instruction
stringclasses
1 value
output
stringlengths
52
197
input
stringlengths
75
717
history
listlengths
0
0
The chemical reaction utilizes CO and O as the solvents. ### The answer is CO and O
In the CC(=O)N1CC(C)(C)c2ccc(N)cc21.BrCCOCCBr.O=C([O-])[O-].[Na+].[Na+]>>CC(=O)N1CC(C)(C)c2ccc(N3CCOCC3)cc21. reaction, which solvents are being used?
[]
This chemical reaction utilizes C=CCBr, CC#N, and Nc1ccccc1 as its solvents. ### The answer is C=CCBr, CC#N, and Nc1ccccc1
What are the solvents needed for the chemical reaction as described in CC(C)(C)ON=O.C=CCBr.Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1.Nc1ccccc1>>C=CCc1ccc([N+](=O)[O-])c(C(F)(F)F)c1.?
[]
The chemical solvents CN(C)C=O are used in this reaction. ### The answer is CN(C)C=O
What dissolving substances are used in the reaction that includes the SMILES CC(C)Oc1cncc(-c2ccc3[nH]cc(I)c3c2)n1.[H].[H][Na+].Cc1ccc(S(=O)(=O)Cl)cc1>>Cc1ccc(S(=O)(=O)n2cc(I)c3cc(-c4cncc(OC(C)C)n4)ccc32)cc1.?
[]
CC(=O)O, the solvents, are used in this chemical reaction. ### The answer is CC(=O)O
What kinds of solvents are used to facilitate the reaction in the SMILES sequence Nc1ccccc1S(=O)(=O)Nc1cccc2c(C(F)(F)F)ccnc12.CC(C)(C)ON=O>>O=S1(=O)Nc2c(ccc3c(C(F)(F)F)ccnc23)-c2ccccc21.?
[]
The reaction is conducted using solvents CC(=O)O. ### The answer is CC(=O)O
In carrying out the reaction involving CC(C)(C)c1ccc(O)c(C(C)(C)C)c1.BrBr>>CC(C)(C)c1cc(Br)c(O)c(C(C)(C)C)c1., what solvents were employed?
[]
In this chemical reaction, the solvents are CO. ### The answer is CO
Which solvents does the C=C(CBr)C(=O)O.SCc1ccccc1.[OH-].[Na+]>>C=C(CSCc1ccccc1)C(=O)O. reaction contain?
[]
This chemical reaction makes use of CCOC(C)=O and CS(C)=O as solvents. ### The answer is CCOC(C)=O and CS(C)=O
What solvents are involved in the reaction described by the SMILES notation COc1ccc(CNC(=O)c2cc(C#N)ccc2N[C@@H](C)CBr)cc1OC.[Na+].O=S(=O)([O-])c1ccccc1>>COc1ccc(CNC(=O)c2cc(C#N)ccc2N[C@@H](C)CS(=O)(=O)c2ccccc2)cc1OC.?
[]
The chemical reaction utilizes C1CCOC1 and CO as the solvents. ### The answer is C1CCOC1 and CO
In the reaction of SMILES COC(=O)c1cccc(CN(Cc2ccccc2)C(=O)Nc2ccc(C#N)cc2)c1.[OH-].[Na+]>>N#Cc1ccc(NC(=O)N(Cc2ccccc2)Cc2cccc(C(=O)O)c2)cc1., can you identify the dissolving agents?
[]
C1COCCO1 are the solvents used in this chemical reaction. ### The answer is C1COCCO1
Could you tell me what the solvent medium for the reaction linked with the SMILES NC(CCC(=O)O)C(F)F.CC(=O)Cl.Cl>>CC(=O)NC(CCC(=O)O)C(F)F. is?
[]
This chemical process is carried out using solvents C1CCOC1, CCN(CC)CC, and CO. ### The answer is C1CCOC1, CCN(CC)CC, and CO
Can you identify the solvents used in the NC(=O)c1c(-c2ccc(N)cc2)csc1N.O=C=Nc1ccccc1>>NC(=O)c1c(-c2ccc(NC(=O)Nc3ccccc3)cc2)csc1N. reaction?
[]
The chemical reaction utilizes CO as solvents. ### The answer is CO
What types of solvents does the chemical reaction of COC(=O)/C=C/c1ncccc1OCc1ccccc1>>COC(=O)CCc1ncccc1O. involve?
[]
This reaction's solvents include C1CCOC1 and CCN(CC)CC. ### The answer is C1CCOC1 and CCN(CC)CC
Could you specify the solvents participating in the SMILES CCc1nn2ccc3oc(C)cc3c2c1CCN.CCN(CC)CC.CC(=O)Cl.O=C([O-])O.[Na+]>>CCc1nn2ccc3oc(C)cc3c2c1CCNC(C)=O. reaction?
[]
CCO, Cc1ccccc1, and O, functioning as solvents, are used in this chemical reaction. ### The answer is CCO, Cc1ccccc1, and O
What solvents aid in initiating the reaction signified by the SMILES sequence CC1(C)O[C@H](c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[C@@H](CF)N1C(=O)C(F)F.CC(C)(C)S(=O)NC(CC#N)c1ccc(Br)cn1.O=C([O-])[O-].[Na+].[Na+]>>CC1(C)O[C@H](c2ccc(-c3ccc(C(CC#N)NS(=O)C(C)(C)C)nc3)cc2)[C@@H](CF)N1C(=O)C(F)F.?
[]
In this chemical reaction, CCN(CC)CC and CCO are the solvents. ### The answer is CCN(CC)CC and CCO
Do you know the dissolving agents in the reaction related to the SMILES CCN(CC)CC.CCOC(=O)c1ccc2cc(C(=O)OCC)n(CC3(CN)CC3)c2c1.O=C([O-])[O-].[K+].[K+]>>CCOC(=O)c1ccc2cc3n(c2c1)CC1(CC1)CNC3=O.?
[]
The chemical reaction involves CN(C)C=O as the solvents used. ### The answer is CN(C)C=O
In the reaction with SMILES notation CC(C)n1ncnc1-c1cn2c(n1)-c1ccc(B3OC(C)(C)C(C)(C)O3)cc1OCC2.CC(C)(O)Cc1nc(Br)cn1C1CCCCO1.[F-].[Cs+]>>CC(C)n1ncnc1-c1cn2c(n1)-c1ccc(-c3cn(C4CCCCO4)c(CC(C)(C)O)n3)cc1OCC2., can you point out the solvents used?
[]
In this chemical process, CCN(CC)CC, CN(C)C=O, and O are used as solvents. ### The answer is CCN(CC)CC, CN(C)C=O, and O
Kindly elaborate on the solvents used in the reaction linked to the SMILES notation Nc1ccccc1CCC(C(=O)O)N1C(=O)c2ccccc2C1=O.CCOP(=O)(C#N)OCC.CCN(CC)CC>>O=C1Nc2ccccc2CCC1N1C(=O)c2ccccc2C1=O.?
[]
In this reaction, the chemicals C1CCOC1 are utilized as solvents. ### The answer is C1CCOC1
Could you specify the solvents that assist in triggering the reaction derived from the SMILES sequence N#Cc1c(F)cccc1Br.[F-].[K+].CC1(C)OB(c2cc([N+](=O)[O-])ccc2F)OC1(C)C>>N#Cc1c(F)cccc1-c1cc([N+](=O)[O-])ccc1F.?
[]
The solvents, C1CCOC1, CCN(CC)CC, and CCO, are utilized in this chemical reaction. ### The answer is C1CCOC1, CCN(CC)CC, and CCO
Do you know the solvents that are part of the reaction with the SMILES C=CC(=O)C(CC1CCOCC1)c1ccc(S(=O)(=O)C2CC2)cc1.COC(OC)C(C)(O)c1cnc(C=O)s1.CCN(CC)CC.C1CCOC1>>COC(OC)C(C)(O)c1cnc(C(=O)CCC(=O)C(CC2CCOCC2)c2ccc(S(=O)(=O)C3CC3)cc2)s1.?
[]
Solvents CN(C)C=O play a role in this chemical reaction. ### The answer is CN(C)C=O
What solvents are involved in the reaction described by the SMILES notation CC(C)(C)OC(=O)N[C@@H](CCOCc1ccccc1)c1nn2ccc(Br)c2c(=O)n1-c1cc(F)cc(F)c1.N#C[Zn]C#N>>CC(C)(C)OC(=O)N[C@@H](CCOCc1ccccc1)c1nn2ccc(C#N)c2c(=O)n1-c1cc(F)cc(F)c1.?
[]
ClCCl and O=C(O)C(F)(F)F serve as the solvents in this chemical reaction. ### The answer is ClCCl and O=C(O)C(F)(F)F
Can you list the solvents used in the Cc1cc(NC(=O)OC(C)(C)C)ncc1-c1ccc2cc(NC(=O)C3CC3)ncc2c1>>Cc1cc(N)ncc1-c1ccc2cc(NC(=O)C3CC3)ncc2c1. reaction?
[]
The solvents for this chemical reaction are identified as C1COCCO1 and O. ### The answer is C1COCCO1 and O
Can you list the solvents that participate in the reaction involving the SMILES N#Cc1ccc2c(c1)[C@@H](n1ccccc1=O)[C@H](O)C(CF)(CF)O2.[OH-].[Na+].C1COCCO1>>N#Cc1ccc2c(c1)C(n1ccccc1=O)=CC(CF)(CF)O2.?
[]
CO are the solvents used in this chemical reaction. ### The answer is CO
Could you specify the solvents that assist in triggering the reaction derived from the SMILES sequence CCOC(=O)c1csc(-c2ccc(Cl)nc2)n1.C[O-].[Na+].O=C(O)C1(c2ccc(Cl)nc2)NC=CS1.Cl>>COc1ccc(-c2nc(C(=O)O)cs2)cn1.?
[]
The chemical reaction involves CN(C)C=O as the solvents used. ### The answer is CN(C)C=O
Could you identify the solvents involved in the SMILES-determined reaction COc1ccc(-c2nc(C)cc(Cl)n2)cc1.c1ccc(C(c2ccccc2)N2CCNCC2)cc1.O=C([O-])[O-].[K+].[K+]>>COc1ccc(-c2nc(C)cc(N3CCN(C(c4ccccc4)c4ccccc4)CC3)n2)cc1.?
[]
CCN(CC)CC and C1COCCO1 are the solvents used in this chemical reaction. ### The answer is CCN(CC)CC and C1COCCO1
What are the solvents that are being used in the chemical reaction according to COC(=O)c1cc(I)c(C(F)(F)F)cc1N.C#CCOC1CCCCO1>>COC(=O)c1cc(C#CCOC2CCCCO2)c(C(F)(F)F)cc1N.?
[]
In this chemical reaction, solvents C1CCOC1, CO, and O are employed. ### The answer is C1CCOC1, CO, and O
Can you provide a list of solvents associated with the reaction depicted by the SMILES notation COC(=O)Cc1ccccc1OCc1nc(CCc2nc(-c3ccccc3)oc2C)no1.C1CCOC1.[OH-].[Na+].Cl>>Cc1oc(-c2ccccc2)nc1CCc1noc(COc2ccccc2CC(=O)O)n1.?
[]
The chemical reaction utilizes CO as solvents. ### The answer is CO
What are the solvents needed for the chemical reaction as described in O=C(OCc1ccccc1)N1CCN(Cc2ccncn2)CC1.[H][H]>>c1cc(CN2CCNCC2)ncn1.?
[]
The solvents, CCO, are utilized in this chemical reaction. ### The answer is CCO
What are the solvents used in a reaction labeled by the SMILES code O=C(c1ccc(-c2ccc(CBr)cc2)cc1)c1ccc(Cl)cc1Cl.CNC>>Cl.CN(C)Cc1ccc(-c2ccc(C(=O)c3ccc(Cl)cc3Cl)cc2)cc1.?
[]
CO, functioning as solvents, are used in this chemical reaction. ### The answer is CO
Could you clarify which solvents are employed in the reaction represented by the SMILES syntax CC(=O)n1ncc2c(Br)cccc21.Cl>>Brc1cccc2[nH]ncc12.?
[]
CCOC(C)=O, O, and c1ccncc1 are the solvents involved in this chemical process. ### The answer is CCOC(C)=O, O, and c1ccncc1
Could you point out the solvent substances included in the reaction characterized by the SMILES code COc1cc2c(cc1-c1c(C)nn(C)c1C)-c1c(-c3cccs3)c3c(n1CC2)C(=O)N(C(C)C)CCNC3.CC(=O)OC(C)=O.O.CCOC(C)=O>>COc1cc2c(cc1-c1c(C)nn(C)c1C)-c1c(-c3cccs3)c3c(n1CC2)C(=O)N(C(C)C)CCN(C(C)=O)C3.?
[]
The chemical reaction involves using C1CCOC1, O, O=C(OC(=O)C(F)(F)F)C(F)(F)F, and c1ccncc1 as solvents. ### The answer is C1CCOC1, O, O=C(OC(=O)C(F)(F)F)C(F)(F)F, and c1ccncc1
Which solvents are involved in the reaction represented by the SMILES Cc1cc(CCCOc2c(C)cc(-c3noc(C(N)=O)n3)cc2C)on1.c1ccncc1.O=C(OC(=O)C(F)(F)F)C(F)(F)F>>Cc1cc(CCCOc2c(C)cc(-c3noc(C#N)n3)cc2C)on1.?
[]
In this chemical reaction, solvents CCN(CC)CC, CN(C)C=O, and O=C(O)C(F)(F)F are employed. ### The answer is CCN(CC)CC, CN(C)C=O, and O=C(O)C(F)(F)F
Which solvents help to activate the reaction represented by the SMILES sequence O=C(N[C@@H](Cc1c[nH]cn1)C(=O)O)OCc1ccccc1.On1nnc2ccccc21.C(=NC1CCCCC1)=NC1CCCCC1.COC(=O)C(=O)[C@H](COCc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(OCc2ccccc2)cc1.O=C(O)C(F)(F)F.CCN(CC)CC>>COC(=O)C(=O)[C@H](COCc1ccccc1)NC(=O)[C@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)OCc1ccccc1.?
[]
The chemical solvents CN(C)C=O are used in this reaction. ### The answer is CN(C)C=O
Could you tell me what solvents accelerate the reaction denoted by the SMILES sequence O=C(CCCCl)c1ccccc1.[N-]=[N+]=[N-].[Na+].O=C([O-])O.[Na+]>>[N-]=[N+]=NCCCC(=O)c1ccccc1.?
[]
The chemical reaction's solvents are ClCCl and O=C(O)C(F)(F)F. ### The answer is ClCCl and O=C(O)C(F)(F)F
What solvents take part in the reaction alongside the SMILES CC(C)CNc1cc(NC(=O)OC(C)(C)C)c(NC(=O)CC(=O)c2cccc(-c3cncnc3)c2)cc1Cl.O=C(O)C(F)(F)F>>CC(C)CNc1cc2c(cc1Cl)NC(=O)CC(c1cccc(-c3cncnc3)c1)=N2.?
[]
This chemical process uses CCO as the solvents. ### The answer is CCO
Would you please tell me what solvent medium is used in the reaction corresponding to the SMILES Cc1cc(OCCN2CCOCC2)c(C)c2c1NC(=O)C2=O.Nc1nnc(Cc2ccc(O)cc2)n1N>>Cc1cc(OCCN2CCOCC2)c(C)c2c1[nH]c1nc3nnc(Cc4ccc(O)cc4)n3nc12.?
[]
This chemical reaction is facilitated by the solvents CC(=O)O, CCN(CC)CC, CCOC(C)=O, and CN(C)C=O. ### The answer is CC(=O)O, CCN(CC)CC, CCOC(C)=O, and CN(C)C=O
In the reaction with SMILES notation CC(=O)O.COCC(C)(C)C(=O)OCOc1nc(C(Nc2ccc(C(=N)N)cc2)c2cc(OC)cc(OCCOC(C)=O)c2F)nn1-c1ncccn1.CCN(CC)CC.C=C(C)COC(=O)Oc1ccc([N+](=O)[O-])cc1.CN(C)C=O>>C=C(C)COC(=O)N=C(N)c1ccc(NC(c2nc(OCOC(=O)C(C)(C)COC)n(-c3ncccn3)n2)c2cc(OC)cc(OCCOC(C)=O)c2F)cc1., can you point out the solvents used?
[]
The solvents, namely ClCCl, are used in this chemical reaction. ### The answer is ClCCl
Can you elucidate the solvent substances associated with the reaction referred to by the SMILES code CC[C@@H](N)C(=O)OC.CC(C)=O.CC(=O)[O-].[Na+].CC(=O)O[BH-](OC(C)=O)OC(C)=O.[Na+].Cl.O=C([O-])[O-].[Na+].[Na+]>>CC[C@@H](NC(C)C)C(=O)OC.?
[]
CC(=O)N(C)C, the solvents, are used in this chemical reaction. ### The answer is CC(=O)N(C)C
Could you tell me what solvents accelerate the reaction denoted by the SMILES sequence C=CCOCC1(c2cccc(C(F)(F)F)c2)NC(=O)NC1=O.N#Cc1ccc(Br)cc1C(F)(F)F>>C=CCOCC1(c2cccc(C(F)(F)F)c2)NC(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C1=O.?
[]
CN(C)C=O, ClCCCl, and O are the chosen solvents for this chemical reaction. ### The answer is CN(C)C=O, ClCCCl, and O
Would you please clarify which solvents exist in the O=C(O)c1ccc(CO)cc1.ClCCCl.On1nnc2ccccc21.O.CC(C)Oc1ccc(/C(N)=N/O)cc1Cl>>CC(C)Oc1ccc(-c2noc(-c3ccc(CO)cc3)n2)cc1Cl. reaction?
[]
The reaction uses CCN(C(C)C)C(C)C and ClCCl as its solvents. ### The answer is CCN(C(C)C)C(C)C and ClCCl
Can you tell me the solvent medium used in the reaction associated with the SMILES CC(=O)c1ccc(OCc2ccccc2)cc1.CCN(C(C)C)C(C)C.C[Si](C)(C)OS(=O)(=O)C(F)(F)F.O=C1CCC(=O)N1Br>>O=C(CBr)c1ccc(OCc2ccccc2)cc1.?
[]
The reaction uses C1CCOC1 as its solvents. ### The answer is C1CCOC1
What solvents are involved in the reaction described by the SMILES notation CC(Cc1cc(F)cc2ccoc12)NC(=O)OC(C)(C)C.[Li]CCCC.C[Si](C)(C)N=C=O>>CC(Cc1cc(F)cc2cc([Si](C)(C)C)oc12)NC(=O)OC(C)(C)C.?
[]
In this chemical reaction, CO are the solvents. ### The answer is CO
Which solvents are involved in the reaction represented by the SMILES Cc1cc(-c2cccc(C(F)(F)F)c2)nc(OCCOCc2ccccc2)c1C(=O)N1CCC(N2CCCC2)CC1.Cl.CO>>Cc1cc(-c2cccc(C(F)(F)F)c2)nc(OCCO)c1C(=O)N1CCC(N2CCCC2)CC1.?
[]
This chemical process utilizes solvents C1CCOC1 and O. ### The answer is C1CCOC1 and O
In the reaction involving the SMILES O=[N+]([O-])c1cccc(-c2ncc(Cl)s2)c1.O.NN>>Nc1cccc(-c2nccs2)c1., what are the agents that promote dissolution?
[]
The chemical reaction uses ClCCl and O as the solvents. ### The answer is ClCCl and O
Can you tell me the solvent medium used in the reaction associated with the SMILES COc1cccc(C)c1CNc1cccn2c(C)c(C)nc12.BrB(Br)Br.O>>Cc1cccc(O)c1CNc1cccn2c(C)c(C)nc12.?
[]
C1COCCO1, as solvents, are employed in this chemical reaction. ### The answer is C1COCCO1
Which solvents does the CNCCOCc1cnc(-c2ccc(C(=O)Nc3ccccc3NC(=O)OC(C)(C)C)cc2)c(C#N)c1.Cl>>CNCCOCc1cnc(-c2ccc(C(=O)Nc3ccccc3N)cc2)c(C#N)c1. chemical reaction require?
[]
The chemical reaction's solvents are C1CCOC1, CCOC(C)=O, and O. ### The answer is C1CCOC1, CCOC(C)=O, and O
What could be the solvent substances involved in the reaction that has the SMILES code CC(C)(C)OC(=O)N[C@@H](COCc1ccccc1)C(=O)O.CI.[H].[H][Na+]>>CN(C(=O)OC(C)(C)C)[C@@H](COCc1ccccc1)C(=O)O.?
[]
This chemical reaction is executed using solvents ClCCl, O, and O=C(O)C(F)(F)F. ### The answer is ClCCl, O, and O=C(O)C(F)(F)F
In the O=C(O)C(F)(F)F.O.CC(C)(C)OC(=O)N1CC[C@H]1COc1cncc(-c2cccc(C[C@H](O)Cc3ccccc3)c2)c1>>O[C@H](Cc1ccccc1)Cc1cccc(-c2cncc(OC[C@@H]3CCN3)c2)c1. chemical reaction, what solvents are called into action?
[]
ClCCl are the solvents that this reaction requires. ### The answer is ClCCl
Can you tell me the solvents that react with the SMILES COc1cc2cc(C#N)sc2cc1OC.BrB(Br)Br>>N#Cc1cc2cc(O)c(O)cc2s1.?
[]
The chemical reaction makes use of solvents CCN(CC)CC and ClCCl. ### The answer is CCN(CC)CC and ClCCl
In the reaction involving the SMILES CC(C)(C)OC(=O)NN1C[C@H](CO)OC1=O.CCN(CC)CC.CS(=O)(=O)Cl>>CC(C)(C)OC(=O)NN1C[C@@H](COS(C)(=O)=O)OC1=O., what are the agents that promote dissolution?
[]
CN(C)P(=O)(N(C)C)N(C)C and O are the solvents that are used in this chemical reaction. ### The answer is CN(C)P(=O)(N(C)C)N(C)C and O
Would you please clarify which solvents exist in the CCOC(=O)CCc1ccc(N)cc1.C=CCC1CCCCC1OS(C)(=O)=O.O=C([O-])[O-].[K+].[K+].CN(C)P(=O)(N(C)C)N(C)C>>C=CCC1CCCCC1Nc1ccc(CCC(=O)OCC)cc1. reaction?
[]
The chemical reaction involves CC(C)=O as solvents. ### The answer is CC(C)=O
Are you aware of the solvent substances in the reaction with the SMILES code Nc1ccc2cc(O)ccc2c1.CCCCCCCCBr.O=C([O-])[O-].[K+].[K+]>>CCCCCCCCOc1ccc2cc(N)ccc2c1.?
[]
The solvents used for this chemical reaction are ClCCl. ### The answer is ClCCl
In carrying out the reaction involving O=C(n1ccnc1)n1ccnc1.O=C(O)c1cccnc1CCCSc1cccc(C(F)(F)F)c1.NCc1cccs1>>O=C(NCc1cccs1)c1cccnc1CCCSc1cccc(C(F)(F)F)c1., what solvents were employed?
[]
The chemical reaction is facilitated by solvents c1ccncc1. ### The answer is c1ccncc1
Could you tell me the solvents applied in the chemical reaction that OC[C@H]1O[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O.CS(=O)(=O)Cl>>CS(=O)(=O)OC[C@H]1O[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](OS(C)(=O)=O)[C@@H](OS(C)(=O)=O)[C@@H]1OS(C)(=O)=O. describes?
[]
The reaction is conducted using solvents CCCCCC and ClCCl. ### The answer is CCCCCC and ClCCl
What solvents were applied in the reaction with the SMILES notation CCOC(=O)C(Cc1ccc(OCCN(C)c2nc3ccccc3o2)cc1)Oc1ccccc1C>>Cc1ccccc1OC(Cc1ccc(OCCN(C)c2nc3ccccc3o2)cc1)C(=O)O.?
[]
This chemical process utilizes solvents C1CCOC1 and O. ### The answer is C1CCOC1 and O
Could you tell me the dissolving agents employed in the reaction with the SMILES Cn1cnc2ccc(Cl)cc21.[Li+].CC(C)[N-]C(C)C.ICCI.O>>Cn1c(I)nc2ccc(Cl)cc21.?
[]
This chemical reaction is carried out with C1COCCO1 and ClCCl as solvents. ### The answer is C1COCCO1 and ClCCl
Which are the solvents interacting in the SMILES COCCN(Cc1ccc(-c2cc3nccc(Oc4ccc(NC(=O)NC5CC5)cc4F)c3s2)cc1)C(=O)OC(C)(C)C.Cl.C1COCCO1>>COCCNCc1ccc(-c2cc3nccc(Oc4ccc(NC(=O)NC5CC5)cc4F)c3s2)cc1. reaction?
[]
The chemical reaction is facilitated by solvents c1ccncc1. ### The answer is c1ccncc1
Do you know what's the solvent medium for the reaction of the SMILES CSc1nc(C)c(Cc2cccnc2)c(=O)[nH]1.Cc1[nH]cnc1CSCCN>>Cc1nc(NCCSCc2nc[nH]c2C)[nH]c(=O)c1Cc1cccnc1.?
[]
CN(C)C=O are the solvents that are used in this chemical reaction. ### The answer is CN(C)C=O
In the reaction involving the SMILES COC(=O)CO.[H].[H][Na+].COC1(c2cccc(CBr)c2)CCOCC1>>COC(=O)COCc1cccc(C2(OC)CCOCC2)c1., what are the agents that promote dissolution?
[]
This chemical reaction utilizes the solvents CC(=O)O and Cc1ccccc1. ### The answer is CC(=O)O and Cc1ccccc1
In the CCn1c(=O)c(-c2nccs2)cc2c(C)nc(N)nc21.CC(C)(C)OC(=O)N1CCN(c2ccc(I)cc2)CC1.CCC(C)(C)[O-].[Na+]>>CCn1c(=O)c(-c2nccs2)cc2c(C)nc(Nc3ccc(N4CCN(C(=O)OC(C)(C)C)CC4)cc3)nc21. reaction, which solvents are being used?
[]
CC(=O)O and O are the solvents that this chemical reaction utilizes. ### The answer is CC(=O)O and O
Could you identify the solvents employed in the OCc1ccc(CO)cc1.CC(=O)O.[O-][Br+2]([O-])[O-].[Na+]>>O=Cc1ccc(C=O)cc1. reaction?
[]
This chemical process uses O as the solvents. ### The answer is O
Which solvents are included in the reaction with the SMILES notation Cc1cc(Br)cc(CBr)c1.C1COCCO1.O=C([O-])[O-].[Ca+2]>>Cc1cc(Br)cc(CO)c1.?
[]
CC(=O)O are the solvents present in this chemical reaction. ### The answer is CC(=O)O
Can you recall the solvents that were used in the reaction with CCOC(=O)CC(=O)Nc1ccc(C(=N)NO)cc1.O=C[O-].[NH4+]>>N=C(N)c1ccc(NC(=O)CC(=O)O)cc1.?
[]
Solvents C1CCOC1 and CCO play a role in this chemical reaction. ### The answer is C1CCOC1 and CCO
Could you identify the solvents employed in the Cc1ccc(C(C)(C)C(=O)c2cnn3c2N(Cc2ccccc2)C(c2ccccc2)CC3(C)C)cc1.CCO.[H][H]>>Cc1ccc(C(C)(C)C(=O)c2cnn3c2NC(c2ccccc2)CC3(C)C)cc1. reaction?
[]
CC(=O)O are the solvents that this chemical reaction utilizes. ### The answer is CC(=O)O
What agents tend to dissolve in the reaction of SMILES Cc1c(-c2ccnn2-c2ccc(C#N)cc2)c(=O)n(C)c(=O)n1-c1cccc(C(F)(F)F)c1.BrBr.O=S([O-])([O-])=S.[Na+].[Na+]>>Cc1c(-c2c(Br)cnn2-c2ccc(C#N)cc2)c(=O)n(C)c(=O)n1-c1cccc(C(F)(F)F)c1.?
[]
In this chemical reaction, solvents C1CCOC1 are employed. ### The answer is C1CCOC1
In the CN(C)C1CN(C2CCN(C(=O)Nc3cc(Oc4ccc([N+](=O)[O-])cc4)ccn3)CC2)C1>>CN(C)C1CN(C2CCN(C(=O)Nc3cc(Oc4ccc(N)cc4)ccn3)CC2)C1. chemical reaction, what solvents are called into action?
[]
The reaction uses c1ccncc1 as its solvents. ### The answer is c1ccncc1
What types of solvents does the chemical reaction of Nc1ccc2c(c1)NC(=O)C(CCCN1CCN(c3ccc(F)cc3)CC1)O2.CC(=O)OC(C)=O>>CC(=O)Nc1ccc2c(c1)NC(=O)C(CCCN1CCN(c3ccc(F)cc3)CC1)O2. involve?
[]
This chemical reaction is facilitated by the solvents C1CCOC1. ### The answer is C1CCOC1
Which solvents are included in the reaction with the SMILES notation C[C@@H](CC(N)=O)Nc1ccccc1.O=C(Cl)OCc1ccccc1.CC(C)(C)[O-].[Li+]>>C[C@@H](CC(=O)NC(=O)OCc1ccccc1)Nc1ccccc1.?
[]
CC#N, the solvents, are used in this chemical reaction. ### The answer is CC#N
Which solvents does the NCc1ccc(Oc2ccc(O)cc2)cc1.CCOCCC1(Br)C(=O)NC(=O)NC1=O.CCCCC=CCCCC.FC(F)(F)C1(C(F)(F)F)OC(F)(F)C(F)(C2(F)OC(C(F)(F)F)(C(F)(F)F)OC2(F)F)O1>>CCOCCC1(Oc2ccc(Oc3ccc(CN)cc3)cc2)C(=O)NC(=O)NC1=O. chemical reaction require?
[]
This chemical reaction is executed using solvents CS(C)=O and ClCCl. ### The answer is CS(C)=O and ClCCl
What solvents are being used in handling the reaction of SMILES O=C(OO)c1cccc(Cl)c1.C[C@@H](O)[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(CSCCNC(=O)OCc3ccc([N+](=O)[O-])cc3)C[C@H]12>>C[C@@H](O)[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(CS(=O)CCNC(=O)OCc3ccc([N+](=O)[O-])cc3)C[C@H]12.?
[]
The chemical reaction employs CCO and O as solvents. ### The answer is CCO and O
What agents tend to dissolve in the reaction of SMILES O=C(c1ccccc1)c1ccsc1C(=O)O.O.NN>>O=c1[nH]nc(-c2ccccc2)c2ccsc12.?
[]
The solvents for this chemical reaction are identified as CO. ### The answer is CO
Can you identify the solvents that help trigger the reaction indicated by the SMILES sequence COC(=O)C1CCC(OC(C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccccc1.[OH-].[Na+]>>CC(OC1CCC(C(=O)O)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.?
[]
C1CCOC1 and CCN(CC)CC are the solvents that are used in this chemical reaction. ### The answer is C1CCOC1 and CCN(CC)CC
Could you specify the solvents that assist in triggering the reaction derived from the SMILES sequence CCC=CC(=O)O.CCN(CC)CC.CC(C)(C)C(=O)Cl.O=C1N[C@@H](c2ccccc2)CO1.[Li]CCCC>>CC/C=C/C(=O)N1C(=O)OC[C@@H]1c1ccccc1.?
[]
CCOCC and ClCCl are utilized as the solvents in this chemical reaction. ### The answer is CCOCC and ClCCl
What are the solvents that facilitate the SMILES sequence Ic1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1.C[Mg+].[Br-].CCc1sccc1C=O>>CCc1sccc1C(O)c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1. reaction?
[]
The solvents participating in this chemical reaction are ClCCl. ### The answer is ClCCl
In carrying out the reaction involving CC(=O)n1c2ccccc2c2ccccc21.NS(=O)(=O)c1cc(C(=O)Cl)ccc1Cl.[Cl-].[Al+3].[Cl-].[Cl-]>>CC(=O)n1c2ccccc2c2ccc(C(=O)c3ccc(Cl)c(S(N)(=O)=O)c3)cc21., what solvents were employed?
[]
In this chemical reaction, CO are the solvents. ### The answer is CO
Would you mind identifying the solvents within the reaction labeled as Cl.COC(=O)c1ccnc(-c2ccc(C(F)(F)F)nc2)c1>>Cl.COC(=O)C1CCNC(c2ccc(C(F)(F)F)nc2)C1. SMILES?
[]
The solvents O and CC#N are utilized in the chemical reaction. ### The answer is O and CC#N
Do you know the solvents that are part of the reaction with the SMILES COc1c(C)c(Cc2ccc(OCc3ccccc3)c(C=O)c2)c(OC)c(OC)c1OC.O=P([O-])(O)O.[Na+].[O-]Cl.[Na+].OO>>COc1c(C)c(Cc2ccc(OCc3ccccc3)c(C(=O)O)c2)c(OC)c(OC)c1OC.?
[]
For this reaction, C1COCCO1 are the solvents used. ### The answer is C1COCCO1
Could you point out the solvent substances in the reaction of the SMILES code Cl.Cc1ccc(NN)cc1.CC(C)(C)OC(=O)N1C2CCC1CC(=O)C2.O=S(=O)(O)O>>Cc1ccc2[nH]c3c(c2c1)C1CCC(C3)N1.?
[]
The reaction uses CC(C)=O as solvents. ### The answer is CC(C)=O
What solvents were applied in the reaction with the SMILES notation FC(F)(CCCCBr)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCBr.N#Cc1ccc(-c2ccc(O)cc2)cc1.O=C([O-])[O-].[K+].[K+]>>N#Cc1ccc(-c2ccc(OCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCBr)cc2)cc1.?
[]
The reaction uses C1CCOC1 as its solvents. ### The answer is C1CCOC1
Could you tell me the solvents in the reaction described by the SMILES COC(=O)c1ccc(N)cc1C(F)(F)F.ICI.CC(C)CCON=O>>COC(=O)c1ccc(I)cc1C(F)(F)F.?
[]
The solvents in this chemical reaction are CCO and ClCCl. ### The answer is CCO and ClCCl
Would you be able to provide the names of the solvents involved in the reaction that the SMILES algorithm NCc1cccc(F)c1.CCOC(=O)c1c(O)nc2cc(C(F)(F)F)ccc2c1O.ClCCl>>O=C(NCc1cccc(F)c1)c1c(O)nc2cc(C(F)(F)F)ccc2c1O. represents?
[]
The chemical solvents CC(=O)O and CC(C)(C)O are used in this reaction. ### The answer is CC(=O)O and CC(C)(C)O
I would like to know the solvents in the reaction associated with the SMILES notation O=C(CBr)c1ccc(Br)cc1.Cn1ccc2c(Nc3ccc(F)c(Cl)c3)ncnc21>>CN1C(=O)Cc2c(Nc3ccc(F)c(Cl)c3)ncnc21., could you tell me?
[]
The reaction uses CN(C)C=O and CO as solvents. ### The answer is CN(C)C=O and CO
May I know the solvents utilized in the reaction that incorporates the SMILES notation C#Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c2ncnc(N)c12.C[Si](C)(C)N=[N+]=[N-].CN(C)C=O>>Nc1ncnc2c1c(-c1c[nH]nn1)cn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O.?
[]
This reaction is dependent on CCN(C(C)C)C(C)C, CN(C)C=O, and ClC(Cl)Cl as solvents. ### The answer is CCN(C(C)C)C(C)C, CN(C)C=O, and ClC(Cl)Cl
What solvents can be found in the reaction denoted by the SMILES CN(C)C(On1nnc2ccccc21)=[N+](C)C.F[B-](F)(F)F.Cc1noc(CC(=O)c2ccccc2)c1C(=O)O.CCN(C(C)C)C(C)C.OC1(c2ccccc2)CCNCC1>>Cc1noc(CC(=O)c2ccccc2)c1C(=O)N1CCC(O)(c2ccccc2)CC1.?
[]
The solvents, namely CN(C)C=O, are used in this chemical reaction. ### The answer is CN(C)C=O
Can you list the solvents that participate in the reaction involving the SMILES Cc1ccc(Br)c(C(=O)O)c1.c1c[nH]nn1.CN[C@H]1CCCC[C@@H]1NC.O=C([O-])[O-].[Cs+].[Cs+]>>Cc1ccc(-n2nccn2)c(C(=O)O)c1.?
[]
For the chemical reaction, solvents C1CCOC1, COCCOC, and ClC(Cl)Cl are used. ### The answer is C1CCOC1, COCCOC, and ClC(Cl)Cl
Would you please clarify which solvents exist in the O=C1CN2C(=O)OCC2(c2ccccc2)C1.C[Si](C)(C)[N-][Si](C)(C)C.[Na+].OB(O)c1cc(F)ccc1F.[Li+].[Cl-].O=C([O-])[O-].[Na+].[Na+]>>O=C1OCC2(c3ccccc3)C=C(c3cc(F)ccc3F)CN12. reaction?
[]
The chemical reaction makes use of solvents C1CCOC1. ### The answer is C1CCOC1
Would you please tell me what solvent medium is used in the reaction corresponding to the SMILES CC(C)Oc1cc(C(F)(F)F)c2cc3c(cc2n1)OCC(CO)N3CC(F)(F)F.[H].[H][Na+].CCCI>>CCCOCC1COc2cc3nc(OC(C)C)cc(C(F)(F)F)c3cc2N1CC(F)(F)F.?
[]
CCO serve as the solvents in this chemical reaction. ### The answer is CCO
What solvents aid in initiating the reaction signified by the SMILES sequence C[NH2+][C@H](C)[C@@H](O)c1ccccc1>>CN[C@@H](C)[C@H](O)c1ccccc1.?
[]
O and CCO are the solvents present in this chemical reaction. ### The answer is O and CCO
Could you identify the solvents employed in the O=Cc1cc(Cl)c(Cl)cc1[N+](=O)[O-]>>Nc1cc(Cl)c(Cl)cc1C=O. reaction?
[]
In this chemical reaction, CO and c1ccccc1 are the solvents. ### The answer is CO and c1ccccc1
Could you identify the solvents employed in the [BH4-].[Na+].CC(=O)Oc1c(C)c(C)c2c(c1C)C(=O)CC(C)(COc1ccc([N+](=O)[O-])cc1)O2.CO.Cl>>CC(=O)Oc1c(C)c(C)c2c(c1C)C(O)CC(C)(COc1ccc([N+](=O)[O-])cc1)O2. reaction?
[]
Solvents CC#N are integral to this chemical reaction's process. ### The answer is CC#N
What are the solvents used in a reaction labeled by the SMILES code COc1cccc(C2CCCN2)c1.O=C([O-])[O-].[K+].[K+].O=C(Cl)c1ccccc1>>COc1cccc(C2CCCN2C(=O)c2ccccc2)c1.?
[]
This chemical reaction is facilitated by the solvents Nc1ccccc1. ### The answer is Nc1ccccc1
Can you tell me the solvents that react with the SMILES NC(N)=O.CCNC(=O)Nc1ccc(-c2nc(N3CC4CCC(C3)O4)c3cnn(C4CCN(C(=O)OCC)CC4)c3n2)cc1.CN(C)NC(=O)c1ccc(N)cc1.Nc1ccccc1>>CCn1ncc2c(N3CC4CCC(C3)O4)nc(-c3ccc(NC(=O)Nc4ccc(C(=O)NN(C)C)cc4)cc3)nc21.?
[]
CC(=O)O, CCN(C(C)C)C(C)C, and CCO are the solvents that make this chemical reaction possible. ### The answer is CC(=O)O, CCN(C(C)C)C(C)C, and CCO
What solvent substances can be found in the reaction that corresponds with the SMILES code COC(=O)C(C)(C)c1ccc(C(=O)NC2CCNCC2)cc1.CCOc1cc(C=O)cc(OCC)c1-n1cncn1.[BH3-]C#N.[Na+].CCN(C(C)C)C(C)C>>CCOc1cc(CN2CCC(NC(=O)c3ccc(C(C)(C)C(=O)OC)cc3)CC2)cc(OCC)c1-n1cncn1.?
[]
This chemical process is carried out using solvents ClCCl. ### The answer is ClCCl
Please enlighten me with the solvents that have been used in the reaction relating to the SMILES notation COc1ccc(CO)cc1[N+](=O)[O-].c1ccc(P(c2ccccc2)c2ccccc2)cc1.O=C1CCC(=O)N1Cl.O=C([O-])[O-].[Na+].[Na+]>>COc1ccc(CCl)cc1[N+](=O)[O-]..
[]
This chemical reaction is performed with C1CCOC1, CCOC(C)=O, and O as solvents. ### The answer is C1CCOC1, CCOC(C)=O, and O
Do you have information on the solvents used in the CNC.COc1ccccc1S(=O)(=O)Cl.O.CCOC(C)=O>>COc1ccccc1S(=O)(=O)N(C)C. reaction scenario?
[]
For this reaction, the solvents employed are C1COCCO1 and O. ### The answer is C1COCCO1 and O
Which solvents help to activate the reaction represented by the SMILES sequence COC(=O)c1cc2c(Cl)ccnc2[nH]1.CB(O)c1cccc(C(=O)OC(C)(C)C)c1.O=P([O-])([O-])[O-].[K+].[K+].[K+].O>>COC(=O)c1cc2c(-c3cccc(C(=O)OC(C)(C)C)c3)ccnc2[nH]1.?
[]
Solvents O and c1ccccc1 are the substances used in this chemical reaction. ### The answer is O and c1ccccc1
Please enlighten me with the solvents that have been used in the reaction relating to the SMILES notation [I-].[NH4+].O=P([O-])(O)O.[NH4+].Cc1ccc(N)cc1.O=O>>Cc1ccc(N)c(I)c1..
[]
Solvents CC(C)=O are integral to this chemical reaction's process. ### The answer is CC(C)=O
Kindly elaborate on the solvents used in the reaction linked to the SMILES notation CC(C)=CCC[C@@H](C)CCCn1c(=O)c2c(ncn2C)n(C)c1=O.C[N+]1([O-])CCOCC1.O.O=S([O-])[O-].[Na+].[Na+].CC(C)=O.O>>C[C@H](CCCn1c(=O)c2c(ncn2C)n(C)c1=O)CCC(O)C(C)(C)O.?
[]
ClCCl and c1ccncc1 are the chosen solvents for this chemical reaction. ### The answer is ClCCl and c1ccncc1
Do you know the solvents used in the CC1(C)OB(c2ccc(N)c(F)c2)OC1(C)C.O=S(=O)(Cl)c1cccc(Cl)c1Cl.c1ccncc1>>CC1(C)OB(c2ccc(NS(=O)(=O)c3cccc(Cl)c3Cl)c(F)c2)OC1(C)C. reaction?
[]
This reaction involves CCO as the solvents. ### The answer is CCO
In carrying out the reaction involving CC(=O)OC1N=C(c2ccccc2)c2c(cn(C)c2C)NC1=O.[OH-].[Na+].O=C=O>>Cc1c2c(cn1C)NC(=O)C(O)N=C2c1ccccc1., what solvents were employed?
[]
In this chemical process, CCCCCC, CCOCC, and O are used as solvents. ### The answer is CCCCCC, CCOCC, and O
What kinds of solvents are used to facilitate the reaction in the SMILES sequence CCOC(=O)c1cccc(Br)c1F.CC(C)(C)P(C(C)(C)C)C(C)(C)C.CCCCCC.[F-].[K+]>>C=Cc1cccc(C(=O)OCC)c1F.?
[]
The chemical reaction employs ClCCl and C1CCOC1 as solvents. ### The answer is ClCCl and C1CCOC1
I'm wondering what solvents help provoke the reaction shown in the SMILES sequence O=C(O)C=CC=CCS(=O)(=O)c1ccccc1.O=C(Cl)C(=O)Cl.NO>>O=C(C=CC=CCS(=O)(=O)c1ccccc1)NO.?
[]