Dataset Viewer
input_text
stringlengths 612
931
| output_text
stringclasses 3
values |
|---|---|
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(NO)Nc1ccc(C(F)(F)F)cc1.
molecular properties: Molecular weight 220.15, partition coefficient: 2.22, Hydrgen-bond acceptors: 2,
Hydrgen-bond donors: 3, Polariable Surface Area: 61.36, Rotatable bonds: 1, Aromatic rings: 1.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(/C=C/c1ccc(O)cc1)c1ccc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1.
molecular properties: Molecular weight 424.43, partition coefficient: 4.00, Hydrgen-bond acceptors: 6,
Hydrgen-bond donors: 2, Polariable Surface Area: 126.61, Rotatable bonds: 7, Aromatic rings: 3.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : Oc1ccc(CCc2ccc(O)cc2O[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)c(O)c1.
molecular properties: Molecular weight 378.38, partition coefficient: 0.41, Hydrgen-bond acceptors: 8,
Hydrgen-bond donors: 6, Polariable Surface Area: 139.84, Rotatable bonds: 5, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=Cc1ccco1.
molecular properties: Molecular weight 96.08, partition coefficient: 1.09, Hydrgen-bond acceptors: 2,
Hydrgen-bond donors: 0, Polariable Surface Area: 30.21, Rotatable bonds: 1, Aromatic rings: 1.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC(C)OC(=O)/C=C/c1cc(=O)c(O)co1.
molecular properties: Molecular weight 224.21, partition coefficient: 1.31, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 1, Polariable Surface Area: 76.74, Rotatable bonds: 3, Aromatic rings: 1.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=c1c(O)c(-c2cccc([N+](=O)[O-])c2)oc2cc(Br)cc(Br)c12.
molecular properties: Molecular weight 441.03, partition coefficient: 4.60, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 1, Polariable Surface Area: 93.58, Rotatable bonds: 2, Aromatic rings: 3.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : Cc1cc(OCc2cn(Cc3ccc(F)cc3)nn2)c(C=C2C(=O)NC(=S)NC2=O)cc1Br.
molecular properties: Molecular weight 530.38, partition coefficient: 3.03, Hydrgen-bond acceptors: 6,
Hydrgen-bond donors: 2, Polariable Surface Area: 98.14, Rotatable bonds: 6, Aromatic rings: 3.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1ccc(-c2cc(=O)c3c(Br)cc(Br)cc3o2)cc1OC.
molecular properties: Molecular weight 440.09, partition coefficient: 5.00, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 0, Polariable Surface Area: 48.67, Rotatable bonds: 3, Aromatic rings: 3.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : C=C1OC(=O)/C(=C\CCCCCCCCCCCCC)[C@H]1O.
molecular properties: Molecular weight 308.46, partition coefficient: 5.05, Hydrgen-bond acceptors: 3,
Hydrgen-bond donors: 1, Polariable Surface Area: 46.53, Rotatable bonds: 12, Aromatic rings: 0.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : C/C(CCc1ccc(O)cc1)=N\NC(=S)NN.
molecular properties: Molecular weight 252.34, partition coefficient: 1.04, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 4, Polariable Surface Area: 82.67, Rotatable bonds: 4, Aromatic rings: 1.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC[C@H](C)[C@H](NC(=O)[C@H](CS)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC(=O)[C@@H](N)[C@@H](C)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CS)C(=O)N[C@@H](CO)C(=O)O.
molecular properties: Molecular weight 1648.00, partition coefficient: -8.27, Hydrgen-bond acceptors: 27,
Hydrgen-bond donors: 31, Polariable Surface Area: 731.18, Rotatable bonds: 56, Aromatic rings: 2.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC1=CC[C@@H](C(C)(C)O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)CC1.
molecular properties: Molecular weight 316.39, partition coefficient: 0.33, Hydrgen-bond acceptors: 6,
Hydrgen-bond donors: 4, Polariable Surface Area: 99.38, Rotatable bonds: 4, Aromatic rings: 0.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1ccc(C(=O)O)cc1.
molecular properties: Molecular weight 152.15, partition coefficient: 1.39, Hydrgen-bond acceptors: 3,
Hydrgen-bond donors: 1, Polariable Surface Area: 46.53, Rotatable bonds: 2, Aromatic rings: 1.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CCCOC(=O)CCc1ccc(/C(C)=N/NC(N)=S)cc1.
molecular properties: Molecular weight 307.42, partition coefficient: 2.13, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 2, Polariable Surface Area: 76.71, Rotatable bonds: 7, Aromatic rings: 1.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : Oc1ccc(C2CC(c3ccc(O)cc3O)=NN2)cc1.
molecular properties: Molecular weight 270.29, partition coefficient: 2.24, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 4, Polariable Surface Area: 85.08, Rotatable bonds: 2, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(OC[C@@H]1O[C@@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@@H](O)[C@H](O)[C@H]1O)c1cc(O)c(O)c(O)c1.
molecular properties: Molecular weight 616.48, partition coefficient: 0.44, Hydrgen-bond acceptors: 16,
Hydrgen-bond donors: 10, Polariable Surface Area: 277.27, Rotatable bonds: 6, Aromatic rings: 4.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : C(=N/Nc1nc(C23CC4CC(CC(C4)C2)C3)cs1)\c1cc2ccccc2s1.
molecular properties: Molecular weight 393.58, partition coefficient: 6.27, Hydrgen-bond acceptors: 2,
Hydrgen-bond donors: 1, Polariable Surface Area: 37.28, Rotatable bonds: 4, Aromatic rings: 3.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1ccc2oc3ccccc3c(=O)c2c1.
molecular properties: Molecular weight 226.23, partition coefficient: 2.95, Hydrgen-bond acceptors: 3,
Hydrgen-bond donors: 0, Polariable Surface Area: 39.44, Rotatable bonds: 1, Aromatic rings: 3.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : C[C@@H](O)CCc1ccc(O)cc1O.
molecular properties: Molecular weight 182.22, partition coefficient: 1.41, Hydrgen-bond acceptors: 3,
Hydrgen-bond donors: 3, Polariable Surface Area: 60.69, Rotatable bonds: 3, Aromatic rings: 1.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1ccc(-c2nc(-c3ccc(O)cc3O)cs2)c(OC)c1.
molecular properties: Molecular weight 329.38, partition coefficient: 3.91, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 2, Polariable Surface Area: 71.81, Rotatable bonds: 4, Aromatic rings: 3.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=c1cc(CSc2nnc(-c3ccc(Cl)cc3)n2NCc2ccccc2O)occ1O.
molecular properties: Molecular weight 456.91, partition coefficient: 4.00, Hydrgen-bond acceptors: 8,
Hydrgen-bond donors: 3, Polariable Surface Area: 113.41, Rotatable bonds: 7, Aromatic rings: 4.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : C[C@@H]1O[C@@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@H](O)[C@H](O)[C@H]1O.
molecular properties: Molecular weight 448.38, partition coefficient: 0.49, Hydrgen-bond acceptors: 11,
Hydrgen-bond donors: 7, Polariable Surface Area: 190.28, Rotatable bonds: 3, Aromatic rings: 3.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COCCOc1ccc(CC2C(=O)NC(=S)NC2=O)cc1.
molecular properties: Molecular weight 308.36, partition coefficient: 0.40, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 2, Polariable Surface Area: 76.66, Rotatable bonds: 6, Aromatic rings: 1.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : C/C(=N\NC(N)=S)c1ccc(NC(=O)C(Cl)(Cl)Cl)cc1.
molecular properties: Molecular weight 353.66, partition coefficient: 2.55, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 3, Polariable Surface Area: 79.51, Rotatable bonds: 3, Aromatic rings: 1.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C1/C(=C/c2ccc(O)cc2O)Oc2c1ccc(O)c2O.
molecular properties: Molecular weight 286.24, partition coefficient: 2.13, Hydrgen-bond acceptors: 6,
Hydrgen-bond donors: 4, Polariable Surface Area: 107.22, Rotatable bonds: 1, Aromatic rings: 2.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC(C)[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)Cc1ccccc1)[C@@H](C)O)C(=O)N[C@@H](CS)C(=O)O.
molecular properties: Molecular weight 971.18, partition coefficient: -5.55, Hydrgen-bond acceptors: 16,
Hydrgen-bond donors: 19, Polariable Surface Area: 431.28, Rotatable bonds: 30, Aromatic rings: 1.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(c1ccc(C(F)(F)F)cc1)N1CCN(Cc2ccc(F)cc2)CC1.
molecular properties: Molecular weight 366.36, partition coefficient: 3.80, Hydrgen-bond acceptors: 2,
Hydrgen-bond donors: 0, Polariable Surface Area: 23.55, Rotatable bonds: 3, Aromatic rings: 2.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CCOC(=O)Cc1ccc(/C(C)=N/NC(N)=S)cc1.
molecular properties: Molecular weight 279.37, partition coefficient: 1.35, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 2, Polariable Surface Area: 76.71, Rotatable bonds: 5, Aromatic rings: 1.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC(=O)OC[C@H]1O[C@@H](Oc2ccc(C=C3C(=O)NC(=O)NC3=O)cc2)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O.
molecular properties: Molecular weight 562.48, partition coefficient: -0.10, Hydrgen-bond acceptors: 13,
Hydrgen-bond donors: 2, Polariable Surface Area: 198.93, Rotatable bonds: 8, Aromatic rings: 1.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1cc(/C=C/C(=O)NCCc2ccc(O)c(O)c2)ccc1O.
molecular properties: Molecular weight 329.35, partition coefficient: 2.18, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 4, Polariable Surface Area: 99.02, Rotatable bonds: 6, Aromatic rings: 2.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : Oc1ccc(CCc2ccc(O)cc2O)c(O)c1.
molecular properties: Molecular weight 246.26, partition coefficient: 2.29, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 4, Polariable Surface Area: 80.92, Rotatable bonds: 3, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1cc(C=O)ccc1O.
molecular properties: Molecular weight 152.15, partition coefficient: 1.21, Hydrgen-bond acceptors: 3,
Hydrgen-bond donors: 1, Polariable Surface Area: 46.53, Rotatable bonds: 2, Aromatic rings: 1.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(O)/C=C/c1ccc(O)cc1.
molecular properties: Molecular weight 164.16, partition coefficient: 1.49, Hydrgen-bond acceptors: 3,
Hydrgen-bond donors: 2, Polariable Surface Area: 57.53, Rotatable bonds: 2, Aromatic rings: 1.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3CC[C@@]21C.
molecular properties: Molecular weight 310.44, partition coefficient: 3.66, Hydrgen-bond acceptors: 2,
Hydrgen-bond donors: 1, Polariable Surface Area: 37.30, Rotatable bonds: 0, Aromatic rings: 0.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=Cc1ccc(O)cc1.
molecular properties: Molecular weight 122.12, partition coefficient: 1.20, Hydrgen-bond acceptors: 2,
Hydrgen-bond donors: 1, Polariable Surface Area: 37.30, Rotatable bonds: 1, Aromatic rings: 1.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=c1c2ccccc2oc2ccc(O)c(O)c12.
molecular properties: Molecular weight 228.20, partition coefficient: 2.36, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 2, Polariable Surface Area: 70.67, Rotatable bonds: 0, Aromatic rings: 3.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(O)/C=C/c1ccccc1O.
molecular properties: Molecular weight 164.16, partition coefficient: 1.49, Hydrgen-bond acceptors: 3,
Hydrgen-bond donors: 2, Polariable Surface Area: 57.53, Rotatable bonds: 2, Aromatic rings: 1.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : C[C@@H](CCc1ccc(O)cc1O)O[C@@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O.
molecular properties: Molecular weight 506.50, partition coefficient: -2.94, Hydrgen-bond acceptors: 13,
Hydrgen-bond donors: 9, Polariable Surface Area: 218.99, Rotatable bonds: 9, Aromatic rings: 1.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H](O)[C@@H]2O)ccc1O.
molecular properties: Molecular weight 478.41, partition coefficient: -0.24, Hydrgen-bond acceptors: 12,
Hydrgen-bond donors: 7, Polariable Surface Area: 199.51, Rotatable bonds: 5, Aromatic rings: 3.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : Oc1cc(O)c2cc(O)c(-c3cc(O)c(O)c(O)c3)[o+]c2c1.
molecular properties: Molecular weight 303.25, partition coefficient: 2.61, Hydrgen-bond acceptors: 7,
Hydrgen-bond donors: 6, Polariable Surface Area: 132.68, Rotatable bonds: 1, Aromatic rings: 3.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1ccc(C(C)=O)c(OC(=O)/C=C/c2ccc(F)cc2)c1.
molecular properties: Molecular weight 314.31, partition coefficient: 3.66, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 0, Polariable Surface Area: 52.60, Rotatable bonds: 5, Aromatic rings: 2.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1ccc(C(=O)NCc2ccc(O)cc2O)c(O)c1.
molecular properties: Molecular weight 289.29, partition coefficient: 1.74, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 4, Polariable Surface Area: 99.02, Rotatable bonds: 4, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1ccc(C(=O)OCc2cc(=O)c(O)co2)cc1.
molecular properties: Molecular weight 276.24, partition coefficient: 1.71, Hydrgen-bond acceptors: 6,
Hydrgen-bond donors: 1, Polariable Surface Area: 85.97, Rotatable bonds: 4, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1cc(/C=C/C(=O)c2cc(OC)c(OC)c(-c3cc(C(=O)/C=C/c4ccc(O)c(OC)c4)cc(OC)c3OC)c2)ccc1O.
molecular properties: Molecular weight 626.66, partition coefficient: 6.61, Hydrgen-bond acceptors: 10,
Hydrgen-bond donors: 2, Polariable Surface Area: 129.98, Rotatable bonds: 13, Aromatic rings: 4.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC(=O)c1ccc(OCc2cn(Cc3cc(=O)c(O)co3)nn2)cc1.
molecular properties: Molecular weight 341.32, partition coefficient: 1.77, Hydrgen-bond acceptors: 7,
Hydrgen-bond donors: 1, Polariable Surface Area: 107.45, Rotatable bonds: 6, Aromatic rings: 3.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC(C)c1ccc(C=O)c(O)c1.
molecular properties: Molecular weight 164.20, partition coefficient: 2.33, Hydrgen-bond acceptors: 2,
Hydrgen-bond donors: 1, Polariable Surface Area: 37.30, Rotatable bonds: 2, Aromatic rings: 1.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COC1=CC(=C/C=C/C=C2C=C(OC)C(=O)C(OC)=C2)C=C(OC)C1=O.
molecular properties: Molecular weight 356.37, partition coefficient: 2.68, Hydrgen-bond acceptors: 6,
Hydrgen-bond donors: 0, Polariable Surface Area: 71.06, Rotatable bonds: 6, Aromatic rings: 0.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : C/C(CCc1ccc(OCc2ccccc2)cc1)=N\NC(N)=S.
molecular properties: Molecular weight 327.45, partition coefficient: 3.41, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 2, Polariable Surface Area: 59.64, Rotatable bonds: 7, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(OC[C@@H]1O[C@@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@@H](O)[C@H](O)[C@@H]1O)c1cc(O)c(O)c(O)c1.
molecular properties: Molecular weight 616.48, partition coefficient: 0.44, Hydrgen-bond acceptors: 16,
Hydrgen-bond donors: 10, Polariable Surface Area: 277.27, Rotatable bonds: 6, Aromatic rings: 4.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC(C)=CCc1c(O)ccc(C=CC(=O)c2ccc(O)cc2O)c1O.
molecular properties: Molecular weight 340.38, partition coefficient: 3.91, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 4, Polariable Surface Area: 97.99, Rotatable bonds: 5, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)ccc1O.
molecular properties: Molecular weight 300.27, partition coefficient: 2.59, Hydrgen-bond acceptors: 6,
Hydrgen-bond donors: 3, Polariable Surface Area: 100.13, Rotatable bonds: 2, Aromatic rings: 3.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : Cc1c(O)ccc2c1O/C(=C\c1ccc(O)cc1O)C2=O.
molecular properties: Molecular weight 284.27, partition coefficient: 2.73, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 3, Polariable Surface Area: 86.99, Rotatable bonds: 1, Aromatic rings: 2.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : Cc1ccc(NC(=S)Nc2nnc(SCC(=O)O)s2)cc1.
molecular properties: Molecular weight 340.46, partition coefficient: 2.83, Hydrgen-bond acceptors: 8,
Hydrgen-bond donors: 3, Polariable Surface Area: 87.14, Rotatable bonds: 5, Aromatic rings: 2.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1cc2c(c(OC)c1CC=C(C)C)C[C@H](c1ccc(O)cc1O)CO2.
molecular properties: Molecular weight 370.45, partition coefficient: 4.34, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 2, Polariable Surface Area: 68.15, Rotatable bonds: 5, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : C=CCc1ccc(OCc2cn(Cc3cc(=O)c(O)co3)nn2)c(OC)c1.
molecular properties: Molecular weight 369.38, partition coefficient: 2.30, Hydrgen-bond acceptors: 7,
Hydrgen-bond donors: 1, Polariable Surface Area: 99.61, Rotatable bonds: 8, Aromatic rings: 3.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : OC[C@H]1O[C@@H](OCCCCCCCCCCCCCCc2ccc(O)cc2O)[C@H](O)[C@@H](O)[C@@H]1O.
molecular properties: Molecular weight 484.63, partition coefficient: 3.14, Hydrgen-bond acceptors: 8,
Hydrgen-bond donors: 6, Polariable Surface Area: 139.84, Rotatable bonds: 17, Aromatic rings: 1.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(/C=C/c1ccc(O)cc1)OC1=C(O)C(=O)O[C@@H]1[C@H](O)CO.
molecular properties: Molecular weight 322.27, partition coefficient: -0.00, Hydrgen-bond acceptors: 8,
Hydrgen-bond donors: 4, Polariable Surface Area: 133.52, Rotatable bonds: 5, Aromatic rings: 1.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1c2c(cc3c1C[C@H](c1ccc(O)cc1O)CO3)OC(C)(C)C=C2.
molecular properties: Molecular weight 354.40, partition coefficient: 4.01, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 2, Polariable Surface Area: 68.15, Rotatable bonds: 2, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(O)c1ccc(OCc2cn(Cc3cc(=O)c(O)co3)nn2)cc1.
molecular properties: Molecular weight 343.30, partition coefficient: 1.26, Hydrgen-bond acceptors: 8,
Hydrgen-bond donors: 2, Polariable Surface Area: 127.68, Rotatable bonds: 6, Aromatic rings: 3.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CCCCOC(=O)CCCc1ccc(/C(C)=N/NC(N)=S)cc1.
molecular properties: Molecular weight 335.47, partition coefficient: 2.91, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 2, Polariable Surface Area: 76.71, Rotatable bonds: 9, Aromatic rings: 1.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CCCOc1cccc(O)c1C(=O)C=Cc1ccc(CO)cc1.
molecular properties: Molecular weight 312.37, partition coefficient: 3.57, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 2, Polariable Surface Area: 66.76, Rotatable bonds: 7, Aromatic rings: 2.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(c1ccccc1F)N1CCN(Cc2ccc(F)cc2)CC1.
molecular properties: Molecular weight 316.35, partition coefficient: 2.92, Hydrgen-bond acceptors: 2,
Hydrgen-bond donors: 0, Polariable Surface Area: 23.55, Rotatable bonds: 3, Aromatic rings: 2.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC(=O)N1N=C(c2ccc(O)cc2O)CC1c1cccc(O)c1.
molecular properties: Molecular weight 312.32, partition coefficient: 2.50, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 3, Polariable Surface Area: 93.36, Rotatable bonds: 2, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(O)[C@H]1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)[C@H](O)[C@@H](O)[C@@H]1O.
molecular properties: Molecular weight 462.36, partition coefficient: -0.15, Hydrgen-bond acceptors: 12,
Hydrgen-bond donors: 7, Polariable Surface Area: 207.35, Rotatable bonds: 4, Aromatic rings: 3.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=c1c(O)c(-c2cc(O)c(O)c(O)c2)oc2cc(O)ccc12.
molecular properties: Molecular weight 302.24, partition coefficient: 1.99, Hydrgen-bond acceptors: 7,
Hydrgen-bond donors: 5, Polariable Surface Area: 131.36, Rotatable bonds: 1, Aromatic rings: 3.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C1C(=Cc2ccc(O)cc2)Oc2cc(O)ccc21.
molecular properties: Molecular weight 254.24, partition coefficient: 2.71, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 2, Polariable Surface Area: 66.76, Rotatable bonds: 1, Aromatic rings: 2.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=c1cc(-c2ccc(O)c(O)c2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O[C@@H]3OC[C@@H](O)[C@H](O)C3O)cc(O)c12.
molecular properties: Molecular weight 580.50, partition coefficient: -1.78, Hydrgen-bond acceptors: 15,
Hydrgen-bond donors: 9, Polariable Surface Area: 249.20, Rotatable bonds: 6, Aromatic rings: 3.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : N[C@@H](Cc1ccc(O)c(O)c1)C(=O)NCCCCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O.
molecular properties: Molecular weight 537.57, partition coefficient: 0.77, Hydrgen-bond acceptors: 9,
Hydrgen-bond donors: 6, Polariable Surface Area: 191.16, Rotatable bonds: 11, Aromatic rings: 2.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : Cc1ccc(C(=O)Nc2cccc(C(=O)/C=C/c3ccc4c(c3)c3ccccc3n4C)c2)cc1.
molecular properties: Molecular weight 444.53, partition coefficient: 6.79, Hydrgen-bond acceptors: 2,
Hydrgen-bond donors: 1, Polariable Surface Area: 51.10, Rotatable bonds: 5, Aromatic rings: 5.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CCCCOc1cccc2c1C(=O)c1c(OCCCC)cc(CO)cc1C2=O.
molecular properties: Molecular weight 382.46, partition coefficient: 4.31, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 1, Polariable Surface Area: 72.83, Rotatable bonds: 9, Aromatic rings: 3.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@@H](N)Cc1ccccc1)C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CS)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)O)[C@@H](C)O)[C@@H](C)CC.
molecular properties: Molecular weight 1407.81, partition coefficient: -1.81, Hydrgen-bond acceptors: 18,
Hydrgen-bond donors: 18, Polariable Surface Area: 470.21, Rotatable bonds: 43, Aromatic rings: 1.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1ccc(/C=C/C(=O)NCCc2c[nH]c3ccc(O)cc23)cc1OC.
molecular properties: Molecular weight 366.42, partition coefficient: 3.26, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 3, Polariable Surface Area: 83.58, Rotatable bonds: 7, Aromatic rings: 3.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC(C)=CCc1c2c(c(O)c3c1O[C@H](c1ccc(O)cc1O)CC3=O)C=CC(C)(C)O2.
molecular properties: Molecular weight 422.48, partition coefficient: 5.20, Hydrgen-bond acceptors: 6,
Hydrgen-bond donors: 3, Polariable Surface Area: 96.22, Rotatable bonds: 3, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC(C)Nc1nc(-c2ccc(O)cc2O)cs1.
molecular properties: Molecular weight 250.32, partition coefficient: 3.04, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 3, Polariable Surface Area: 65.38, Rotatable bonds: 3, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(Nc1nc(-c2ccc(O)cc2O)cs1)c1ccc(CO)cc1.
molecular properties: Molecular weight 342.38, partition coefficient: 2.97, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 4, Polariable Surface Area: 102.68, Rotatable bonds: 4, Aromatic rings: 3.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1ccc(-c2cc3cc(Br)cc(OC)c3oc2=O)cc1.
molecular properties: Molecular weight 361.19, partition coefficient: 4.24, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 0, Polariable Surface Area: 48.67, Rotatable bonds: 3, Aromatic rings: 3.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CCCOC(=O)CCC(=O)c1cc(C)c(OCC)cc1C(C)C.
molecular properties: Molecular weight 320.43, partition coefficient: 4.43, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 0, Polariable Surface Area: 52.60, Rotatable bonds: 9, Aromatic rings: 1.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC(c1ccccc1)c1ccc(O)cc1O.
molecular properties: Molecular weight 214.26, partition coefficient: 3.25, Hydrgen-bond acceptors: 2,
Hydrgen-bond donors: 2, Polariable Surface Area: 40.46, Rotatable bonds: 2, Aromatic rings: 2.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1c(O)cc2oc3ccccc3c(=O)c2c1O.
molecular properties: Molecular weight 258.23, partition coefficient: 2.37, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 2, Polariable Surface Area: 79.90, Rotatable bonds: 1, Aromatic rings: 3.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CNC(=S)N/N=C(\C)c1ccc(OC)cc1O.
molecular properties: Molecular weight 253.33, partition coefficient: 1.22, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 3, Polariable Surface Area: 65.88, Rotatable bonds: 3, Aromatic rings: 1.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1ccc(C(=O)OCc2cc(=O)c(O)co2)c(O)c1.
molecular properties: Molecular weight 292.24, partition coefficient: 1.42, Hydrgen-bond acceptors: 7,
Hydrgen-bond donors: 2, Polariable Surface Area: 106.20, Rotatable bonds: 4, Aromatic rings: 2.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CNC(=S)N/N=C(\C)c1ccc(O)cc1O.
molecular properties: Molecular weight 239.30, partition coefficient: 0.92, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 4, Polariable Surface Area: 76.88, Rotatable bonds: 2, Aromatic rings: 1.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(/C=C/c1ccc(O)cc1)NCCCNC(=O)/C=C/c1ccc(O)cc1.
molecular properties: Molecular weight 366.42, partition coefficient: 2.45, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 4, Polariable Surface Area: 98.66, Rotatable bonds: 8, Aromatic rings: 2.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC(C)[C@H](NC(=O)OCc1cc(=O)c(O)co1)C(=O)OCc1cc(=O)c(O)co1.
molecular properties: Molecular weight 409.35, partition coefficient: 1.00, Hydrgen-bond acceptors: 10,
Hydrgen-bond donors: 3, Polariable Surface Area: 165.51, Rotatable bonds: 7, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=Cc1ccc(O[C@@H]2OC[C@@H](O)[C@@H](O)[C@H]2O)cc1.
molecular properties: Molecular weight 254.24, partition coefficient: -0.68, Hydrgen-bond acceptors: 6,
Hydrgen-bond donors: 3, Polariable Surface Area: 96.22, Rotatable bonds: 3, Aromatic rings: 1.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC(C)c1ccccc(=O)c1O.
molecular properties: Molecular weight 164.20, partition coefficient: 1.88, Hydrgen-bond acceptors: 2,
Hydrgen-bond donors: 1, Polariable Surface Area: 37.30, Rotatable bonds: 1, Aromatic rings: 1.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : CC(=O)Oc1c(/N=N/c2ccc(C3=N/C(=C/c4ccc(OC(F)(F)F)cc4)C(=O)O3)cc2)ccc2ccccc12.
molecular properties: Molecular weight 545.47, partition coefficient: 7.42, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 0, Polariable Surface Area: 98.91, Rotatable bonds: 6, Aromatic rings: 4.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(c1ccc(F)cc1F)N1CCN(Cc2ccc(F)cc2)CC1.
molecular properties: Molecular weight 334.34, partition coefficient: 3.06, Hydrgen-bond acceptors: 2,
Hydrgen-bond donors: 0, Polariable Surface Area: 23.55, Rotatable bonds: 3, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(c1ccc(C(F)(F)F)cc1C(F)(F)F)N1CCN(Cc2ccc(F)cc2)CC1.
molecular properties: Molecular weight 434.36, partition coefficient: 4.82, Hydrgen-bond acceptors: 2,
Hydrgen-bond donors: 0, Polariable Surface Area: 23.55, Rotatable bonds: 3, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1cc(N)ccc1C=CC(=O)c1ccccc1O.
molecular properties: Molecular weight 269.30, partition coefficient: 2.88, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 2, Polariable Surface Area: 72.55, Rotatable bonds: 4, Aromatic rings: 2.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(/C=C/c1ccc(O)cc1O)c1ccco1.
molecular properties: Molecular weight 230.22, partition coefficient: 2.59, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 2, Polariable Surface Area: 70.67, Rotatable bonds: 3, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(NCc1ccc(O)cc1O)c1cc(O)cc(O)c1.
molecular properties: Molecular weight 275.26, partition coefficient: 1.44, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 5, Polariable Surface Area: 110.02, Rotatable bonds: 3, Aromatic rings: 2.
Answer: | (A) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)C=Cc3ccc(O)cc3)cc2)cc1.
molecular properties: Molecular weight 393.46, partition coefficient: 4.40, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 2, Polariable Surface Area: 83.47, Rotatable bonds: 6, Aromatic rings: 3.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C(O)CSc1nnc(NC(=S)Nc2ccc(Cl)cc2)s1.
molecular properties: Molecular weight 360.87, partition coefficient: 3.18, Hydrgen-bond acceptors: 8,
Hydrgen-bond donors: 3, Polariable Surface Area: 87.14, Rotatable bonds: 5, Aromatic rings: 2.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C1C(=Cc2ccc(O)cc2O)Oc2ccc(O)cc21.
molecular properties: Molecular weight 270.24, partition coefficient: 2.42, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 3, Polariable Surface Area: 86.99, Rotatable bonds: 1, Aromatic rings: 2.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=C1/C(=C/c2ccc(O)c(Br)c2)CSc2ccccc21.
molecular properties: Molecular weight 347.23, partition coefficient: 4.53, Hydrgen-bond acceptors: 3,
Hydrgen-bond donors: 1, Polariable Surface Area: 37.30, Rotatable bonds: 1, Aromatic rings: 2.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : Oc1ccc2cc[nH]c2c1.
molecular properties: Molecular weight 133.15, partition coefficient: 1.87, Hydrgen-bond acceptors: 1,
Hydrgen-bond donors: 2, Polariable Surface Area: 36.02, Rotatable bonds: 0, Aromatic rings: 2.
Answer: | (B) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc2c1.
molecular properties: Molecular weight 316.27, partition coefficient: 2.29, Hydrgen-bond acceptors: 7,
Hydrgen-bond donors: 4, Polariable Surface Area: 120.36, Rotatable bonds: 2, Aromatic rings: 3.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : O=c1c(-c2cccc(O)c2)coc2cc(O)ccc12.
molecular properties: Molecular weight 254.24, partition coefficient: 2.87, Hydrgen-bond acceptors: 4,
Hydrgen-bond donors: 2, Polariable Surface Area: 70.67, Rotatable bonds: 1, Aromatic rings: 3.
Answer: | (C) |
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar.
drug SMILES : COc1cccc(OC(=O)COC(=O)/C=C/c2ccccc2)c1.
molecular properties: Molecular weight 312.32, partition coefficient: 2.86, Hydrgen-bond acceptors: 5,
Hydrgen-bond donors: 0, Polariable Surface Area: 61.83, Rotatable bonds: 6, Aromatic rings: 2.
Answer: | (B) |
End of preview. Expand
in Data Studio
README.md exists but content is empty.
- Downloads last month
- 19