branch1][Ring1][C][O][=C][Branch1][C][Cl][C][=C][Ring1][=Branch2][F]"
],
"smiles": [
"NS(=O)(=O)c1cc(C(=O)O)c(Cl)cc1F",
"NS(=O)(=O)c1cc(CO)c(Cl)cc1F"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
70,860 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][N][Branch1][C][C][C][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring1][P][N][C][Branch1][#Branch1][C][C][Branch1][C][C][C][C][C][=C][Branch1][=N][C][=C][C][=C][Branch1][Ring1][O][C][N][=C][Ring1][Branch2][O][C][=Ring1][=N][C][C][=C][Ring2][Ring1][#Branch2]",
"[C][O][C][=C][C][=C][Branch2][Branch1][C][C][=C][C][Branch2][Ring2][Ring2][C][Branch1][#Branch1][C][C][Branch1][C][C][C][N][C][=C][C][=C][Branch1][S][C][=Branch1][C][=O][N][Branch1][C][C][C][C][C][=Branch1][C][=O][O][C][=C][Ring1][#C][=C][Branch1][C][C][O][Ring2][Ring1][O][C][=N][Ring2][Ring1][P]"
],
"smiles": [
"CCOC(=O)CCN(C)C(=O)c1ccc(NC(CC(C)C)c2cc(-c3ccc(OC)nc3)oc2C)cc1",
"COc1ccc(-c2cc(C(CC(C)C)Nc3ccc(C(=O)N(C)CCC(=O)O)cc3)c(C)o2)cn1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,861 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][C][Branch1][Branch2][C][C][C][Branch1][C][N][=O][N][C][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring1][Branch2][N][C][Branch1][=Branch2][C][N][C][=C][N][=C][Ring1][Branch1][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][=C][Ring2][Ring1][Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[N][C][=Branch1][C][=O][C][C][C][Branch2][Ring2][P][N][C][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring1][Branch2][N][C][Branch1][=Branch2][C][N][C][=C][N][=C][Ring1][Branch1][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][=C][Ring2][Ring1][Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O]"
],
"smiles": [
"CC(C)(C)OC(=O)C(CCC(N)=O)NC(=O)c1ccc(NC(Cn2ccnc2)c2ccc(F)cc2)cc1-c1ccccc1",
"NC(=O)CCC(NC(=O)c1ccc(NC(Cn2ccnc2)c2ccc(F)cc2)cc1-c1ccccc1)C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "O=C(O)C(F)(F)F .",
"role": "assistant"
}
] | |
70,862 | {
"selfies": [
"[C][C][Branch1][C][C][O][B][Branch2][Ring1][Ring2][B][O][C][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][O][Ring1][=Branch2][O][C][Ring1][#C][Branch1][C][C][C]",
"[C][C][S][C][=C][C][Branch1][C][Br][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][O]",
"[C][C][S][C][=C][C][Branch2][Ring1][Ring2][B][O][C][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][O][Ring1][=Branch2][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring2][Ring1][Ring1]"
],
"smiles": [
"CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C",
"CCSc1cc(Br)cc(C(F)(F)F)c1",
"CCSc1cc(B2OC(C)(C)C(C)(C)O2)cc(C(F)(F)F)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CS(C)=O .",
"role": "assistant"
}
] | |
70,863 | {
"selfies": [
"[O][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][C][=C][C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][C][=C][Ring1][=C][C][Ring2][Ring1][C]",
"[O][=C][Branch1][C][O][C][C][C][C][=C][C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][C][=C][Ring1][=C][C][Ring2][Ring1][C]"
],
"smiles": [
"O=C(OCc1ccccc1)C1CCc2cc(OCc3ccccc3)ccc2C1",
"O=C(O)C1CCc2cc(OCc3ccccc3)ccc2C1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CCO.O .",
"role": "assistant"
}
] | |
70,864 | {
"selfies": [
"[C][S][=Branch1][C][=O][=Branch1][C][=O][N][C][C][C][C][C][C][=Branch1][C][=O][O]",
"[N][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][N][C][C][C][C][C][C][=Branch1][C][=O][N][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CS(=O)(=O)NCCCCCC(=O)O",
"Nc1ccccc1",
"CS(=O)(=O)NCCCCCC(=O)Nc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
70,865 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][C][=C][Ring1][#Branch2]",
"[O][C][C][C][C][Ring1][Ring2]",
"[C][C][=C][C][=C][Branch1][#C][S][=Branch1][C][=O][=Branch1][C][=O][O][C][C][C][C][Ring1][Ring2][C][=C][Ring1][=C]"
],
"smiles": [
"Cc1ccc(S(=O)(=O)Cl)cc1",
"OC1CCC1",
"Cc1ccc(S(=O)(=O)OC2CCC2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "c1ccncc1 .",
"role": "assistant"
}
] | |
70,866 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][N][C][N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch2][Ring1][#Branch1][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N][C][Ring2][Ring1][#Branch1][=O]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][Branch1][C][C][Ring1][=Branch1][C][=Branch1][C][=O][N][Branch1][#Branch1][C][C][=Branch1][C][=O][O][C][N][Ring1][N][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"COC(=O)CN1CN(c2ccccc2)C2(CCN(C(=O)OC(C)(C)C)CC2)C1=O",
"CC(C)(C)OC(=O)N1CCC2(CC1)C(=O)N(CC(=O)O)CN2c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: O .",
"role": "assistant"
}
] | |
70,867 | {
"selfies": [
"[C][C][C][Branch1][C][C][C][C][=C][C][=C][Branch1][=N][C][=C][C][=C][Branch1][Ring1][O][C][C][=C][Ring1][Branch2][C][=C][Ring1][=C]",
"[C][C][C][Branch1][C][C][C][C][=C][C][=C][Branch1][N][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1][C][=C][Ring1][=N]"
],
"smiles": [
"CCC(C)Cc1ccc(-c2ccc(OC)cc2)cc1",
"CCC(C)Cc1ccc(-c2ccc(O)cc2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,868 | {
"selfies": [
"[C][C][=N][C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][=C][C][=C][Ring1][N][N+1][=Branch1][C][=O][O-1]",
"[C][C][=N][C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][=C][C][=C][Ring1][N][N]"
],
"smiles": [
"Cc1nc(N2CCOCC2)ccc1[N+](=O)[O-]",
"Cc1nc(N2CCOCC2)ccc1N"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CCO.O .",
"role": "assistant"
}
] | |
70,869 | {
"selfies": [
"[C][C][=Branch1][C][=O][N][C][=C][C][=C][Branch2][Ring1][Ring1][S][=Branch1][C][=O][=Branch1][C][=O][N][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][C]",
"[N][C][=C][C][=C][Branch2][Ring1][Ring1][S][=Branch1][C][=O][=Branch1][C][=O][N][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][C]"
],
"smiles": [
"CC(=O)Nc1ccc(S(=O)(=O)NCCc2ccccc2)cc1",
"Nc1ccc(S(=O)(=O)NCCc2ccccc2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "C1COCCO1 .",
"role": "assistant"
}
] | |
70,870 | {
"selfies": [
"[C][N][C][C][N][Branch1][C][C][C][=Branch1][C][=O][O][C][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O][C]",
"[O][=C][Branch1][C][Cl][N][C][C][O][C][C][Ring1][=Branch1]",
"[C][O][C][=Branch1][C][=O][C][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][=Branch1][C][=O][N][Branch1][C][C][C][C][N][Branch1][C][C][C][=Branch1][C][=O][N][C][C][O][C][C][Ring1][=Branch1]"
],
"smiles": [
"CNCCN(C)C(=O)OC(Cc1ccccc1)C(=O)OC",
"O=C(Cl)N1CCOCC1",
"COC(=O)C(Cc1ccccc1)OC(=O)N(C)CCN(C)C(=O)N1CCOCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,871 | {
"selfies": [
"[C][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][=Branch2][O]",
"[C][I]",
"[C][O][C][=C][Branch1][=Branch1][C][Branch1][C][C][=O][C][=C][C][=C][Ring1][=Branch2][N+1][=Branch1][C][=O][O-1]"
],
"smiles": [
"CC(=O)c1cccc([N+](=O)[O-])c1O",
"CI",
"COc1c(C(C)=O)cccc1[N+](=O)[O-]"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
70,872 | {
"selfies": [
"[Cl][C][C][C][Br]",
"[O][C][C][C][C][C][N][C][C][Ring1][=Branch1]",
"[O][C][C][C][C][C][N][Branch1][Branch1][C][C][C][Cl][C][C][Ring1][#Branch2]"
],
"smiles": [
"ClCCCBr",
"OCCC1CCNCC1",
"OCCC1CCN(CCCCl)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CC(C)=O .",
"role": "assistant"
}
] | |
70,873 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][Branch1][C][N][=C][Ring1][#Branch2]",
"[O][=C][Branch1][=C][O][C][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][C][Branch1][C][F][Branch1][C][F][F]",
"[C][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][Branch1][=C][N][C][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][S]"
],
"smiles": [
"Cc1ccc(C(=O)O)c(N)c1",
"O=C(OC(=O)C(F)(F)F)C(F)(F)F",
"Cc1ccc(C(=O)O)c(NC(=O)C(F)(F)F)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: C1COCCO1 .",
"role": "assistant"
}
] | |
70,874 | {
"selfies": [
"[O][=C][Branch2][Ring1][=Branch1][N][C][=N][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][S][Ring1][N][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[N][C][=C][C][=C][N][=C][Branch1][=C][N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][S][C][Ring1][=C][=C][Ring2][Ring1][C]"
],
"smiles": [
"O=C(Nc1nc2ccc([N+](=O)[O-])cc2s1)c1ccccc1",
"Nc1ccc2nc(NC(=O)c3ccccc3)sc2c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CCOC(C)=O .",
"role": "assistant"
}
] | |
70,875 | {
"selfies": [
"[Cl][C][C][N][C][C][C][C][Ring1][Branch1]",
"[O][C][=C][C][=C][Branch2][Ring1][S][C][=Branch2][Ring1][Ring2][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][F][Branch1][C][F][F][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][Branch2]",
"[F][C][Branch1][C][F][Branch1][C][F][C][=Branch2][Ring1][S][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][Branch1][O][O][C][C][N][C][C][C][C][Ring1][Branch1][C][=C][Ring1][=C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"ClCCN1CCCC1",
"Oc1ccc(C(=C(c2ccccc2)C(F)(F)F)c2ccccc2)cc1",
"FC(F)(F)C(=C(c1ccccc1)c1ccc(OCCN2CCCC2)cc1)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: Cc1ccccc1C .",
"role": "assistant"
}
] | |
70,876 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][Branch1][C][N][C][Branch1][C][N][=C][Ring1][Branch2]",
"[C][C][N][Branch2][Branch1][=Branch2][C][C][C][C][Branch2][Ring2][C][N][C][=C][C][=C][Branch1][P][N][C][C][=C][C][=C][Branch1][Ring1][O][C][C][=C][Ring1][Branch2][O][C][N][=C][N][=C][Ring2][Ring1][C][Ring2][Ring1][Branch1][C][O][C][Branch1][C][C][Branch1][C][C][O][C][Ring2][Ring1][#C][Ring1][#Branch1][C][C][C][Branch1][Branch2][C][C][C][=Branch1][C][=O][O][C][Ring1][=Branch2]",
"[C][C][N][Branch2][Branch1][=Branch2][C][C][C][C][Branch2][Ring2][C][N][C][=C][C][=C][Branch1][P][N][C][C][=C][C][=C][Branch1][Ring1][O][C][C][=C][Ring1][Branch2][O][C][N][=C][N][=C][Ring2][Ring1][C][Ring2][Ring1][Branch1][C][O][C][Branch1][C][C][Branch1][C][C][O][C][Ring2][Ring1][#C][Ring1][#Branch1][C][C][C][Branch2][Ring1][O][C][C][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#Branch2][N][C][Ring2][Ring1][Ring2]"
],
"smiles": [
"CC(C)(C)c1ccc(N)c(N)c1",
"CCN(CC1CC(n2ccc3c(NCc4ccc(OC)cc4OC)ncnc32)C2OC(C)(C)OC12)C1CC(CCC(=O)O)C1",
"CCN(CC1CC(n2ccc3c(NCc4ccc(OC)cc4OC)ncnc32)C2OC(C)(C)OC12)C1CC(CCC(=O)Nc2ccc(C(C)(C)C)cc2N)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
70,877 | {
"selfies": [
"[C][C][=C][Branch1][#Branch1][C][C][=Branch1][C][=O][O][C][=C][C][=C][C][Branch1][C][F][=C][C][Ring1][#Branch1][=C][Ring1][#C][C][=Branch1][C][=O][C][=C][C][=C][Branch1][=Branch2][S][Branch1][C][C][=Branch1][C][=O][=O][C][=C][Ring1][#Branch2]",
"[C][C][=C][Branch1][#Branch1][C][C][=Branch1][C][=O][O][C][=C][C][=C][C][Branch1][C][F][=C][C][Ring1][#Branch1][=C][Ring1][#C][C][Branch1][C][O][C][=C][C][=C][Branch1][=Branch2][S][Branch1][C][C][=Branch1][C][=O][=O][C][=C][Ring1][#Branch2]"
],
"smiles": [
"Cc1c(CC(=O)O)cc2ccc(F)cc2c1C(=O)c1ccc(S(C)(=O)=O)cc1",
"Cc1c(CC(=O)O)cc2ccc(F)cc2c1C(O)c1ccc(S(C)(=O)=O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
70,878 | {
"selfies": [
"[C][C][I]",
"[O][C][=C][C][=C][Branch1][C][Br][C][Branch1][C][Cl][=C][Ring1][Branch2]",
"[C][C][O][C][=C][C][=C][Branch1][C][Br][C][Branch1][C][Cl][=C][Ring1][Branch2]"
],
"smiles": [
"CCI",
"Oc1ccc(Br)c(Cl)c1",
"CCOc1ccc(Br)c(Cl)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
70,879 | {
"selfies": [
"[C][O][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][C][=C][Ring1][=Branch2][F]",
"[O][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2]",
"[C][O][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][C][=C][Ring1][=Branch2][O][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2]"
],
"smiles": [
"COc1cc([N+](=O)[O-])ccc1F",
"Oc1ccc(Cl)c(Cl)c1",
"COc1cc([N+](=O)[O-])ccc1Oc1ccc(Cl)c(Cl)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be O .",
"role": "assistant"
}
] | |
70,880 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch1][Ring1][O][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][O][F]",
"[O][=S][Branch1][C][Cl][Cl]",
"[C][O][C][=C][C][=C][Branch1][Ring1][O][C][C][Branch1][=Branch1][C][=Branch1][C][=O][Cl][=C][Ring1][O][F]"
],
"smiles": [
"COc1ccc(OC)c(C(=O)O)c1F",
"O=S(Cl)Cl",
"COc1ccc(OC)c(C(=O)Cl)c1F"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be ClCCl .",
"role": "assistant"
}
] | |
70,881 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][NH1][C][Ring1][P][=O]",
"[C][I]",
"[C][C][O][C][=Branch1][C][=O][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][N][Branch1][C][C][C][Ring2][Ring1][C][=O]"
],
"smiles": [
"CCOC(=O)c1c(-c2ccccc2)c2cc(Cl)ccc2[nH]c1=O",
"CI",
"CCOC(=O)c1c(-c2ccccc2)c2cc(Cl)ccc2n(C)c1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be CN(C)C=O .",
"role": "assistant"
}
] | |
70,882 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][Branch1][C][C][Branch1][C][C][C][N][C][=Branch1][C][=O][C][=N][C][Branch1][Ring1][C][#N][=C][C][Branch2][Ring1][=N][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][Ring1][=N][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring2][Ring1][#Branch2][O]",
"[C][C][Branch1][C][C][Branch2][Branch1][Ring2][C][N][C][=Branch1][C][=O][C][=N][C][Branch1][Ring1][C][#N][=C][C][Branch2][Ring1][=N][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][Ring1][=N][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring2][Ring1][#Branch2][O][C][=Branch1][C][=O][O]"
],
"smiles": [
"COC(=O)C(C)(C)CNC(=O)c1nc(C#N)c2c(cc(-c3ccccc3)c(=O)n2Cc2ccccc2)c1O",
"CC(C)(CNC(=O)c1nc(C#N)c2c(cc(-c3ccccc3)c(=O)n2Cc2ccccc2)c1O)C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CO .",
"role": "assistant"
}
] | |
70,883 | {
"selfies": [
"[C][N][Branch1][C][C][C][C][C][C][C][C][C][C][C][C][C][N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][#Branch2][=O]",
"[C][N][Branch1][C][C][C][C][C][C][C][C][C][C][C][C][C][N]"
],
"smiles": [
"CN(C)CCCCCCCCCCCN1C(=O)c2ccccc2C1=O",
"CN(C)CCCCCCCCCCCN"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "CCO.Cl .",
"role": "assistant"
}
] | |
70,884 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch2][Ring1][=Branch1][C][=N][C][C][Branch1][C][O][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][O][Ring1][=N][C][=C][Ring2][Ring1][Ring1]",
"[O][=C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][O][C][=C][C][=C][Branch2][Ring2][Ring2][C][=N][C][C][Branch1][#C][O][C][=Branch1][C][=O][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][O][Ring2][Ring1][=Branch1][C][=C][Ring2][Ring1][N]"
],
"smiles": [
"COc1ccc(C2=NCC(O)C(c3ccccc3)O2)cc1",
"O=C=Nc1ccccc1",
"COc1ccc(C2=NCC(OC(=O)Nc3ccccc3)C(c3ccccc3)O2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "ClCCCl .",
"role": "assistant"
}
] | |
70,885 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][S][O][C][=C][C][Branch1][C][F][=C][C][Branch1][C][Br][=C][Ring1][Branch2][C][C][Ring1][#C]",
"[C][N][Branch1][C][C][C][=O]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][P][O][C][=C][C][Branch1][C][F][=C][C][Branch1][Ring1][C][=O][=C][Ring1][=Branch2][C][C][Ring1][S]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCC(Oc2cc(F)cc(Br)c2)CC1",
"CN(C)C=O",
"CC(C)(C)OC(=O)N1CCC(Oc2cc(F)cc(C=O)c2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
70,886 | {
"selfies": [
"[C][C][C][N][C][=C][Branch2][Ring1][C][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][C][=C][Ring1][=Branch2][Ring1][N][C][C][C][C][Ring1][#C]",
"[C][C][C][N][C][=C][Branch1][=C][C][=C][C][Branch1][C][N][=C][C][=C][Ring1][#Branch1][Ring1][#Branch2][C][C][C][C][Ring1][=N]"
],
"smiles": [
"CCCn1c2c(c3cc([N+](=O)[O-])ccc31)CCCC2",
"CCCn1c2c(c3cc(N)ccc31)CCCC2"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CCOC(C)=O .",
"role": "assistant"
}
] | |
70,887 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Br]",
"[N][C][=Branch1][C][=O][C][=C][Branch2][Ring1][C][N][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][S][C][=C][Ring1][S][C][C][N][C][Ring1][=Branch1]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][N][C][C][C][=C][Branch2][Ring1][#C][S][C][Branch2][Ring1][C][N][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][=C][Ring1][S][C][Branch1][C][N][=O][C][Ring2][Ring1][#Branch1]"
],
"smiles": [
"CC(C)(C)OC(=O)NCCCBr",
"NC(=O)c1c(NC(=O)Nc2ccc(Cl)cc2)sc2c1CCNC2",
"CC(C)(C)OC(=O)NCCCN1CCc2c(sc(NC(=O)Nc3ccc(Cl)cc3)c2C(N)=O)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CN(C)C=O .",
"role": "assistant"
}
] | |
70,888 | {
"selfies": [
"[C][C][Branch1][C][C][N][Branch1][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][=Branch2][O]",
"[O][=C][Branch1][C][Cl][C][Cl]",
"[C][C][Branch1][C][C][N][Branch1][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][=Branch2][O][C][=Branch1][C][=O][C][Cl]"
],
"smiles": [
"CC(C)N(C)C1c2ccccc2CC1O",
"O=C(Cl)CCl",
"CC(C)N(C)C1c2ccccc2CC1OC(=O)CCl"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: ClCCl.O .",
"role": "assistant"
}
] | |
70,889 | {
"selfies": [
"[C][N][Branch1][C][C][C][C][O][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=N][Ring1][=Branch2]",
"[C][N][Branch1][C][C][C][C][O][C][=C][C][=C][Branch1][C][N][C][=N][Ring1][#Branch1]"
],
"smiles": [
"CN(C)CCOc1ccc([N+](=O)[O-])cn1",
"CN(C)CCOc1ccc(N)cn1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
70,890 | {
"selfies": [
"[C][C][C][C][Branch1][#Branch1][C][=Branch1][C][=O][O][C][C][=C][Branch1][C][C][N][=C][Branch1][=Branch2][N][C][C][C][C][C][Ring1][=Branch1][N][=C][Ring1][=N][N][C][C][C][C][C][Ring1][=Branch1]",
"[C][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Branch1][C][C][N][=C][Branch1][=Branch2][N][C][C][C][C][C][Ring1][=Branch1][N][=C][Ring1][=N][N][C][C][C][C][C][Ring1][=Branch1]"
],
"smiles": [
"CCCC(C(=O)OC)c1c(C)nc(N2CCCCC2)nc1N1CCCCC1",
"CCCC(C(=O)O)c1c(C)nc(N2CCCCC2)nc1N1CCCCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: CO .",
"role": "assistant"
}
] | |
70,891 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][N][=C][NH1][C][Ring1][Branch1][=C][Ring1][=Branch2]",
"[N][C][=C][C][=C][N][=C][NH1][C][Ring1][Branch1][=C][Ring1][=Branch2]"
],
"smiles": [
"O=[N+]([O-])c1ccc2nc[nH]c2c1",
"Nc1ccc2nc[nH]c2c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
70,892 | {
"selfies": [
"[C][#C][C][C][Branch1][=N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][Cl][C][Branch1][C][O][Branch1][=Branch1][C][Branch1][C][C][=O][C][=C][C][=C][N][=C][Ring1][=Branch1]",
"[C][#C][C][C][Branch1][=N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][Cl][C][Branch1][C][O][Branch1][=Branch2][C][=C][C][=C][N][=C][Ring1][=Branch1][C][Branch1][C][C][O]"
],
"smiles": [
"C#CCC(c1ccc(Cl)cc1Cl)C(O)(C(C)=O)c1cccnc1",
"C#CCC(c1ccc(Cl)cc1Cl)C(O)(c1cccnc1)C(C)O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,893 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][=Branch1][C][=C][Ring1][=Branch1][Br][NH1][C][=Branch1][C][=O][N][Ring1][=Branch2][C][C][C][N][C][C][Ring1][=Branch1]",
"[O][=C][C][C][O][C][C][Ring1][=Branch1]",
"[C][C][=C][C][=C][Branch1][=Branch1][C][=C][Ring1][=Branch1][Br][NH1][C][=Branch1][C][=O][N][Ring1][=Branch2][C][C][C][N][Branch1][=Branch2][C][C][C][O][C][C][Ring1][=Branch1][C][C][Ring1][N]"
],
"smiles": [
"Cc1cc2c(cc1Br)[nH]c(=O)n2C1CCNCC1",
"O=C1CCOCC1",
"Cc1cc2c(cc1Br)[nH]c(=O)n2C1CCN(C2CCOCC2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,894 | {
"selfies": [
"[O][=C][C][=C][Branch1][C][O][C][=C][C][=C][C][Branch1][C][Br][=C][C][=C][Ring1][N][Ring1][#Branch1]",
"[O][=S][=Branch1][C][=O][Branch2][Ring1][O][N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][S][=Branch1][C][=O][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][C][Branch1][C][F][Branch1][C][F][F]",
"[O][=C][C][=C][Branch1][P][O][S][=Branch1][C][=O][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][C][=C][C][=C][C][Branch1][C][Br][=C][C][=C][Ring2][Ring1][Ring1][Ring1][#Branch1]"
],
"smiles": [
"O=Cc1c(O)ccc2cc(Br)ccc12",
"O=S(=O)(N(c1ccccc1)S(=O)(=O)C(F)(F)F)C(F)(F)F",
"O=Cc1c(OS(=O)(=O)C(F)(F)F)ccc2cc(Br)ccc12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be ClCCl .",
"role": "assistant"
}
] | |
70,895 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][C][=C][Ring1][#Branch1][S][Ring1][#Branch2]",
"[O][=C][Branch1][C][O][C][=C][C][=C][Branch1][C][Cl][C][=C][C][=C][Ring1][#Branch1][S][Ring1][#Branch2]"
],
"smiles": [
"COC(=O)c1cc2c(Cl)cccc2s1",
"O=C(O)c1cc2c(Cl)cccc2s1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: CO.O .",
"role": "assistant"
}
] | |
70,896 | {
"selfies": [
"[O][C][C][=C][C][=C][NH1][N][=N][C][Ring1][Branch1][=C][Ring1][=Branch2]",
"[O][=C][C][=C][C][=C][NH1][N][=N][C][Ring1][Branch1][=C][Ring1][=Branch2]"
],
"smiles": [
"OCc1ccc2[nH]nnc2c1",
"O=Cc1ccc2[nH]nnc2c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CC(C)=O .",
"role": "assistant"
}
] | |
70,897 | {
"selfies": [
"[C][C][C][C][C][Branch1][Ring1][C][O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][O][C][O][Ring1][=Branch1]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[C][C][C][C][C][Branch1][O][C][O][S][Branch1][C][C][=Branch1][C][=O][=O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][O][C][O][Ring1][=Branch1]"
],
"smiles": [
"CCCCC(CO)c1ccc2c(c1)OCO2",
"CS(=O)(=O)Cl",
"CCCCC(COS(C)(=O)=O)c1ccc2c(c1)OCO2"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,898 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][=C][C][=C][Branch1][P][C][=C][C][=C][C][NH1][N][=C][Branch1][C][N][C][Ring1][#Branch2][=Ring1][=Branch1][C][=C][Ring1][S]",
"[N][C][=N][NH1][C][=C][C][=C][C][Branch1][P][C][=C][C][=C][Branch1][#Branch1][C][C][=Branch1][C][=O][O][C][=C][Ring1][#Branch2][=C][Ring2][Ring1][Ring1][Ring1][S]"
],
"smiles": [
"COC(=O)Cc1ccc(-c2cccc3[nH]nc(N)c23)cc1",
"Nc1n[nH]c2cccc(-c3ccc(CC(=O)O)cc3)c12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CO .",
"role": "assistant"
}
] | |
70,899 | {
"selfies": [
"[C][C][Branch1][C][O][C][C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][N][Ring1][=N][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][I]",
"[C][O][C][Branch1][C][C][C][C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][N][Ring1][=N][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CC(O)C1CN(Cc2ccccc2)CCN1Cc1ccccc1",
"CI",
"COC(C)C1CN(Cc2ccccc2)CCN1Cc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] |
Subsets and Splits