instruction
stringclasses 1
value | output
stringlengths 52
197
| input
stringlengths 75
717
| history
listlengths 0
0
|
---|---|---|---|
This reaction's solvents include CC(=O)O, ClC(Cl)Cl, and O. ### The answer is CC(=O)O, ClC(Cl)Cl, and O | Can you specify the dissolving agents used in the reaction with the SMILES BrBr.CC(C)Sc1cc([Si](C)(C)C)oc1C(=O)Nc1nnn[nH]1.O>>CC(C)Sc1cc(Br)oc1C(=O)Nc1nnn[nH]1.? | []
|
|
The chemical reaction utilizes CCN(CC)CC and CS(C)=O as the solvents. ### The answer is CCN(CC)CC and CS(C)=O | What are the solvents needed for the chemical reaction as described in Cc1ccc2nc(C(=O)O)ncc2c1.N[C@H]1CCN(c2nccn3cnnc23)C1.CCN(CC)CC.CN(C)C(On1nnc2cccnc21)=[N+](C)C.F[P-](F)(F)(F)(F)F>>Cc1ccc2nc(C(=O)N[C@H]3CCN(c4nccn5cnnc45)C3)ncc2c1.? | []
|
|
Solvents CCCCO and CCN(C(C)C)C(C)C are the substances used in this chemical reaction. ### The answer is CCCCO and CCN(C(C)C)C(C)C | I'm wondering what solvents help provoke the reaction shown in the SMILES sequence Clc1cncc(Cl)n1.NCCO.CCN(C(C)C)C(C)C>>OCCNc1cncc(Cl)n1.? | []
|
|
The reaction uses CO as solvents. ### The answer is CO | Which solvents are involved in the reaction represented by the SMILES CCCc1cc(CO[Si](C)(C)C(C)(C)C)ccc1OC(C(=O)OC)c1ccccc1.[OH-].[Na+]>>CCCc1cc(CO[Si](C)(C)C(C)(C)C)ccc1OC(C(=O)O)c1ccccc1.? | []
|
|
For the chemical reaction, solvents CCN(CC)CC, CCOC(C)=O, and CN1CCCC1=O are used. ### The answer is CCN(CC)CC, CCOC(C)=O, and CN1CCCC1=O | Can you tell me which solvents were used in the reaction involving the SMILES COC(=O)Cc1cccc(C[C@H](C)N)c1.CCN(CC)CC.CN1CCCC1=O.CC(C)(C)[Si](C)(C)O[C@@H](CNCc1ccccc1)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12>>COC(=O)Cc1cccc(C[C@H](C)NC[C@H](O[Si](C)(C)C(C)(C)C)c2ccc(OCc3ccccc3)c3[nH]c(=O)ccc23)c1.? | []
|
|
This chemical reaction is executed using solvents CCN(CC)CC and CN(C)C=O. ### The answer is CCN(CC)CC and CN(C)C=O | Could you tell me what the solvent medium for the reaction linked with the SMILES CCN(CC)CCCNc1nc(-c2cccc(C(=O)O)c2C)c2ccc(=O)n(-c3c(F)cccc3F)c2n1.CN(C)C(On1nnc2ccccc21)=[N+](C)C.F[P-](F)(F)(F)(F)F.CCN(CC)CC.Nc1ccc(F)cc1>>CCN(CC)CCCNc1nc(-c2cccc(C(=O)Nc3ccc(F)cc3)c2C)c2ccc(=O)n(-c3c(F)cccc3F)c2n1. is? | []
|
|
In this chemical reaction, solvents CC(C)=O and O are employed. ### The answer is CC(C)=O and O | What solvents are involved in the chemical reaction that is defined by Clc1nc(Cl)nc(Cl)n1.CC(C)N.[OH-].[Na+].CCN>>CCNc1nc(Cl)nc(NC(C)C)n1.? | []
|
|
The chemical reaction involves using CCO as solvents. ### The answer is CCO | What solvents can be found in the reaction denoted by the SMILES CC(C)(C)OC(=O)N1CC2CN(CC(COc3ccc(C#N)cc3)NC(=O)OCc3ccccc3)CC(C1)C2O>>CC(C)(C)OC(=O)N1CC2CN(CC(N)COc3ccc(C#N)cc3)CC(C1)C2O.? | []
|
|
ClC(Cl)Cl and c1ccncc1 serve as the solvents in this chemical reaction. ### The answer is ClC(Cl)Cl and c1ccncc1 | Can you identify the solvents used in the CC(C)(C)OC(=O)N1CCN(c2nc(N[C@H]3CCNC3)nc3ccccc23)CC1.c1ccncc1.O=C(Cl)Cc1ccccc1.O=C([O-])O.[Na+]>>CC(C)(C)OC(=O)N1CCN(c2nc(N[C@H]3CCN(C(=O)Cc4ccccc4)C3)nc3ccccc23)CC1. reaction? | []
|
|
CC(=O)O are the chosen solvents for this chemical reaction. ### The answer is CC(=O)O | In the context of the SMILES COC(=O)[C@H](CC=O)C[C@@H](OC)c1ccc(F)cc1.CC(C)(C)OC(=O)N1CCNCC1.CC(=O)O[BH-](OC(C)=O)OC(C)=O.[Na+].CC(=O)O>>COC(=O)[C@@H](CCN1CCN(C(=O)OC(C)(C)C)CC1)C[C@@H](OC)c1ccc(F)cc1. reaction, could you state the solvent medium? | []
|
|
CCN(CC)CC and CN(C)C=O are the solvents incorporated in this chemical reaction. ### The answer is CCN(CC)CC and CN(C)C=O | What solvent substances can be found in the reaction that corresponds with the SMILES code O=C(O)c1cccc2[nH]ncc12.c1ccc2c(c1)nnn2O[P+](N1CCCC1)(N1CCCC1)N1CCCC1.F[P-](F)(F)(F)(F)F.CCN(CC)CC.NCc1cccc(C(F)(F)F)c1>>O=C(NCc1cccc(C(F)(F)F)c1)c1cccc2[nH]ncc12.? | []
|
|
C1CCOC1 are the solvents that have been used in this chemical reaction. ### The answer is C1CCOC1 | Do you know which solvents enhance the reaction represented by the SMILES sequence Cc1nnc2c(NC(=O)OC(C)(C)C)cc(N(C)[C@@H](C)c3ccccc3)nn12.Cl>>Cc1nnc2c(N)cc(N(C)[C@@H](C)c3ccccc3)nn12.? | []
|
|
The solvents in this chemical reaction are CO and O. ### The answer is CO and O | In the reaction involving the SMILES O=C([O-])[O-].[K+].[K+].O.CCCCCC/C=C/Cc1nc2ccccc2c(OC(C)=O)c1C.Cl>>CCCCCC/C=C/CC1=Nc2ccccc2C(=O)C1C., what are the agents that promote dissolution? | []
|
|
The solvents, namely CC(=O)N(C)C, are used in this chemical reaction. ### The answer is CC(=O)N(C)C | What dissolving substances are used in the reaction that includes the SMILES O=C1N=c2ccccc2=N1.[Cl-].[Li+].OCC1CO1>>O=c1n(CC(O)CO)c2ccccc2n1CC(O)CO.? | []
|
|
CCO are the solvents that facilitate this chemical reaction. ### The answer is CCO | What exactly is the solvent medium involved in the reaction that corresponds to the SMILES Oc1ccc(N=Nc2ccccc2)cc1OC(F)(F)F>>Nc1ccc(O)c(OC(F)(F)F)c1.? | []
|
|
This chemical reaction is carried out with C1CCOC1 and O as solvents. ### The answer is C1CCOC1 and O | What solvents were applied in the reaction with the SMILES notation CO/N=C(\COc1ccc(CO)cc1)c1ccccc1.O=Cc1ccc(O)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.CC(C)OC(=O)N=NC(=O)OC(C)C>>CO/N=C(\COc1ccc(COc2ccc(C=O)cc2)cc1)c1ccccc1.? | []
|
|
CCOC(C)=O and CN(C)C=O are the solvents that this reaction requires. ### The answer is CCOC(C)=O and CN(C)C=O | Can you specify the solvents involved in the OCC(C1CCCCC1)n1c(-c2ccc(Cl)cc2)nc2cc(F)c(F)cc21.[H].[H][Na+].BrCC1CCCCC1.CCOC(C)=O>>Fc1cc2nc(-c3ccc(Cl)cc3)n(C(COCC3CCCCC3)C3CCCCC3)c2cc1F. reaction? | []
|
|
This chemical reaction is performed with CS(C)=O and O as solvents. ### The answer is CS(C)=O and O | Can you provide a list of solvents associated with the reaction depicted by the SMILES notation O=C([O-])[O-].[K+].[K+].CCCN.ClCCCOc1ccc2ccccc2c1>>CCCNCCCOc1ccc2ccccc2c1.? | []
|
|
In this chemical process, CO and ClCCl are used as solvents. ### The answer is CO and ClCCl | What types of solvents does the chemical reaction of Cc1ncn(-c2ccc(N3CC(CN=[N+]=[N-])OC3=O)cc2F)n1.Cc1cn(-c2ccc(N3C[C@H](CN)OC3=O)cc2F)nn1.CO>>CN1C=NN(c2ccc(N3CC(CN)OC3=O)cc2F)C1. involve? | []
|
|
In this chemical reaction, solvents C1CCOC1 and O are employed. ### The answer is C1CCOC1 and O | What are the solvents used in the SMILES notation [N-]=[N+]=NCc1ccc2c(N)n[nH]c2n1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.O>>NCc1ccc2c(N)n[nH]c2n1. reaction? | []
|
|
The solvents CO and O are utilized in the chemical reaction. ### The answer is CO and O | Could you identify the solvents employed in the O=C(CBr)c1ccccc1.O=C([O-])O.[Na+].Nc1cc(N)ncn1.O>>Nc1cc2nc(-c3ccccc3)cn2cn1. reaction? | []
|
|
The chemical reaction utilizes ClCCl as the solvents. ### The answer is ClCCl | Do you know what's the solvent medium for the reaction of the SMILES COc1cccc(CNc2nc(Nc3cccc(CCCO)c3)ncc2Cl)c1.BrB(Br)Br.O=C([O-])O.[Na+]>>Oc1cccc(CNc2nc(Nc3cccc(CCCBr)c3)ncc2Cl)c1.? | []
|
|
Solvents CO and O are the substances used in this chemical reaction. ### The answer is CO and O | Could you tell me the solvents in the reaction described by the SMILES CCOC(=O)/C(C)=C/c1ccc(OC)c(OC2CCCC2)c1.[Li]O.O>>COc1ccc(/C=C(\C)C(=O)O)cc1OC1CCCC1.? | []
|
|
The solvents for this reaction are O and CC(C)O. ### The answer is O and CC(C)O | What dissolving substances are used in the reaction that includes the SMILES [OH-].[Na+].Oc1cc(-n2nc3c(c2Cl)CCCC3)c(F)cc1Cl.FC(F)Cl.Cl>>Fc1cc(Cl)c(OC(F)F)cc1-n1nc2c(c1Cl)CCCC2.? | []
|
|
The chemical reaction uses CN(C)C=O and CN1CCOCC1 as the solvents. ### The answer is CN(C)C=O and CN1CCOCC1 | What are the solvents used in a reaction labeled by the SMILES code [Br-].C[N+](C)(CCCCN)CCNC(=O)c1nc(Cl)c(N)nc1N.O=S(=O)(Cl)c1ccc(Cl)cc1.CN1CCOCC1>>[Br-].C[N+](C)(CCCCNS(=O)(=O)c1ccc(Cl)cc1)CCNC(=O)c1nc(Cl)c(N)nc1N.? | []
|
|
This chemical reaction utilizes the solvents COCCOCCOC. ### The answer is COCCOCCOC | In carrying out the reaction involving Fc1cc(OC2CCOCC2)c2c(Nc3c(Cl)ccc4c3OCO4)ncnc2c1.[OH-].[K+].CN1CCN(CCO)CC1.Cl>>CN1CCN(CCOc2cc(OC3CCOCC3)c3c(Nc4c(Cl)ccc5c4OCO5)ncnc3c2)CC1., what solvents were employed? | []
|
|
The solvents participating in this chemical reaction are C1CCNCC1 and c1ccncc1. ### The answer is C1CCNCC1 and c1ccncc1 | What are the solvents that facilitate the SMILES sequence N#Cc1ccc(-c2nc(C=O)no2)cc1.O=C(O)CC(=O)O.C1CCNCC1>>N#Cc1ccc(-c2nc(/C=C/C(=O)O)no2)cc1. reaction? | []
|
|
CCN(C(C)C)C(C)C and CN(C)C=O are the chosen solvents for this chemical reaction. ### The answer is CCN(C(C)C)C(C)C and CN(C)C=O | Could you specify the solvents participating in the SMILES CS(=O)(=O)c1ccccc1C(=O)O.NC[C@@H](O)CN1CCC(Oc2ccc(Cl)c(Cl)c2)CC1.CCN(C(C)C)C(C)C.O=C([O-])O.[Na+]>>CS(=O)(=O)c1ccccc1C(=O)NC[C@@H](O)CN1CCC(Oc2ccc(Cl)c(Cl)c2)CC1. reaction? | []
|
|
This reaction involves CCOC(C)=O and CN(C)C=O as the solvents. ### The answer is CCOC(C)=O and CN(C)C=O | Which solvents are involved in the reaction represented by the SMILES CC(C)(C)[O-].[K+].O=[N+]([O-])c1ccccc1Cl.CCOC(=O)C(C)Cl.Cl>>CCOC(=O)C(C)c1ccc([N+](=O)[O-])c(Cl)c1.? | []
|
|
This chemical reaction utilizes the solvents NC=O and O. ### The answer is NC=O and O | What are the solvents used in a reaction labeled by the SMILES code O=[N+]([O-])c1ncccn1.O=CO.O=S([O-])S(=O)[O-].[Na+].[Na+].C>>O=CNc1ncccn1.? | []
|
|
The chemical reaction takes place with the use of solvents CCOCC and Cc1ccccc1. ### The answer is CCOCC and Cc1ccccc1 | What solvents aid in initiating the reaction signified by the SMILES sequence COc1ccc(Br)cc1C=O.OCCCO.FB(F)F.CCOCC>>COc1ccc(Br)cc1C1OCCCO1.? | []
|
|
The chemical reaction's solvents are CS(C)=O and O. ### The answer is CS(C)=O and O | Can you name the solvents used in the reaction depicted by the SMILES code C[Si](C)(C)I.CN1C[C@H](CO)C=C2c3cccc4[nH]cc(c34)C[C@H]21.O.N>>CN1C[C@H](CO)C=C2c3cccc4[nH]c(I)c(c34)C[C@H]21.? | []
|
|
Solvents CC#N and CCN(CC)CC are the substances used in this chemical reaction. ### The answer is CC#N and CCN(CC)CC | Can you specify the solvents involved in the CS(=O)(=O)O.NCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O.O=C=Nc1ccccc1.CCN(CC)CC.Cl>>O=C1CCC(N2Cc3cc(CNC(=O)Nc4ccccc4)ccc3C2=O)C(=O)N1. reaction? | []
|
|
This reaction involves CCCCO as the solvents. ### The answer is CCCCO | Could you clarify which solvents are employed in the reaction represented by the SMILES syntax [O-][n+]1cccc(F)c1Cl.C1CNCCN1>>[O-][n+]1cccc(F)c1N1CCNCC1.? | []
|
|
The solvents in this chemical reaction are ClCCl and O. ### The answer is ClCCl and O | What solvents aid in initiating the reaction signified by the SMILES sequence [OH-].[Na+].Cc1cccc(C)c1-n1cc(C#N)c(=O)[nH]c1=O.ClSC(Cl)(Cl)C(Cl)Cl.ClCCl>>Cc1cccc(C)c1-n1cc(C#N)c(=O)n(SC(Cl)(Cl)C(Cl)Cl)c1=O.? | []
|
|
The chemical reaction's solvents are C1CCOC1. ### The answer is C1CCOC1 | What agents tend to dissolve in the reaction of SMILES .[Al+3].[Li+].[H].[H].[H].[H]O=C(c1ccccc1)N1CCC(CCOC/C=C/c2ccccc2)CC1>>C(=C/c1ccccc1)\COCCC1CCNCC1.? | []
|
|
The solvents for this reaction are CCN(C(C)C)C(C)C and CN1CCCC1=O. ### The answer is CCN(C(C)C)C(C)C and CN1CCCC1=O | Can you provide a list of solvents associated with the reaction depicted by the SMILES notation CCOC(=O)Nc1nc2c(Br)nc(SCc3cccc(F)c3F)nc2[nH]1.NC(CO)CO.CCN(C(C)C)C(C)C>>Nc1nc2c(NC(CO)CO)nc(SCc3cccc(F)c3F)nc2[nH]1.? | []
|
|
This chemical reaction incorporates C1CCOC1 as solvents. ### The answer is C1CCOC1 | Can you elucidate the solvent substances associated with the reaction referred to by the SMILES code CCOC(=O)C(C)(C)Oc1cnc2[nH]c(C(CC3CCCC3)c3ccc(S(C)(=O)=O)cc3)cc2c1.[H].[H]CC(C)C[Al+]CC(C)C>>CC(C)(CO)Oc1cnc2[nH]c(C(CC3CCCC3)c3ccc(S(C)(=O)=O)cc3)cc2c1.? | []
|
|
CC(=O)O, CCO, and O are the solvents present in this chemical reaction. ### The answer is CC(=O)O, CCO, and O | Kindly elaborate on the solvents used in the reaction linked to the SMILES notation CCOc1cc(Cc2cnc(N)nc2N)cc(OCC2(COC)CC2)c1-c1ccc(O)cc1.O>>CCOc1cc(Cc2cnc(N)nc2N)cc(OCC(C)(C)COC)c1-c1ccc(O)cc1.? | []
|
|
This chemical reaction is carried out with solvents CI. ### The answer is CI | Can you specify the solvents used in the reaction having the SMILES notation NC(=S)Nc1nncs1.Cl.CCO>>CSC(N)=Nc1nncs1.? | []
|
|
ClCCl and O=C(O)C(F)(F)F are the solvents present in this chemical reaction. ### The answer is ClCCl and O=C(O)C(F)(F)F | Could you tell me what the solvent medium for the reaction linked with the SMILES O=C(O)C(F)(F)F.CC[C@@H]1C(=O)N(C)c2cnc(-c3ccncc3NC(=O)OC(C)(C)C)nc2N1C1CCCC1>>CC[C@@H]1C(=O)N(C)c2cnc(-c3ccncc3N)nc2N1C1CCCC1. is? | []
|
|
This chemical reaction utilizes ClCCl and O as its solvents. ### The answer is ClCCl and O | What solvents aid in initiating the reaction signified by the SMILES sequence Cc1[nH]c2cccc(I)c2c1Sc1ccc(Cl)cc1.O=C(O)C(F)(F)F.CC#N.N.Cl>>Cc1c(Sc2ccc(Cl)cc2)c2c(-c3ccccc3)cccc2n1CC(=O)O.? | []
|
|
This chemical reaction is performed with Cc1ccccc1 as solvents. ### The answer is Cc1ccccc1 | I would like to know the solvents in the reaction associated with the SMILES notation Brc1c2ccccc2cc2ccccc12.OBO.O=C([O-])[O-].[Na+].[Na+]>>c1ccc2cc(-c3c4ccccc4cc4ccccc34)ccc2c1., could you tell me? | []
|
|
For this chemical reaction, CN(C)C=O and O act as solvents. ### The answer is CN(C)C=O and O | In carrying out the reaction involving NCc1ccccc1.O=[N+]([O-])c1ccc(-c2ccc(S(=O)(=O)Cl)cc2)cc1.O>>O=[N+]([O-])c1ccc(-c2ccc(S(=O)(=O)NCc3ccccc3)cc2)cc1., what solvents were employed? | []
|
|
For this reaction, ClC(Cl)Cl are the solvents used. ### The answer is ClC(Cl)Cl | Would you be able to provide the names of the solvents involved in the reaction that the SMILES algorithm Cc1sc2c(Br)c3ccccc3c(-c3cc(Br)c(O)c(Br)c3)c2c1C.O=C([O-])[C@H](O)CCc1ccccc1.BrBr>>Cc1sc2c(Br)c3ccccc3c(-c3cc(Br)c(O[C@@H](CCc4ccccc4)C(=O)O)c(Br)c3)c2c1C. represents? | []
|
|
CCOC(C)=O and ClCCl are the solvents used in this chemical reaction. ### The answer is CCOC(C)=O and ClCCl | In the reaction with SMILES notation O=C(OCc1ccccc1)c1ccc(CCc2coc3cccc(O)c23)cc1.CC(=O)OC[C@H]1O[C@H](OC(=N)C(Cl)(Cl)Cl)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O.O=C([O-])O.[Na+]>>CC(=O)OC[C@H]1O[C@@H](Oc2cccc3occ(CCc4ccc(C(=O)OCc5ccccc5)cc4)c23)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O., can you point out the solvents used? | []
|
|
C1COCCO1 and CCN(C(C)C)C(C)C are the solvents selected for this chemical reaction. ### The answer is C1COCCO1 and CCN(C(C)C)C(C)C | What solvents aid in initiating the reaction signified by the SMILES sequence CN1CCC[C@H]1c1nnc2ccc(O[C@@H]3CC[C@H](N)c4ccccc43)cn12.CC(C)(C)c1cc(NC(=O)OCC(Cl)(Cl)Cl)n(-c2cccc(SCCO)c2)n1.CCN(C(C)C)C(C)C>>CN1CCC[C@H]1c1nnc2ccc(O[C@@H]3CC[C@H](NC(=O)Nc4cc(C(C)(C)C)nn4-c4cccc(SCCO)c4)c4ccccc43)cn12.? | []
|
|
The chemical solvents used here are C1CCOC1 and CCCCCC. ### The answer is C1CCOC1 and CCCCCC | Can you list the solvents that participate in the reaction involving the SMILES CCC1(c2ccc3occc3c2)OCCO1.[Li]CCCC.CCCCCC.ClC(Cl)(Cl)C(Cl)(Cl)Cl>>CCC1(c2ccc3oc(Cl)cc3c2)OCCO1.? | []
|
|
This chemical reaction is facilitated by the solvents CCO. ### The answer is CCO | What agents tend to dissolve in the reaction of SMILES Cc1cc(Oc2nc(C(F)(F)F)cs2)cc(C)c1NC(=S)NC(C)(C)C.CI>>CSC(=NC(C)(C)C)Nc1c(C)cc(Oc2nc(C(F)(F)F)cs2)cc1C.? | []
|
|
The reaction uses C1CCOC1 and O as its solvents. ### The answer is C1CCOC1 and O | Could you specify the solvents that assist in triggering the reaction derived from the SMILES sequence COC(=O)C[C@@H]1C[C@H](NC(=O)c2nn(C(C)C)c3ccccc23)CN1C(=O)OC(C)(C)C.[BH4-].[Li+].O>>CC(C)n1nc(C(=O)N[C@H]2C[C@@H](CCO)N(C(=O)OC(C)(C)C)C2)c2ccccc21.? | []
|
|
This chemical reaction is conducted with C1CCOC1 as the solvents. ### The answer is C1CCOC1 | Can you identify the solvent substances used in the reaction denoted by the SMILES code COc1ccc(C(=O)NNC(=O)c2ccc(N)c([N+](=O)[O-])c2)cc1.CC[N+](CC)(CC)S(=O)(=O)N=C([O-])OC>>COc1ccc(-c2nnc(-c3ccc(N)c([N+](=O)[O-])c3)o2)cc1.? | []
|
|
CC(=O)O are the chosen solvents for this chemical reaction. ### The answer is CC(=O)O | Do you know the dissolving agents in the reaction related to the SMILES Nc1sc(Cl)cc1C(=O)c1ccc(F)cc1.CC(=O)CC(=O)C(F)(F)F>>Cc1nc2sc(Cl)cc2c(-c2ccc(F)cc2)c1C(=O)C(F)(F)F.? | []
|
|
The solvents, namely CCN(CC)CC and ClCCl, are used in this chemical reaction. ### The answer is CCN(CC)CC and ClCCl | Can you identify the solvent substances used in the reaction denoted by the SMILES code COC(=O)c1ccc(CCc2ccc(NC(=O)c3c(NC(=O)c4cccc(S(=O)(=O)Cl)c4)sc4c3CCCC4)cc2)cc1.Cl.CCOC(=O)C1(N)CC1.CCN(CC)CC>>CCOC(=O)C1(NS(=O)(=O)c2cccc(C(=O)Nc3sc4c(c3C(=O)Nc3ccc(CCc5ccc(C(=O)OC)cc5)cc3)CCCC4)c2)CC1.? | []
|
|
The reaction is conducted using solvents O. ### The answer is O | What solvents were applied in the reaction with the SMILES notation Br.Oc1ccc2c(c1)CCNC2.NC=O>>O=CN1CCc2cc(O)ccc2C1.? | []
|
|
The chemical reaction is facilitated by solvents CCO. ### The answer is CCO | In the reaction with SMILES notation O=C(NC1CCN(c2ccccc2)C1)c1ccc([N+](=O)[O-])cc1.[H][H]>>Nc1ccc(C(=O)NC2CCN(c3ccccc3)C2)cc1., can you point out the solvents used? | []
|
|
The chemical reaction involves using CCN(CC)CC as solvents. ### The answer is CCN(CC)CC | Can you specify the solvents involved in the CC(C)(C)OC(=O)N[C@@H](CCOCc1ccccc1)C(=O)Nn1cccc1C(=O)Nc1ccccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.BrBr.CCN(CC)CC.N>>CC(C)(C)OC(=O)N[C@@H](CCOCc1ccccc1)c1nn2cccc2c(=O)n1-c1ccccc1. reaction? | []
|
|
For this reaction, ClCCl are the solvents used. ### The answer is ClCCl | What solvents take part in the reaction alongside the SMILES CCCCCCCCCCCCCCCC(=O)O.CCOC(=O)Cl.O=C([O-])[O-].[Na+].[Na+]>>CCCCCCCCCCCCCCCC(=O)OC(=O)OCC.? | []
|
|
C1CCOC1, CCOC(C)=O, and O are the solvents that this reaction requires. ### The answer is C1CCOC1, CCOC(C)=O, and O | Could you tell me what solvents accelerate the reaction denoted by the SMILES sequence [Li+].[OH-].COC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1OCc1ccccc1.Cl>>O=C(O)c1cc(S(=O)(=O)N2CCCCC2)ccc1OCc1ccccc1.? | []
|
|
This reaction's solvents include ClCCl and O. ### The answer is ClCCl and O | May I know the solvents utilized in the reaction that incorporates the SMILES notation O=C(NC12CCC(C(=O)O)(CC1)CC2)OCc1ccccc1.C1=COCCC1.O.Cc1ccc(S(=O)(=O)O)cc1>>O=C(NC12CCC(C(=O)OC3CCCCO3)(CC1)CC2)OCc1ccccc1.? | []
|
|
The reaction uses C1COCCO1 and ClCCl as its solvents. ### The answer is C1COCCO1 and ClCCl | In the context of the SMILES CC(C)(C)OC(=O)N1CC[C@@H](Nc2c(C(N)=O)cnn3cc(Br)nc23)C(C)(C)C1.CCn1cc(B2OC(C)(C)C(C)(C)O2)cn1.O=P([O-])([O-])[O-].[K+].[K+].[K+]>>CCn1cc(-c2cn3ncc(C(N)=O)c(N[C@@H]4CCN(C(=O)OC(C)(C)C)CC4(C)C)c3n2)cn1. reaction, could you state the solvent medium? | []
|
|
C1CCOC1 are the solvents that are used in this chemical reaction. ### The answer is C1CCOC1 | Would you be able to provide the names of the solvents involved in the reaction that the SMILES algorithm Cc1cccc(Cl)c1N1Cc2cnc(Nc3ccccc3)nc2N(c2cccc(CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c2)C1=O.[F-].CCCC[N+](CCCC)(CCCC)CCCC>>Cc1cccc(Cl)c1N1Cc2cnc(Nc3ccccc3)nc2N(c2cccc(CCO)c2)C1=O. represents? | []
|
|
Solvents O and CS(C)=O are used in this particular chemical reaction. ### The answer is O and CS(C)=O | Kindly elaborate on the solvents used in the reaction linked to the SMILES notation Oc1ccccn1.[H].[H][Na+].CC1(C)Oc2ccc(S(=O)(=O)C(F)(F)F)cc2C2OC21.O>>CC1(C)Oc2ccc(S(=O)(=O)C(F)(F)F)cc2[C@@H](n2ccccc2=O)[C@@H]1O.? | []
|
|
For this chemical reaction, the solvents CN(C)C=O and CCN(C(C)C)C(C)C are used. ### The answer is CN(C)C=O and CCN(C(C)C)C(C)C | Could you tell me the solvents in the reaction described by the SMILES O=C(O)c1cccc2c1OCCO2.CCOC(=O)C1(N)Cc2ccccc2C1.CN(C)C(On1nnc2cccnc21)=[N+](C)C.F[P-](F)(F)(F)(F)F.CCN(C(C)C)C(C)C>>CCOC(=O)C1(NC(=O)c2cccc3c2OCCO3)Cc2ccccc2C1.? | []
|
|
The solvents C1CCOC1 are integral to this chemical reaction. ### The answer is C1CCOC1 | Are you able to tell me which solvents are used in the reaction that's characterized by the SMILES string CC(C)[Si](C(C)C)(C(C)C)n1cc(C(O)c2cc(F)c(OCc3ccccc3)cc2F)c2cccnc21.[F-].CCCC[N+](CCCC)(CCCC)CCCC>>OC(c1cc(F)c(OCc2ccccc2)cc1F)c1c[nH]c2ncccc12.? | []
|
|
In this reaction, ClCCl act as the solvents. ### The answer is ClCCl | What solvents are involved in the reaction described by the SMILES notation COC[C@@H](N)C(=O)NCc1ccccc1.CN(C)c1ccccn1.CC(=O)OC(C)=O>>COC[C@@H](NC(C)=O)C(=O)NCc1ccccc1.? | []
|
|
The solvents in this chemical reaction are CC(=O)O and CCOC(C)=O. ### The answer is CC(=O)O and CCOC(C)=O | Could you specify the solvents participating in the SMILES Nc1[nH]ncc1C(=O)c1cccs1.CC(=O)N(C)c1cc(C(=O)C=CN(C)C)c(F)cc1F.CCOC(C)=O>>CC(=O)N(C)c1cc(-c2ccnc3c(C(=O)c4cccs4)cnn23)c(F)cc1F. reaction? | []
|
|
Solvents CC#N are the substances used in this chemical reaction. ### The answer is CC#N | What solvents are employed in the chemical reaction represented by COc1ccc(-c2cccc3c2CCC3=O)c(O)c1OCC1CC1.O=C([O-])[O-].[K+].[K+].CCCBr>>CCCOc1c(-c2cccc3c2CCC3=O)ccc(OC)c1OCC1CC1.? | []
|
|
This reaction is dependent on ClCCl as solvents. ### The answer is ClCCl | Please enlighten me with the solvents that have been used in the reaction relating to the SMILES notation CCOC(C)OCC#CC(O)c1ccc(OC)cc1>>CCOC(C)OCC#CC(=O)c1ccc(OC)cc1.. | []
|
|
Solvents CO and ClC(Cl)Cl are integral to this chemical reaction's process. ### The answer is CO and ClC(Cl)Cl | Kindly elaborate on the solvents used in the reaction linked to the SMILES notation CCCCCCCCNC(=O)N1CCC(C(=O)N2CCC(Nc3ccc(CCNC[C@H](O)COc4ccc(O[Si](c5ccccc5)(c5ccccc5)C(C)(C)C)cc4)cc3)CC2)CC1>>CCCCCCCCNC(=O)N1CCC(C(=O)N2CCC(Nc3ccc(CCNC[C@H](O)COc4ccc(O)cc4)cc3)CC2)CC1.? | []
|
|
CC(=O)O and ClCCl serve as the solvents in this chemical reaction. ### The answer is CC(=O)O and ClCCl | I would like to know the solvents in the reaction associated with the SMILES notation Cc1c(C=O)cnn1C.CC(C)(C)OC(=O)Nc1ccccc1NC(=O)c1ccc(C2CCNCC2)cc1.CC(=O)O.CC(=O)O[BH-](OC(C)=O)OC(C)=O.[Na+].O=C([O-])O.[Na+]>>Cc1c(CN2CCC(c3ccc(C(=O)Nc4ccccc4NC(=O)OC(C)(C)C)cc3)CC2)cnn1C., could you tell me? | []
|
|
C1COCCO1 and O are the solvents that this reaction requires. ### The answer is C1COCCO1 and O | What types of solvents were used for the reaction with the SMILES O.[OH-].[Li+].COC(=O)CCc1ccc(C(=O)N2CCCCc3ccccc32)cc1>>O=C(O)CCc1ccc(C(=O)N2CCCCc3ccccc32)cc1.? | []
|
|
The reaction uses CCO as solvents. ### The answer is CCO | Could you tell me what solvents accelerate the reaction denoted by the SMILES sequence CCOC(=O)CSc1nccc(Cl)n1.NCc1ccc(Cl)cc1.O=C([O-])[O-].[Na+].[Na+]>>CCOC(=O)CSc1nccc(NCc2ccc(Cl)cc2)n1.? | []
|
|
In this reaction, the chemicals CI, CN(C)C=O, and O are utilized as solvents. ### The answer is CI, CN(C)C=O, and O | Which solvents does the O=C(O)c1cc(Cl)cc([N+](=O)[O-])c1Cl.O=C([O-])[O-].[Na+].[Na+].CI.O>>COC(=O)c1cc(Cl)cc([N+](=O)[O-])c1Cl. chemical reaction require? | []
|
|
This chemical reaction is performed with CCN(CC)CC and OCCO as solvents. ### The answer is CCN(CC)CC and OCCO | Do you know the dissolving agents in the reaction related to the SMILES O=C(c1ccc(Nc2ccnc3cc(C(F)(F)F)ccc23)cc1)N1CCNCC1.COc1cc(Cl)nc(OC)n1.CCN(CC)CC>>COc1cc(N2CCN(C(=O)c3ccc(Nc4ccnc5cc(C(F)(F)F)ccc45)cc3)CC2)nc(OC)n1.? | []
|
|
The reaction proceeds with ClCCl as solvents. ### The answer is ClCCl | Do you know the solvents that are part of the reaction with the SMILES CSc1ncc2ccc(C(O)c3ccccc3)n2n1.ClCCl.O=C(OO)c1cccc(Cl)c1>>CS(=O)c1ncc2ccc(C(O)c3ccccc3)n2n1.? | []
|
|
Solvents CN(C)C=O and O are integral to this chemical reaction's process. ### The answer is CN(C)C=O and O | Could you tell me what solvents accelerate the reaction denoted by the SMILES sequence CC(Br)C(=O)c1ncc(Cl)cc1Cl.O=C1NC(=O)c2ccccc21.[K].O>>CC(C(=O)c1ncc(Cl)cc1Cl)N1C(=O)c2ccccc2C1=O.? | []
|
|
This reaction involves C1CCOC1 as the solvents. ### The answer is C1CCOC1 | What solvents were applied in the reaction with the SMILES notation O=[N+]([O-])c1ccc(O)c(Cl)c1.Cn1c(N2CCN(CCCO)CC2)cc(=O)n(C)c1=O.c1ccc(P(c2ccccc2)c2ccccc2)cc1.CCOC(=O)N=NC(=O)OCC>>Cn1c(N2CCN(CCCOc3ccc([N+](=O)[O-])cc3Cl)CC2)cc(=O)n(C)c1=O.? | []
|
|
Solvents CC#N and CCN(CC)CC are employed in this chemical reaction. ### The answer is CC#N and CCN(CC)CC | Which agents cause dissolution in the reaction involving the SMILES Clc1cc(Cl)nc(Cl)n1.CCN(CC)CC.CC(C)(N)CO>>CC(C)(CO)Nc1cc(Cl)nc(Cl)n1.? | []
|
|
CC(=O)O and CCN(CC)CC, as solvents, are employed in this chemical reaction. ### The answer is CC(=O)O and CCN(CC)CC | What kinds of solvents are used to facilitate the reaction in the SMILES sequence O=C1OC(=O)C(c2ccccc2)=C1Cl.Cl.Cl.CN(C)c1ccc(CN)cc1.CCN(CC)CC>>CN(C)c1ccc(CN2C(=O)C(Cl)=C(c3ccccc3)C2=O)cc1.? | []
|
|
This chemical reaction makes use of O as solvents. ### The answer is O | Can you identify the particular solvent medium that is connected with the SMILES O=[N+]([O-])c1ccc(F)c(F)c1.[OH-].[NH4+]>>Nc1ccc([N+](=O)[O-])cc1F. reaction? | []
|
|
O are the solvents that are used in this chemical reaction. ### The answer is O | Which solvents are involved in the reaction with the SMILES O=[N+]([O-])c1ccccc1Cl.[S-][S-].[Na+].[Na+]>>O=[N+]([O-])c1ccccc1SSc1ccccc1[N+](=O)[O-].? | []
|
|
The chemical reaction involves CCO as the solvents used. ### The answer is CCO | In the context of the SMILES CCOC(=O)Cc1ccc(Oc2ccc3[nH]c(=O)ccc3c2[N+](=O)[O-])c(OC)c1>>CCOC(=O)Cc1ccc(Oc2ccc3[nH]c(=O)ccc3c2N)c(OC)c1. reaction, could you state the solvent medium? | []
|
|
The chemical solvents used here are C1CCOC1, C=C(C)CC, and CC(C)(C)O. ### The answer is C1CCOC1, C=C(C)CC, and CC(C)(C)O | What types of solvents were used for the reaction with the SMILES O=CCCc1ccc(-c2cnc3c(-c4ccccc4)cnn3c2)cc1.C=C(C)CC.O=P([O-])(O)O.[Na+].[O-][Cl+][O-].[Na+]>>O=C(O)CCc1ccc(-c2cnc3c(-c4ccccc4)cnn3c2)cc1.? | []
|
|
The chemical reaction's solvents are CO. ### The answer is CO | Which solvents are included in the reaction with the SMILES notation CCOC(=O)N=C=S.Nc1cnc(Cl)nc1Cl>>CCOC(=O)Nc1nc2cnc(Cl)nc2s1.? | []
|
|
This chemical reaction is conducted with CC(C)O as the solvents. ### The answer is CC(C)O | Can you provide a list of solvents associated with the reaction depicted by the SMILES notation Cn1cc(-c2nc(N[C@@H]3CCCC[C@@H]3NC(=O)OC(C)(C)C)c(F)c3c2C(=O)N(C(=O)OC(C)(C)C)C3)cn1.Cl>>Cn1cc(-c2nc(N[C@@H]3CCCC[C@@H]3N)c(F)c3c2C(=O)NC3)cn1.? | []
|
|
The chemical reaction makes use of solvents CN(C)C=O and O. ### The answer is CN(C)C=O and O | Do you have information on the solvents used in the N=C(NO)c1ccc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)cc1.[H].[H][Na+].CCI.O>>CCONC(=N)c1ccc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)cc1. reaction scenario? | []
|
|
For this chemical reaction, the solvents CCCCCC, Clc1ccccc1Cl, and O are used. ### The answer is CCCCCC, Clc1ccccc1Cl, and O | In the reaction involving the SMILES O.Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(O)c(NC(=O)c2ccc(CCl)cc2)c1.O.CCCCCC>>Cc1ccc2oc(-c3ccc(CCl)cc3)nc2c1., what are the agents that promote dissolution? | []
|
|
The chemical reaction involves using C1CCOC1 and CO as solvents. ### The answer is C1CCOC1 and CO | Do you have information on the solvents used in the O=C1COc2cc3c(cc21)C1(CO3)C(=O)N(C[C@H]2CCCO2)c2ccccc21.Cl.NO.CC(=O)[O-].[Na+].[OH-].[Na+]>>O=C1N(C[C@H]2CCCO2)c2ccccc2C12COc1cc3c(cc12)C(=NO)CO3. reaction scenario? | []
|
|
This chemical reaction incorporates CCN(CC)CC and CO as solvents. ### The answer is CCN(CC)CC and CO | Kindly elaborate on the solvents used in the reaction linked to the SMILES notation CC(C)(C)OC(=O)N1CC=C(c2cc3c(Nc4cccc(-c5ncc[nH]5)c4)ncnc3[nH]2)CC1.Cl.CCN(CC)CC.CC(C)(C)N=C=O>>CC(C)(C)NC(=O)N1CC=C(c2cc3c(Nc4cccc(-c5ncc[nH]5)c4)ncnc3[nH]2)CC1.? | []
|
|
In this reaction, the chemicals Cc1ccccc1 are utilized as solvents. ### The answer is Cc1ccccc1 | Which agents cause dissolution in the reaction involving the SMILES OCCC1CCC2(CC1)OCCO2.c1ccc(P(c2ccccc2)c2ccccc2)cc1.c1c[nH]cn1.II>>ICCC1CCC2(CC1)OCCO2.? | []
|
|
The solvents participating in this chemical reaction are ClCCl. ### The answer is ClCCl | Can you specify the solvent medium used for the reaction corresponding to the SMILES Nc1c(S(=O)(=O)C(F)(F)F)cnn1-c1c(Cl)cc(C(F)(F)F)cc1Cl.CC(C)(C)ON=O.ClCCl.BrC(Br)Br>>O=S(=O)(c1cnn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1Br)C(F)(F)F.? | []
|
|
Solvents CCN(C(C)C)C(C)C and ClCCl are integral to this chemical reaction's process. ### The answer is CCN(C(C)C)C(C)C and ClCCl | What types of solvents were used for the reaction with the SMILES Nc1nc(N2CCNCC2)c2nc(CCc3ccc(F)cc3)sc2n1.CCN(C(C)C)C(C)C.O=C(Cl)COc1ccccc1>>Nc1nc(N2CCN(C(=O)COc3ccccc3)CC2)c2nc(CCc3ccc(F)cc3)sc2n1.? | []
|
|
In this reaction, CN(C)C=O act as the solvents. ### The answer is CN(C)C=O | Can you elucidate the solvent substances associated with the reaction referred to by the SMILES code CCOC(=O)c1cnc(SC)[nH]c1=O.COc1ccccc1N>>CCOC(=O)c1cnc(Nc2ccccc2OC)[nH]c1=O.? | []
|
|
The solvents in this chemical reaction are CC(C)=O. ### The answer is CC(C)=O | Could you specify the solvents that assist in triggering the reaction derived from the SMILES sequence COC(=O)c1ccc(CNc2nccc(-c3ccc(O)c(F)c3)n2)cc1.Cl.CN(C)CCCl.[I-].[K+].O=C([O-])[O-].[K+].[K+].[NH4+].[Cl-]>>COC(=O)c1ccc(CNc2nccc(-c3ccc(OCCN(C)C)c(F)c3)n2)cc1.? | []
|
|
C1CCOC1 and CO serve as the solvents in this chemical reaction. ### The answer is C1CCOC1 and CO | Do you have information on the solvent substances in the reaction with the designated SMILES code CSc1ncnc2cc(N)ncc12.Nc1cccc([N+](=O)[O-])c1>>Nc1cccc(Nc2ncnc3cc(N)ncc23)c1.? | []
|
|
This chemical reaction makes use of CC#N as solvents. ### The answer is CC#N | What agents tend to dissolve in the reaction of SMILES Cl.Cl.CCCCOC(OCCCC)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCC(=O)N1C(=O)OCc1ccccc1.[OH-].[Na+]>>Cl.N=C(N)NCCC[C@@H](C=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCC(=O)N1C(=O)OCc1ccccc1.? | []
|
|
C1CCOC1 are the solvents that are used in this chemical reaction. ### The answer is C1CCOC1 | Would you be able to specify the solvents used in the reaction characterized by the SMILES code O=C(N[C@@H](Cc1ccccc1)C(=O)O)OCc1ccccc1.O=[N+]([O-])c1ccc(O)cc1.C(=NC1CCCCC1)=NC1CCCCC1>>O=C(N[C@@H](Cc1ccccc1)C(=O)Oc1ccc([N+](=O)[O-])cc1)OCc1ccccc1.? | []
|
|
The chemical reaction involves CO as the solvents used. ### The answer is CO | Which agents cause dissolution in the reaction involving the SMILES CC1(C)CCC(C)(C)c2cc(-c3cc(C4CCNCC4)on3)ccc21.CC(=O)OCCCCBr.[OH-].[Na+]>>CC1(C)CCC(C)(C)c2cc(-c3cc(C4CCN(CCCCO)CC4)on3)ccc21.? | []
|
|
The chemical reaction makes use of solvents c1ccncc1 and ClCCl. ### The answer is c1ccncc1 and ClCCl | Could you specify the solvents participating in the SMILES Cl.CON.c1ccncc1.O=C(Cl)Oc1ccc([N+](=O)[O-])cc1>>CONC(=O)Oc1ccc([N+](=O)[O-])cc1. reaction? | []
|
|
C1COCCO1 and O are utilized as the solvents in this chemical reaction. ### The answer is C1COCCO1 and O | What are the solvents present in the reaction process of SMILES O=C1CN2CCC(CC2)N1.[H].[H].[H].[H].[Li+].[Al+3].O>>C1CN2CCC(CC2)N1.? | []
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.