molvision/TOX21-V-SMILES-4 · Datasets at Hugging Face

Question stringlengths 677 1.63k	Answer stringclasses 2 values	TargetMolecule stringlengths 2 243	SampleMethod stringclasses 1 value	SampleNum int64 4 4	SampleRep stringclasses 1 value
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CN(C)CCc1c[nH]c2cccc(OP(=O)(O)O)c12 Toxic: <boolean>No</boolean> Example 2: Smiles: COc1ccc2[nH]cc(CCNC(C)=O)c2c1 Toxic: <boolean>No</boolean> Example 3: Smiles: Cc1c[nH]c2ccccc12 Toxic: <boolean>No</boolean> Example 4: Smiles: c1ccc2[nH]ccc2c1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=C(O)Cc1c[nH]c2ccccc12 Toxic:	<boolean>No</boolean>	O=C(O)Cc1c[nH]c2ccccc12	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(C)c1ccccc1O Toxic:	<boolean>No</boolean>	CC(C)c1ccccc1O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): COc1cccc(OC)c1 Toxic:	<boolean>No</boolean>	COc1cccc(OC)c1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CN(C)C(=O)C(c1ccccc1)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(CCC(=O)O)(c1ccc(O)cc1)c1ccc(O)cc1 Toxic: <boolean>No</boolean> Example 3: Smiles: CC(C)(C)c1cc(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O Toxic: <boolean>No</boolean> Example 4: Smiles: CCN(CC)CCOC(=O)C(O)(c1ccccc1)c1ccccc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(C)(c1cc(Br)c(OCC(Br)CBr)c(Br)c1)c1cc(Br)c(OCC(Br)CBr)c(Br)c1 Toxic:	<boolean>No</boolean>	CC(C)(c1cc(Br)c(OCC(Br)CBr)c(Br)c1)c1cc(Br)c(OCC(Br)CBr)c(Br)c1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCOP(=O)(N=C1SCCS1)OCC Toxic:	<boolean>No</boolean>	CCOP(=O)(N=C1SCCS1)OCC	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): OCc1ccc(Cl)cc1Cl Toxic:	<boolean>No</boolean>	OCc1ccc(Cl)cc1Cl	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CNCCS(=O)(=O)[O-] Toxic:	<boolean>No</boolean>	CNCCS(=O)(=O)[O-]	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=NN(c1ccccc1)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CNC(=O)N(c1ccccc1)c1ccccc1 Toxic: <boolean>No</boolean> Example 3: Smiles: O=C(OCCOCCO)c1ccccc1Nc1cccc(C(F)(F)F)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: CC(C)(C)CC(C)(C)c1ccc(Nc2ccc(C(C)(C)CC(C)(C)C)cc2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=C([O-])c1ccccc1Nc1cc(Cl)ccc1C(=O)[O-] Toxic:	<boolean>No</boolean>	O=C([O-])c1ccccc1Nc1cc(Cl)ccc1C(=O)[O-]	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=C1C(O)=C(O)C(=O)C(O)=C1O Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=C1C=CC(=O)C=C1 Toxic:	<boolean>No</boolean>	O=C1C=CC(=O)C=C1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[C@H]1CN(c2c(F)c(F)c3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C[C@@H](C)N1 Toxic: <boolean>Yes</boolean> Example 2: Smiles: COc1c(N2CCNC(C)C2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12 Toxic: <boolean>No</boolean> Example 3: Smiles: CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNC(C)C3)c(F)c21 Toxic: <boolean>No</boolean> Example 4: Smiles: CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNCC3)cc21 Toxic: <boolean>No</boolean> Target Molecule (Smiles): C[C@H]1CN(c2c(F)c(N)c3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C[C@@H](C)N1 Toxic:	<boolean>Yes</boolean>	C[C@H]1CN(c2c(F)c(N)c3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C[C@@H](C)N1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cc1cc(C)nc(NS(=O)(=O)c2ccc(N)cc2)n1 Toxic: <boolean>No</boolean> Example 2: Smiles: COc1cnc(NS(=O)(=O)c2ccc(N)cc2)nc1 Toxic: <boolean>No</boolean> Example 3: Smiles: COC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1nc(C)cc(C)n1 Toxic: <boolean>No</boolean> Example 4: Smiles: Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1ccnc(NS(=O)(=O)c2ccc(N)cc2)n1 Toxic:	<boolean>No</boolean>	Cc1ccnc(NS(=O)(=O)c2ccc(N)cc2)n1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCOc1ccccc1O Toxic:	<boolean>No</boolean>	CCOc1ccccc1O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(COCc2ccccc2)cc1 Toxic: <boolean>No</boolean> Example 2: Smiles: O=P(O)(OCc1ccccc1)OCc1ccccc1 Toxic: <boolean>No</boolean> Example 3: Smiles: CC(=O)SC[C@@H](Cc1ccccc1)C(=O)NCC(=O)OCc1ccccc1 Toxic: <boolean>No</boolean> Example 4: Smiles: CCCCOC(=O)c1ccccc1C(=O)OCc1ccccc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=C(OCc1ccccc1)C(=O)OCc1ccccc1 Toxic:	<boolean>No</boolean>	O=C(OCc1ccccc1)C(=O)OCc1ccccc1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCN(Cc1ccc(Cl)nc1)/C(=C/[N+](=O)[O-])NC Toxic: <boolean>No</boolean> Example 2: Smiles: Cc1ncc(CO)c(CO)c1O Toxic: <boolean>No</boolean> Example 3: Smiles: CC(=O)c1cccnc1 Toxic: <boolean>No</boolean> Example 4: Smiles: NCc1cccnc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1cccnc1 Toxic:	<boolean>No</boolean>	Cc1cccnc1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CNCC(O)c1ccc(O)cc1 Toxic:	<boolean>No</boolean>	CNCC(O)c1ccc(O)cc1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=C([O-])Cc1cccc2ccccc12 Toxic: <boolean>No</boolean> Example 2: Smiles: CCCCc1ccc2cccc(S(=O)(=O)[O-])c2c1 Toxic: <boolean>No</boolean> Example 3: Smiles: O=S(=O)([O-])c1cccc2ccccc12 Toxic: <boolean>No</boolean> Example 4: Smiles: Nc1ccc2cc(S(=O)(=O)O)ccc2c1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): c1ccc2ccccc2c1 Toxic:	<boolean>No</boolean>	c1ccc2ccccc2c1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCN(Cc1ccc(Cl)nc1)/C(=C/[N+](=O)[O-])NC Toxic: <boolean>No</boolean> Example 2: Smiles: Cc1ncc(CO)c(CO)c1O Toxic: <boolean>No</boolean> Example 3: Smiles: NCc1cccnc1 Toxic: <boolean>No</boolean> Example 4: Smiles: Clc1ccccn1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(=O)c1cccnc1 Toxic:	<boolean>No</boolean>	CC(=O)c1cccnc1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCCCCCCCOS(=O)(=O)[O-] Toxic:	<boolean>No</boolean>	CCCCCCCCOS(=O)(=O)[O-]	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: COC(=O)C1(O)c2ccccc2-c2ccccc21 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(=O)Nc1ccc2c(c1)Cc1cc(NC(C)=O)ccc1-2 Toxic: <boolean>No</boolean> Example 3: Smiles: O=C1c2c(O)cccc2Cc2cccc(O)c21 Toxic: <boolean>No</boolean> Example 4: Smiles: CC(C)[N+](C)(CCOC(=O)C1c2ccccc2Oc2ccccc21)C(C)C Toxic: <boolean>No</boolean> Target Molecule (Smiles): c1ccc2c(c1)Cc1ccccc1-2 Toxic:	<boolean>No</boolean>	c1ccc2c(c1)Cc1ccccc1-2	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(-c2ccccc2)cc1 Toxic: <boolean>No</boolean> Example 2: Smiles: Nc1ccc(-c2ccc(N)cc2)cc1 Toxic: <boolean>No</boolean> Example 3: Smiles: Cc1ccc(-c2ccccc2)cc1 Toxic: <boolean>No</boolean> Example 4: Smiles: CCCCCCc1ccc(-c2ccc(C#N)cc2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1ccc(-c2ncc(Cl)cc2-c2ccc(S(C)(=O)=O)cc2)cn1 Toxic:	<boolean>No</boolean>	Cc1ccc(-c2ncc(Cl)cc2-c2ccc(S(C)(=O)=O)cc2)cn1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCOC(OCC)OCC Toxic:	<boolean>No</boolean>	CCOC(OCC)OCC	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC1=CC(O)CC(C)(C)C1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC1=C(CC=O)C(C)(C)CCC1 Toxic: <boolean>No</boolean> Example 3: Smiles: CC(=O)/C=C/C1=C(C)CCCC1(C)C Toxic: <boolean>No</boolean> Example 4: Smiles: CCC(=O)/C=C/C1C(C)=CCCC1(C)C Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCC(=O)C1CC(C(C)C)CC=C1C Toxic:	<boolean>No</boolean>	CCC(=O)C1CC(C(C)C)CC=C1C	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CC(C)CNCC(C)C Toxic:	<boolean>No</boolean>	CC(C)CNCC(C)C	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): O=S1OCCO1 Toxic:	<boolean>No</boolean>	O=S1OCCO1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Oc1nc(O)nc(O)n1 Toxic: <boolean>No</boolean> Example 2: Smiles: COCN(COC)c1nc(N(COC)COC)nc(N(COC)COC)n1 Toxic: <boolean>No</boolean> Example 3: Smiles: C=CCOc1nc(OCC=C)nc(OCC=C)n1 Toxic: <boolean>No</boolean> Example 4: Smiles: CSc1nc(NC(C)C)nc(NC(C)C)n1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCNc1nc(NC(C)CC)nc(OC)n1 Toxic:	<boolean>No</boolean>	CCNc1nc(NC(C)CC)nc(OC)n1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): NC(=O)c1ccc([N+](=O)[O-])cc1Cl Toxic:	<boolean>No</boolean>	NC(=O)c1ccc([N+](=O)[O-])cc1Cl	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=P(O)(O)c1ccccc1 Toxic:	<boolean>No</boolean>	O=P(O)(O)c1ccccc1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): NCCOS(=O)(=O)O Toxic:	<boolean>No</boolean>	NCCOS(=O)(=O)O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): N=C(N)NN Toxic:	<boolean>No</boolean>	N=C(N)NN	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(C)CCOC(=O)c1ccccc1 Toxic:	<boolean>No</boolean>	CC(C)CCOC(=O)c1ccccc1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCCCCCCCCCCCCCCCCCCl Toxic:	<boolean>No</boolean>	CCCCCCCCCCCCCCCCCCCl	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=C(NN1CCCC1)NS(=O)(=O)c1ccc(Cl)cc1 Toxic: <boolean>No</boolean> Example 2: Smiles: Cc1ccc(S(=O)(=O)NC(=O)NC2CCCCCCC2)cc1 Toxic: <boolean>No</boolean> Example 3: Smiles: Cc1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1 Toxic: <boolean>No</boolean> Example 4: Smiles: CC(=O)c1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1ccc(S(=O)(=O)NC(=O)NN2CCCCCC2)cc1 Toxic:	<boolean>No</boolean>	Cc1ccc(S(=O)(=O)NC(=O)NN2CCCCCC2)cc1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): NS(=O)(=O)c1ccccc1Cl Toxic:	<boolean>No</boolean>	NS(=O)(=O)c1ccccc1Cl	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): NC(=O)CC[C@H](Nc1ccc([N+](=O)[O-])cc1)C(=O)O Toxic:	<boolean>No</boolean>	NC(=O)CC[C@H](Nc1ccc([N+](=O)[O-])cc1)C(=O)O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CNC(=O)Oc1ccc2c(c1)[C@]1(C)CCN(C)[C@@H]1N2C Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(C)=CCN1CC[C@@]2(C)c3cc(O)ccc3C[C@@H]1[C@@H]2C.O=C(O)CCC(=O)O Toxic:	<boolean>No</boolean>	CC(C)=CCN1CC[C@@]2(C)c3cc(O)ccc3C[C@@H]1[C@@H]2C.O=C(O)CCC(=O)O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): [Zn+2] Toxic:	<boolean>No</boolean>	[Zn+2]	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CN1C(=O)N(C)C(O)C1O Toxic: <boolean>No</boolean> Example 2: Smiles: O=C1NCCN1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): S=C1NCCN1 Toxic:	<boolean>No</boolean>	S=C1NCCN1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C=CCCCCCCCCC=O Toxic:	<boolean>No</boolean>	C=CCCCCCCCCC=O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC(C)(C)c1nnc(NS(=O)(=O)c2ccccc2)s1 Toxic: <boolean>No</boolean> Example 2: Smiles: COc1ccc(S(=O)(=O)Nc2nnc(CC(C)C)s2)cc1 Toxic: <boolean>No</boolean> Example 3: Smiles: Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 Toxic: <boolean>No</boolean> Example 4: Smiles: O=C(O)CCC(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1 Toxic:	<boolean>No</boolean>	Cc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: OC1CCCc2ccccc21 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)(C)NCC(O)COc1cccc2c1C[C@H](O)[C@H](O)C2 Toxic: <boolean>No</boolean> Example 3: Smiles: C#CCN[C@@H]1CCc2ccccc21 Toxic: <boolean>No</boolean> Example 4: Smiles: C[C@H]1CNCCc2ccc(Cl)cc21 Toxic: <boolean>No</boolean> Target Molecule (Smiles): c1ccc2c(c1)CCCC2 Toxic:	<boolean>No</boolean>	c1ccc2c(c1)CCCC2	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1ccc(C(=O)O)cc1 Toxic:	<boolean>No</boolean>	Cc1ccc(C(=O)O)cc1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC1=CC(=O)CC(C)(C)C1 Toxic: <boolean>No</boolean> Example 2: Smiles: CCCC(=NOCC)C1=C(O)CC(CC(C)SCC)CC1=O Toxic: <boolean>No</boolean> Example 3: Smiles: CC1=CC(=O)CC(C)(C)C1(O)/C=C/C(C)=C\C(=O)O Toxic: <boolean>No</boolean> Example 4: Smiles: C=C(C)[C@@H]1CC=C(C)C(=O)C1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): C=C(C)C1CC=C(C)C(=O)C1 Toxic:	<boolean>No</boolean>	C=C(C)C1CC=C(C)C(=O)C1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): O=C(O)C(Cl)Cl Toxic:	<boolean>No</boolean>	O=C(O)C(Cl)Cl	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CC1(C)C(=O)C(C)(C)C1=O Toxic:	<boolean>No</boolean>	CC1(C)C(=O)C(C)(C)C1=O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CC(=O)C(=O)[O-] Toxic:	<boolean>No</boolean>	CC(=O)C(=O)[O-]	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[C@@H]1CN([C@H]2CC[C@](C#N)(c3ccc(F)cc3)CC2)CC[C@]1(C(=O)O)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: OC1CCCCC1c1ccccc1 Toxic: <boolean>No</boolean> Example 3: Smiles: COc1cccc([C@@]2(O)CCCC[C@@H]2CN(C)C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: O=C(CCCN1CCC(O)(c2ccc(Br)cc2)CC1)c1ccc(F)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCN(CC)CCOC(=O)C1(c2ccccc2)CCCC1.CCN(CC)CCOC(=O)C1(c2ccccc2)CCCC1.O=S(=O)(O)CCS(=O)(=O)O Toxic:	<boolean>No</boolean>	CCN(CC)CCOC(=O)C1(c2ccccc2)CCCC1.CCN(CC)CCOC(=O)C1(c2ccccc2)CCCC1.O=S(=O)(O)CCS(=O)(=O)O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cn1cnc2c1c(=O)[nH]c(=O)n2C Toxic: <boolean>No</boolean> Example 2: Smiles: Cn1c(=O)c2c(ncn2CC(O)CO)n(C)c1=O Toxic: <boolean>No</boolean> Example 3: Smiles: CC(O)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O Toxic: <boolean>No</boolean> Example 4: Smiles: Cn1c(=O)c2[nH]c(Br)nc2n(C)c1=O Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cn1c(=O)c2[nH]cnc2n(C)c1=O Toxic:	<boolean>No</boolean>	Cn1c(=O)c2[nH]cnc2n(C)c1=O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cc1occc(=O)c1OC(=O)C(C)C Toxic: <boolean>No</boolean> Example 2: Smiles: Cc1occc(=O)c1O Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=c1cc(CO)occ1O Toxic:	<boolean>No</boolean>	O=c1cc(CO)occ1O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): COCCOCCOCCOCCOCCO Toxic:	<boolean>No</boolean>	COCCOCCOCCOCCOCCO	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C=COCCOCCOCCOC=C Toxic:	<boolean>No</boolean>	C=COCCOCCOCCOC=C	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=C(O)c1cc(Cl)cc([N+](=O)[O-])c1Cl Toxic:	<boolean>No</boolean>	O=C(O)c1cc(Cl)cc([N+](=O)[O-])c1Cl	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C=C(C)C(=O)OCC(C)C Toxic:	<boolean>No</boolean>	C=C(C)C(=O)OCC(C)C	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): O=C([O-])C(=O)[O-].[Ca+2] Toxic:	<boolean>No</boolean>	O=C([O-])C(=O)[O-].[Ca+2]	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): O=C(O)C(Br)(Br)Br Toxic:	<boolean>No</boolean>	O=C(O)C(Br)(Br)Br	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): [Ca+2].[Cl-].[Cl-] Toxic:	<boolean>No</boolean>	[Ca+2].[Cl-].[Cl-]	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=C1c2cccc(O)c2C(=O)c2c(O)cccc21 Toxic: <boolean>No</boolean> Example 2: Smiles: O=C(O)CN1C(=O)c2cccc3cccc(c23)C1=O Toxic: <boolean>No</boolean> Example 3: Smiles: c1ccc2c(c1)c1cccc3ccc4cccc2c4c31 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccc2ccc3cccc4ccc1c2c34 Toxic: <boolean>No</boolean> Target Molecule (Smiles): c1ccc2c(c1)-c1cccc3cccc-2c13 Toxic:	<boolean>No</boolean>	c1ccc2c(c1)-c1cccc3cccc-2c13	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1ccc(C(=O)O)cc1 Toxic:	<boolean>No</boolean>	Cc1ccc(C(=O)O)cc1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1ccccc1C(N)=O Toxic:	<boolean>No</boolean>	Cc1ccccc1C(N)=O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCN(CC)CCc1nc(-c2ccccc2)no1.O=C(O)CC(O)(CC(=O)O)C(=O)O Toxic: <boolean>No</boolean> Example 2: Smiles: Nc1nc(N)c(-c2ccccc2)s1 Toxic: <boolean>No</boolean> Example 3: Smiles: Cc1nc(-c2ccc(Cl)cc2)oc1COC(C)(C)C(=O)O Toxic: <boolean>No</boolean> Example 4: Smiles: c1ccc(-c2nnn[nH]2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Nc1nc(N)nc(-c2cc(Cl)ccc2Cl)n1 Toxic:	<boolean>No</boolean>	Nc1nc(N)nc(-c2cc(Cl)ccc2Cl)n1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): C=Cc1ccccc1C=C Toxic:	<boolean>No</boolean>	C=Cc1ccccc1C=C	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cn1cnc2c1c(=O)[nH]c(=O)n2C Toxic: <boolean>No</boolean> Example 2: Smiles: Cn1c(=O)c2c(ncn2CC(O)CO)n(C)c1=O Toxic: <boolean>No</boolean> Example 3: Smiles: Cn1c(=O)c2[nH]c(Br)nc2n(C)c1=O Toxic: <boolean>No</boolean> Example 4: Smiles: Cn1c(=O)c2[nH]cnc2n(C)c1=O Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(O)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O Toxic:	<boolean>No</boolean>	CC(O)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CN(C)CCOCCO Toxic:	<boolean>No</boolean>	CN(C)CCOCCO	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCCCCCCCCCCCCO Toxic:	<boolean>No</boolean>	CCCCCCCCCCCCCO	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=NN(c1ccccc1)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CNC(=O)N(c1ccccc1)c1ccccc1 Toxic: <boolean>No</boolean> Example 3: Smiles: O=C(OCCOCCO)c1ccccc1Nc1cccc(C(F)(F)F)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: O=C([O-])c1ccccc1Nc1cc(Cl)ccc1C(=O)[O-] Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(C)(C)CC(C)(C)c1ccc(Nc2ccc(C(C)(C)CC(C)(C)C)cc2)cc1 Toxic:	<boolean>No</boolean>	CC(C)(C)CC(C)(C)c1ccc(Nc2ccc(C(C)(C)CC(C)(C)C)cc2)cc1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(C)OC(=O)COc1ccc(Cl)cc1Cl Toxic:	<boolean>No</boolean>	CC(C)OC(=O)COc1ccc(Cl)cc1Cl	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CC(C)CCCC(C)CC=O Toxic:	<boolean>No</boolean>	CC(C)CCCC(C)CC=O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C=CC=O Toxic:	<boolean>No</boolean>	C=CC=O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): [Zn+2] Toxic:	<boolean>No</boolean>	[Zn+2]	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=C(O)CCC(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)(C)c1nnc(NS(=O)(=O)c2ccccc2)s1 Toxic: <boolean>No</boolean> Example 3: Smiles: Cc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1 Toxic: <boolean>No</boolean> Example 4: Smiles: COc1ccc(S(=O)(=O)Nc2nnc(CC(C)C)s2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 Toxic:	<boolean>No</boolean>	Nc1ccc(S(=O)(=O)Nc2nccs2)cc1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): O=C(O)COCC(=O)O Toxic:	<boolean>No</boolean>	O=C(O)COCC(=O)O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC(=O)Nc1nnc(S(N)(=O)=O)s1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): CNC(=O)N(C)c1nnc(C(C)(C)C)s1 Toxic:	<boolean>No</boolean>	CNC(=O)N(C)c1nnc(C(C)(C)C)s1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CC(=O)CC(C)(C)O Toxic:	<boolean>No</boolean>	CC(=O)CC(C)(C)O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCN(Cc1ccc(Cl)nc1)/C(=C/[N+](=O)[O-])NC Toxic: <boolean>No</boolean> Example 2: Smiles: Cc1ncc(CO)c(CO)c1O Toxic: <boolean>No</boolean> Example 3: Smiles: CC(=O)c1cccnc1 Toxic: <boolean>No</boolean> Example 4: Smiles: NCc1cccnc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): ClCc1cccnc1 Toxic:	<boolean>No</boolean>	ClCc1cccnc1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): N=c1ccn2c(n1)O[C@H]1[C@H](O)[C@@H](CO)O[C@H]12 Toxic:	<boolean>No</boolean>	N=c1ccn2c(n1)O[C@H]1[C@H](O)[C@@H](CO)O[C@H]12	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCOCCOCCOCCO Toxic:	<boolean>No</boolean>	CCOCCOCCOCCO	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=C1CCCN1 Toxic: <boolean>No</boolean> Example 2: Smiles: O=C1CC[C@@H](C(=O)O)N1 Toxic: <boolean>No</boolean> Example 3: Smiles: CN1CCCC1=O Toxic: <boolean>No</boolean> Example 4: Smiles: NC(=O)CN1CCCC1=O Toxic: <boolean>No</boolean> Target Molecule (Smiles): C=CN1CCCC1=O Toxic:	<boolean>No</boolean>	C=CN1CCCC1=O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(-c2ccccc2)cc1 Toxic: <boolean>No</boolean> Example 2: Smiles: Nc1ccc(-c2ccc(N)cc2)cc1 Toxic: <boolean>No</boolean> Example 3: Smiles: Cc1ccc(-c2ccccc2)cc1 Toxic: <boolean>No</boolean> Example 4: Smiles: CCCCCCc1ccc(-c2ccc(C#N)cc2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=C(O)Cc1ccc(-c2ccccc2)cc1 Toxic:	<boolean>No</boolean>	O=C(O)Cc1ccc(-c2ccccc2)cc1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C=CC(C)(CCC=C(C)C)OC(=O)CC Toxic:	<boolean>No</boolean>	C=CC(C)(CCC=C(C)C)OC(=O)CC	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(C)Oc1ccccc1O Toxic:	<boolean>No</boolean>	CC(C)Oc1ccccc1O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCCCCCCC(=O)OC Toxic:	<boolean>No</boolean>	CCCCCCCC(=O)OC	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CO/N=C(/C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(Cn3nnc(C)n3)CS[C@H]12)c1csc(N)n1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1nnc(SCC2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)Cn4cnnn4)[C@H]3SC2)s1 Toxic:	<boolean>No</boolean>	Cc1nnc(SCC2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)Cn4cnnn4)[C@H]3SC2)s1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCCC(=O)Nc1ccc(OCC(O)CNC(C)C)c(C(C)=O)c1 Toxic:	<boolean>No</boolean>	CCCC(=O)Nc1ccc(OCC(O)CNC(C)C)c(C(C)=O)c1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCSC(=O)N(CC)CC Toxic:	<boolean>No</boolean>	CCSC(=O)N(CC)CC	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): Clc1ccc(Cl)cc1 Toxic:	<boolean>No</boolean>	Clc1ccc(Cl)cc1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc2c(c1)Nc1ccccc1S2 Toxic: <boolean>No</boolean> Example 2: Smiles: c1ccc2c(c1)Oc1ccccc1S2 Toxic: <boolean>No</boolean> Example 3: Smiles: NC(=O)N1c2ccccc2C=Cc2ccccc21 Toxic: <boolean>Yes</boolean> Example 4: Smiles: CC(C(=O)O)c1ccc2c(c1)CC(=O)c1ccccc1S2 Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCN(CC)C(C)CN1c2ccccc2Sc2ccccc21 Toxic:	<boolean>No</boolean>	CCN(CC)C(C)CN1c2ccccc2Sc2ccccc21	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CN(C)CCc1c[nH]c2cccc(OP(=O)(O)O)c12 Toxic: <boolean>No</boolean> Example 2: Smiles: COc1ccc2[nH]cc(CCNC(C)=O)c2c1 Toxic: <boolean>No</boolean> Example 3: Smiles: Cc1c[nH]c2ccccc12 Toxic: <boolean>No</boolean> Example 4: Smiles: c1ccc2[nH]ccc2c1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=C(O)Cc1c[nH]c2ccccc12 Toxic:	<boolean>No</boolean>	O=C(O)Cc1c[nH]c2ccccc12	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Clc1sc(Cl)c(Cl)c1Cl Toxic: <boolean>No</boolean> Example 2: Smiles: COC(=O)c1sccc1S(N)(=O)=O Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCCNC(C)C(=O)Nc1c(C)csc1C(=O)OC Toxic:	<boolean>No</boolean>	CCCNC(C)C(=O)Nc1c(C)csc1C(=O)OC	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CN(C(=O)Cc1cccc2occc12)[C@H]1CC[C@@]2(CCCO2)C[C@@H]1N1CCCC1 Toxic:	<boolean>No</boolean>	CN(C(=O)Cc1cccc2occc12)[C@H]1CC[C@@]2(CCCO2)C[C@@H]1N1CCCC1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC1=CC(O)CC(C)(C)C1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC1=C(CC=O)C(C)(C)CCC1 Toxic: <boolean>No</boolean> Example 3: Smiles: CC(=O)/C=C/C1=C(C)CCCC1(C)C Toxic: <boolean>No</boolean> Example 4: Smiles: CCC(=O)/C=C/C1C(C)=CCCC1(C)C Toxic: <boolean>No</boolean> Target Molecule (Smiles): C=C(C)C1CC=C(C)CC1 Toxic:	<boolean>Yes</boolean>	C=C(C)C1CC=C(C)CC1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C[N+](=O)[O-] Toxic:	<boolean>No</boolean>	C[N+](=O)[O-]	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C=CCOCC(O)CO Toxic:	<boolean>No</boolean>	C=CCOCC(O)CO	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1cc(O)ccc1Cl Toxic:	<boolean>No</boolean>	Cc1cc(O)ccc1Cl	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: COc1c2occc2cc2ccc(=O)oc12 Toxic: <boolean>No</boolean> Example 2: Smiles: CCCc1c2oc(C(=O)O)cc(=O)c2cc2c(=O)cc(C(=O)O)n(CC)c12 Toxic: <boolean>No</boolean> Target Molecule (Smiles): COc1c2occc2c(OC)c2c(=O)cc(C)oc12 Toxic:	<boolean>No</boolean>	COc1c2occc2c(OC)c2c(=O)cc(C)oc12	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C=C(C)C(=O)OCCO Toxic:	<boolean>No</boolean>	C=C(C)C(=O)OCCO	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=C(NCCc1c[nH]c2ccccc12)c1cccnc1 Toxic: <boolean>No</boolean> Example 2: Smiles: O=C([O-])c1[nH]n(-c2ccc(S(=O)(=O)[O-])cc2)c(=O)c1/N=N/c1ccc(S(=O)(=O)[O-])cc1 Toxic: <boolean>No</boolean> Example 3: Smiles: O=C(NCc1cccnc1)Nc1ccc([N+](=O)[O-])cc1 Toxic: <boolean>No</boolean> Example 4: Smiles: Nc1ccc(NC(=O)c2ccc(N)cc2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1c(NC(=O)c2cccnc2)c(=O)n(-c2ccccc2)n1C Toxic:	<boolean>No</boolean>	Cc1c(NC(=O)c2cccnc2)c(=O)n(-c2ccccc2)n1C	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC(=O)Nc1nnc(S(N)(=O)=O)s1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): CNC(=O)N(C)c1nnc(C(C)(C)C)s1 Toxic:	<boolean>No</boolean>	CNC(=O)N(C)c1nnc(C(C)(C)C)s1	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCOc1ccccc1O Toxic:	<boolean>No</boolean>	CCOc1ccccc1O	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): COc1ccc(-c2ccc3cc(C(=O)O)ccc3c2)cc1C12CC3CC(CC(C3)C1)C2 Toxic:	<boolean>No</boolean>	COc1ccc(-c2ccc3cc(C(=O)O)ccc3c2)cc1C12CC3CC(CC(C3)C1)C2	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1cc(C)c(NC(=O)CN(CC(=O)O)CC(=O)O)c(C)c1Br Toxic:	<boolean>No</boolean>	Cc1cc(C)c(NC(=O)CN(CC(=O)O)CC(=O)O)c(C)c1Br	scaffold	4	smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C[Si](C)(C)Cl Toxic:	<boolean>No</boolean>	C[Si](C)(C)Cl	scaffold	4	smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CN(C)CCc1c[nH]c2cccc(OP(=O)(O)O)c12 Toxic: <boolean>No</boolean> Example 2: Smiles: COc1ccc2[nH]cc(CCNC(C)=O)c2c1 Toxic: <boolean>No</boolean> Example 3: Smiles: Cc1c[nH]c2ccccc12 Toxic: <boolean>No</boolean> Example 4: Smiles: c1ccc2[nH]ccc2c1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=C(O)Cc1c[nH]c2ccccc12 Toxic:

O=C(O)Cc1c[nH]c2ccccc12

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(C)c1ccccc1O Toxic:

CC(C)c1ccccc1O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): COc1cccc(OC)c1 Toxic:

COc1cccc(OC)c1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CN(C)C(=O)C(c1ccccc1)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(CCC(=O)O)(c1ccc(O)cc1)c1ccc(O)cc1 Toxic: <boolean>No</boolean> Example 3: Smiles: CC(C)(C)c1cc(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O Toxic: <boolean>No</boolean> Example 4: Smiles: CCN(CC)CCOC(=O)C(O)(c1ccccc1)c1ccccc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(C)(c1cc(Br)c(OCC(Br)CBr)c(Br)c1)c1cc(Br)c(OCC(Br)CBr)c(Br)c1 Toxic:

CC(C)(c1cc(Br)c(OCC(Br)CBr)c(Br)c1)c1cc(Br)c(OCC(Br)CBr)c(Br)c1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCOP(=O)(N=C1SCCS1)OCC Toxic:

CCOP(=O)(N=C1SCCS1)OCC

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): OCc1ccc(Cl)cc1Cl Toxic:

OCc1ccc(Cl)cc1Cl

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CNCCS(=O)(=O)[O-] Toxic:

CNCCS(=O)(=O)[O-]

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=NN(c1ccccc1)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CNC(=O)N(c1ccccc1)c1ccccc1 Toxic: <boolean>No</boolean> Example 3: Smiles: O=C(OCCOCCO)c1ccccc1Nc1cccc(C(F)(F)F)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: CC(C)(C)CC(C)(C)c1ccc(Nc2ccc(C(C)(C)CC(C)(C)C)cc2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=C([O-])c1ccccc1Nc1cc(Cl)ccc1C(=O)[O-] Toxic:

O=C([O-])c1ccccc1Nc1cc(Cl)ccc1C(=O)[O-]

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=C1C(O)=C(O)C(=O)C(O)=C1O Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=C1C=CC(=O)C=C1 Toxic:

O=C1C=CC(=O)C=C1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[C@H]1CN(c2c(F)c(F)c3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C[C@@H](C)N1 Toxic: <boolean>Yes</boolean> Example 2: Smiles: COc1c(N2CCNC(C)C2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12 Toxic: <boolean>No</boolean> Example 3: Smiles: CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNC(C)C3)c(F)c21 Toxic: <boolean>No</boolean> Example 4: Smiles: CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNCC3)cc21 Toxic: <boolean>No</boolean> Target Molecule (Smiles): C[C@H]1CN(c2c(F)c(N)c3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C[C@@H](C)N1 Toxic:

C[C@H]1CN(c2c(F)c(N)c3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C[C@@H](C)N1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cc1cc(C)nc(NS(=O)(=O)c2ccc(N)cc2)n1 Toxic: <boolean>No</boolean> Example 2: Smiles: COc1cnc(NS(=O)(=O)c2ccc(N)cc2)nc1 Toxic: <boolean>No</boolean> Example 3: Smiles: COC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1nc(C)cc(C)n1 Toxic: <boolean>No</boolean> Example 4: Smiles: Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1ccnc(NS(=O)(=O)c2ccc(N)cc2)n1 Toxic:

Cc1ccnc(NS(=O)(=O)c2ccc(N)cc2)n1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCOc1ccccc1O Toxic:

CCOc1ccccc1O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(COCc2ccccc2)cc1 Toxic: <boolean>No</boolean> Example 2: Smiles: O=P(O)(OCc1ccccc1)OCc1ccccc1 Toxic: <boolean>No</boolean> Example 3: Smiles: CC(=O)SC[C@@H](Cc1ccccc1)C(=O)NCC(=O)OCc1ccccc1 Toxic: <boolean>No</boolean> Example 4: Smiles: CCCCOC(=O)c1ccccc1C(=O)OCc1ccccc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=C(OCc1ccccc1)C(=O)OCc1ccccc1 Toxic:

O=C(OCc1ccccc1)C(=O)OCc1ccccc1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCN(Cc1ccc(Cl)nc1)/C(=C/[N+](=O)[O-])NC Toxic: <boolean>No</boolean> Example 2: Smiles: Cc1ncc(CO)c(CO)c1O Toxic: <boolean>No</boolean> Example 3: Smiles: CC(=O)c1cccnc1 Toxic: <boolean>No</boolean> Example 4: Smiles: NCc1cccnc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1cccnc1 Toxic:

Cc1cccnc1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CNCC(O)c1ccc(O)cc1 Toxic:

CNCC(O)c1ccc(O)cc1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=C([O-])Cc1cccc2ccccc12 Toxic: <boolean>No</boolean> Example 2: Smiles: CCCCc1ccc2cccc(S(=O)(=O)[O-])c2c1 Toxic: <boolean>No</boolean> Example 3: Smiles: O=S(=O)([O-])c1cccc2ccccc12 Toxic: <boolean>No</boolean> Example 4: Smiles: Nc1ccc2cc(S(=O)(=O)O)ccc2c1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): c1ccc2ccccc2c1 Toxic:

c1ccc2ccccc2c1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCN(Cc1ccc(Cl)nc1)/C(=C/[N+](=O)[O-])NC Toxic: <boolean>No</boolean> Example 2: Smiles: Cc1ncc(CO)c(CO)c1O Toxic: <boolean>No</boolean> Example 3: Smiles: NCc1cccnc1 Toxic: <boolean>No</boolean> Example 4: Smiles: Clc1ccccn1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(=O)c1cccnc1 Toxic:

CC(=O)c1cccnc1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCCCCCCCOS(=O)(=O)[O-] Toxic:

CCCCCCCCOS(=O)(=O)[O-]

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: COC(=O)C1(O)c2ccccc2-c2ccccc21 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(=O)Nc1ccc2c(c1)Cc1cc(NC(C)=O)ccc1-2 Toxic: <boolean>No</boolean> Example 3: Smiles: O=C1c2c(O)cccc2Cc2cccc(O)c21 Toxic: <boolean>No</boolean> Example 4: Smiles: CC(C)[N+](C)(CCOC(=O)C1c2ccccc2Oc2ccccc21)C(C)C Toxic: <boolean>No</boolean> Target Molecule (Smiles): c1ccc2c(c1)Cc1ccccc1-2 Toxic:

c1ccc2c(c1)Cc1ccccc1-2

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(-c2ccccc2)cc1 Toxic: <boolean>No</boolean> Example 2: Smiles: Nc1ccc(-c2ccc(N)cc2)cc1 Toxic: <boolean>No</boolean> Example 3: Smiles: Cc1ccc(-c2ccccc2)cc1 Toxic: <boolean>No</boolean> Example 4: Smiles: CCCCCCc1ccc(-c2ccc(C#N)cc2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1ccc(-c2ncc(Cl)cc2-c2ccc(S(C)(=O)=O)cc2)cn1 Toxic:

Cc1ccc(-c2ncc(Cl)cc2-c2ccc(S(C)(=O)=O)cc2)cn1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCOC(OCC)OCC Toxic:

CCOC(OCC)OCC

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC1=CC(O)CC(C)(C)C1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC1=C(CC=O)C(C)(C)CCC1 Toxic: <boolean>No</boolean> Example 3: Smiles: CC(=O)/C=C/C1=C(C)CCCC1(C)C Toxic: <boolean>No</boolean> Example 4: Smiles: CCC(=O)/C=C/C1C(C)=CCCC1(C)C Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCC(=O)C1CC(C(C)C)CC=C1C Toxic:

CCC(=O)C1CC(C(C)C)CC=C1C

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CC(C)CNCC(C)C Toxic:

CC(C)CNCC(C)C

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): O=S1OCCO1 Toxic:

O=S1OCCO1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Oc1nc(O)nc(O)n1 Toxic: <boolean>No</boolean> Example 2: Smiles: COCN(COC)c1nc(N(COC)COC)nc(N(COC)COC)n1 Toxic: <boolean>No</boolean> Example 3: Smiles: C=CCOc1nc(OCC=C)nc(OCC=C)n1 Toxic: <boolean>No</boolean> Example 4: Smiles: CSc1nc(NC(C)C)nc(NC(C)C)n1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCNc1nc(NC(C)CC)nc(OC)n1 Toxic:

CCNc1nc(NC(C)CC)nc(OC)n1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): NC(=O)c1ccc([N+](=O)[O-])cc1Cl Toxic:

NC(=O)c1ccc([N+](=O)[O-])cc1Cl

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=P(O)(O)c1ccccc1 Toxic:

O=P(O)(O)c1ccccc1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): NCCOS(=O)(=O)O Toxic:

NCCOS(=O)(=O)O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): N=C(N)NN Toxic:

N=C(N)NN

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(C)CCOC(=O)c1ccccc1 Toxic:

CC(C)CCOC(=O)c1ccccc1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCCCCCCCCCCCCCCCCCCl Toxic:

CCCCCCCCCCCCCCCCCCCl

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=C(NN1CCCC1)NS(=O)(=O)c1ccc(Cl)cc1 Toxic: <boolean>No</boolean> Example 2: Smiles: Cc1ccc(S(=O)(=O)NC(=O)NC2CCCCCCC2)cc1 Toxic: <boolean>No</boolean> Example 3: Smiles: Cc1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1 Toxic: <boolean>No</boolean> Example 4: Smiles: CC(=O)c1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1ccc(S(=O)(=O)NC(=O)NN2CCCCCC2)cc1 Toxic:

Cc1ccc(S(=O)(=O)NC(=O)NN2CCCCCC2)cc1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): NS(=O)(=O)c1ccccc1Cl Toxic:

NS(=O)(=O)c1ccccc1Cl

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): NC(=O)CC[C@H](Nc1ccc([N+](=O)[O-])cc1)C(=O)O Toxic:

NC(=O)CC[C@H](Nc1ccc([N+](=O)[O-])cc1)C(=O)O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CNC(=O)Oc1ccc2c(c1)[C@]1(C)CCN(C)[C@@H]1N2C Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(C)=CCN1CC[C@@]2(C)c3cc(O)ccc3C[C@@H]1[C@@H]2C.O=C(O)CCC(=O)O Toxic:

CC(C)=CCN1CC[C@@]2(C)c3cc(O)ccc3C[C@@H]1[C@@H]2C.O=C(O)CCC(=O)O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): [Zn+2] Toxic:

[Zn+2]

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CN1C(=O)N(C)C(O)C1O Toxic: <boolean>No</boolean> Example 2: Smiles: O=C1NCCN1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): S=C1NCCN1 Toxic:

S=C1NCCN1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C=CCCCCCCCCC=O Toxic:

C=CCCCCCCCCC=O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC(C)(C)c1nnc(NS(=O)(=O)c2ccccc2)s1 Toxic: <boolean>No</boolean> Example 2: Smiles: COc1ccc(S(=O)(=O)Nc2nnc(CC(C)C)s2)cc1 Toxic: <boolean>No</boolean> Example 3: Smiles: Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 Toxic: <boolean>No</boolean> Example 4: Smiles: O=C(O)CCC(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1 Toxic:

Cc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: OC1CCCc2ccccc21 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)(C)NCC(O)COc1cccc2c1C[C@H](O)[C@H](O)C2 Toxic: <boolean>No</boolean> Example 3: Smiles: C#CCN[C@@H]1CCc2ccccc21 Toxic: <boolean>No</boolean> Example 4: Smiles: C[C@H]1CNCCc2ccc(Cl)cc21 Toxic: <boolean>No</boolean> Target Molecule (Smiles): c1ccc2c(c1)CCCC2 Toxic:

c1ccc2c(c1)CCCC2

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1ccc(C(=O)O)cc1 Toxic:

Cc1ccc(C(=O)O)cc1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC1=CC(=O)CC(C)(C)C1 Toxic: <boolean>No</boolean> Example 2: Smiles: CCCC(=NOCC)C1=C(O)CC(CC(C)SCC)CC1=O Toxic: <boolean>No</boolean> Example 3: Smiles: CC1=CC(=O)CC(C)(C)C1(O)/C=C/C(C)=C\C(=O)O Toxic: <boolean>No</boolean> Example 4: Smiles: C=C(C)[C@@H]1CC=C(C)C(=O)C1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): C=C(C)C1CC=C(C)C(=O)C1 Toxic:

C=C(C)C1CC=C(C)C(=O)C1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): O=C(O)C(Cl)Cl Toxic:

O=C(O)C(Cl)Cl

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CC1(C)C(=O)C(C)(C)C1=O Toxic:

CC1(C)C(=O)C(C)(C)C1=O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CC(=O)C(=O)[O-] Toxic:

CC(=O)C(=O)[O-]

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[C@@H]1CN([C@H]2CC[C@](C#N)(c3ccc(F)cc3)CC2)CC[C@]1(C(=O)O)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: OC1CCCCC1c1ccccc1 Toxic: <boolean>No</boolean> Example 3: Smiles: COc1cccc([C@@]2(O)CCCC[C@@H]2CN(C)C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: O=C(CCCN1CCC(O)(c2ccc(Br)cc2)CC1)c1ccc(F)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCN(CC)CCOC(=O)C1(c2ccccc2)CCCC1.CCN(CC)CCOC(=O)C1(c2ccccc2)CCCC1.O=S(=O)(O)CCS(=O)(=O)O Toxic:

CCN(CC)CCOC(=O)C1(c2ccccc2)CCCC1.CCN(CC)CCOC(=O)C1(c2ccccc2)CCCC1.O=S(=O)(O)CCS(=O)(=O)O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cn1cnc2c1c(=O)[nH]c(=O)n2C Toxic: <boolean>No</boolean> Example 2: Smiles: Cn1c(=O)c2c(ncn2CC(O)CO)n(C)c1=O Toxic: <boolean>No</boolean> Example 3: Smiles: CC(O)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O Toxic: <boolean>No</boolean> Example 4: Smiles: Cn1c(=O)c2[nH]c(Br)nc2n(C)c1=O Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cn1c(=O)c2[nH]cnc2n(C)c1=O Toxic:

Cn1c(=O)c2[nH]cnc2n(C)c1=O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cc1occc(=O)c1OC(=O)C(C)C Toxic: <boolean>No</boolean> Example 2: Smiles: Cc1occc(=O)c1O Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=c1cc(CO)occ1O Toxic:

O=c1cc(CO)occ1O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): COCCOCCOCCOCCOCCO Toxic:

COCCOCCOCCOCCOCCO

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C=COCCOCCOCCOC=C Toxic:

C=COCCOCCOCCOC=C

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=C(O)c1cc(Cl)cc([N+](=O)[O-])c1Cl Toxic:

O=C(O)c1cc(Cl)cc([N+](=O)[O-])c1Cl

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C=C(C)C(=O)OCC(C)C Toxic:

C=C(C)C(=O)OCC(C)C

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): O=C([O-])C(=O)[O-].[Ca+2] Toxic:

O=C([O-])C(=O)[O-].[Ca+2]

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): O=C(O)C(Br)(Br)Br Toxic:

O=C(O)C(Br)(Br)Br

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): [Ca+2].[Cl-].[Cl-] Toxic:

[Ca+2].[Cl-].[Cl-]

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=C1c2cccc(O)c2C(=O)c2c(O)cccc21 Toxic: <boolean>No</boolean> Example 2: Smiles: O=C(O)CN1C(=O)c2cccc3cccc(c23)C1=O Toxic: <boolean>No</boolean> Example 3: Smiles: c1ccc2c(c1)c1cccc3ccc4cccc2c4c31 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccc2ccc3cccc4ccc1c2c34 Toxic: <boolean>No</boolean> Target Molecule (Smiles): c1ccc2c(c1)-c1cccc3cccc-2c13 Toxic:

c1ccc2c(c1)-c1cccc3cccc-2c13

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1ccc(C(=O)O)cc1 Toxic:

Cc1ccc(C(=O)O)cc1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1ccccc1C(N)=O Toxic:

Cc1ccccc1C(N)=O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCN(CC)CCc1nc(-c2ccccc2)no1.O=C(O)CC(O)(CC(=O)O)C(=O)O Toxic: <boolean>No</boolean> Example 2: Smiles: Nc1nc(N)c(-c2ccccc2)s1 Toxic: <boolean>No</boolean> Example 3: Smiles: Cc1nc(-c2ccc(Cl)cc2)oc1COC(C)(C)C(=O)O Toxic: <boolean>No</boolean> Example 4: Smiles: c1ccc(-c2nnn[nH]2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Nc1nc(N)nc(-c2cc(Cl)ccc2Cl)n1 Toxic:

Nc1nc(N)nc(-c2cc(Cl)ccc2Cl)n1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): C=Cc1ccccc1C=C Toxic:

C=Cc1ccccc1C=C

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cn1cnc2c1c(=O)[nH]c(=O)n2C Toxic: <boolean>No</boolean> Example 2: Smiles: Cn1c(=O)c2c(ncn2CC(O)CO)n(C)c1=O Toxic: <boolean>No</boolean> Example 3: Smiles: Cn1c(=O)c2[nH]c(Br)nc2n(C)c1=O Toxic: <boolean>No</boolean> Example 4: Smiles: Cn1c(=O)c2[nH]cnc2n(C)c1=O Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(O)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O Toxic:

CC(O)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CN(C)CCOCCO Toxic:

CN(C)CCOCCO

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCCCCCCCCCCCCO Toxic:

CCCCCCCCCCCCCO

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=NN(c1ccccc1)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CNC(=O)N(c1ccccc1)c1ccccc1 Toxic: <boolean>No</boolean> Example 3: Smiles: O=C(OCCOCCO)c1ccccc1Nc1cccc(C(F)(F)F)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: O=C([O-])c1ccccc1Nc1cc(Cl)ccc1C(=O)[O-] Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(C)(C)CC(C)(C)c1ccc(Nc2ccc(C(C)(C)CC(C)(C)C)cc2)cc1 Toxic:

CC(C)(C)CC(C)(C)c1ccc(Nc2ccc(C(C)(C)CC(C)(C)C)cc2)cc1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(C)OC(=O)COc1ccc(Cl)cc1Cl Toxic:

CC(C)OC(=O)COc1ccc(Cl)cc1Cl

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CC(C)CCCC(C)CC=O Toxic:

CC(C)CCCC(C)CC=O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C=CC=O Toxic:

C=CC=O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): [Zn+2] Toxic:

[Zn+2]

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=C(O)CCC(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)(C)c1nnc(NS(=O)(=O)c2ccccc2)s1 Toxic: <boolean>No</boolean> Example 3: Smiles: Cc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1 Toxic: <boolean>No</boolean> Example 4: Smiles: COc1ccc(S(=O)(=O)Nc2nnc(CC(C)C)s2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 Toxic:

Nc1ccc(S(=O)(=O)Nc2nccs2)cc1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): O=C(O)COCC(=O)O Toxic:

O=C(O)COCC(=O)O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC(=O)Nc1nnc(S(N)(=O)=O)s1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): CNC(=O)N(C)c1nnc(C(C)(C)C)s1 Toxic:

CNC(=O)N(C)c1nnc(C(C)(C)C)s1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CC(=O)CC(C)(C)O Toxic:

CC(=O)CC(C)(C)O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCN(Cc1ccc(Cl)nc1)/C(=C/[N+](=O)[O-])NC Toxic: <boolean>No</boolean> Example 2: Smiles: Cc1ncc(CO)c(CO)c1O Toxic: <boolean>No</boolean> Example 3: Smiles: CC(=O)c1cccnc1 Toxic: <boolean>No</boolean> Example 4: Smiles: NCc1cccnc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): ClCc1cccnc1 Toxic:

ClCc1cccnc1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): N=c1ccn2c(n1)O[C@H]1[C@H](O)[C@@H](CO)O[C@H]12 Toxic:

N=c1ccn2c(n1)O[C@H]1[C@H](O)[C@@H](CO)O[C@H]12

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCOCCOCCOCCO Toxic:

CCOCCOCCOCCO

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=C1CCCN1 Toxic: <boolean>No</boolean> Example 2: Smiles: O=C1CC[C@@H](C(=O)O)N1 Toxic: <boolean>No</boolean> Example 3: Smiles: CN1CCCC1=O Toxic: <boolean>No</boolean> Example 4: Smiles: NC(=O)CN1CCCC1=O Toxic: <boolean>No</boolean> Target Molecule (Smiles): C=CN1CCCC1=O Toxic:

C=CN1CCCC1=O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(-c2ccccc2)cc1 Toxic: <boolean>No</boolean> Example 2: Smiles: Nc1ccc(-c2ccc(N)cc2)cc1 Toxic: <boolean>No</boolean> Example 3: Smiles: Cc1ccc(-c2ccccc2)cc1 Toxic: <boolean>No</boolean> Example 4: Smiles: CCCCCCc1ccc(-c2ccc(C#N)cc2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=C(O)Cc1ccc(-c2ccccc2)cc1 Toxic:

O=C(O)Cc1ccc(-c2ccccc2)cc1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C=CC(C)(CCC=C(C)C)OC(=O)CC Toxic:

C=CC(C)(CCC=C(C)C)OC(=O)CC

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CC(C)Oc1ccccc1O Toxic:

CC(C)Oc1ccccc1O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCCCCCCC(=O)OC Toxic:

CCCCCCCC(=O)OC

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CO/N=C(/C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(Cn3nnc(C)n3)CS[C@H]12)c1csc(N)n1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1nnc(SCC2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)Cn4cnnn4)[C@H]3SC2)s1 Toxic:

Cc1nnc(SCC2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)Cn4cnnn4)[C@H]3SC2)s1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCCC(=O)Nc1ccc(OCC(O)CNC(C)C)c(C(C)=O)c1 Toxic:

CCCC(=O)Nc1ccc(OCC(O)CNC(C)C)c(C(C)=O)c1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCSC(=O)N(CC)CC Toxic:

CCSC(=O)N(CC)CC

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): Clc1ccc(Cl)cc1 Toxic:

Clc1ccc(Cl)cc1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc2c(c1)Nc1ccccc1S2 Toxic: <boolean>No</boolean> Example 2: Smiles: c1ccc2c(c1)Oc1ccccc1S2 Toxic: <boolean>No</boolean> Example 3: Smiles: NC(=O)N1c2ccccc2C=Cc2ccccc21 Toxic: <boolean>Yes</boolean> Example 4: Smiles: CC(C(=O)O)c1ccc2c(c1)CC(=O)c1ccccc1S2 Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCN(CC)C(C)CN1c2ccccc2Sc2ccccc21 Toxic:

CCN(CC)C(C)CN1c2ccccc2Sc2ccccc21

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CN(C)CCc1c[nH]c2cccc(OP(=O)(O)O)c12 Toxic: <boolean>No</boolean> Example 2: Smiles: COc1ccc2[nH]cc(CCNC(C)=O)c2c1 Toxic: <boolean>No</boolean> Example 3: Smiles: Cc1c[nH]c2ccccc12 Toxic: <boolean>No</boolean> Example 4: Smiles: c1ccc2[nH]ccc2c1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): O=C(O)Cc1c[nH]c2ccccc12 Toxic:

O=C(O)Cc1c[nH]c2ccccc12

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Clc1sc(Cl)c(Cl)c1Cl Toxic: <boolean>No</boolean> Example 2: Smiles: COC(=O)c1sccc1S(N)(=O)=O Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCCNC(C)C(=O)Nc1c(C)csc1C(=O)OC Toxic:

CCCNC(C)C(=O)Nc1c(C)csc1C(=O)OC

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CN(C(=O)Cc1cccc2occc12)[C@H]1CC[C@@]2(CCCO2)C[C@@H]1N1CCCC1 Toxic:

CN(C(=O)Cc1cccc2occc12)[C@H]1CC[C@@]2(CCCO2)C[C@@H]1N1CCCC1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC1=CC(O)CC(C)(C)C1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC1=C(CC=O)C(C)(C)CCC1 Toxic: <boolean>No</boolean> Example 3: Smiles: CC(=O)/C=C/C1=C(C)CCCC1(C)C Toxic: <boolean>No</boolean> Example 4: Smiles: CCC(=O)/C=C/C1C(C)=CCCC1(C)C Toxic: <boolean>No</boolean> Target Molecule (Smiles): C=C(C)C1CC=C(C)CC1 Toxic:

C=C(C)C1CC=C(C)CC1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C[N+](=O)[O-] Toxic:

C[N+](=O)[O-]

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C=CCOCC(O)CO Toxic:

C=CCOCC(O)CO

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1cc(O)ccc1Cl Toxic:

Cc1cc(O)ccc1Cl

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: COc1c2occc2cc2ccc(=O)oc12 Toxic: <boolean>No</boolean> Example 2: Smiles: CCCc1c2oc(C(=O)O)cc(=O)c2cc2c(=O)cc(C(=O)O)n(CC)c12 Toxic: <boolean>No</boolean> Target Molecule (Smiles): COc1c2occc2c(OC)c2c(=O)cc(C)oc12 Toxic:

COc1c2occc2c(OC)c2c(=O)cc(C)oc12

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C=C(C)C(=O)OCCO Toxic:

C=C(C)C(=O)OCCO

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=C(NCCc1c[nH]c2ccccc12)c1cccnc1 Toxic: <boolean>No</boolean> Example 2: Smiles: O=C([O-])c1[nH]n(-c2ccc(S(=O)(=O)[O-])cc2)c(=O)c1/N=N/c1ccc(S(=O)(=O)[O-])cc1 Toxic: <boolean>No</boolean> Example 3: Smiles: O=C(NCc1cccnc1)Nc1ccc([N+](=O)[O-])cc1 Toxic: <boolean>No</boolean> Example 4: Smiles: Nc1ccc(NC(=O)c2ccc(N)cc2)cc1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1c(NC(=O)c2cccnc2)c(=O)n(-c2ccccc2)n1C Toxic:

Cc1c(NC(=O)c2cccnc2)c(=O)n(-c2ccccc2)n1C

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC(=O)Nc1nnc(S(N)(=O)=O)s1 Toxic: <boolean>No</boolean> Target Molecule (Smiles): CNC(=O)N(C)c1nnc(C(C)(C)C)s1 Toxic:

CNC(=O)N(C)c1nnc(C(C)(C)C)s1

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): CCOc1ccccc1O Toxic:

CCOc1ccccc1O

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): COc1ccc(-c2ccc3cc(C(=O)O)ccc3c2)cc1C12CC3CC(CC(C3)C1)C2 Toxic:

COc1ccc(-c2ccc3cc(C(=O)O)ccc3c2)cc1C12CC3CC(CC(C3)C1)C2

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: O=S(=O)(Cl)c1ccccc1 Toxic: <boolean>No</boolean> Example 2: Smiles: CC(C)N(c1ccccc1)C(C)C Toxic: <boolean>No</boolean> Example 3: Smiles: CCc1cccc(C)c1 Toxic: <boolean>No</boolean> Example 4: Smiles: Cc1ccccc1CCO Toxic: <boolean>No</boolean> Target Molecule (Smiles): Cc1cc(C)c(NC(=O)CN(CC(=O)O)CC(=O)O)c(C)c1Br Toxic:

Cc1cc(C)c(NC(=O)CN(CC(=O)O)CC(=O)O)c(C)c1Br

scaffold

4

smiles

You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule exhibits androgen receptor antagonist activity (Yes) or not (No). Consider all molecular properties provided to assess the compound's potential and its interaction with the androgen receptor. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C[Si](C)(C)Cl Toxic:

C[Si](C)(C)Cl

scaffold

4

smiles