input_text
stringlengths
612
931
output_text
stringclasses
3 values
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C(OCc1ccc(O)cc1)c1cc(O)c(O)c(O)c1. molecular properties: Molecular weight 276.24, partition coefficient: 1.87, Hydrgen-bond acceptors: 6, Hydrgen-bond donors: 4, Polariable Surface Area: 107.22, Rotatable bonds: 3, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(CC/C(C)=N/NC(=S)NN)cc1. molecular properties: Molecular weight 266.37, partition coefficient: 1.34, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 3, Polariable Surface Area: 71.67, Rotatable bonds: 5, Aromatic rings: 1. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C1OC(c2ccc(/N=N/c3ccc(N4CCOCC4)cc3)cc2)=N/C1=C/c1ccc(F)cc1. molecular properties: Molecular weight 456.48, partition coefficient: 5.42, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 0, Polariable Surface Area: 75.85, Rotatable bonds: 5, Aromatic rings: 3. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C(OCCc1ccc(O)cc1)c1cc(O)c(O)c(O)c1. molecular properties: Molecular weight 290.27, partition coefficient: 1.91, Hydrgen-bond acceptors: 6, Hydrgen-bond donors: 4, Polariable Surface Area: 107.22, Rotatable bonds: 4, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(/C=C/C(=O)NCCCNC(=O)/C=C/c2ccc(OC)c(O)c2)cc1O. molecular properties: Molecular weight 426.47, partition coefficient: 2.46, Hydrgen-bond acceptors: 6, Hydrgen-bond donors: 4, Polariable Surface Area: 117.12, Rotatable bonds: 10, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C1/C(=C/c2ccc(O)cc2O)Nc2ccccc21. molecular properties: Molecular weight 253.26, partition coefficient: 2.75, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 3, Polariable Surface Area: 69.56, Rotatable bonds: 1, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccccc1NC(=S)Nc1nnc(SCC(=O)O)s1. molecular properties: Molecular weight 356.45, partition coefficient: 2.53, Hydrgen-bond acceptors: 9, Hydrgen-bond donors: 3, Polariable Surface Area: 96.37, Rotatable bonds: 6, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : C/C(CCc1ccc(OCCC(C)C)cc1)=N\NC(N)=S. molecular properties: Molecular weight 307.46, partition coefficient: 3.25, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 2, Polariable Surface Area: 59.64, Rotatable bonds: 8, Aromatic rings: 1. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(C(=O)NCc2ccc(O)cc2O)cc1C12CC3CC(CC(C3)C1)C2. molecular properties: Molecular weight 407.51, partition coefficient: 4.50, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 3, Polariable Surface Area: 78.79, Rotatable bonds: 5, Aromatic rings: 2. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C(/C=C/c1ccc(O)cc1)c1ccc(O)cc1. molecular properties: Molecular weight 240.26, partition coefficient: 2.99, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 2, Polariable Surface Area: 57.53, Rotatable bonds: 3, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C1CC(c2ccc(O)cc2O)Oc2ccccc21. molecular properties: Molecular weight 256.26, partition coefficient: 2.80, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 2, Polariable Surface Area: 66.76, Rotatable bonds: 1, Aromatic rings: 2. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C1C(=Cc2ccc(O)cc2O)Oc2cc(O)cc(O)c21. molecular properties: Molecular weight 286.24, partition coefficient: 2.13, Hydrgen-bond acceptors: 6, Hydrgen-bond donors: 4, Polariable Surface Area: 107.22, Rotatable bonds: 1, Aromatic rings: 2. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C(O)c1ccc(O)cc1. molecular properties: Molecular weight 138.12, partition coefficient: 1.09, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 2, Polariable Surface Area: 57.53, Rotatable bonds: 1, Aromatic rings: 1. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C(Cc1ccc(O)cc1)c1ccc(O)cc1O. molecular properties: Molecular weight 244.25, partition coefficient: 2.23, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 3, Polariable Surface Area: 77.76, Rotatable bonds: 3, Aromatic rings: 2. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C(c1ccc(Br)cc1Br)N1CCN(Cc2ccc(F)cc2)CC1. molecular properties: Molecular weight 456.15, partition coefficient: 4.31, Hydrgen-bond acceptors: 2, Hydrgen-bond donors: 0, Polariable Surface Area: 23.55, Rotatable bonds: 3, Aromatic rings: 2. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : C[C@@H](CCc1ccc(O)cc1O)O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O. molecular properties: Molecular weight 506.50, partition coefficient: -2.94, Hydrgen-bond acceptors: 13, Hydrgen-bond donors: 9, Polariable Surface Area: 218.99, Rotatable bonds: 9, Aromatic rings: 1. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1cc(C2Oc3c(O)cc(C4Oc5cc(O)cc(O)c5C(=O)C4O)cc3C2CO)ccc1O. molecular properties: Molecular weight 482.44, partition coefficient: 2.40, Hydrgen-bond acceptors: 10, Hydrgen-bond donors: 6, Polariable Surface Area: 166.14, Rotatable bonds: 4, Aromatic rings: 3. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(C=O)cc1. molecular properties: Molecular weight 136.15, partition coefficient: 1.51, Hydrgen-bond acceptors: 2, Hydrgen-bond donors: 0, Polariable Surface Area: 26.30, Rotatable bonds: 2, Aromatic rings: 1. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : Cc1ccc(C(C)C)c(OCc2cn(Cc3cc(=O)c(O)co3)nn2)c1. molecular properties: Molecular weight 355.39, partition coefficient: 3.00, Hydrgen-bond acceptors: 6, Hydrgen-bond donors: 1, Polariable Surface Area: 90.38, Rotatable bonds: 6, Aromatic rings: 3. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CC1=C(O)C(=O)CO1. molecular properties: Molecular weight 114.10, partition coefficient: 0.38, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 1, Polariable Surface Area: 46.53, Rotatable bonds: 0, Aromatic rings: 0. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1cccc2c1c(C(=O)C(=O)Nc1cc[nH]n1)cn2Cc1ccc(F)cc1. molecular properties: Molecular weight 392.39, partition coefficient: 3.38, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 2, Polariable Surface Area: 89.01, Rotatable bonds: 6, Aromatic rings: 4. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C1CC(c2ccc(O)cc2)Oc2cc(O)cc(O)c21. molecular properties: Molecular weight 272.26, partition coefficient: 2.51, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 3, Polariable Surface Area: 86.99, Rotatable bonds: 1, Aromatic rings: 2. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccccc1-c1nnc(SCC(=O)Nc2ccc(Br)cc2)o1. molecular properties: Molecular weight 420.29, partition coefficient: 4.24, Hydrgen-bond acceptors: 6, Hydrgen-bond donors: 1, Polariable Surface Area: 77.25, Rotatable bonds: 6, Aromatic rings: 3. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : NCCc1c[nH]c2ccc(O)cc12. molecular properties: Molecular weight 176.22, partition coefficient: 1.37, Hydrgen-bond acceptors: 2, Hydrgen-bond donors: 3, Polariable Surface Area: 62.04, Rotatable bonds: 2, Aromatic rings: 2. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CCc1ccc(NC(N)=S)cc1. molecular properties: Molecular weight 180.28, partition coefficient: 1.90, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 2, Polariable Surface Area: 38.05, Rotatable bonds: 2, Aromatic rings: 1. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CC(=O)OC[C@H]1O[C@@H](Oc2ccc(C=C3C(=O)NC(=S)NC3=O)c(O)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O. molecular properties: Molecular weight 594.55, partition coefficient: -0.23, Hydrgen-bond acceptors: 14, Hydrgen-bond donors: 3, Polariable Surface Area: 202.09, Rotatable bonds: 8, Aromatic rings: 1. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : C[C@]12CC[C@@H](O)[C@@](C)(C(=O)O)[C@@H]1CC[C@]1(C)[C@@H]2CC[C@@H]2[C@H]3[C@H]([C@](C)(O)CO)CC[C@]3(C(=O)O)CC[C@]21C. molecular properties: Molecular weight 520.71, partition coefficient: 4.32, Hydrgen-bond acceptors: 7, Hydrgen-bond donors: 5, Polariable Surface Area: 135.29, Rotatable bonds: 4, Aromatic rings: 0. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(C2CC(=O)c3c(O)cc(OC)cc3O2)cc1. molecular properties: Molecular weight 300.31, partition coefficient: 3.12, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 1, Polariable Surface Area: 64.99, Rotatable bonds: 3, Aromatic rings: 2. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C(NCc1ccc(O)cc1O)c1cc(C23CC4CC(CC(C4)C2)C3)c(O)cc1O. molecular properties: Molecular weight 409.48, partition coefficient: 3.91, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 5, Polariable Surface Area: 110.02, Rotatable bonds: 4, Aromatic rings: 2. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1cc(/C=C/C(=O)NCCCNC(=O)/C=C/c2ccc(O)c(OC)c2)ccc1O. molecular properties: Molecular weight 426.47, partition coefficient: 2.46, Hydrgen-bond acceptors: 6, Hydrgen-bond donors: 4, Polariable Surface Area: 117.12, Rotatable bonds: 10, Aromatic rings: 2. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1cc(/C=C/C(=O)OC/C(C)=C\Cc2c(O)ccc(C(=O)/C=C/c3ccc(O)cc3)c2O)cc(OC)c1O. molecular properties: Molecular weight 546.57, partition coefficient: 5.17, Hydrgen-bond acceptors: 9, Hydrgen-bond donors: 4, Polariable Surface Area: 142.75, Rotatable bonds: 11, Aromatic rings: 3. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : NC(=S)N/N=C/c1cccc(F)c1. molecular properties: Molecular weight 197.24, partition coefficient: 0.99, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 2, Polariable Surface Area: 50.41, Rotatable bonds: 2, Aromatic rings: 1. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : Cc1ccc(S(=O)(=O)Oc2ccccc2/N=N/c2ccc(O)cc2O)cc1. molecular properties: Molecular weight 384.41, partition coefficient: 4.59, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 2, Polariable Surface Area: 108.55, Rotatable bonds: 5, Aromatic rings: 3. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COCCOCCOc1ccc(/C=N/NC(N)=S)cc1. molecular properties: Molecular weight 297.38, partition coefficient: 0.90, Hydrgen-bond acceptors: 6, Hydrgen-bond donors: 2, Polariable Surface Area: 78.10, Rotatable bonds: 9, Aromatic rings: 1. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CCCCC(=O)NC(=S)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-]. molecular properties: Molecular weight 326.33, partition coefficient: 2.51, Hydrgen-bond acceptors: 7, Hydrgen-bond donors: 2, Polariable Surface Area: 127.41, Rotatable bonds: 6, Aromatic rings: 1. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : Cc1ccc(O)cc1O. molecular properties: Molecular weight 124.14, partition coefficient: 1.41, Hydrgen-bond acceptors: 2, Hydrgen-bond donors: 2, Polariable Surface Area: 40.46, Rotatable bonds: 0, Aromatic rings: 1. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(C/C(C)=N\NC(N)=S)cc1. molecular properties: Molecular weight 237.33, partition coefficient: 1.45, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 2, Polariable Surface Area: 59.64, Rotatable bonds: 4, Aromatic rings: 1. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(/C=C/C(=O)O)cc1O. molecular properties: Molecular weight 194.19, partition coefficient: 1.50, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 2, Polariable Surface Area: 66.76, Rotatable bonds: 3, Aromatic rings: 1. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O.O=C(CCc1ccc(O)cc1)c1c(O)cc(O)cc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O. molecular properties: Molecular weight 454.43, partition coefficient: -1.03, Hydrgen-bond acceptors: 10, Hydrgen-bond donors: 7, Polariable Surface Area: 208.64, Rotatable bonds: 7, Aromatic rings: 2. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=c1c(O)c(-c2cc(O)c(O)c(O)c2)oc2cc(O)cc(O)c12. molecular properties: Molecular weight 318.24, partition coefficient: 1.69, Hydrgen-bond acceptors: 8, Hydrgen-bond donors: 6, Polariable Surface Area: 151.59, Rotatable bonds: 1, Aromatic rings: 3. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=c1cc(-c2cccc([N+](=O)[O-])c2)oc2cc(Br)cc(Br)c12. molecular properties: Molecular weight 425.03, partition coefficient: 4.89, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 0, Polariable Surface Area: 73.35, Rotatable bonds: 2, Aromatic rings: 3. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccccc1/C=C/C=O. molecular properties: Molecular weight 162.19, partition coefficient: 1.91, Hydrgen-bond acceptors: 2, Hydrgen-bond donors: 0, Polariable Surface Area: 26.30, Rotatable bonds: 3, Aromatic rings: 1. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CCCCCC[S+]([O-])Cc1cc(=O)c(O)co1. molecular properties: Molecular weight 258.34, partition coefficient: 2.17, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 1, Polariable Surface Area: 73.50, Rotatable bonds: 7, Aromatic rings: 1. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(-c2oc3c(CC=C(C)C)c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc(O)c3c(=O)c2O[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)cc1. molecular properties: Molecular weight 676.67, partition coefficient: 0.07, Hydrgen-bond acceptors: 15, Hydrgen-bond donors: 8, Polariable Surface Area: 238.20, Rotatable bonds: 9, Aromatic rings: 3. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C(NCc1ccc(O)cc1)c1ccc(O)cc1O. molecular properties: Molecular weight 259.26, partition coefficient: 1.73, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 4, Polariable Surface Area: 89.79, Rotatable bonds: 3, Aromatic rings: 2. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COC(=O)/C=C/c1ccc(O)cc1. molecular properties: Molecular weight 178.19, partition coefficient: 1.58, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 1, Polariable Surface Area: 46.53, Rotatable bonds: 2, Aromatic rings: 1. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=c1c(O)c(-c2ccccc2)oc2cc(O)c(O)c(O)c12. molecular properties: Molecular weight 286.24, partition coefficient: 2.28, Hydrgen-bond acceptors: 6, Hydrgen-bond donors: 4, Polariable Surface Area: 111.13, Rotatable bonds: 1, Aromatic rings: 3. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(CCC(=O)c2ccc3c(c2O)CC(O)C(C)(C)O3)cc1. molecular properties: Molecular weight 356.42, partition coefficient: 3.29, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 2, Polariable Surface Area: 75.99, Rotatable bonds: 5, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=c1cc(Cn2cc(COc3ccc([N+](=O)[O-])cc3)nn2)occ1O. molecular properties: Molecular weight 344.28, partition coefficient: 1.47, Hydrgen-bond acceptors: 8, Hydrgen-bond donors: 1, Polariable Surface Area: 133.52, Rotatable bonds: 6, Aromatic rings: 3. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CC(=O)OC[C@H]1O[C@@H](Oc2ccc(C=C3C(=O)NC(=O)NC3=O)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O. molecular properties: Molecular weight 562.48, partition coefficient: -0.10, Hydrgen-bond acceptors: 13, Hydrgen-bond donors: 2, Polariable Surface Area: 198.93, Rotatable bonds: 8, Aromatic rings: 1. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CC(=O)Nc1cccc(/C(C)=N/NC(N)=S)c1. molecular properties: Molecular weight 250.33, partition coefficient: 1.20, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 3, Polariable Surface Area: 79.51, Rotatable bonds: 3, Aromatic rings: 1. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C1/C(=C/c2ccc(O)cc2O)Oc2ccccc21. molecular properties: Molecular weight 254.24, partition coefficient: 2.71, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 2, Polariable Surface Area: 66.76, Rotatable bonds: 1, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=Cc1ccc(Cl)nc1. molecular properties: Molecular weight 141.56, partition coefficient: 1.55, Hydrgen-bond acceptors: 2, Hydrgen-bond donors: 0, Polariable Surface Area: 29.96, Rotatable bonds: 1, Aromatic rings: 1. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)COc1ccc(C=O)cc1. molecular properties: Molecular weight 380.40, partition coefficient: 2.26, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 2, Polariable Surface Area: 97.49, Rotatable bonds: 8, Aromatic rings: 3. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1cc(C2Oc3cc([C@H]4Oc5cc(O)cc(O)c5C(=O)[C@@H]4O)ccc3OC2CO)ccc1O. molecular properties: Molecular weight 482.44, partition coefficient: 2.36, Hydrgen-bond acceptors: 10, Hydrgen-bond donors: 5, Polariable Surface Area: 155.14, Rotatable bonds: 4, Aromatic rings: 3. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CC(C)(C)c1ccc(O)cc1. molecular properties: Molecular weight 150.22, partition coefficient: 2.69, Hydrgen-bond acceptors: 1, Hydrgen-bond donors: 1, Polariable Surface Area: 20.23, Rotatable bonds: 0, Aromatic rings: 1. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CC1=CC(=O)CC(C)(C)[C@@H]1CC[C@@H](C)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O. molecular properties: Molecular weight 518.60, partition coefficient: -0.62, Hydrgen-bond acceptors: 11, Hydrgen-bond donors: 6, Polariable Surface Area: 175.37, Rotatable bonds: 8, Aromatic rings: 0. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CCC(=O)Nc1ccc(/C(C)=N/NC(N)=S)cc1. molecular properties: Molecular weight 264.35, partition coefficient: 1.59, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 3, Polariable Surface Area: 79.51, Rotatable bonds: 4, Aromatic rings: 1. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C(c1ccc2ccccc2c1)N1CCC(N2CCCCC2)CC1. molecular properties: Molecular weight 322.45, partition coefficient: 3.93, Hydrgen-bond acceptors: 2, Hydrgen-bond donors: 0, Polariable Surface Area: 23.55, Rotatable bonds: 2, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=c1c2ccccc2oc2ccc(O)cc12. molecular properties: Molecular weight 212.20, partition coefficient: 2.65, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 1, Polariable Surface Area: 50.44, Rotatable bonds: 0, Aromatic rings: 3. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C(c1ccc(F)cc1)N1CCN(Cc2ccc(F)cc2)CC1. molecular properties: Molecular weight 316.35, partition coefficient: 2.92, Hydrgen-bond acceptors: 2, Hydrgen-bond donors: 0, Polariable Surface Area: 23.55, Rotatable bonds: 3, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : NC(=S)N/N=C/c1ccco1. molecular properties: Molecular weight 169.21, partition coefficient: 0.45, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 2, Polariable Surface Area: 63.55, Rotatable bonds: 2, Aromatic rings: 1. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CC(=O)OC[C@H]1O[C@@H](Oc2ccc(/C=N\NC(N)=S)cc2)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O. molecular properties: Molecular weight 525.54, partition coefficient: 0.32, Hydrgen-bond acceptors: 13, Hydrgen-bond donors: 2, Polariable Surface Area: 174.07, Rotatable bonds: 9, Aromatic rings: 1. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CN1[C@@H]2CC[C@H]1C/C(=N/Nc1nc(-c3ccc(Cl)c(Cl)c3)cs1)C2. molecular properties: Molecular weight 381.33, partition coefficient: 5.14, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 1, Polariable Surface Area: 40.52, Rotatable bonds: 3, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : Oc1cc(O)c2c(c1)OC(c1ccc(O)c(O)c1)C(OC1(c3ccc(O)c(O)c3)Oc3cc(O)cc(O)c3C(O)C1O)C2. molecular properties: Molecular weight 594.53, partition coefficient: 2.73, Hydrgen-bond acceptors: 13, Hydrgen-bond donors: 10, Polariable Surface Area: 229.99, Rotatable bonds: 4, Aromatic rings: 4. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(C(C)=O)cc1. molecular properties: Molecular weight 150.18, partition coefficient: 1.90, Hydrgen-bond acceptors: 2, Hydrgen-bond donors: 0, Polariable Surface Area: 26.30, Rotatable bonds: 2, Aromatic rings: 1. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CCCCSCc1cc(=O)c(O)co1. molecular properties: Molecular weight 214.29, partition coefficient: 2.38, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 1, Polariable Surface Area: 50.44, Rotatable bonds: 5, Aromatic rings: 1. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CCCCC(=O)NC(=S)Nc1cccc(Cl)c1Cl. molecular properties: Molecular weight 305.23, partition coefficient: 4.00, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 2, Polariable Surface Area: 41.13, Rotatable bonds: 4, Aromatic rings: 1. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : Cc1ccc(C(C)C)cc1OCc1cn(Cc2cc(=O)c(O)co2)nn1. molecular properties: Molecular weight 355.39, partition coefficient: 3.00, Hydrgen-bond acceptors: 6, Hydrgen-bond donors: 1, Polariable Surface Area: 90.38, Rotatable bonds: 6, Aromatic rings: 3. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CC(C)c1ccc(/C=N/NC(N)=S)cc1. molecular properties: Molecular weight 221.33, partition coefficient: 1.98, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 2, Polariable Surface Area: 50.41, Rotatable bonds: 3, Aromatic rings: 1. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=c1cc(CSc2ccc(O)cc2)occ1O. molecular properties: Molecular weight 250.28, partition coefficient: 2.34, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 2, Polariable Surface Area: 70.67, Rotatable bonds: 3, Aromatic rings: 2. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CCCCCCCCn1cc(O)c(=O)cc1COC(=O)[C@@H](N)Cc1ccccc1. molecular properties: Molecular weight 400.52, partition coefficient: 3.53, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 2, Polariable Surface Area: 94.55, Rotatable bonds: 12, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : N/C(S)=N/N=C/c1ccc([N+](=O)[O-])cc1. molecular properties: Molecular weight 224.25, partition coefficient: 1.17, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 2, Polariable Surface Area: 93.88, Rotatable bonds: 3, Aromatic rings: 1. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CC(=O)c1ccccc1. molecular properties: Molecular weight 120.15, partition coefficient: 1.89, Hydrgen-bond acceptors: 1, Hydrgen-bond donors: 0, Polariable Surface Area: 17.07, Rotatable bonds: 1, Aromatic rings: 1. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CCOc1cc(/C=N/NC(=O)c2ccc(O)c(OC)c2)ccc1O. molecular properties: Molecular weight 330.34, partition coefficient: 2.27, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 3, Polariable Surface Area: 100.38, Rotatable bonds: 6, Aromatic rings: 2. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=CN1CCc2cc3c(c4c2[C@H]1Cc1ccccc1-4)OCO3. molecular properties: Molecular weight 293.32, partition coefficient: 2.69, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 0, Polariable Surface Area: 38.77, Rotatable bonds: 1, Aromatic rings: 2. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : Oc1ccc2c(c1)OCO2. molecular properties: Molecular weight 138.12, partition coefficient: 1.12, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 1, Polariable Surface Area: 38.69, Rotatable bonds: 0, Aromatic rings: 1. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(OC)c(/C=C/C(=N\O)c2cc3ccccc3cc2O)c1. molecular properties: Molecular weight 349.39, partition coefficient: 4.45, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 2, Polariable Surface Area: 71.28, Rotatable bonds: 5, Aromatic rings: 3. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=Cc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]2O)cc1. molecular properties: Molecular weight 284.26, partition coefficient: -1.32, Hydrgen-bond acceptors: 7, Hydrgen-bond donors: 4, Polariable Surface Area: 116.45, Rotatable bonds: 4, Aromatic rings: 1. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(C(=O)N/N=C/c2cccc(O)c2O)cc1OC. molecular properties: Molecular weight 316.31, partition coefficient: 1.88, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 3, Polariable Surface Area: 100.38, Rotatable bonds: 5, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=Cc1cc(O)c(O)c2oc3ccccc3c(=O)c12. molecular properties: Molecular weight 256.21, partition coefficient: 2.17, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 2, Polariable Surface Area: 87.74, Rotatable bonds: 1, Aromatic rings: 3. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : C/C(=N\C#N)N(C)Cc1ccc(Cl)nc1. molecular properties: Molecular weight 222.68, partition coefficient: 2.07, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 0, Polariable Surface Area: 52.28, Rotatable bonds: 2, Aromatic rings: 1. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C1C(=Cc2ccc(O)cc2)Oc2cccc(O)c21. molecular properties: Molecular weight 254.24, partition coefficient: 2.71, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 2, Polariable Surface Area: 66.76, Rotatable bonds: 1, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : Cn1c2ccccc2c2cc(/C=C/C(=O)c3cccc(NC(=O)c4cccc(F)c4)c3)ccc21. molecular properties: Molecular weight 448.50, partition coefficient: 6.62, Hydrgen-bond acceptors: 2, Hydrgen-bond donors: 1, Polariable Surface Area: 51.10, Rotatable bonds: 5, Aromatic rings: 5. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(C=C2C(=O)NC(=S)NC2=O)cc1. molecular properties: Molecular weight 262.29, partition coefficient: 0.61, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 2, Polariable Surface Area: 67.43, Rotatable bonds: 2, Aromatic rings: 1. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : OC[C@H]1O[C@H](Oc2cc(CCc3ccc(O)cc3O)cc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)[C@H](O)[C@@H](O)[C@@H]1O. molecular properties: Molecular weight 570.54, partition coefficient: -2.76, Hydrgen-bond acceptors: 14, Hydrgen-bond donors: 10, Polariable Surface Area: 239.22, Rotatable bonds: 9, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CC(C)C[C@H](NC(=O)OCc1cc(=O)c(O)co1)C(=O)OCc1cc(=O)c(O)co1. molecular properties: Molecular weight 423.37, partition coefficient: 1.39, Hydrgen-bond acceptors: 10, Hydrgen-bond donors: 3, Polariable Surface Area: 165.51, Rotatable bonds: 8, Aromatic rings: 2. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=Cc1ccc(OCCOP(=O)(O)O)cc1. molecular properties: Molecular weight 246.16, partition coefficient: 0.99, Hydrgen-bond acceptors: 6, Hydrgen-bond donors: 2, Polariable Surface Area: 93.06, Rotatable bonds: 6, Aromatic rings: 1. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : Oc1cc(O)cc(CCc2ccc(O)cc2O)c1. molecular properties: Molecular weight 246.26, partition coefficient: 2.29, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 4, Polariable Surface Area: 80.92, Rotatable bonds: 3, Aromatic rings: 2. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C(NC(Cc1ccccc1)C(=O)NO)OCc1cc(=O)c(O)co1. molecular properties: Molecular weight 348.31, partition coefficient: 0.69, Hydrgen-bond acceptors: 7, Hydrgen-bond donors: 4, Polariable Surface Area: 138.10, Rotatable bonds: 6, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : NC(=S)N/N=C/c1ccccc1F. molecular properties: Molecular weight 197.24, partition coefficient: 0.99, Hydrgen-bond acceptors: 3, Hydrgen-bond donors: 2, Polariable Surface Area: 50.41, Rotatable bonds: 2, Aromatic rings: 1. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : CC(=O)c1c(O)ccc(C(c2ccc(O)cc2O)c2ccc(O)c(C(C)=O)c2O)c1O. molecular properties: Molecular weight 424.41, partition coefficient: 3.51, Hydrgen-bond acceptors: 8, Hydrgen-bond donors: 6, Polariable Surface Area: 155.52, Rotatable bonds: 5, Aromatic rings: 3. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : C/C(=N\NC(N)=S)c1cccc(NC(=O)c2ccccc2)c1. molecular properties: Molecular weight 312.40, partition coefficient: 2.50, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 3, Polariable Surface Area: 79.51, Rotatable bonds: 4, Aromatic rings: 2. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C(c1cccc(Cl)c1)N1CCN(Cc2ccc(F)cc2)CC1. molecular properties: Molecular weight 332.81, partition coefficient: 3.44, Hydrgen-bond acceptors: 2, Hydrgen-bond donors: 0, Polariable Surface Area: 23.55, Rotatable bonds: 3, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(C=CC(=O)c2ccccc2O)cc1N. molecular properties: Molecular weight 269.30, partition coefficient: 2.88, Hydrgen-bond acceptors: 4, Hydrgen-bond donors: 2, Polariable Surface Area: 72.55, Rotatable bonds: 4, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C(CCCCC1CCS[Zn]S1)NC(Cc1c[nH]cn1)C(=O)[O-].[Na+]. molecular properties: Molecular weight 430.85, partition coefficient: -2.10, Hydrgen-bond acceptors: 6, Hydrgen-bond donors: 2, Polariable Surface Area: 97.91, Rotatable bonds: 9, Aromatic rings: 1. Answer:
(A)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : O=C1/C(=C/c2ccc(O)cc2O)Sc2c(O)cccc21. molecular properties: Molecular weight 286.31, partition coefficient: 3.13, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 3, Polariable Surface Area: 77.76, Rotatable bonds: 1, Aromatic rings: 2. Answer:
(B)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1c(O)cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2O[C@@H](C)[C@H](OC(C)=O)[C@@H](O)[C@H]2O)cc1O. molecular properties: Molecular weight 520.44, partition coefficient: 1.07, Hydrgen-bond acceptors: 13, Hydrgen-bond donors: 6, Polariable Surface Area: 205.58, Rotatable bonds: 5, Aromatic rings: 3. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(CC(=O)c2c(O)cc(O)cc2O)cc1. molecular properties: Molecular weight 274.27, partition coefficient: 2.24, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 3, Polariable Surface Area: 86.99, Rotatable bonds: 4, Aromatic rings: 2. Answer:
(C)
Drugs which act as inhibitors for Tyrosinase can be categoried by IC50, which is the concentration at which they inhibit 50% of the Tyrosinase enzyme's activity. Given the drug SMILES string and molecular properties below, tell which of the three categories the drug will be in: (A) IC50 less than 2.5 micromolar, (B) between 2.5 and 50 micromolar, or (C) above 50 micromolar. drug SMILES : COc1ccc(/C(C)=N/NC(=S)NN)cc1. molecular properties: Molecular weight 238.32, partition coefficient: 0.76, Hydrgen-bond acceptors: 5, Hydrgen-bond donors: 3, Polariable Surface Area: 71.67, Rotatable bonds: 3, Aromatic rings: 1. Answer:
(C)