instruction
stringclasses
1 value
output
stringlengths
52
197
input
stringlengths
75
717
history
listlengths
0
0
This reaction's solvents include C1CCOC1 and CCN(CC)CC. ### The answer is C1CCOC1 and CCN(CC)CC
Would you be able to provide the names of the solvents involved in the reaction that the SMILES algorithm O=C(O)CCCCc1nnnn1C1CCCCC1.CCN(CC)CC.CC(C)COC(=O)Cl.CCNC1CCCCC1>>CCN(C(=O)CCCCc1nnnn1C1CCCCC1)C1CCCCC1. represents?
[]
This chemical reaction incorporates CCO and O as solvents. ### The answer is CCO and O
Which agents cause dissolution in the reaction involving the SMILES COc1ccc(C(=O)CCC(=O)O)cc1.Br.O.NN>>O=C1CCC(c2ccc(O)cc2)=NN1.?
[]
The solvents in this chemical reaction are CC(=O)O, CO, and O. ### The answer is CC(=O)O, CO, and O
What solvents were applied in the reaction with the SMILES notation Nc1ccccc1N.CCc1cccc(C#N)c1.C[O-].[Na+].CC(=O)O>>CCc1cccc(-c2nc3ccccc3[nH]2)c1.?
[]
Solvents CN(C)C=O are the substances used in this chemical reaction. ### The answer is CN(C)C=O
Would you be able to specify the solvents used in the reaction characterized by the SMILES code Brc1cnc2cc(Br)cnc2c1.CCCC[Sn](C=COCC)(CCCC)CCCC>>CCOC=Cc1cnc2cc(Br)cnc2c1.?
[]
Cc1ccccc1, functioning as solvents, are used in this chemical reaction. ### The answer is Cc1ccccc1
Would you tell me what the solvent substances are in the reaction with the SMILES code CCOc1c(F)cc(-c2nc3ccc(OC[C@H](C)NC(C)=O)cc3o2)cc1Br.C=C(OCC)[Sn](CCCC)(CCCC)CCCC.Cl.O=C([O-])O.[Na+]>>CCOc1c(F)cc(-c2nc3ccc(OC[C@H](C)NC(C)=O)cc3o2)cc1C(C)=O.?
[]
The chemical reaction utilizes CC(=O)O as solvents. ### The answer is CC(=O)O
Which solvents are involved in the reaction with the SMILES O=C1[C@@H](NC(=O)C(F)(F)F)CCN1Cc1ccc([N+](=O)[O-])cc1.CC(=O)OC(C)=O>>CC(=O)Nc1ccc(CN2CC[C@H](NC(=O)C(F)(F)F)C2=O)cc1.?
[]
The chemical reaction involves the use of CC#N as solvents. ### The answer is CC#N
What are the solvents that have been used in the O=[N+]([O-])c1ccc(Cl)c(OCC2CCNCC2)c1.C=O.[BH3-]C#N.[Na+]>>CN1CCC(COc2cc([N+](=O)[O-])ccc2Cl)CC1. reaction?
[]
CCOC(C)=O and CN(C)C=O are the solvents involved in this chemical process. ### The answer is CCOC(C)=O and CN(C)C=O
What solvents can be found in the reaction denoted by the SMILES Cc1ccc2ncc(CN(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3nn[nH]n3)c(N(CC3CC3)CC3CC3)c2c1.[H].[H][Na+].CI>>Cc1ccc2ncc(CN(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3nnn(C)n3)c(N(CC3CC3)CC3CC3)c2c1.?
[]
The reaction proceeds with CO, CS(C)=O, and c1ccncc1 as solvents. ### The answer is CO, CS(C)=O, and c1ccncc1
Can you tell me the solvent medium used in the reaction associated with the SMILES COc1cc(Br)cc(F)c1-c1ccc(N(C)C2CC(C)(C)NC(C)(C)C2)nn1.Cl.c1ccncc1>>CN(c1ccc(-c2c(O)cc(Br)cc2F)nn1)C1CC(C)(C)NC(C)(C)C1.?
[]
This chemical reaction is performed with O and c1ccncc1 as solvents. ### The answer is O and c1ccncc1
What solvent substances can be found in the reaction that corresponds with the SMILES code COC(=O)CCc1oc(=O)[nH]c1-c1ccc(C(F)(F)F)cc1.O=P(Cl)(Cl)Cl.c1ccncc1>>COC(=O)CCc1oc(Cl)nc1-c1ccc(C(F)(F)F)cc1.?
[]
This chemical reaction is conducted with CCOCC as the solvents. ### The answer is CCOCC
Can you tell me the solvents that react with the SMILES .[Al+3].[Li+].[H].[H].[H].[H]CC(C)(C(=O)O)c1ccc(Cl)cc1>>CC(C)(CO)c1ccc(Cl)cc1.?
[]
ClCCl and O=C(O)C(F)(F)F, functioning as solvents, are used in this chemical reaction. ### The answer is ClCCl and O=C(O)C(F)(F)F
Can you identify the solvent substances used in the reaction denoted by the SMILES code CC(NC(=O)OC(C)(C)C)C(=O)NC(C(=O)N1CCCC1Cc1coc2ccc(O)cc12)C(C)C.O=C(O)C(F)(F)F>>CC(N)C(=O)NC(C(=O)N1CCCC1Cc1coc2ccc(O)cc12)C(C)C.?
[]
In this reaction, CN(C)C=O and CCN(C(C)C)C(C)C act as the solvents. ### The answer is CN(C)C=O and CCN(C(C)C)C(C)C
Can you tell me which solvents were used in the reaction involving the SMILES Cc1ccc(-c2cc(Oc3nccs3)cc(C(=O)O)c2)cc1.Cc1ncc([C@@H](C)N)cn1.F[P-](F)(F)(F)(F)F.CN(C)C(On1nnc2cccnc21)=[N+](C)C.CCN(C(C)C)C(C)C>>Cc1ccc(-c2cc(Oc3nccs3)cc(C(=O)N[C@H](C)c3cnc(C)nc3)c2)cc1.?
[]
CCOC(C)=O and ClCCCl are the solvents used in this chemical reaction. ### The answer is CCOC(C)=O and ClCCCl
Would you mind sharing the solvent medium in the reaction that corresponds to the SMILES Cc1ccc(S(=O)(=O)[O-])cc1.c1cc[nH+]cc1.CC1(O)c2cc(Cl)ncc2Oc2c(F)cc(Br)cc21.CCOC(C)=O.O=C([O-])O.[Na+]>>C=C1c2cc(Cl)ncc2Oc2c(F)cc(Br)cc21.?
[]
The solvents C1CCOC1 and ClCCCl are integral to this chemical reaction. ### The answer is C1CCOC1 and ClCCCl
In the reaction of SMILES CC(C)Oc1ccc(C(=O)O)cc1Cl.On1nnc2ccccc21.[H]/N=C(/NO)c1cccc2c(CCCCC(=O)OCC)c[nH]c12.CCCC[N+](CCCC)(CCCC)CCCC.[F-]>>CCOC(=O)CCCCc1c[nH]c2c(-c3noc(-c4ccc(OC(C)C)c(Cl)c4)n3)cccc12., can you identify the dissolving agents?
[]
This chemical reaction is conducted with CCN(CC)CC and CCO as the solvents. ### The answer is CCN(CC)CC and CCO
Could you tell me what solvents accelerate the reaction denoted by the SMILES sequence O=C1c2ccc(Cl)cc2CC1Br.N#CCC(N)=S.CCN(CC)CC>>N#CCc1nc2c(s1)Cc1cc(Cl)ccc1-2.?
[]
CC(=O)N(C)C are the solvents that facilitate this chemical reaction. ### The answer is CC(=O)N(C)C
What agents tend to dissolve in the reaction of SMILES CCOC(=O)CC(=O)OCC.[H].[H][Na+].O=c1oc(=O)n(Cc2ccccc2)c2ncccc12.Cl>>CCOC(=O)c1c(O)c2cccnc2n(Cc2ccccc2)c1=O.?
[]
The solvents for this reaction are C1CCOC1. ### The answer is C1CCOC1
What are the solvents that facilitate the SMILES sequence [N-]=[N+]=NCC(O)COc1ccccc1.[H].[H][Al+3].[Li+].[H].[H].>>NCC(O)COc1ccccc1. reaction?
[]
CCOC(C)=O, CN(C)C=O, and O, the solvents, are used in this chemical reaction. ### The answer is CCOC(C)=O, CN(C)C=O, and O
Are you aware of the solvent substances in the reaction with the SMILES code O=[N+]([O-])c1ccc(I)c(O)c1.O=C([O-])[O-].[K+].[K+].[Na+].O=C([O-])C(F)(F)Cl>>O=[N+]([O-])c1ccc(I)c(OC(F)F)c1.?
[]
This chemical reaction is executed using solvents C1CCOC1 and CCOC(C)=O. ### The answer is C1CCOC1 and CCOC(C)=O
What types of solvents were used for the reaction with the SMILES C=C(c1ccccc1)c1nc(Cl)nc(Cl)c1C=O.C=C[Mg]Br.[NH4+].[Cl-].CCOC(C)=O>>C=CC(O)c1c(Cl)nc(Cl)nc1C(=C)c1ccccc1.?
[]
In this chemical reaction, solvents C=CC#N are employed. ### The answer is C=CC#N
Can you specify the dissolving agents used in the reaction with the SMILES Oc1cccc(CN2CCCCC2)c1.[OH-].C[N+](C)(C)Cc1ccccc1>>N#CCCOc1cccc(CN2CCCCC2)c1.?
[]
This chemical reaction is conducted with CCN(C(C)C)C(C)C and CN(C)C=O as the solvents. ### The answer is CCN(C(C)C)C(C)C and CN(C)C=O
Which solvents are used in the reaction with the given SMILES Cl.Cl.c1ccc(N2CCNNCC2)cc1.O=[N+]([O-])c1ccccc1F.CCN(C(C)C)C(C)C>>O=[N+]([O-])c1ccccc1N1CCN(c2ccccc2)CCN1.?
[]
This chemical reaction is facilitated by the solvents ClCCl. ### The answer is ClCCl
Can you list the solvents used in BrB(Br)Br.COc1cccc2c1C[C@H]1N(C(=O)C3CCCC3)CC[C@]2(C)C1(C)C>>CC1(C)[C@H]2Cc3c(O)cccc3[C@]1(C)CCN2C(=O)C1CCCC1.'s chemical reaction?
[]
For this chemical reaction, CCO, Cc1ccccc1, and O act as solvents. ### The answer is CCO, Cc1ccccc1, and O
Can you list the solvents used in the COc1ccc(I)cc1.O=C([O-])[O-].[K+].[K+]>>COc1ccc(-c2cccc(OC)c2)cc1. reaction?
[]
The chemical reaction utilizes CCO as the solvents. ### The answer is CCO
What exactly is the solvent medium involved in the reaction that corresponds to the SMILES CCOC(=O)C(C)(C)Oc1ccc(OCCc2nc(-c3ccc(-c4ccccc4)cc3)oc2C)cc1CC1CCCCC1.[OH-].[Na+]>>Cc1oc(-c2ccc(-c3ccccc3)cc2)nc1CCOc1ccc(OC(C)(C)C(=O)O)c(CC2CCCCC2)c1.?
[]
For the chemical reaction, solvents CCN(C(C)C)C(C)C, ClCCl, and O are used. ### The answer is CCN(C(C)C)C(C)C, ClCCl, and O
Can you identify the particular solvent medium that is connected with the SMILES NC(CCO)c1ccc(C(F)(F)F)c(F)c1.CC(C)(C)[Si](C)(C)Cl.CCN(C(C)C)C(C)C.ClCCl>>CC(C)(C)[Si](C)(C)OCCC(N)c1ccc(C(F)(F)F)c(F)c1. reaction?
[]
CN(C)C=O are the solvents that are used in this chemical reaction. ### The answer is CN(C)C=O
Could you point out the solvent substances in the reaction of the SMILES code [Na].Oc1cccnc1.CC(=O)OCCBr>>CCOC(=O)COc1cccnc1.?
[]
In this reaction, solvents CCOCC, O, and O=C(O)C(F)(F)F are used. ### The answer is CCOCC, O, and O=C(O)C(F)(F)F
Would you be able to provide the names of the solvents involved in the reaction that the SMILES algorithm COC(=O)c1cc(Br)nc(-c2ccc(N3CCOCC3)nc2)c1N.O=N[O-].[Na+].[N-]=[N+]=[N-].[Na+].CCOCC>>COC(=O)c1cc(Br)nc(-c2ccc(N3CCOCC3)nc2)c1N=[N+]=[N-]. represents?
[]
CC(=O)O, CCO, ClCCCl, and ClCCl are utilized as the solvents in this chemical reaction. ### The answer is CC(=O)O, CCO, ClCCCl, and ClCCl
Would you please tell me what solvent medium is used in the reaction corresponding to the SMILES C[C@@H]1CC(N)C[C@H](C)O1.C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1c(Br)c(C=O)nc2c(-c3cnc4ccc(F)cc4c3)cnn12.CC(=O)O.[BH3-]C#N.[Na+]>>C[C@@H]1CC(NCc2nc3c(-c4cnc5ccc(F)cc5c4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2Br)C[C@H](C)O1.?
[]
The chemical reaction's solvents are CCOCC and O. ### The answer is CCOCC and O
Which solvents are involved in the reaction represented by the SMILES FB(F)F.Oc1cccc(F)c1.O=C(Cl)CCCCCCl.O>>O=C(CCCCCCl)c1ccc(F)cc1O.?
[]
The chemical reaction uses ClCCl and O as the solvents. ### The answer is ClCCl and O
Could you specify the solvents participating in the SMILES C1CCNC1.CC(=O)O[BH-](OC(C)=O)OC(C)=O.[Na+].O=Cc1c(F)cc(Br)cc1F.O>>Fc1cc(Br)cc(F)c1CN1CCCC1. reaction?
[]
CC(=O)O are the solvents that make this chemical reaction possible. ### The answer is CC(=O)O
Would you be able to specify the solvents used in the reaction characterized by the SMILES code Cl.NNc1ccc(C2=NNC(=O)CC2)cc1.CC(C)C(=O)c1ccccc1>>CC1(C)C(c2ccccc2)=Nc2ccc(C3=NNC(=O)CC3)cc21.?
[]
CC(=O)O and CO are the solvents that this reaction requires. ### The answer is CC(=O)O and CO
Which agents cause dissolution in the reaction involving the SMILES Br.COc1cccc(OC)c1CNC(=N)Nc1nc2c(s1)CN(C(=O)OCc1ccccc1)CC2.O=C([O-])[O-]>>COc1cccc(OC)c1CNC(=N)Nc1nc2c(s1)CNCC2.?
[]
In this chemical reaction, the solvents are CO. ### The answer is CO
Do you have information on the solvents used in the OCC1CNCCO1.C1CNCCOC1.O=C(O)/C=C\C(=O)O>>O=C(O)/C=C\C(=O)O.OC[C@H]1CNCCO1. reaction scenario?
[]
The chemical reaction utilizes O as solvents. ### The answer is O
Can you specify the solvent medium used for the reaction corresponding to the SMILES Cl.Cl.CCN(CC)CCOC1CN(CCCOc2ccc(F)cc2)CCC1(OC)OC.O=S(=O)(O)O>>CCN(CC)CCOC1CN(CCCOc2ccc(F)cc2)CCC1=O.?
[]
In this reaction, solvents CN(C)C=O are used. ### The answer is CN(C)C=O
Would you be able to specify the solvents used in the reaction characterized by the SMILES code COc1cccc(OC)c1O.CCOC(=O)CBr.O=C([O-])[O-].[K+].[K+]>>CCOC(=O)COc1c(OC)cccc1OC.?
[]
C1CCNCC1 and CCO, functioning as solvents, are used in this chemical reaction. ### The answer is C1CCNCC1 and CCO
Can you provide a list of solvents associated with the reaction depicted by the SMILES notation O=C1Cc2cc(Cl)ccc2N1.O=Cc1ccc(B(O)O)o1.C1CCNCC1>>O=C1Nc2ccc(Cl)cc2C1=Cc1ccc(B(O)O)o1.?
[]
The solvents in this chemical reaction are c1ccccc1. ### The answer is c1ccccc1
Do you know the solvents being leveraged in the chemical reaction detailed by O=[N+]([O-])c1ccc2oc(-c3ccc(CBr)s3)nc2c1.C1COCCN1>>O=[N+]([O-])c1ccc2oc(-c3ccc(CN4CCOCC4)s3)nc2c1.?
[]
The chemical reaction involves CN(C)C=O as the solvents used. ### The answer is CN(C)C=O
What solvents are being used in handling the reaction of SMILES O=C(NC(CC1C(=O)Nc2ccccc21)C(=O)O)c1ccc(Cl)cc1.[H].[H][Na+].C#CCCl.[Cl-].[Na+]>>C#CCN1C(=O)C(CC(NC(=O)c2ccc(Cl)cc2)C(=O)O)c2ccccc21.?
[]
For this reaction, Cc1ccccc1 are the solvents used. ### The answer is Cc1ccccc1
Can you recall the solvents that were used in the reaction with CC(=O)c1ccc2c(c1O)CC(S(C)(=O)=O)CO2.CCCc1cc(CC(=O)OC)ccc1O.[H].[H][Na+].C1COCCOCCOCCOCCO1.[H][H].Cl>>CCCc1cc(CC(=O)OC)ccc1OC1COc2ccc(C(C)=O)c(O)c2C1.?
[]
This chemical reaction is carried out with CN(C)C=O as solvents. ### The answer is CN(C)C=O
What are the solvents needed for the chemical reaction as described in On1nnc2ccccc21.Cl.CCN=C=NCCCN(C)C.SCc1ccccc1.CN(C)CCCC[C@H](NC(=O)[C@H](CSSC(C)(C)C)NC(=O)OCc1ccc(N=[N+]=[N-])cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCCNC(=O)[C@@H]1CSCN1C(=O)OCc1ccc(N=[N+]=[N-])cc1)C(=O)N[C@@H](CC(=O)O)C(=O)N1CCC[C@H]1C(N)=O.Cl>>CN(C)CCCC[C@H](NC(=O)[C@H](CSSC(C)(C)C)NC(=O)OCc1ccc(N=[N+]=[N-])cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCCNC(=O)[C@@H]1CSCN1C(=O)OCc1ccc(N=[N+]=[N-])cc1)C(=O)N[C@@H](CC(=O)SCc1ccccc1)C(=O)N1CCC[C@H]1C(N)=O.?
[]
This chemical reaction is conducted with CCN(C(C)C)C(C)C and CN(C)C=O as the solvents. ### The answer is CCN(C(C)C)C(C)C and CN(C)C=O
Can you list the solvents used in CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)OC(C)(C)C)C(=O)O.CN(C)[P+](On1nnc2ccccc21)(N(C)C)N(C)C.CCN(C(C)C)C(C)C>>CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CN)C(=O)O.'s chemical reaction?
[]
The chemical solvents C1CCOC1 and CO are used in this reaction. ### The answer is C1CCOC1 and CO
Can you identify the particular solvent medium that is connected with the SMILES C=CCOc1cc(C(=O)OC)cc(C(=O)N(C)C)c1.[OH-].[K+]>>C=CCOc1cc(C(=O)O)cc(C(=O)N(C)C)c1. reaction?
[]
This chemical reaction utilizes the solvents C1CCOC1 and O. ### The answer is C1CCOC1 and O
Do you know the solvents used in the COC(=O)c1cc(Br)cc(C(=O)OC)c1.[Li]O.O.O>>COC(=O)c1cc(Br)cc(C(=O)O)c1. reaction?
[]
The reaction uses CCN(CC)CC, CN(C)C=O, and O as its solvents. ### The answer is CCN(CC)CC, CN(C)C=O, and O
What exactly is the solvent medium involved in the reaction that corresponds to the SMILES COc1ccccc1-c1nc(N[C@H]2C[C@H](C(=O)O)N(C(=O)OC(C)(C)C)C2)c2ccccc2n1.Cl.CNC.F[B-](F)(F)F.CN(C)C(On1nnc2ccccc21)=[N+](C)C.CCN(CC)CC>>COc1ccccc1-c1nc(N[C@H]2C[C@H](C(=O)N(C)C)N(C(=O)OC(C)(C)C)C2)c2ccccc2n1.?
[]
For the chemical reaction, solvents CCO and O are used. ### The answer is CCO and O
In the reaction involving the SMILES O=C1CC2CCc3ccc([N+](=O)[O-])cc3C2=NN1c1ccccc1.Cl>>Nc1ccc2c(c1)C1=NN(c3ccccc3)C(=O)CC1CC2., what are the agents that promote dissolution?
[]
The solvents CC#N and CCOC(C)=O are integral to this chemical reaction. ### The answer is CC#N and CCOC(C)=O
Can you list the solvents that participate in the reaction involving the SMILES CCNC(=O)c1ccc(-n2nnc(C(=O)NC3CC3)c2COS(C)(=O)=O)cc1.O=C([O-])[O-].[K+].[K+].C1CCNC1>>CCNC(=O)c1ccc(-n2nnc(C(=O)NC3CC3)c2CN2CCCC2)cc1.?
[]
Solvents ClCCl and CCN(CC)CC are the substances used in this chemical reaction. ### The answer is ClCCl and CCN(CC)CC
Can you list the solvents that participate in the reaction involving the SMILES Cl.CC(C)OC(=N)c1ccccc1.CCN(CC)CC.CN(SCl)C(=O)Oc1cccc2c1OC(C)(C)C2>>CC(C)OC(=NSN(C)C(=O)Oc1cccc2c1OC(C)(C)C2)c1ccccc1.?
[]
The solvents for this reaction are CCN(CC)CC and CN(C)C=O. ### The answer is CCN(CC)CC and CN(C)C=O
Do you know the solvents being leveraged in the chemical reaction detailed by Cl.Cl.CC1NCCN(CCCN2CC[C@H](C)[C@H](O)C2)C1=O.O=C(O)C=Cc1ccc(Cl)c(Cl)c1.CCN(CC)CC.F[P-](F)(F)(F)(F)F.CN(C)C(On1nnc2cccnc21)=[N+](C)C>>CC1C(=O)N(CCCN2CC[C@H](C)[C@H](O)C2)CCN1C(=O)/C=C/c1ccc(Cl)c(Cl)c1.?
[]
The solvents Cc1ccccc1 are utilized in the chemical reaction. ### The answer is Cc1ccccc1
What are the solvents used in a reaction labeled by the SMILES code Cc1nc(N)nc2c1C(=S)N[C@@H](c1ccc(F)cc1Br)C2.CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1CON>>Cc1nc(N)nc2c1/C(=N/OC[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)OC(C)(C)C)N[C@@H](c1ccc(F)cc1Br)C2.?
[]
This chemical reaction incorporates CCOCC and O as solvents. ### The answer is CCOCC and O
Would you mind sharing the solvent medium in the reaction that corresponds to the SMILES COc1ccccc1Br.[Li]CCCC.CN1C2CCC1CC(=O)C2.O>>COc1ccccc1C1(O)CC2CCC(C1)N2C.?
[]
The chemical reaction takes place with the use of solvents CCN(C(C)C)C(C)C and CC(=O)N(C)C. ### The answer is CCN(C(C)C)C(C)C and CC(=O)N(C)C
What are the solvents used in the SMILES notation F[P-](F)(F)(F)(F)F.CN(C)C(On1nnc2cccnc21)=[N+](C)C.CC(C)(C)OC(=O)NC1(C(=O)O)CCN(c2ncnc3[nH]ccc23)CC1.C[C@H](N)c1ccc(Cl)cc1.CCN(C(C)C)C(C)C>>C[C@H](NC(=O)C1(N)CCN(c2ncnc3[nH]ccc23)CC1)c1ccc(Cl)cc1. reaction?
[]
This chemical reaction utilizes CCOCCO and O as its solvents. ### The answer is CCOCCO and O
In the reaction with SMILES notation NCCS(=O)(=O)O.[OH-].[Na+].CCOCCO.C=CCOCC1CO1>>C=CCOCC(O)CNCCS(=O)(=O)O., can you point out the solvents used?
[]
CC(C)=O are the solvents involved in this chemical process. ### The answer is CC(C)=O
What types of solvents were used for the reaction with the SMILES Cc1nn(-c2cc(O)c(Cl)cc2F)c(=O)n1CCCF.C#CCBr.O=C([O-])[O-].[K+].[K+]>>C#CCOc1cc(-n2nc(C)n(CCCF)c2=O)c(F)cc1Cl.?
[]
In this reaction, the chemicals C1CCOC1 are utilized as solvents. ### The answer is C1CCOC1
Which solvents are included in the reaction with the SMILES notation O=C(O)CC1COc2ccc(Br)cc21.B>>OCCC1COc2ccc(Br)cc21.?
[]
Solvents CN(C)C=O and O play a role in this chemical reaction. ### The answer is CN(C)C=O and O
Are you aware of the solvent substances in the reaction with the SMILES code O=[N+]([O-])c1ccccc1OCCCl.O=[N+]([O-])c1ccc(F)cc1O.O=C([O-])[O-].[K+].[K+].O>>O=[N+]([O-])c1ccccc1OCCOc1cc(F)ccc1[N+](=O)[O-].?
[]
This chemical reaction utilizes CCCCCC, CCOCC, and CO as its solvents. ### The answer is CCCCCC, CCOCC, and CO
Would you be able to specify the solvents used in the reaction characterized by the SMILES code COC(=O)c1cccc(-c2ccc3c(=O)c(Cc4ccccc4)coc3c2)c1.[BH4-].[Na+].[Cl-].[NH4+].CCCCCC>>COC(=O)c1cccc(-c2ccc3c(c2)OCC(Cc2ccccc2)=C3O)c1.?
[]
This chemical reaction makes use of C1CCOC1 as solvents. ### The answer is C1CCOC1
What solvents are employed in the chemical reaction represented by C[Si](C)(C)CCN1C(=O)CN(c2ccc(CCCC#N)cc2OCc2ccccc2)S1(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC.[F-].Cl>>N#CCCCc1ccc(N2CC(=O)NS2(=O)=O)c(OCc2ccccc2)c1.?
[]
ClCCl are the solvents that are used in this chemical reaction. ### The answer is ClCCl
Could you tell me the solvents applied in the chemical reaction that COc1ccc(Cl)cc1C.COC(Cl)Cl.O=C([O-])O.[Na+]>>COc1c(C)cc(Cl)cc1C=O. describes?
[]
This chemical reaction is performed with ClCCl as solvents. ### The answer is ClCCl
Do you know the solvents that are part of the reaction with the SMILES COc1ccc2cc([C@H](C)C(=O)O)ccc2c1.CC1(C)OC[C@](C)(CO)O1>>COc1ccc2cc([C@H](C)C(=O)OC[C@@]3(C)COC(C)(C)O3)ccc2c1.?
[]
In this chemical reaction, ClCCl and O=C(O)C(F)(F)F are the solvents. ### The answer is ClCCl and O=C(O)C(F)(F)F
What solvents are involved in the chemical reaction that is defined by CC1C(=O)NN=C2COc3cc(OCc4ccccc4)c(NC4CN(C(=O)OC(C)(C)C)C4)cc3N21.O=C(O)C(F)(F)F>>O=C(O)C(F)(F)F.CC1C(=O)NN=C2COc3cc(OCc4ccccc4)c(NC4CNC4)cc3N21.?
[]
The chemical reaction employs CCN(CC)CC, CN(C)C=O, and Cc1ccccc1 as solvents. ### The answer is CCN(CC)CC, CN(C)C=O, and Cc1ccccc1
In the O=[N+]([O-])c1cc(Cl)ccc1Br.CCN(CC)CC.C=CC(=O)OCC.c1ccc(P(c2ccccc2)c2ccccc2)cc1>>CCOC(=O)/C=C/c1ccc(Cl)cc1[N+](=O)[O-]. chemical reaction, what solvents are called into action?
[]
This chemical reaction is conducted with CCO and CI as the solvents. ### The answer is CCO and CI
Would you be able to provide the names of the solvents involved in the reaction that the SMILES algorithm CCOC(=O)c1onc(O)c1C.O=C([O-])[O-].[K+].[K+].CI>>CCOC(=O)c1onc(OC)c1C. represents?
[]
This chemical reaction incorporates CCO as solvents. ### The answer is CCO
What solvents are being used in handling the reaction of SMILES CCOCc1nc2c(N)nc3cc(CCCCN4C(=O)c5ccccc5C4=O)ccc3c2n1CCCOC(C)C.NN>>CCOCc1nc2c(N)nc3cc(CCCCN)ccc3c2n1CCCOC(C)C.?
[]
The solvents CC#N and CO are integral to this chemical reaction. ### The answer is CC#N and CO
What could be the solvent substances involved in the reaction that has the SMILES code CC(C)C1(C#N)CCN(c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)C1=O.O=C=O.CO.CC#N>>CC(C)[C@]1(C#N)CCN(c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)C1=O.?
[]
This reaction is dependent on CCN(CC)CC, ClCCl, and O as solvents. ### The answer is CCN(CC)CC, ClCCl, and O
What types of solvents does the chemical reaction of O=C(Cl)c1ccc(Br)cc1.Cl.CNOC.CCN(CC)CC.O>>CON(C)C(=O)c1ccc(Br)cc1. involve?
[]
The solvents for this chemical reaction are identified as C1CCOC1, CN(C)C=O, and O. ### The answer is C1CCOC1, CN(C)C=O, and O
What are the reacting solvents in the SMILES CN(C)CCCCCCO.[H].[H][Na+].O.COc1ccccc1CCl>>COc1ccccc1COCCCCCCN(C)C. equation?
[]
The solvents CN(C)C=O are utilized in the chemical reaction. ### The answer is CN(C)C=O
Are you able to tell me which solvents are used in the reaction that's characterized by the SMILES string COC(C(=O)NCc1ccc(C#N)cc1)c1ccc(O)cc1.CC(C)I.O=C([O-])[O-].[Cs+].[Cs+]>>COC(C(=O)NCc1ccc(C#N)cc1)c1ccc(OC(C)C)cc1.?
[]
This chemical process utilizes solvents CO. ### The answer is CO
Could you tell me about the solvents in the reaction that includes the SMILES notation c1ccc2c(c1)cc1n2CCNCC1.C=O.[BH3-]C#N.[Na+]>>CN1CCc2cc3ccccc3n2CC1.?
[]
This chemical reaction makes use of CN(C)C=O and CO as solvents. ### The answer is CN(C)C=O and CO
What solvents can be found in the reaction denoted by the SMILES O=C(O)C=Cc1cccnc1.CO>>O=C(O)CCc1cccnc1.?
[]
CCOCC, ClCCl, and c1ccncc1 are the solvents that this reaction requires. ### The answer is CCOCC, ClCCl, and c1ccncc1
What dissolving substances are used in the reaction that includes the SMILES O=C(Cl)c1ccc(Br)cc1.c1ccncc1.CN(C)C1CCNC1>>CN(C)C1CCN(C(=O)c2ccc(Br)cc2)C1.?
[]
This chemical process uses C1CCOC1 and O as the solvents. ### The answer is C1CCOC1 and O
Which solvents are included in the reaction with the SMILES notation OCc1ccc(NCc2ccc(Cl)cc2)nc1F.CC(=O)OI1(OC(C)=O)(OC(C)=O)OC(=O)c2ccccc21.O>>O=Cc1ccc(NCc2ccc(Cl)cc2)nc1F.?
[]
C1CCOC1, the solvents, are integral to this chemical reaction. ### The answer is C1CCOC1
What solvents were applied in the reaction with the SMILES notation CO[C@@H](C(=O)N1CCO[C@@H](c2cc(Cl)cc(Cl)c2)C1)c1ccccc1.[Li+].CC[B-](CC)CC.Cl>>Clc1cc(Cl)cc([C@H]2CNCCO2)c1.?
[]
COc1ccccc1 and O=C(O)C(F)(F)F are the solvents present in this chemical reaction. ### The answer is COc1ccccc1 and O=C(O)C(F)(F)F
Regarding the SMILES O=c1[nH]c(=O)n(C(c2ccccc2)c2ccccc2)cc1-c1cccnc1.COc1ccccc1.O=S(=O)(O)C(F)(F)F.O=C(O)C(F)(F)F>>O=c1[nH]cc(-c2cccnc2)c(=O)[nH]1. reaction, what would be the corresponding solvent medium?
[]
The chemical solvents used here are C1CCOC1 and CC(=O)O. ### The answer is C1CCOC1 and CC(=O)O
Could you tell me the solvents applied in the chemical reaction that O=C(OCN1C(=O)c2ccccc2C1=O)c1ccccc1[N+](=O)[O-]>>Nc1ccccc1C(=O)OCN1C(=O)c2ccccc2C1=O. describes?
[]
This reaction is dependent on CI, CN(C)C=O, and O as solvents. ### The answer is CI, CN(C)C=O, and O
Could you tell me about the solvents in the reaction that includes the SMILES notation CC(=O)c1ccsc1C(=O)O.CI.O=C([O-])[O-].[K+].[K+].O>>COC(=O)c1sccc1C(C)=O.?
[]
The chemical reaction makes use of solvents CC(=O)O. ### The answer is CC(=O)O
In the reaction of SMILES COc1ccc(C(=O)O)c(CC#N)c1C.Cc1cc(N)n[nH]1>>COc1ccc2c(=O)[nH]c(Nc3cc(C)[nH]n3)cc2c1C., can you identify the dissolving agents?
[]
Solvents C1COCCO1, CCOCC, CO, and ClCCl are integral to this chemical reaction's process. ### The answer is C1COCCO1, CCOCC, CO, and ClCCl
Can you specify the dissolving agents used in the reaction with the SMILES CC(C)Nc1ncc2c(n1)CN(C(=O)NC1(c3ccc(Cl)c(Cl)c3)CCN(C(=O)OC(C)(C)C)CC1)CC2.CO.C1COCCO1.Cl>>CC(C)Nc1ncc2c(n1)CN(C(=O)NC1(c3ccc(Cl)c(Cl)c3)CCNCC1)CC2.?
[]
Solvents C1CCOC1, CO, and O are employed in this chemical reaction. ### The answer is C1CCOC1, CO, and O
Kindly elaborate on the solvents used in the reaction linked to the SMILES notation COC(=O)Cc1cc2ccc(F)cc2c(-c2ccc([N+](=O)[O-])cc2)c1C.C1CCOC1.[Cl-].[NH4+].O>>COC(=O)Cc1cc2ccc(F)cc2c(-c2ccc(N)cc2)c1C.?
[]
For this reaction, the solvents employed are C1CCOC1, CC(C)NC(C)C, and CI. ### The answer is C1CCOC1, CC(C)NC(C)C, and CI
Can you recall the solvents that were used in the reaction with [Li]CCCC.N#N.CC(C)NC(C)C.N#CC1(Cc2nc[nH]n2)C=CC=CC1.CI>>CC(c1nc[nH]n1)C1(C#N)C=CC=CC1.?
[]
OCCO are utilized as the solvents in this chemical reaction. ### The answer is OCCO
Please enlighten me with the solvents that have been used in the reaction relating to the SMILES notation COC(OC)c1ccsc1C(=O)c1ccccc1F.[OH-].[K+].NN>>COC(OC)c1ccsc1Cc1ccccc1F..
[]
Solvents CCN(CC)CC and ClCCl play a role in this chemical reaction. ### The answer is CCN(CC)CC and ClCCl
Can you list the solvents that participate in the reaction involving the SMILES NCCCCl.CCN(CC)CC.O=C(Cl)c1ccc([N+](=O)[O-])cc1>>O=C(NCCCCl)c1ccc([N+](=O)[O-])cc1.?
[]
This chemical reaction makes use of CN(C)C=O as solvents. ### The answer is CN(C)C=O
What solvent substances can be found in the reaction that corresponds with the SMILES code Oc1ccc(N2CCN(c3ccc(C(F)(F)F)cc3)CC2)cc1.[H].[H][Na+].CC1(Cn2cc([N+](=O)[O-])nc2Cl)CO1>>CC1(COc2ccc(N3CCN(c4ccc(C(F)(F)F)cc4)CC3)cc2)Cn2cc([N+](=O)[O-])nc2O1.?
[]
The chemical reaction is facilitated by solvents C1COCCO1 and CO. ### The answer is C1COCCO1 and CO
Can you list the solvents that participate in the reaction involving the SMILES CCOC(=O)C1(CCCc2c(F)cnc3ccc(OC)cc23)CCN(CCSc2ccccc2)CC1.[OH-].[Na+]>>COc1ccc2ncc(F)c(CCCC3(C(=O)O)CCN(CCSc4ccccc4)CC3)c2c1.?
[]
This reaction is dependent on C1CCOC1 and CCN(C(C)C)C(C)C as solvents. ### The answer is C1CCOC1 and CCN(C(C)C)C(C)C
Can you specify the solvents used in the reaction having the SMILES notation O=Cc1ccc(I)cc1.C#C[Si](C)(C)C.CCN(C(C)C)C(C)C>>C[Si](C)(C)C#Cc1ccc(C=O)cc1.?
[]
The solvents for this chemical reaction are identified as CO. ### The answer is CO
Are you able to tell me which solvents are used in the reaction that's characterized by the SMILES string CC#CC(=O)Nc1ccc(S(=O)(=O)N2CCN(C(=O)OC(C)(C)C)CC2)cc1>>C/C=C\C(=O)Nc1ccc(S(=O)(=O)N2CCN(C(=O)OC(C)(C)C)CC2)cc1.?
[]
For this reaction, the solvents employed are C1COCCO1 and Cc1ccccc1. ### The answer is C1COCCO1 and Cc1ccccc1
Can you specify the solvents involved in the CCn1c(-c2nonc2N)nc2cnc(Br)cc21.c1ccc(P(c2ccccc2)c2ccc3ccccc3c2-c2c(P(c3ccccc3)c3ccccc3)ccc3ccccc23)cc1.CC(C)(C)[Si](C)(C)Oc1cccc(S)c1.CC(C)(C)[O-].[Na+]>>CCn1c(-c2nonc2N)nc2cnc(-c3ccccc3S)cc21. reaction?
[]
CC(C)(C)O are the chosen solvents for this chemical reaction. ### The answer is CC(C)(C)O
What kinds of solvents are used to facilitate the reaction in the SMILES sequence CC1(C)C=Cc2ccc(F)c(C#N)c2O1.[OH-].[K+].[Cl-].[Na+]>>CC1(C)C=Cc2ccc(F)c(C(N)=O)c2O1.?
[]
The chemical reaction utilizes CO as solvents. ### The answer is CO
In the COCC(=O)C(=CN(C)C)C(=O)OC.Cl.NO>>COCc1oncc1C(=O)OC. reaction, which solvents are being used?
[]
The solvents, namely CCN(C(C)C)C(C)C, CS(C)=O, and O, are used in this chemical reaction. ### The answer is CCN(C(C)C)C(C)C, CS(C)=O, and O
Can you specify the solvents used in the reaction having the SMILES notation COC(=O)c1ccc2nc(-c3ccc(F)cc3)c(Cl)nc2c1.CCN(C(C)C)C(C)C.CC(C)(C)N>>COC(=O)c1ccc2nc(-c3ccc(F)cc3)c(NC(C)(C)C)nc2c1.?
[]
The solvents OCCO are integral to this chemical reaction. ### The answer is OCCO
Would you be able to specify the solvents used in the reaction characterized by the SMILES code O=C(NCCN(CCNC(=O)OCCO)c1nc(Cl)nc(N(CCNC(=O)OCCO)CCNC(=O)OCCO)n1)OCCO.O=C([O-])O.[Na+]>>O=C(NCCN(CCNC(=O)OCCO)c1nc(N(CCNC(=O)OCCO)CCNC(=O)OCCO)nc(N(CCNC(=O)OCCO)CCNC(=O)OCCO)n1)OCCO.?
[]
This chemical reaction is conducted with CN(C)C=O and O as the solvents. ### The answer is CN(C)C=O and O
Can you name the solvents used in the reaction depicted by the SMILES code COc1cc(C)c([N+](=O)[O-])cc1Br.COC(OC)N(C)C>>COc1cc(C=O)c([N+](=O)[O-])cc1Br.?
[]
This chemical reaction is performed with CC(=O)O as solvents. ### The answer is CC(=O)O
Can you list the solvents used in the C[Si](C)(C)[N-][Si](C)(C)C.[K+].CN1C(=O)CN=C(c2cccnc2)c2cc(Cl)ccc21.CC(C)c1cc(C(C)C)c(S(=O)(=O)N=[N+]=[N-])c(C(C)C)c1.CC(=O)O>>CN1C(=O)C(N=[N+]=[N-])N=C(c2cccnc2)c2cc(Cl)ccc21. reaction?
[]
The chemical reaction utilizes C1CCOC1 and CO as solvents. ### The answer is C1CCOC1 and CO
Could you tell me about the solvents in the reaction that includes the SMILES notation COC(=O)c1ncc(Cc2ccc(F)cc2)cc1[N+](=O)[O-].Cl>>COC(=O)c1ncc(Cc2ccc(F)cc2)cc1N.?
[]
CCO and O are the solvents involved in this chemical process. ### The answer is CCO and O
Would you mind identifying the solvents within the reaction labeled as O=C1c2ccccc2C(=O)N1C1C=C(c2ccc(F)cc2)CC1.O.NN>>NC1C=C(c2ccc(F)cc2)CC1. SMILES?
[]
CCO are the solvents that this reaction requires. ### The answer is CCO
Would you be able to provide the names of the solvents involved in the reaction that the SMILES algorithm N.CCOC(=O)C(Nc1ncnc2ccc(Cl)cc12)c1ccc2c(c1)OCO2>>NC(=O)C(Nc1ncnc2ccc(Cl)cc12)c1ccc2c(c1)OCO2. represents?
[]
The chemical solvents used here are CO and C1CCOC1. ### The answer is CO and C1CCOC1
Can you specify the dissolving agents used in the reaction with the SMILES O=C([O-])C1=Cc2ccccc2S(=O)(=O)CC1.O=C([O-])[O-].[K+].[K+]>>O=C(O)C1=Cc2ccccc2S(=O)(=O)CC1.?
[]
The solvents in this chemical reaction are CS(C)=O and ClC(Cl)Cl. ### The answer is CS(C)=O and ClC(Cl)Cl
In the reaction involving the SMILES O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1Cl.CN(C)C(=S)S.[Na].O.ClC(Cl)Cl>>O=c1sc2cc(C(F)(F)F)cc([N+](=O)[O-])c2s1., what are the agents that promote dissolution?
[]
CCN(CC)CC and ClCCl, functioning as solvents, are used in this chemical reaction. ### The answer is CCN(CC)CC and ClCCl
Can you identify the solvents used in the C=C(F)C(=O)Cl.N#Cc1cc(Br)c(O)c(Br)c1.CCN(CC)CC>>C=C(F)C(=O)Oc1c(Br)cc(C#N)cc1Br. reaction?
[]
In this chemical reaction, solvents CO are employed. ### The answer is CO
What solvents aid in initiating the reaction signified by the SMILES sequence Cl.CCOC(=O)[C@@H](N)CSCCc1ccccc1.CC(=O)SCC(Cc1ccccc1)C(=O)O>>CCOC(=O)[C@H](CSCCc1ccccc1)NC(=O)C(CSC(C)=O)Cc1ccccc1.?
[]